/*!

* Materialize v0.100.2 (http://materializecss.com)
* Copyright 2014-2017 Materialize
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
*/

var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (“value” in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();

function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(“Cannot call a class as a function”); } }

// Check for jQuery. if (typeof jQuery === 'undefined') {

// Check if require is a defined function.
if (typeof require === 'function') {
  jQuery = $ = require('jquery');
  // Else use the dollar sign alias.
} else {
  jQuery = $;
}

} ; /*

* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
* Open source under the BSD License.
* Copyright © 2008 George McGinley Smith
* All rights reserved.
* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
*/

(function (factory) {

if (typeof define === "function" && define.amd) {
  define(['jquery'], function ($) {
    return factory($);
  });
} else if (typeof module === "object" && typeof module.exports === "object") {
  exports = factory(require('jquery'));
} else {
  factory(jQuery);
}

})(function ($) {

// Preserve the original jQuery "swing" easing as "jswing"
$.easing['jswing'] = $.easing['swing'];

var pow = Math.pow,
    sqrt = Math.sqrt,
    sin = Math.sin,
    cos = Math.cos,
    PI = Math.PI,
    c1 = 1.70158,
    c2 = c1 * 1.525,
    c3 = c1 + 1,
    c4 = 2 * PI / 3,
    c5 = 2 * PI / 4.5;

// x is the fraction of animation progress, in the range 0..1
function bounceOut(x) {
  var n1 = 7.5625,
      d1 = 2.75;
  if (x < 1 / d1) {
    return n1 * x * x;
  } else if (x < 2 / d1) {
    return n1 * (x -= 1.5 / d1) * x + .75;
  } else if (x < 2.5 / d1) {
    return n1 * (x -= 2.25 / d1) * x + .9375;
  } else {
    return n1 * (x -= 2.625 / d1) * x + .984375;
  }
}

$.extend($.easing, {
  def: 'easeOutQuad',
  swing: function (x) {
    return $.easing[$.easing.def](x);
  },
  easeInQuad: function (x) {
    return x * x;
  },
  easeOutQuad: function (x) {
    return 1 - (1 - x) * (1 - x);
  },
  easeInOutQuad: function (x) {
    return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
  },
  easeInCubic: function (x) {
    return x * x * x;
  },
  easeOutCubic: function (x) {
    return 1 - pow(1 - x, 3);
  },
  easeInOutCubic: function (x) {
    return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
  },
  easeInQuart: function (x) {
    return x * x * x * x;
  },
  easeOutQuart: function (x) {
    return 1 - pow(1 - x, 4);
  },
  easeInOutQuart: function (x) {
    return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
  },
  easeInQuint: function (x) {
    return x * x * x * x * x;
  },
  easeOutQuint: function (x) {
    return 1 - pow(1 - x, 5);
  },
  easeInOutQuint: function (x) {
    return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
  },
  easeInSine: function (x) {
    return 1 - cos(x * PI / 2);
  },
  easeOutSine: function (x) {
    return sin(x * PI / 2);
  },
  easeInOutSine: function (x) {
    return -(cos(PI * x) - 1) / 2;
  },
  easeInExpo: function (x) {
    return x === 0 ? 0 : pow(2, 10 * x - 10);
  },
  easeOutExpo: function (x) {
    return x === 1 ? 1 : 1 - pow(2, -10 * x);
  },
  easeInOutExpo: function (x) {
    return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
  },
  easeInCirc: function (x) {
    return 1 - sqrt(1 - pow(x, 2));
  },
  easeOutCirc: function (x) {
    return sqrt(1 - pow(x - 1, 2));
  },
  easeInOutCirc: function (x) {
    return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
  },
  easeInElastic: function (x) {
    return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
  },
  easeOutElastic: function (x) {
    return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
  },
  easeInOutElastic: function (x) {
    return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
  },
  easeInBack: function (x) {
    return c3 * x * x * x - c1 * x * x;
  },
  easeOutBack: function (x) {
    return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
  },
  easeInOutBack: function (x) {
    return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
  },
  easeInBounce: function (x) {
    return 1 - bounceOut(1 - x);
  },
  easeOutBounce: bounceOut,
  easeInOutBounce: function (x) {
    return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
  }
});

});; // Custom Easing jQuery.extend(jQuery.easing, {

easeInOutMaterial: function (x, t, b, c, d) {
  if ((t /= d / 2) < 1) return c / 2 * t * t + b;
  return c / 4 * ((t -= 2) * t * t + 2) + b;
}

});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log(“Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.”) : (!function (e) {

function t(e) {
  var t = e.length,
      a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
}if (!e.jQuery) {
  var r = function (e, t) {
    return new r.fn.init(e, t);
  };r.isWindow = function (e) {
    return null != e && e == e.window;
  }, r.type = function (e) {
    return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
  }, r.isArray = Array.isArray || function (e) {
    return "array" === r.type(e);
  }, r.isPlainObject = function (e) {
    var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
      if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
    } catch (a) {
      return !1;
    }for (t in e) {}return void 0 === t || o.call(e, t);
  }, r.each = function (e, r, a) {
    var n,
        o = 0,
        i = e.length,
        s = t(e);if (a) {
      if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
        if (n = r.apply(e[o], a), n === !1) break;
      }
    } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
      if (n = r.call(e[o], o, e[o]), n === !1) break;
    }return e;
  }, r.data = function (e, t, n) {
    if (void 0 === n) {
      var o = e[r.expando],
          i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
    } else if (void 0 !== t) {
      var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
    }
  }, r.removeData = function (e, t) {
    var n = e[r.expando],
        o = n && a[n];o && r.each(t, function (e, t) {
      delete o[t];
    });
  }, r.extend = function () {
    var e,
        t,
        a,
        n,
        o,
        i,
        s = arguments[0] || {},
        l = 1,
        u = arguments.length,
        c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
      if (null != (o = arguments[l])) for (n in o) {
        e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
      }
    }return s;
  }, r.queue = function (e, a, n) {
    function o(e, r) {
      var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
        for (var r = +t.length, a = 0, n = e.length; r > a;) {
          e[n++] = t[a++];
        }if (r !== r) for (; void 0 !== t[a];) {
          e[n++] = t[a++];
        }return e.length = n, e;
      }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
    }if (e) {
      a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
    }
  }, r.dequeue = function (e, t) {
    r.each(e.nodeType ? [e] : e, function (e, a) {
      t = t || "fx";var n = r.queue(a, t),
          o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
        r.dequeue(a, t);
      }));
    });
  }, r.fn = r.prototype = { init: function (e) {
      if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
    }, offset: function () {
      var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
    }, position: function () {
      function e() {
        for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
          e = e.offsetParent;
        }return e || document;
      }var t = this[0],
          e = e.apply(t),
          a = this.offset(),
          n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
    } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
    n["[object " + s[l] + "]"] = s[l].toLowerCase();
  }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
}

}(window), function (e) {

"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();

}(function () {

return function (e, t, r, a) {
  function n(e) {
    for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
      var n = e[t];n && a.push(n);
    }return a;
  }function o(e) {
    return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
  }function i(e) {
    var t = f.data(e, "velocity");return null === t ? a : t;
  }function s(e) {
    return function (t) {
      return Math.round(t * e) * (1 / e);
    };
  }function l(e, r, a, n) {
    function o(e, t) {
      return 1 - 3 * t + 3 * e;
    }function i(e, t) {
      return 3 * t - 6 * e;
    }function s(e) {
      return 3 * e;
    }function l(e, t, r) {
      return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
    }function u(e, t, r) {
      return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
    }function c(t, r) {
      for (var n = 0; m > n; ++n) {
        var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
      }return r;
    }function p() {
      for (var t = 0; b > t; ++t) {
        w[t] = l(t * x, e, a);
      }
    }function f(t, r, n) {
      var o,
          i,
          s = 0;do {
        i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
      } while (Math.abs(o) > h && ++s < v);return i;
    }function d(t) {
      for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
        r += x;
      }--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
          s = r + i * x,
          l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
    }function g() {
      V = !0, (e != r || a != n) && p();
    }var m = 4,
        y = .001,
        h = 1e-7,
        v = 10,
        b = 11,
        x = 1 / (b - 1),
        S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
      if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
    }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
        V = !1,
        C = function (t) {
      return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
    };C.getControlPoints = function () {
      return [{ x: e, y: r }, { x: a, y: n }];
    };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
      return T;
    }, C;
  }function u(e, t) {
    var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
  }function c(e) {
    if (e) {
      var t = new Date().getTime(),
          r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
        if (b.State.calls[o]) {
          var s = b.State.calls[o],
              l = s[0],
              u = s[2],
              d = s[3],
              g = !!d,
              y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
            var P = l[v],
                V = P.element;if (i(V)) {
              var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
                if ("flex" === u.display) {
                  var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
                    S.setPropertyValue(V, "display", t);
                  });
                }S.setPropertyValue(V, "display", u.display);
              }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
                if ("element" !== k) {
                  var A,
                      F = P[k],
                      j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
                    var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
                  }if (F.currentValue = A, "tween" === k) y = A;else {
                    if (S.Hooks.registered[k]) {
                      var H = S.Hooks.getRoot(k),
                          N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
                    }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
                  }
                }
              }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
            }
          }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
        }
      }
    }b.State.isTicking && w(c);
  }function p(e, t) {
    if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
      var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
        i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
          var r = /^scale/.test(t) ? 1 : 0,
              n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
        }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
      }if (!t && o.complete && !o.loop && u === c - 1) try {
        o.complete.call(n, n);
      } catch (g) {
        setTimeout(function () {
          throw g;
        }, 1);
      }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
        /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
      }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
    }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
      if (b.State.calls[m] !== !1) {
        l = !0;break;
      }
    }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
  }var f,
      d = function () {
    if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
      var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
    }return a;
  }(),
      g = function () {
    var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
      var r,
          a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
        t(a + r);
      }, r);
    };
  }(),
      m = { isString: function (e) {
      return "string" == typeof e;
    }, isArray: Array.isArray || function (e) {
      return "[object Array]" === Object.prototype.toString.call(e);
    }, isFunction: function (e) {
      return "[object Function]" === Object.prototype.toString.call(e);
    }, isNode: function (e) {
      return e && e.nodeType;
    }, isNodeList: function (e) {
      return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
    }, isWrapped: function (e) {
      return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
    }, isSVG: function (e) {
      return t.SVGElement && e instanceof t.SVGElement;
    }, isEmptyObject: function (e) {
      for (var t in e) {
        return !1;
      }return !0;
    } },
      y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
      v = "swing",
      b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
      f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
    }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
    function e(e) {
      return -e.tension * e.x - e.friction * e.v;
    }function t(t, r, a) {
      var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
    }function r(r, a) {
      var n = { dx: r.v, dv: e(r) },
          o = t(r, .5 * a, n),
          i = t(r, .5 * a, o),
          s = t(r, a, i),
          l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
          u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
    }return function a(e, t, n) {
      var o,
          i,
          s,
          l = { x: -1, v: 0, tension: null, friction: null },
          u = [0],
          c = 0,
          p = 1e-4,
          f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
        return u[e * (u.length - 1) | 0];
      } : c;
    };
  }();b.Easings = { linear: function (e) {
      return e;
    }, swing: function (e) {
      return .5 - Math.cos(e * Math.PI) / 2;
    }, spring: function (e) {
      return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
    } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
    b.Easings[t[0]] = l.apply(null, t[1]);
  });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
        for (var e = 0; e < S.Lists.colors.length; e++) {
          var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
        }var r, a, n;if (d) for (r in S.Hooks.templates) {
          a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
        }for (r in S.Hooks.templates) {
          a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
            var i = r + n[e],
                s = e;S.Hooks.registered[i] = [r, s];
          }
        }
      }, getRoot: function (e) {
        var t = S.Hooks.registered[e];return t ? t[0] : e;
      }, cleanRootPropertyValue: function (e, t) {
        return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
      }, extractValue: function (e, t) {
        var r = S.Hooks.registered[e];if (r) {
          var a = r[0],
              n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
        }return t;
      }, injectValue: function (e, t, r) {
        var a = S.Hooks.registered[e];if (a) {
          var n,
              o,
              i = a[0],
              s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
        }return r;
      } }, Normalizations: { registered: { clip: function (e, t, r) {
          switch (e) {case "name":
              return "clip";case "extract":
              var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
              return "rect(" + r + ")";}
        }, blur: function (e, t, r) {
          switch (e) {case "name":
              return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
              var a = parseFloat(r);if (!a && 0 !== a) {
                var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
              }return a;case "inject":
              return parseFloat(r) ? "blur(" + r + ")" : "none";}
        }, opacity: function (e, t, r) {
          if (8 >= d) switch (e) {case "name":
              return "filter";case "extract":
              var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
              return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
              return "opacity";case "extract":
              return r;case "inject":
              return r;}
        } }, register: function () {
        9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
          !function () {
            var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
              switch (e) {case "name":
                  return "transform";case "extract":
                  return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
                  var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
                      o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
                      b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
                      o = !/(deg|\d)$/i.test(n);break;case "rotate":
                      o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
            };
          }();
        }for (var e = 0; e < S.Lists.colors.length; e++) {
          !function () {
            var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
              switch (e) {case "name":
                  return t;case "extract":
                  var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
                    var i,
                        s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
                  }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
                  return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
            };
          }();
        }
      } }, Names: { camelCase: function (e) {
        return e.replace(/-(\w)/g, function (e, t) {
          return t.toUpperCase();
        });
      }, SVGAttribute: function (e) {
        var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
      }, prefixCheck: function (e) {
        if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
          var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
            return e.toUpperCase();
          }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
        }return [e, !1];
      } }, Values: { hexToRgb: function (e) {
        var t,
            r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
            a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
          return t + t + r + r + a + a;
        }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
      }, isCSSNullValue: function (e) {
        return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
      }, getUnitType: function (e) {
        return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
        );
      }, getDisplayType: function (e) {
        var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
        );
      }, addClass: function (e, t) {
        e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
      }, removeClass: function (e, t) {
        e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
      } }, getPropertyValue: function (e, r, n, o) {
      function s(e, r) {
        function n() {
          u && S.setPropertyValue(e, "display", "none");
        }var l = 0;if (8 >= d) l = f.css(e, r);else {
          var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
            if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
              var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
            }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
              var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
            }
          }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
        }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
          var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
        }return l;
      }var l;if (S.Hooks.registered[r]) {
        var u = r,
            c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
      } else if (S.Normalizations.registered[r]) {
        var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
      }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
        if (/^(height|width)$/i.test(r)) try {
          l = e.getBBox()[r];
        } catch (m) {
          l = 0;
        } else l = e.getAttribute(r);
      } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
    }, setPropertyValue: function (e, r, a, n, o) {
      var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
        if (S.Hooks.registered[r]) {
          var l = r,
              u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
        }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
          e.style[s] = a;
        } catch (c) {
          b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
        } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
      }return [s, a];
    }, flushTransformCache: function (e) {
      function t(t) {
        return parseFloat(S.getPropertyValue(e, t));
      }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
        var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
          /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
        });
      } else {
        var n, o;f.each(i(e).transformCache, function (t) {
          return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
        }), o && (r = "perspective" + o + " " + r);
      }S.setPropertyValue(e, "transform", r);
    } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
    var n = a;return e = o(e), f.each(e, function (e, o) {
      if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
        var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
      }
    }), n;
  };var P = function () {
    function e() {
      return s ? k.promise || null : l;
    }function n() {
      function e(e) {
        function p(e, t) {
          var r = a,
              n = a,
              i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
        }function d(e, t) {
          var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
            return r = e, "";
          }), r || (r = S.Values.getUnitType(e)), [a, r];
        }function h() {
          var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
              a = e.position === L.lastPosition && e.myParent === L.lastParent,
              n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
              l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
            var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
              b.CSS.setPropertyValue(u, t, "hidden");
            }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
              b.CSS.setPropertyValue(u, t, s + "%");
            }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
          }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
        }if (s.begin && 0 === V) try {
          s.begin.call(g, g);
        } catch (x) {
          setTimeout(function () {
            throw x;
          }, 1);
        }if ("scroll" === A) {
          var P,
              C,
              T,
              F = /^x$/i.test(s.axis) ? "Left" : "Top",
              j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
        } else if ("reverse" === A) {
          if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
            if ("element" !== H) {
              var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
            }
          }l = E;
        } else if ("start" === A) {
          var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
            if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
              var r = p(t, !0),
                  n = r[0],
                  o = r[1],
                  i = r[2];if (S.RegEx.isHex.test(n)) {
                for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
                  var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
                }delete y[e];
              }
            }
          });for (var z in y) {
            var O = p(y[z]),
                q = O[0],
                $ = O[1],
                M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
                B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
              (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
                  G,
                  Y,
                  D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
                return D = t, "";
              }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
                n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
                    M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
                    break;default:
                    M *= n[Y + "ToPx"];}switch (G) {case "%":
                    M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
                    break;default:
                    M *= 1 / n[G + "ToPx"];}
              }switch (D) {case "+":
                  q = M + q;break;case "-":
                  q = M - q;break;case "*":
                  q = M * q;break;case "/":
                  q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
            } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
          }l.element = o;
        }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
      }var n,
          o = this,
          s = f.extend({}, b.defaults, v),
          l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
        b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
      }), s.duration.toString().toLowerCase()) {case "fast":
          s.duration = 200;break;case "normal":
          s.duration = h;break;case "slow":
          s.duration = 600;break;default:
          s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
        return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
      }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
    }var s,
        l,
        d,
        g,
        y,
        v,
        x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
      x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
          V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
        var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
          m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
        }
      }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
        k.resolver = e, k.rejecter = t;
      }));var A;switch (y) {case "scroll":
          A = "scroll";break;case "reverse":
          A = "reverse";break;case "finish":case "stop":
          f.each(g, function (e, t) {
            i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
          });var F = [];return f.each(b.State.calls, function (e, t) {
            t && f.each(t[1], function (r, n) {
              var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
                a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
                  m.isFunction(t) && t(null, !0);
                }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
                  t.endValue = t.currentValue;
                }), F.push(e)) : "finish" === y && (t[2].duration = 1));
              }) : !0;
            });
          }), "stop" === y && (f.each(F, function (e, t) {
            p(t, !0);
          }), k.promise && k.resolver(g)), e();default:
          if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
            if (m.isString(y) && b.Redirects[y]) {
              var j = f.extend({}, v),
                  E = j.duration,
                  H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
                parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
              }), e();
            }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
          }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
          R = [];f.each(g, function (e, t) {
        m.isNode(t) && n.call(t);
      });var z,
          j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
        var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
      }return e();
    }
  };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
    r.hidden ? (w = function (e) {
      return setTimeout(function () {
        e(!0);
      }, 16);
    }, c()) : w = t.requestAnimationFrame || g;
  }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
    b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
      var l = f.extend({}, r),
          u = l.begin,
          c = l.complete,
          p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
          d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
        u && u.call(i, i);for (var r in p) {
          d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
        }d.overflow = e.style.overflow, e.style.overflow = "hidden";
      }, l.complete = function () {
        for (var t in d) {
          e.style[t] = d[t];
        }c && c.call(i, i), s && s.resolver(i);
      }, b(e, p, l);
    };
  }), f.each(["In", "Out"], function (e, t) {
    b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
      var l = f.extend({}, r),
          u = { opacity: "In" === t ? 1 : 0 },
          c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
        c && c.call(i, i), s && s.resolver(i);
      }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
    };
  }), b;
}(window.jQuery || window.Zepto || window, window, document);

})); ;!function (a, b, c, d) {

"use strict";
function k(a, b, c) {
  return setTimeout(q(a, c), b);
}function l(a, b, c) {
  return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
}function m(a, b, c) {
  var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
    b.call(c, a[e], e, a), e++;
  } else for (e in a) {
    a.hasOwnProperty(e) && b.call(c, a[e], e, a);
  }
}function n(a, b, c) {
  for (var e = Object.keys(b), f = 0; f < e.length;) {
    (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
  }return a;
}function o(a, b) {
  return n(a, b, !0);
}function p(a, b, c) {
  var e,
      d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
}function q(a, b) {
  return function () {
    return a.apply(b, arguments);
  };
}function r(a, b) {
  return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
}function s(a, b) {
  return a === d ? b : a;
}function t(a, b, c) {
  m(x(b), function (b) {
    a.addEventListener(b, c, !1);
  });
}function u(a, b, c) {
  m(x(b), function (b) {
    a.removeEventListener(b, c, !1);
  });
}function v(a, b) {
  for (; a;) {
    if (a == b) return !0;a = a.parentNode;
  }return !1;
}function w(a, b) {
  return a.indexOf(b) > -1;
}function x(a) {
  return a.trim().split(/\s+/g);
}function y(a, b, c) {
  if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
    if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
  }return -1;
}function z(a) {
  return Array.prototype.slice.call(a, 0);
}function A(a, b, c) {
  for (var d = [], e = [], f = 0; f < a.length;) {
    var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
  }return c && (d = b ? d.sort(function (a, c) {
    return a[b] > c[b];
  }) : d.sort()), d;
}function B(a, b) {
  for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
    if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
  }return d;
}function D() {
  return C++;
}function E(a) {
  var b = a.ownerDocument;return b.defaultView || b.parentWindow;
}function ab(a, b) {
  var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
    r(a.options.enable, [a]) && c.handler(b);
  }, this.init();
}function bb(a) {
  var b,
      c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
}function cb(a, b, c) {
  var d = c.pointers.length,
      e = c.changedPointers.length,
      f = b & O && 0 === d - e,
      g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
}function db(a, b) {
  var c = a.session,
      d = b.pointers,
      e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
      g = c.firstMultiple,
      h = g ? g.center : f.center,
      i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
}function eb(a, b) {
  var c = b.center,
      d = a.offsetDelta || {},
      e = a.prevDelta || {},
      f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
}function fb(a, b) {
  var f,
      g,
      h,
      j,
      c = a.lastInterval || b,
      e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
    var k = c.deltaX - b.deltaX,
        l = c.deltaY - b.deltaY,
        m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
  } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
}function gb(a) {
  for (var b = [], c = 0; c < a.pointers.length;) {
    b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
  }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
}function hb(a) {
  var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
    c += a[e].clientX, d += a[e].clientY, e++;
  }return { x: h(c / b), y: h(d / b) };
}function ib(a, b, c) {
  return { x: b / a || 0, y: c / a || 0 };
}function jb(a, b) {
  return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
}function kb(a, b, c) {
  c || (c = $);var d = b[c[0]] - a[c[0]],
      e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
}function lb(a, b, c) {
  c || (c = $);var d = b[c[0]] - a[c[0]],
      e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
}function mb(a, b) {
  return lb(b[1], b[0], _) - lb(a[1], a[0], _);
}function nb(a, b) {
  return kb(b[0], b[1], _) / kb(a[0], a[1], _);
}function rb() {
  this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
}function wb() {
  this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
}function Ab() {
  this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
}function Bb(a, b) {
  var c = z(a.touches),
      d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
}function Eb() {
  this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
}function Fb(a, b) {
  var c = z(a.touches),
      d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
      f,
      g = z(a.changedTouches),
      h = [],
      i = this.target;if (f = c.filter(function (a) {
    return v(a.target, i);
  }), b === O) for (e = 0; e < f.length;) {
    d[f[e].identifier] = !0, e++;
  }for (e = 0; e < g.length;) {
    d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
  }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
}function Gb() {
  ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
}function Pb(a, b) {
  this.manager = a, this.set(b);
}function Qb(a) {
  if (w(a, Mb)) return Mb;var b = w(a, Nb),
      c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
}function Yb(a) {
  this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
}function Zb(a) {
  return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
}function $b(a) {
  return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
}function _b(a, b) {
  var c = b.manager;return c ? c.get(a) : a;
}function ac() {
  Yb.apply(this, arguments);
}function bc() {
  ac.apply(this, arguments), this.pX = null, this.pY = null;
}function cc() {
  ac.apply(this, arguments);
}function dc() {
  Yb.apply(this, arguments), this._timer = null, this._input = null;
}function ec() {
  ac.apply(this, arguments);
}function fc() {
  ac.apply(this, arguments);
}function gc() {
  Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
}function hc(a, b) {
  return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
}function kc(a, b) {
  b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
    var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
  }, this);
}function lc(a, b) {
  var c = a.element;m(a.options.cssProps, function (a, d) {
    c.style[B(c.style, d)] = b ? a : "";
  });
}function mc(a, c) {
  var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
}var e = ["", "webkit", "moz", "MS", "ms", "o"],
    f = b.createElement("div"),
    g = "function",
    h = Math.round,
    i = Math.abs,
    j = Date.now,
    C = 1,
    F = /mobile|tablet|ip(ad|hone|od)|android/i,
    G = "ontouchstart" in a,
    H = B(a, "PointerEvent") !== d,
    I = G && F.test(navigator.userAgent),
    J = "touch",
    K = "pen",
    L = "mouse",
    M = "kinect",
    N = 25,
    O = 1,
    P = 2,
    Q = 4,
    R = 8,
    S = 1,
    T = 2,
    U = 4,
    V = 8,
    W = 16,
    X = T | U,
    Y = V | W,
    Z = X | Y,
    $ = ["x", "y"],
    _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
    this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
  }, destroy: function () {
    this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
  } };var ob = { mousedown: O, mousemove: P, mouseup: Q },
    pb = "mousedown",
    qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
    var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
  } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
    tb = { 2: J, 3: K, 4: L, 5: M },
    ub = "pointerdown",
    vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
    var b = this.store,
        c = !1,
        d = a.type.toLowerCase().replace("ms", ""),
        e = sb[d],
        f = tb[a.pointerType] || a.pointerType,
        g = f == J,
        h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
  } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
    yb = "touchstart",
    zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
    var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
      var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
    }
  } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
    Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
    var b = Cb[a.type],
        c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
  } }), p(Gb, ab, { handler: function (a, b, c) {
    var d = c.pointerType == J,
        e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
  }, destroy: function () {
    this.touch.destroy(), this.mouse.destroy();
  } });var Hb = B(f.style, "touchAction"),
    Ib = Hb !== d,
    Jb = "compute",
    Kb = "auto",
    Lb = "manipulation",
    Mb = "none",
    Nb = "pan-x",
    Ob = "pan-y";Pb.prototype = { set: function (a) {
    a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
  }, update: function () {
    this.set(this.manager.options.touchAction);
  }, compute: function () {
    var a = [];return m(this.manager.recognizers, function (b) {
      r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
    }), Qb(a.join(" "));
  }, preventDefaults: function (a) {
    if (!Ib) {
      var b = a.srcEvent,
          c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
          e = w(d, Mb),
          f = w(d, Ob),
          g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
    }
  }, preventSrc: function (a) {
    this.manager.session.prevented = !0, a.preventDefault();
  } };var Rb = 1,
    Sb = 2,
    Tb = 4,
    Ub = 8,
    Vb = Ub,
    Wb = 16,
    Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
    return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
  }, recognizeWith: function (a) {
    if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
  }, dropRecognizeWith: function (a) {
    return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
  }, requireFailure: function (a) {
    if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
  }, dropRequireFailure: function (a) {
    if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
  }, hasRequireFailures: function () {
    return this.requireFail.length > 0;
  }, canRecognizeWith: function (a) {
    return !!this.simultaneous[a.id];
  }, emit: function (a) {
    function d(d) {
      b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
    }var b = this,
        c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
  }, tryEmit: function (a) {
    return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
  }, canEmit: function () {
    for (var a = 0; a < this.requireFail.length;) {
      if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
    }return !0;
  }, recognize: function (a) {
    var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
  }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
    var b = this.options.pointers;return 0 === b || a.pointers.length === b;
  }, process: function (a) {
    var b = this.state,
        c = a.eventType,
        d = b & (Sb | Tb),
        e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
  } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
    var a = this.options.direction,
        b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
  }, directionTest: function (a) {
    var b = this.options,
        c = !0,
        d = a.distance,
        e = a.direction,
        f = a.deltaX,
        g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
  }, attrTest: function (a) {
    return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
  }, emit: function (a) {
    this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
  } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
    return [Mb];
  }, attrTest: function (a) {
    return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
  }, emit: function (a) {
    if (this._super.emit.call(this, a), 1 !== a.scale) {
      var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
    }
  } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
    return [Kb];
  }, process: function (a) {
    var b = this.options,
        c = a.pointers.length === b.pointers,
        d = a.distance < b.threshold,
        e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
      this.state = Vb, this.tryEmit();
    }, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
  }, reset: function () {
    clearTimeout(this._timer);
  }, emit: function (a) {
    this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
  } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
    return [Mb];
  }, attrTest: function (a) {
    return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
  } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
    return bc.prototype.getTouchAction.call(this);
  }, attrTest: function (a) {
    var c,
        b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
  }, emit: function (a) {
    var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
  } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
    return [Lb];
  }, process: function (a) {
    var b = this.options,
        c = a.pointers.length === b.pointers,
        d = a.distance < b.threshold,
        e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
      if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
          g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
        this.state = Vb, this.tryEmit();
      }, b.interval, this), Sb) : Vb;
    }return Xb;
  }, failTimeout: function () {
    return this._timer = k(function () {
      this.state = Xb;
    }, this.options.interval, this), Xb;
  }, reset: function () {
    clearTimeout(this._timer);
  }, emit: function () {
    this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
  } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
    jc = 2;kc.prototype = { set: function (a) {
    return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
  }, stop: function (a) {
    this.session.stopped = a ? jc : ic;
  }, recognize: function (a) {
    var b = this.session;if (!b.stopped) {
      this.touchAction.preventDefaults(a);var c,
          d = this.recognizers,
          e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
        c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
      }
    }
  }, get: function (a) {
    if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
      if (b[c].options.event == a) return b[c];
    }return null;
  }, add: function (a) {
    if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
  }, remove: function (a) {
    if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
  }, on: function (a, b) {
    var c = this.handlers;return m(x(a), function (a) {
      c[a] = c[a] || [], c[a].push(b);
    }), this;
  }, off: function (a, b) {
    var c = this.handlers;return m(x(a), function (a) {
      b ? c[a].splice(y(c[a], b), 1) : delete c[a];
    }), this;
  }, emit: function (a, b) {
    this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
      b.type = a, b.preventDefault = function () {
        b.srcEvent.preventDefault();
      };for (var d = 0; d < c.length;) {
        c[d](b), d++;
      }
    }
  }, destroy: function () {
    this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
  } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
  return hc;
}) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;

}(window, document, “Hammer”);;(function (factory) {

if (typeof define === 'function' && define.amd) {
  define(['jquery', 'hammerjs'], factory);
} else if (typeof exports === 'object') {
  factory(require('jquery'), require('hammerjs'));
} else {
  factory(jQuery, Hammer);
}

})(function ($, Hammer) {

function hammerify(el, options) {
  var $el = $(el);
  if (!$el.data("hammer")) {
    $el.data("hammer", new Hammer($el[0], options));
  }
}

$.fn.hammer = function (options) {
  return this.each(function () {
    hammerify(this, options);
  });
};

// extend the emit method to also trigger jQuery events
Hammer.Manager.prototype.emit = function (originalEmit) {
  return function (type, data) {
    originalEmit.call(this, type, data);
    $(this.element).trigger({
      type: type,
      gesture: data
    });
  };
}(Hammer.Manager.prototype.emit);

}); ; // Required for Meteor package, the use of window prevents export by Meteor (function (window) {

if (window.Package) {
  Materialize = {};
} else {
  window.Materialize = {};
}

})(window);

if (typeof exports !== 'undefined' && !exports.nodeType) {

if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
  exports = module.exports = Materialize;
}
exports.default = Materialize;

}

/*

* raf.js
* https://github.com/ngryman/raf.js
*
* original requestAnimationFrame polyfill by Erik Möller
* inspired from paul_irish gist and post
*
* Copyright (c) 2013 ngryman
* Licensed under the MIT license.
*/

(function (window) {

var lastTime = 0,
    vendors = ['webkit', 'moz'],
    requestAnimationFrame = window.requestAnimationFrame,
    cancelAnimationFrame = window.cancelAnimationFrame,
    i = vendors.length;

// try to un-prefix existing raf
while (--i >= 0 && !requestAnimationFrame) {
  requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
  cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
}

// polyfill with setTimeout fallback
// heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
if (!requestAnimationFrame || !cancelAnimationFrame) {
  requestAnimationFrame = function (callback) {
    var now = +Date.now(),
        nextTime = Math.max(lastTime + 16, now);
    return setTimeout(function () {
      callback(lastTime = nextTime);
    }, nextTime - now);
  };

  cancelAnimationFrame = clearTimeout;
}

// export to window
window.requestAnimationFrame = requestAnimationFrame;
window.cancelAnimationFrame = cancelAnimationFrame;

})(window);

/**

* Generate approximated selector string for a jQuery object
* @param {jQuery} obj  jQuery object to be parsed
* @returns {string}
*/

Materialize.objectSelectorString = function (obj) {

var tagStr = obj.prop('tagName') || '';
var idStr = obj.attr('id') || '';
var classStr = obj.attr('class') || '';
return (tagStr + idStr + classStr).replace(/\s/g, '');

};

// Unique Random ID Materialize.guid = function () {

function s4() {
  return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
}
return function () {
  return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
};

}();

/**

* Escapes hash from special characters
* @param {string} hash  String returned from this.hash
* @returns {string}
*/

Materialize.escapeHash = function (hash) {

return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");

};

Materialize.elementOrParentIsFixed = function (element) {

var $element = $(element);
var $checkElements = $element.add($element.parents());
var isFixed = false;
$checkElements.each(function () {
  if ($(this).css("position") === "fixed") {
    isFixed = true;
    return false;
  }
});
return isFixed;

};

/**

* Get time in ms
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @type {function}
* @return {number}
*/

var getTime = Date.now || function () {

return new Date().getTime();

};

/**

* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/

Materialize.throttle = function (func, wait, options) {

var context, args, result;
var timeout = null;
var previous = 0;
options || (options = {});
var later = function () {
  previous = options.leading === false ? 0 : getTime();
  timeout = null;
  result = func.apply(context, args);
  context = args = null;
};
return function () {
  var now = getTime();
  if (!previous && options.leading === false) previous = now;
  var remaining = wait - (now - previous);
  context = this;
  args = arguments;
  if (remaining <= 0) {
    clearTimeout(timeout);
    timeout = null;
    previous = now;
    result = func.apply(context, args);
    context = args = null;
  } else if (!timeout && options.trailing !== false) {
    timeout = setTimeout(later, remaining);
  }
  return result;
};

};

// Velocity has conflicts when loaded with jQuery, this will check for it // First, check if in noConflict mode var Vel; if (jQuery) {

Vel = jQuery.Velocity;

} else if ($) {

Vel = $.Velocity;

} else {

Vel = Velocity;

}

if (Vel) {

Materialize.Vel = Vel;

} else {

Materialize.Vel = Velocity;

} ;(function ($) {

$.fn.collapsible = function (options, methodParam) {
  var defaults = {
    accordion: undefined,
    onOpen: undefined,
    onClose: undefined
  };

  var methodName = options;
  options = $.extend(defaults, options);

  return this.each(function () {

    var $this = $(this);

    var $panel_headers = $(this).find('> li > .collapsible-header');

    var collapsible_type = $this.data("collapsible");

    /****************
    Helper Functions
    ****************/

    // Accordion Open
    function accordionOpen(object) {
      $panel_headers = $this.find('> li > .collapsible-header');
      if (object.hasClass('active')) {
        object.parent().addClass('active');
      } else {
        object.parent().removeClass('active');
      }
      if (object.parent().hasClass('active')) {
        object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
            $(this).css('height', '');
          } });
      } else {
        object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
            $(this).css('height', '');
          } });
      }

      $panel_headers.not(object).removeClass('active').parent().removeClass('active');

      // Close previously open accordion elements.
      $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
        if ($(this).is(':visible')) {
          $(this).slideUp({
            duration: 350,
            easing: "easeOutQuart",
            queue: false,
            complete: function () {
              $(this).css('height', '');
              execCallbacks($(this).siblings('.collapsible-header'));
            }
          });
        }
      });
    }

    // Expandable Open
    function expandableOpen(object) {
      if (object.hasClass('active')) {
        object.parent().addClass('active');
      } else {
        object.parent().removeClass('active');
      }
      if (object.parent().hasClass('active')) {
        object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
            $(this).css('height', '');
          } });
      } else {
        object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
            $(this).css('height', '');
          } });
      }
    }

    // Open collapsible. object: .collapsible-header
    function collapsibleOpen(object, noToggle) {
      if (!noToggle) {
        object.toggleClass('active');
      }

      if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
        // Handle Accordion
        accordionOpen(object);
      } else {
        // Handle Expandables
        expandableOpen(object);
      }

      execCallbacks(object);
    }

    // Handle callbacks
    function execCallbacks(object) {
      if (object.hasClass('active')) {
        if (typeof options.onOpen === "function") {
          options.onOpen.call(this, object.parent());
        }
      } else {
        if (typeof options.onClose === "function") {
          options.onClose.call(this, object.parent());
        }
      }
    }

    /**
     * Check if object is children of panel header
     * @param  {Object}  object Jquery object
     * @return {Boolean} true if it is children
     */
    function isChildrenOfPanelHeader(object) {

      var panelHeader = getPanelHeader(object);

      return panelHeader.length > 0;
    }

    /**
     * Get panel header from a children element
     * @param  {Object} object Jquery object
     * @return {Object} panel header object
     */
    function getPanelHeader(object) {

      return object.closest('li > .collapsible-header');
    }

    // Turn off any existing event handlers
    function removeEventHandlers() {
      $this.off('click.collapse', '> li > .collapsible-header');
    }

    /*****  End Helper Functions  *****/

    // Methods
    if (methodName === 'destroy') {
      removeEventHandlers();
      return;
    } else if (methodParam >= 0 && methodParam < $panel_headers.length) {
      var $curr_header = $panel_headers.eq(methodParam);
      if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
        collapsibleOpen($curr_header);
      }
      return;
    }

    removeEventHandlers();

    // Add click handler to only direct collapsible header children
    $this.on('click.collapse', '> li > .collapsible-header', function (e) {
      var element = $(e.target);

      if (isChildrenOfPanelHeader(element)) {
        element = getPanelHeader(element);
      }

      collapsibleOpen(element);
    });

    // Open first active
    if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
      // Handle Accordion
      collapsibleOpen($panel_headers.filter('.active').first(), true);
    } else {
      // Handle Expandables
      $panel_headers.filter('.active').each(function () {
        collapsibleOpen($(this), true);
      });
    }
  });
};

$(document).ready(function () {
  $('.collapsible').collapsible();
});

})(jQuery);;(function ($) {

// Add posibility to scroll to selected option
// usefull for select for example
$.fn.scrollTo = function (elem) {
  $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
  return this;
};

$.fn.dropdown = function (options) {
  var defaults = {
    inDuration: 300,
    outDuration: 225,
    constrainWidth: true, // Constrains width of dropdown to the activator
    hover: false,
    gutter: 0, // Spacing from edge
    belowOrigin: false,
    alignment: 'left',
    stopPropagation: false
  };

  // Open dropdown.
  if (options === "open") {
    this.each(function () {
      $(this).trigger('open');
    });
    return false;
  }

  // Close dropdown.
  if (options === "close") {
    this.each(function () {
      $(this).trigger('close');
    });
    return false;
  }

  this.each(function () {
    var origin = $(this);
    var curr_options = $.extend({}, defaults, options);
    var isFocused = false;

    // Dropdown menu
    var activates = $("#" + origin.attr('data-activates'));

    function updateOptions() {
      if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
      if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
      if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
      if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
      if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
      if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
      if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
      if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
    }

    updateOptions();

    // Attach dropdown to its activator
    origin.after(activates);

    /*
      Helper function to position and resize dropdown.
      Used in hover and click handler.
    */
    function placeDropdown(eventType) {
      // Check for simultaneous focus and click events.
      if (eventType === 'focus') {
        isFocused = true;
      }

      // Check html data attributes
      updateOptions();

      // Set Dropdown state
      activates.addClass('active');
      origin.addClass('active');

      var originWidth = origin[0].getBoundingClientRect().width;

      // Constrain width
      if (curr_options.constrainWidth === true) {
        activates.css('width', originWidth);
      } else {
        activates.css('white-space', 'nowrap');
      }

      // Offscreen detection
      var windowHeight = window.innerHeight;
      var originHeight = origin.innerHeight();
      var offsetLeft = origin.offset().left;
      var offsetTop = origin.offset().top - $(window).scrollTop();
      var currAlignment = curr_options.alignment;
      var gutterSpacing = 0;
      var leftPosition = 0;

      // Below Origin
      var verticalOffset = 0;
      if (curr_options.belowOrigin === true) {
        verticalOffset = originHeight;
      }

      // Check for scrolling positioned container.
      var scrollYOffset = 0;
      var scrollXOffset = 0;
      var wrapper = origin.parent();
      if (!wrapper.is('body')) {
        if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
          scrollYOffset = wrapper[0].scrollTop;
        }
        if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
          scrollXOffset = wrapper[0].scrollLeft;
        }
      }

      if (offsetLeft + activates.innerWidth() > $(window).width()) {
        // Dropdown goes past screen on right, force right alignment
        currAlignment = 'right';
      } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
        // Dropdown goes past screen on left, force left alignment
        currAlignment = 'left';
      }
      // Vertical bottom offscreen detection
      if (offsetTop + activates.innerHeight() > windowHeight) {
        // If going upwards still goes offscreen, just crop height of dropdown.
        if (offsetTop + originHeight - activates.innerHeight() < 0) {
          var adjustedHeight = windowHeight - offsetTop - verticalOffset;
          activates.css('max-height', adjustedHeight);
        } else {
          // Flow upwards.
          if (!verticalOffset) {
            verticalOffset += originHeight;
          }
          verticalOffset -= activates.innerHeight();
        }
      }

      // Handle edge alignment
      if (currAlignment === 'left') {
        gutterSpacing = curr_options.gutter;
        leftPosition = origin.position().left + gutterSpacing;
      } else if (currAlignment === 'right') {
        // Material icons fix
        activates.stop(true, true).css({
          opacity: 0,
          left: 0
        });

        var offsetRight = origin.position().left + originWidth - activates.width();
        gutterSpacing = -curr_options.gutter;
        leftPosition = offsetRight + gutterSpacing;
      }

      // Position dropdown
      activates.css({
        position: 'absolute',
        top: origin.position().top + verticalOffset + scrollYOffset,
        left: leftPosition + scrollXOffset
      });

      // Show dropdown
      activates.slideDown({
        queue: false,
        duration: curr_options.inDuration,
        easing: 'easeOutCubic',
        complete: function () {
          $(this).css('height', '');
        }
      }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });

      // Add click close handler to document
      setTimeout(function () {
        $(document).on('click.' + activates.attr('id'), function (e) {
          hideDropdown();
          $(document).off('click.' + activates.attr('id'));
        });
      }, 0);
    }

    function hideDropdown() {
      // Check for simultaneous focus and click events.
      isFocused = false;
      activates.fadeOut(curr_options.outDuration);
      activates.removeClass('active');
      origin.removeClass('active');
      $(document).off('click.' + activates.attr('id'));
      setTimeout(function () {
        activates.css('max-height', '');
      }, curr_options.outDuration);
    }

    // Hover
    if (curr_options.hover) {
      var open = false;
      origin.off('click.' + origin.attr('id'));
      // Hover handler to show dropdown
      origin.on('mouseenter', function (e) {
        // Mouse over
        if (open === false) {
          placeDropdown();
          open = true;
        }
      });
      origin.on('mouseleave', function (e) {
        // If hover on origin then to something other than dropdown content, then close
        var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
        if (!$(toEl).closest('.dropdown-content').is(activates)) {
          activates.stop(true, true);
          hideDropdown();
          open = false;
        }
      });

      activates.on('mouseleave', function (e) {
        // Mouse out
        var toEl = e.toElement || e.relatedTarget;
        if (!$(toEl).closest('.dropdown-button').is(origin)) {
          activates.stop(true, true);
          hideDropdown();
          open = false;
        }
      });

      // Click
    } else {
      // Click handler to show dropdown
      origin.off('click.' + origin.attr('id'));
      origin.on('click.' + origin.attr('id'), function (e) {
        if (!isFocused) {
          if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
            e.preventDefault(); // Prevents button click from moving window
            if (curr_options.stopPropagation) {
              e.stopPropagation();
            }
            placeDropdown('click');
          }
          // If origin is clicked and menu is open, close menu
          else if (origin.hasClass('active')) {
              hideDropdown();
              $(document).off('click.' + activates.attr('id'));
            }
        }
      });
    } // End else

    // Listen to open and close event - useful for select component
    origin.on('open', function (e, eventType) {
      placeDropdown(eventType);
    });
    origin.on('close', hideDropdown);
  });
}; // End dropdown plugin

$(document).ready(function () {
  $('.dropdown-button').dropdown();
});

})(jQuery); ;(function ($, Vel) {

'use strict';

var _defaults = {
  opacity: 0.5,
  inDuration: 250,
  outDuration: 250,
  ready: undefined,
  complete: undefined,
  dismissible: true,
  startingTop: '4%',
  endingTop: '10%'
};

/**
 * @class
 *
 */

var Modal = function () {
  /**
   * Construct Modal instance and set up overlay
   * @constructor
   * @param {jQuery} $el
   * @param {Object} options
   */
  function Modal($el, options) {
    _classCallCheck(this, Modal);

    // If exists, destroy and reinitialize
    if (!!$el[0].M_Modal) {
      $el[0].M_Modal.destroy();
    }

    /**
     * The jQuery element
     * @type {jQuery}
     */
    this.$el = $el;

    /**
     * Options for the modal
     * @member Modal#options
     * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
     * @prop {Number} [inDuration=250] - Length in ms of enter transition
     * @prop {Number} [outDuration=250] - Length in ms of exit transition
     * @prop {Function} ready - Callback function called when modal is finished entering
     * @prop {Function} complete - Callback function called when modal is finished exiting
     * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
     * @prop {String} [startingTop='4%'] - startingTop
     * @prop {String} [endingTop='10%'] - endingTop
     */
    this.options = $.extend({}, Modal.defaults, options);

    /**
     * Describes open/close state of modal
     * @type {Boolean}
     */
    this.isOpen = false;

    this.$el[0].M_Modal = this;
    this.id = $el.attr('id');
    this.openingTrigger = undefined;
    this.$overlay = $('<div class="modal-overlay"></div>');

    Modal._increment++;
    Modal._count++;
    this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
    this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
    this.setupEventHandlers();
  }

  _createClass(Modal, [{
    key: 'getInstance',

    /**
     * Get Instance
     */
    value: function getInstance() {
      return this;
    }

    /**
     * Teardown component
     */

  }, {
    key: 'destroy',
    value: function destroy() {
      this.removeEventHandlers();
      this.$el[0].removeAttribute('style');
      if (!!this.$overlay[0].parentNode) {
        this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
      }
      this.$el[0].M_Modal = undefined;
      Modal._count--;
    }

    /**
     * Setup Event Handlers
     */

  }, {
    key: 'setupEventHandlers',
    value: function setupEventHandlers() {
      this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
      this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);

      if (Modal._count === 1) {
        document.body.addEventListener('click', this.handleTriggerClick);
      }
      this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
      this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
    }

    /**
     * Remove Event Handlers
     */

  }, {
    key: 'removeEventHandlers',
    value: function removeEventHandlers() {
      if (Modal._count === 0) {
        document.body.removeEventListener('click', this.handleTriggerClick);
      }
      this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
      this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
    }

    /**
     * Handle Trigger Click
     * @param {Event} e
     */

  }, {
    key: 'handleTriggerClick',
    value: function handleTriggerClick(e) {
      var $trigger = $(e.target).closest('.modal-trigger');
      if (e.target && $trigger.length) {
        var modalId = $trigger[0].getAttribute('href');
        if (modalId) {
          modalId = modalId.slice(1);
        } else {
          modalId = $trigger[0].getAttribute('data-target');
        }
        var modalInstance = document.getElementById(modalId).M_Modal;
        if (modalInstance) {
          modalInstance.open($trigger);
        }
        e.preventDefault();
      }
    }

    /**
     * Handle Overlay Click
     */

  }, {
    key: 'handleOverlayClick',
    value: function handleOverlayClick() {
      if (this.options.dismissible) {
        this.close();
      }
    }

    /**
     * Handle Modal Close Click
     * @param {Event} e
     */

  }, {
    key: 'handleModalCloseClick',
    value: function handleModalCloseClick(e) {
      var $closeTrigger = $(e.target).closest('.modal-close');
      if (e.target && $closeTrigger.length) {
        this.close();
      }
    }

    /**
     * Handle Keydown
     * @param {Event} e
     */

  }, {
    key: 'handleKeydown',
    value: function handleKeydown(e) {
      // ESC key
      if (e.keyCode === 27 && this.options.dismissible) {
        this.close();
      }
    }

    /**
     * Animate in modal
     */

  }, {
    key: 'animateIn',
    value: function animateIn() {
      var _this = this;

      // Set initial styles
      $.extend(this.$el[0].style, {
        display: 'block',
        opacity: 0
      });
      $.extend(this.$overlay[0].style, {
        display: 'block',
        opacity: 0
      });

      // Animate overlay
      Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });

      // Define modal animation options
      var enterVelocityOptions = {
        duration: this.options.inDuration,
        queue: false,
        ease: 'easeOutCubic',
        // Handle modal ready callback
        complete: function () {
          if (typeof _this.options.ready === 'function') {
            _this.options.ready.call(_this, _this.$el, _this.openingTrigger);
          }
        }
      };

      // Bottom sheet animation
      if (this.$el[0].classList.contains('bottom-sheet')) {
        Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);

        // Normal modal animation
      } else {
        Vel.hook(this.$el[0], 'scaleX', 0.7);
        this.$el[0].style.top = this.options.startingTop;
        Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
      }
    }

    /**
     * Animate out modal
     */

  }, {
    key: 'animateOut',
    value: function animateOut() {
      var _this2 = this;

      // Animate overlay
      Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });

      // Define modal animation options
      var exitVelocityOptions = {
        duration: this.options.outDuration,
        queue: false,
        ease: 'easeOutCubic',
        // Handle modal ready callback
        complete: function () {
          _this2.$el[0].style.display = 'none';
          // Call complete callback
          if (typeof _this2.options.complete === 'function') {
            _this2.options.complete.call(_this2, _this2.$el);
          }
          _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
        }
      };

      // Bottom sheet animation
      if (this.$el[0].classList.contains('bottom-sheet')) {
        Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);

        // Normal modal animation
      } else {
        Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
      }
    }

    /**
     * Open Modal
     * @param {jQuery} [$trigger]
     */

  }, {
    key: 'open',
    value: function open($trigger) {
      if (this.isOpen) {
        return;
      }

      this.isOpen = true;
      var body = document.body;
      body.style.overflow = 'hidden';
      this.$el[0].classList.add('open');
      body.appendChild(this.$overlay[0]);

      // Set opening trigger, undefined indicates modal was opened by javascript
      this.openingTrigger = !!$trigger ? $trigger : undefined;

      if (this.options.dismissible) {
        this.handleKeydownBound = this.handleKeydown.bind(this);
        document.addEventListener('keydown', this.handleKeydownBound);
      }

      this.animateIn();

      return this;
    }

    /**
     * Close Modal
     */

  }, {
    key: 'close',
    value: function close() {
      if (!this.isOpen) {
        return;
      }

      this.isOpen = false;
      this.$el[0].classList.remove('open');
      document.body.style.overflow = '';

      if (this.options.dismissible) {
        document.removeEventListener('keydown', this.handleKeydownBound);
      }

      this.animateOut();

      return this;
    }
  }], [{
    key: 'init',
    value: function init($els, options) {
      var arr = [];
      $els.each(function () {
        arr.push(new Modal($(this), options));
      });
      return arr;
    }
  }, {
    key: 'defaults',
    get: function () {
      return _defaults;
    }
  }]);

  return Modal;
}();

/**
 * @static
 * @memberof Modal
 */

Modal._increment = 0;

/**
 * @static
 * @memberof Modal
 */
Modal._count = 0;

Materialize.Modal = Modal;

$.fn.modal = function (methodOrOptions) {
  // Call plugin method if valid method name is passed in
  if (Modal.prototype[methodOrOptions]) {
    // Getter methods
    if (methodOrOptions.slice(0, 3) === 'get') {
      return this.first()[0].M_Modal[methodOrOptions]();

      // Void methods
    } else {
      return this.each(function () {
        this.M_Modal[methodOrOptions]();
      });
    }

    // Initialize plugin if options or no argument is passed in
  } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
    Modal.init(this, arguments[0]);
    return this;

    // Return error if an unrecognized  method name is passed in
  } else {
    $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
  }
};

})(jQuery, Materialize.Vel); ;(function ($) {

$.fn.materialbox = function () {

  return this.each(function () {

    if ($(this).hasClass('initialized')) {
      return;
    }

    $(this).addClass('initialized');

    var overlayActive = false;
    var doneAnimating = true;
    var inDuration = 275;
    var outDuration = 200;
    var origin = $(this);
    var placeholder = $('<div></div>').addClass('material-placeholder');
    var originalWidth = 0;
    var originalHeight = 0;
    var ancestorsChanged;
    var ancestor;
    var originInlineStyles = origin.attr('style');
    origin.wrap(placeholder);

    // Start click handler
    origin.on('click', function () {
      var placeholder = origin.parent('.material-placeholder');
      var windowWidth = window.innerWidth;
      var windowHeight = window.innerHeight;
      var originalWidth = origin.width();
      var originalHeight = origin.height();

      // If already modal, return to original
      if (doneAnimating === false) {
        returnToOriginal();
        return false;
      } else if (overlayActive && doneAnimating === true) {
        returnToOriginal();
        return false;
      }

      // Set states
      doneAnimating = false;
      origin.addClass('active');
      overlayActive = true;

      // Set positioning for placeholder
      placeholder.css({
        width: placeholder[0].getBoundingClientRect().width,
        height: placeholder[0].getBoundingClientRect().height,
        position: 'relative',
        top: 0,
        left: 0
      });

      // Find ancestor with overflow: hidden; and remove it
      ancestorsChanged = undefined;
      ancestor = placeholder[0].parentNode;
      var count = 0;
      while (ancestor !== null && !$(ancestor).is(document)) {
        var curr = $(ancestor);
        if (curr.css('overflow') !== 'visible') {
          curr.css('overflow', 'visible');
          if (ancestorsChanged === undefined) {
            ancestorsChanged = curr;
          } else {
            ancestorsChanged = ancestorsChanged.add(curr);
          }
        }
        ancestor = ancestor.parentNode;
      }

      // Set css on origin
      origin.css({
        position: 'absolute',
        'z-index': 1000,
        'will-change': 'left, top, width, height'
      }).data('width', originalWidth).data('height', originalHeight);

      // Add overlay
      var overlay = $('<div id="materialbox-overlay"></div>').css({
        opacity: 0
      }).click(function () {
        if (doneAnimating === true) returnToOriginal();
      });

      // Put before in origin image to preserve z-index layering.
      origin.before(overlay);

      // Set dimensions if needed
      var overlayOffset = overlay[0].getBoundingClientRect();
      overlay.css({
        width: windowWidth,
        height: windowHeight,
        left: -1 * overlayOffset.left,
        top: -1 * overlayOffset.top
      });

      // Animate Overlay
      overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });

      // Add and animate caption if it exists
      if (origin.data('caption') !== "") {
        var $photo_caption = $('<div class="materialbox-caption"></div>');
        $photo_caption.text(origin.data('caption'));
        $('body').append($photo_caption);
        $photo_caption.css({ "display": "inline" });
        $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
      }

      // Resize Image
      var ratio = 0;
      var widthPercent = originalWidth / windowWidth;
      var heightPercent = originalHeight / windowHeight;
      var newWidth = 0;
      var newHeight = 0;

      if (widthPercent > heightPercent) {
        ratio = originalHeight / originalWidth;
        newWidth = windowWidth * 0.9;
        newHeight = windowWidth * 0.9 * ratio;
      } else {
        ratio = originalWidth / originalHeight;
        newWidth = windowHeight * 0.9 * ratio;
        newHeight = windowHeight * 0.9;
      }

      // Animate image + set z-index
      if (origin.hasClass('responsive-img')) {
        origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
          complete: function () {
            origin.css({ left: 0, top: 0 }).velocity({
              height: newHeight,
              width: newWidth,
              left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
              top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
            }, {
              duration: inDuration,
              queue: false,
              easing: 'easeOutQuad',
              complete: function () {
                doneAnimating = true;
              }
            });
          } // End Complete
        }); // End Velocity
      } else {
        origin.css('left', 0).css('top', 0).velocity({
          height: newHeight,
          width: newWidth,
          left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
          top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
        }, {
          duration: inDuration,
          queue: false,
          easing: 'easeOutQuad',
          complete: function () {
            doneAnimating = true;
          }
        }); // End Velocity
      }

      // Handle Exit triggers
      $(window).on('scroll.materialbox', function () {
        if (overlayActive) {
          returnToOriginal();
        }
      });

      $(window).on('resize.materialbox', function () {
        if (overlayActive) {
          returnToOriginal();
        }
      });

      $(document).on('keyup.materialbox', function (e) {
        // ESC key
        if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
          returnToOriginal();
        }
      });
    }); // End click handler

    // This function returns the modaled image to the original spot
    function returnToOriginal() {

      doneAnimating = false;

      var placeholder = origin.parent('.material-placeholder');
      var windowWidth = window.innerWidth;
      var windowHeight = window.innerHeight;
      var originalWidth = origin.data('width');
      var originalHeight = origin.data('height');

      origin.velocity("stop", true);
      $('#materialbox-overlay').velocity("stop", true);
      $('.materialbox-caption').velocity("stop", true);

      // disable exit handlers
      $(window).off('scroll.materialbox');
      $(document).off('keyup.materialbox');
      $(window).off('resize.materialbox');

      $('#materialbox-overlay').velocity({ opacity: 0 }, {
        duration: outDuration, // Delay prevents animation overlapping
        queue: false, easing: 'easeOutQuad',
        complete: function () {
          // Remove Overlay
          overlayActive = false;
          $(this).remove();
        }
      });

      // Resize Image
      origin.velocity({
        width: originalWidth,
        height: originalHeight,
        left: 0,
        top: 0
      }, {
        duration: outDuration,
        queue: false, easing: 'easeOutQuad',
        complete: function () {
          placeholder.css({
            height: '',
            width: '',
            position: '',
            top: '',
            left: ''
          });

          origin.removeAttr('style');
          origin.attr('style', originInlineStyles);

          // Remove class
          origin.removeClass('active');
          doneAnimating = true;

          // Remove overflow overrides on ancestors
          if (ancestorsChanged) {
            ancestorsChanged.css('overflow', '');
          }
        }
      });

      // Remove Caption + reset css settings on image
      $('.materialbox-caption').velocity({ opacity: 0 }, {
        duration: outDuration, // Delay prevents animation overlapping
        queue: false, easing: 'easeOutQuad',
        complete: function () {
          $(this).remove();
        }
      });
    }
  });
};

$(document).ready(function () {
  $('.materialboxed').materialbox();
});

})(jQuery); ;(function ($) {

$.fn.parallax = function () {
  var window_width = $(window).width();
  // Parallax Scripts
  return this.each(function (i) {
    var $this = $(this);
    $this.addClass('parallax');

    function updateParallax(initial) {
      var container_height;
      if (window_width < 601) {
        container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
      } else {
        container_height = $this.height() > 0 ? $this.height() : 500;
      }
      var $img = $this.children("img").first();
      var img_height = $img.height();
      var parallax_dist = img_height - container_height;
      var bottom = $this.offset().top + container_height;
      var top = $this.offset().top;
      var scrollTop = $(window).scrollTop();
      var windowHeight = window.innerHeight;
      var windowBottom = scrollTop + windowHeight;
      var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
      var parallax = Math.round(parallax_dist * percentScrolled);

      if (initial) {
        $img.css('display', 'block');
      }
      if (bottom > scrollTop && top < scrollTop + windowHeight) {
        $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
      }
    }

    // Wait for image load
    $this.children("img").one("load", function () {
      updateParallax(true);
    }).each(function () {
      if (this.complete) $(this).trigger("load");
    });

    $(window).scroll(function () {
      window_width = $(window).width();
      updateParallax(false);
    });

    $(window).resize(function () {
      window_width = $(window).width();
      updateParallax(false);
    });
  });
};

})(jQuery); ;(function ($) {

var methods = {
  init: function (options) {
    var defaults = {
      onShow: null,
      swipeable: false,
      responsiveThreshold: Infinity // breakpoint for swipeable
    };
    options = $.extend(defaults, options);
    var namespace = Materialize.objectSelectorString($(this));

    return this.each(function (i) {

      var uniqueNamespace = namespace + i;

      // For each set of tabs, we want to keep track of
      // which tab is active and its associated content
      var $this = $(this),
          window_width = $(window).width();

      var $active,
          $content,
          $links = $this.find('li.tab a'),
          $tabs_width = $this.width(),
          $tabs_content = $(),
          $tabs_wrapper,
          $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
          $indicator,
          index = 0,
          prev_index = 0,
          clicked = false,
          clickedTimeout,
          transition = 300;

      // Finds right attribute for indicator based on active tab.
      // el: jQuery Object
      var calcRightPos = function (el) {
        return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
      };

      // Finds left attribute for indicator based on active tab.
      // el: jQuery Object
      var calcLeftPos = function (el) {
        return Math.floor(el.position().left + $this.scrollLeft());
      };

      // Animates Indicator to active tab.
      // prev_index: Number
      var animateIndicator = function (prev_index) {
        if (index - prev_index >= 0) {
          $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
          $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
        } else {
          $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
          $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
        }
      };

      // Change swipeable according to responsive threshold
      if (options.swipeable) {
        if (window_width > options.responsiveThreshold) {
          options.swipeable = false;
        }
      }

      // If the location.hash matches one of the links, use that as the active tab.
      $active = $($links.filter('[href="' + location.hash + '"]'));

      // If no match is found, use the first link or any with class 'active' as the initial active tab.
      if ($active.length === 0) {
        $active = $(this).find('li.tab a.active').first();
      }
      if ($active.length === 0) {
        $active = $(this).find('li.tab a').first();
      }

      $active.addClass('active');
      index = $links.index($active);
      if (index < 0) {
        index = 0;
      }

      if ($active[0] !== undefined) {
        $content = $($active[0].hash);
        $content.addClass('active');
      }

      // append indicator then set indicator width to tab width
      if (!$this.find('.indicator').length) {
        $this.append('<li class="indicator"></li>');
      }
      $indicator = $this.find('.indicator');

      // we make sure that the indicator is at the end of the tabs
      $this.append($indicator);

      if ($this.is(":visible")) {
        // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
        // $indicator.css({"left": index * $tab_width});
        setTimeout(function () {
          $indicator.css({ "right": calcRightPos($active) });
          $indicator.css({ "left": calcLeftPos($active) });
        }, 0);
      }
      $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
        $tabs_width = $this.width();
        $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
        if (index < 0) {
          index = 0;
        }
        if ($tab_width !== 0 && $tabs_width !== 0) {
          $indicator.css({ "right": calcRightPos($active) });
          $indicator.css({ "left": calcLeftPos($active) });
        }
      });

      // Initialize Tabs Content.
      if (options.swipeable) {
        // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
        $links.each(function () {
          var $curr_content = $(Materialize.escapeHash(this.hash));
          $curr_content.addClass('carousel-item');
          $tabs_content = $tabs_content.add($curr_content);
        });
        $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
        $tabs_content.css('display', '');
        $('.tabs-content.carousel').carousel({
          fullWidth: true,
          noWrap: true,
          onCycleTo: function (item) {
            if (!clicked) {
              var prev_index = index;
              index = $tabs_wrapper.index(item);
              $active.removeClass('active');
              $active = $links.eq(index);
              $active.addClass('active');
              animateIndicator(prev_index);
              if (typeof options.onShow === "function") {
                options.onShow.call($this[0], $content);
              }
            }
          }
        });
      } else {
        // Hide the remaining content
        $links.not($active).each(function () {
          $(Materialize.escapeHash(this.hash)).hide();
        });
      }

      // Bind the click event handler
      $this.off('click.tabs').on('click.tabs', 'a', function (e) {
        if ($(this).parent().hasClass('disabled')) {
          e.preventDefault();
          return;
        }

        // Act as regular link if target attribute is specified.
        if (!!$(this).attr("target")) {
          return;
        }

        clicked = true;
        $tabs_width = $this.width();
        $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;

        // Make the old tab inactive.
        $active.removeClass('active');
        var $oldContent = $content;

        // Update the variables with the new link and content
        $active = $(this);
        $content = $(Materialize.escapeHash(this.hash));
        $links = $this.find('li.tab a');
        var activeRect = $active.position();

        // Make the tab active.
        $active.addClass('active');
        prev_index = index;
        index = $links.index($(this));
        if (index < 0) {
          index = 0;
        }
        // Change url to current tab
        // window.location.hash = $active.attr('href');

        // Swap content
        if (options.swipeable) {
          if ($tabs_content.length) {
            $tabs_content.carousel('set', index, function () {
              if (typeof options.onShow === "function") {
                options.onShow.call($this[0], $content);
              }
            });
          }
        } else {
          if ($content !== undefined) {
            $content.show();
            $content.addClass('active');
            if (typeof options.onShow === "function") {
              options.onShow.call(this, $content);
            }
          }

          if ($oldContent !== undefined && !$oldContent.is($content)) {
            $oldContent.hide();
            $oldContent.removeClass('active');
          }
        }

        // Reset clicked state
        clickedTimeout = setTimeout(function () {
          clicked = false;
        }, transition);

        // Update indicator
        animateIndicator(prev_index);

        // Prevent the anchor's default click action
        e.preventDefault();
      });
    });
  },
  select_tab: function (id) {
    this.find('a[href="#' + id + '"]').trigger('click');
  }
};

$.fn.tabs = function (methodOrOptions) {
  if (methods[methodOrOptions]) {
    return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
  } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
    // Default to "init"
    return methods.init.apply(this, arguments);
  } else {
    $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
  }
};

$(document).ready(function () {
  $('ul.tabs').tabs();
});

})(jQuery); ;(function ($) {

$.fn.tooltip = function (options) {
  var timeout = null,
      margin = 5;

  // Defaults
  var defaults = {
    delay: 350,
    tooltip: '',
    position: 'bottom',
    html: false
  };

  // Remove tooltip from the activator
  if (options === "remove") {
    this.each(function () {
      $('#' + $(this).attr('data-tooltip-id')).remove();
      $(this).removeAttr('data-tooltip-id');
      $(this).off('mouseenter.tooltip mouseleave.tooltip');
    });
    return false;
  }

  options = $.extend(defaults, options);

  return this.each(function () {
    var tooltipId = Materialize.guid();
    var origin = $(this);

    // Destroy old tooltip
    if (origin.attr('data-tooltip-id')) {
      $('#' + origin.attr('data-tooltip-id')).remove();
    }

    origin.attr('data-tooltip-id', tooltipId);

    // Get attributes.
    var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
    var setAttributes = function () {
      allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
      tooltipDelay = origin.attr('data-delay');
      tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
      tooltipPosition = origin.attr('data-position');
      tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
      tooltipText = origin.attr('data-tooltip');
      tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
    };
    setAttributes();

    var renderTooltipEl = function () {
      var tooltip = $('<div class="material-tooltip"></div>');

      // Create Text span
      if (allowHtml) {
        tooltipText = $('<span></span>').html(tooltipText);
      } else {
        tooltipText = $('<span></span>').text(tooltipText);
      }

      // Create tooltip
      tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);

      // Create backdrop
      backdrop = $('<div class="backdrop"></div>');
      backdrop.appendTo(tooltip);
      return tooltip;
    };
    tooltipEl = renderTooltipEl();

    // Destroy previously binded events
    origin.off('mouseenter.tooltip mouseleave.tooltip');
    // Mouse In
    var started = false,
        timeoutRef;
    origin.on({ 'mouseenter.tooltip': function (e) {
        var showTooltip = function () {
          setAttributes();
          started = true;
          tooltipEl.velocity('stop');
          backdrop.velocity('stop');
          tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });

          // Tooltip positioning
          var originWidth = origin.outerWidth();
          var originHeight = origin.outerHeight();
          var tooltipHeight = tooltipEl.outerHeight();
          var tooltipWidth = tooltipEl.outerWidth();
          var tooltipVerticalMovement = '0px';
          var tooltipHorizontalMovement = '0px';
          var backdropOffsetWidth = backdrop[0].offsetWidth;
          var backdropOffsetHeight = backdrop[0].offsetHeight;
          var scaleXFactor = 8;
          var scaleYFactor = 8;
          var scaleFactor = 0;
          var targetTop, targetLeft, newCoordinates;

          if (tooltipPosition === "top") {
            // Top Position
            targetTop = origin.offset().top - tooltipHeight - margin;
            targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
            newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
            tooltipVerticalMovement = '-10px';
            backdrop.css({
              bottom: 0,
              left: 0,
              borderRadius: '14px 14px 0 0',
              transformOrigin: '50% 100%',
              marginTop: tooltipHeight,
              marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
            });
          }
          // Left Position
          else if (tooltipPosition === "left") {
              targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
              targetLeft = origin.offset().left - tooltipWidth - margin;
              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);

              tooltipHorizontalMovement = '-10px';
              backdrop.css({
                top: '-7px',
                right: 0,
                width: '14px',
                height: '14px',
                borderRadius: '14px 0 0 14px',
                transformOrigin: '95% 50%',
                marginTop: tooltipHeight / 2,
                marginLeft: tooltipWidth
              });
            }
            // Right Position
            else if (tooltipPosition === "right") {
                targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                targetLeft = origin.offset().left + originWidth + margin;
                newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);

                tooltipHorizontalMovement = '+10px';
                backdrop.css({
                  top: '-7px',
                  left: 0,
                  width: '14px',
                  height: '14px',
                  borderRadius: '0 14px 14px 0',
                  transformOrigin: '5% 50%',
                  marginTop: tooltipHeight / 2,
                  marginLeft: '0px'
                });
              } else {
                // Bottom Position
                targetTop = origin.offset().top + origin.outerHeight() + margin;
                targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                tooltipVerticalMovement = '+10px';
                backdrop.css({
                  top: 0,
                  left: 0,
                  marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
                });
              }

          // Set tooptip css placement
          tooltipEl.css({
            top: newCoordinates.y,
            left: newCoordinates.x
          });

          // Calculate Scale to fill
          scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
          scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
          scaleFactor = Math.max(scaleXFactor, scaleYFactor);

          tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
          backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
        };

        timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval

        // Mouse Out
      },
      'mouseleave.tooltip': function () {
        // Reset State
        started = false;
        clearTimeout(timeoutRef);

        // Animate back
        setTimeout(function () {
          if (started !== true) {
            tooltipEl.velocity({
              opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
            backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
              duration: 225,
              queue: false,
              complete: function () {
                backdrop.css({ visibility: 'hidden' });
                tooltipEl.css({ visibility: 'hidden' });
                started = false;
              }
            });
          }
        }, 225);
      }
    });
  });
};

var repositionWithinScreen = function (x, y, width, height) {
  var newX = x;
  var newY = y;

  if (newX < 0) {
    newX = 4;
  } else if (newX + width > window.innerWidth) {
    newX -= newX + width - window.innerWidth;
  }

  if (newY < 0) {
    newY = 4;
  } else if (newY + height > window.innerHeight + $(window).scrollTop) {
    newY -= newY + height - window.innerHeight;
  }

  return { x: newX, y: newY };
};

$(document).ready(function () {
  $('.tooltipped').tooltip();
});

})(jQuery); ; /*!

* Waves v0.6.4
* http://fian.my.id/Waves
*
* Copyright 2014 Alfiana E. Sibuea and other contributors
* Released under the MIT license
* https://github.com/fians/Waves/blob/master/LICENSE
*/

;(function (window) {

'use strict';

var Waves = Waves || {};
var $$ = document.querySelectorAll.bind(document);

// Find exact position of element
function isWindow(obj) {
  return obj !== null && obj === obj.window;
}

function getWindow(elem) {
  return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
}

function offset(elem) {
  var docElem,
      win,
      box = { top: 0, left: 0 },
      doc = elem && elem.ownerDocument;

  docElem = doc.documentElement;

  if (typeof elem.getBoundingClientRect !== typeof undefined) {
    box = elem.getBoundingClientRect();
  }
  win = getWindow(doc);
  return {
    top: box.top + win.pageYOffset - docElem.clientTop,
    left: box.left + win.pageXOffset - docElem.clientLeft
  };
}

function convertStyle(obj) {
  var style = '';

  for (var a in obj) {
    if (obj.hasOwnProperty(a)) {
      style += a + ':' + obj[a] + ';';
    }
  }

  return style;
}

var Effect = {

  // Effect delay
  duration: 750,

  show: function (e, element) {

    // Disable right click
    if (e.button === 2) {
      return false;
    }

    var el = element || this;

    // Create ripple
    var ripple = document.createElement('div');
    ripple.className = 'waves-ripple';
    el.appendChild(ripple);

    // Get click coordinate and element witdh
    var pos = offset(el);
    var relativeY = e.pageY - pos.top;
    var relativeX = e.pageX - pos.left;
    var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';

    // Support for touch devices
    if ('touches' in e) {
      relativeY = e.touches[0].pageY - pos.top;
      relativeX = e.touches[0].pageX - pos.left;
    }

    // Attach data to element
    ripple.setAttribute('data-hold', Date.now());
    ripple.setAttribute('data-scale', scale);
    ripple.setAttribute('data-x', relativeX);
    ripple.setAttribute('data-y', relativeY);

    // Set ripple position
    var rippleStyle = {
      'top': relativeY + 'px',
      'left': relativeX + 'px'
    };

    ripple.className = ripple.className + ' waves-notransition';
    ripple.setAttribute('style', convertStyle(rippleStyle));
    ripple.className = ripple.className.replace('waves-notransition', '');

    // Scale the ripple
    rippleStyle['-webkit-transform'] = scale;
    rippleStyle['-moz-transform'] = scale;
    rippleStyle['-ms-transform'] = scale;
    rippleStyle['-o-transform'] = scale;
    rippleStyle.transform = scale;
    rippleStyle.opacity = '1';

    rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
    rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
    rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
    rippleStyle['transition-duration'] = Effect.duration + 'ms';

    rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
    rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
    rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
    rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';

    ripple.setAttribute('style', convertStyle(rippleStyle));
  },

  hide: function (e) {
    TouchHandler.touchup(e);

    var el = this;
    var width = el.clientWidth * 1.4;

    // Get first ripple
    var ripple = null;
    var ripples = el.getElementsByClassName('waves-ripple');
    if (ripples.length > 0) {
      ripple = ripples[ripples.length - 1];
    } else {
      return false;
    }

    var relativeX = ripple.getAttribute('data-x');
    var relativeY = ripple.getAttribute('data-y');
    var scale = ripple.getAttribute('data-scale');

    // Get delay beetween mousedown and mouse leave
    var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
    var delay = 350 - diff;

    if (delay < 0) {
      delay = 0;
    }

    // Fade out ripple after delay
    setTimeout(function () {
      var style = {
        'top': relativeY + 'px',
        'left': relativeX + 'px',
        'opacity': '0',

        // Duration
        '-webkit-transition-duration': Effect.duration + 'ms',
        '-moz-transition-duration': Effect.duration + 'ms',
        '-o-transition-duration': Effect.duration + 'ms',
        'transition-duration': Effect.duration + 'ms',
        '-webkit-transform': scale,
        '-moz-transform': scale,
        '-ms-transform': scale,
        '-o-transform': scale,
        'transform': scale
      };

      ripple.setAttribute('style', convertStyle(style));

      setTimeout(function () {
        try {
          el.removeChild(ripple);
        } catch (e) {
          return false;
        }
      }, Effect.duration);
    }, delay);
  },

  // Little hack to make <input> can perform waves effect
  wrapInput: function (elements) {
    for (var a = 0; a < elements.length; a++) {
      var el = elements[a];

      if (el.tagName.toLowerCase() === 'input') {
        var parent = el.parentNode;

        // If input already have parent just pass through
        if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
          continue;
        }

        // Put element class and style to the specified parent
        var wrapper = document.createElement('i');
        wrapper.className = el.className + ' waves-input-wrapper';

        var elementStyle = el.getAttribute('style');

        if (!elementStyle) {
          elementStyle = '';
        }

        wrapper.setAttribute('style', elementStyle);

        el.className = 'waves-button-input';
        el.removeAttribute('style');

        // Put element as child
        parent.replaceChild(wrapper, el);
        wrapper.appendChild(el);
      }
    }
  }
};

/**
 * Disable mousedown event for 500ms during and after touch
 */
var TouchHandler = {
  /* uses an integer rather than bool so there's no issues with
   * needing to clear timeouts if another touch event occurred
   * within the 500ms. Cannot mouseup between touchstart and
   * touchend, nor in the 500ms after touchend. */
  touches: 0,
  allowEvent: function (e) {
    var allow = true;

    if (e.type === 'touchstart') {
      TouchHandler.touches += 1; //push
    } else if (e.type === 'touchend' || e.type === 'touchcancel') {
      setTimeout(function () {
        if (TouchHandler.touches > 0) {
          TouchHandler.touches -= 1; //pop after 500ms
        }
      }, 500);
    } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
      allow = false;
    }

    return allow;
  },
  touchup: function (e) {
    TouchHandler.allowEvent(e);
  }
};

/**
 * Delegated click handler for .waves-effect element.
 * returns null when .waves-effect element not in "click tree"
 */
function getWavesEffectElement(e) {
  if (TouchHandler.allowEvent(e) === false) {
    return null;
  }

  var element = null;
  var target = e.target || e.srcElement;

  while (target.parentNode !== null) {
    if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
      element = target;
      break;
    }
    target = target.parentNode;
  }
  return element;
}

/**
 * Bubble the click and show effect if .waves-effect elem was found
 */
function showEffect(e) {
  var element = getWavesEffectElement(e);

  if (element !== null) {
    Effect.show(e, element);

    if ('ontouchstart' in window) {
      element.addEventListener('touchend', Effect.hide, false);
      element.addEventListener('touchcancel', Effect.hide, false);
    }

    element.addEventListener('mouseup', Effect.hide, false);
    element.addEventListener('mouseleave', Effect.hide, false);
    element.addEventListener('dragend', Effect.hide, false);
  }
}

Waves.displayEffect = function (options) {
  options = options || {};

  if ('duration' in options) {
    Effect.duration = options.duration;
  }

  //Wrap input inside <i> tag
  Effect.wrapInput($$('.waves-effect'));

  if ('ontouchstart' in window) {
    document.body.addEventListener('touchstart', showEffect, false);
  }

  document.body.addEventListener('mousedown', showEffect, false);
};

/**
 * Attach Waves to an input element (or any element which doesn't
 * bubble mouseup/mousedown events).
 *   Intended to be used with dynamically loaded forms/inputs, or
 * where the user doesn't want a delegated click handler.
 */
Waves.attach = function (element) {
  //FUTURE: automatically add waves classes and allow users
  // to specify them with an options param? Eg. light/classic/button
  if (element.tagName.toLowerCase() === 'input') {
    Effect.wrapInput([element]);
    element = element.parentNode;
  }

  if ('ontouchstart' in window) {
    element.addEventListener('touchstart', showEffect, false);
  }

  element.addEventListener('mousedown', showEffect, false);
};

window.Waves = Waves;

document.addEventListener('DOMContentLoaded', function () {
  Waves.displayEffect();
}, false);

})(window); ;(function ($, Vel) {

'use strict';

var _defaults = {
  displayLength: Infinity,
  inDuration: 300,
  outDuration: 375,
  className: undefined,
  completeCallback: undefined,
  activationPercent: 0.8
};

var Toast = function () {
  function Toast(message, displayLength, className, completeCallback) {
    _classCallCheck(this, Toast);

    if (!message) {
      return;
    }

    /**
     * Options for the toast
     * @member Toast#options
     */
    this.options = {
      displayLength: displayLength,
      className: className,
      completeCallback: completeCallback
    };

    this.options = $.extend({}, Toast.defaults, this.options);
    this.message = message;

    /**
     * Describes current pan state toast
     * @type {Boolean}
     */
    this.panning = false;

    /**
     * Time remaining until toast is removed
     */
    this.timeRemaining = this.options.displayLength;

    if (Toast._toasts.length === 0) {
      Toast._createContainer();
    }

    // Create new toast
    Toast._toasts.push(this);
    var toastElement = this.createToast();
    toastElement.M_Toast = this;
    this.el = toastElement;
    this._animateIn();
    this.setTimer();
  }

  _createClass(Toast, [{
    key: 'createToast',

    /**
     * Create toast and append it to toast container
     */
    value: function createToast() {
      var toast = document.createElement('div');
      toast.classList.add('toast');

      // Add custom classes onto toast
      if (this.options.className) {
        var classes = this.options.className.split(' ');
        var i = void 0,
            count = void 0;
        for (i = 0, count = classes.length; i < count; i++) {
          toast.classList.add(classes[i]);
        }
      }

      // Set content
      if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
        toast.appendChild(this.message);

        // Check if it is jQuery object
      } else if (this.message instanceof jQuery) {
        $(toast).append(this.message);

        // Insert as text;
      } else {
        toast.innerHTML = this.message;
      }

      // Append toasft
      Toast._container.appendChild(toast);
      return toast;
    }

    /**
     * Animate in toast
     */

  }, {
    key: '_animateIn',
    value: function _animateIn() {
      // Animate toast in
      Vel(this.el, { top: 0, opacity: 1 }, {
        duration: 300,
        easing: 'easeOutCubic',
        queue: false
      });
    }

    /**
     * Create setInterval which automatically removes toast when timeRemaining >= 0
     * has been reached
     */

  }, {
    key: 'setTimer',
    value: function setTimer() {
      var _this3 = this;

      if (this.timeRemaining !== Infinity) {
        this.counterInterval = setInterval(function () {
          // If toast is not being dragged, decrease its time remaining
          if (!_this3.panning) {
            _this3.timeRemaining -= 20;
          }

          // Animate toast out
          if (_this3.timeRemaining <= 0) {
            _this3.remove();
          }
        }, 20);
      }
    }

    /**
     * Dismiss toast with animation
     */

  }, {
    key: 'remove',
    value: function remove() {
      var _this4 = this;

      window.clearInterval(this.counterInterval);
      var activationDistance = this.el.offsetWidth * this.options.activationPercent;

      if (this.wasSwiped) {
        this.el.style.transition = 'transform .05s, opacity .05s';
        this.el.style.transform = 'translateX(' + activationDistance + 'px)';
        this.el.style.opacity = 0;
      }

      Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
        duration: this.options.outDuration,
        easing: 'easeOutExpo',
        queue: false,
        complete: function () {
          // Call the optional callback
          if (typeof _this4.options.completeCallback === 'function') {
            _this4.options.completeCallback();
          }
          // Remove toast from DOM
          _this4.el.parentNode.removeChild(_this4.el);
          Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
          if (Toast._toasts.length === 0) {
            Toast._removeContainer();
          }
        }
      });
    }
  }], [{
    key: '_createContainer',

    /**
     * Append toast container and add event handlers
     */
    value: function _createContainer() {
      var container = document.createElement('div');
      container.setAttribute('id', 'toast-container');

      // Add event handler
      container.addEventListener('touchstart', Toast._onDragStart);
      container.addEventListener('touchmove', Toast._onDragMove);
      container.addEventListener('touchend', Toast._onDragEnd);

      container.addEventListener('mousedown', Toast._onDragStart);
      document.addEventListener('mousemove', Toast._onDragMove);
      document.addEventListener('mouseup', Toast._onDragEnd);

      document.body.appendChild(container);
      Toast._container = container;
    }

    /**
     * Remove toast container and event handlers
     */

  }, {
    key: '_removeContainer',
    value: function _removeContainer() {
      // Add event handler
      document.removeEventListener('mousemove', Toast._onDragMove);
      document.removeEventListener('mouseup', Toast._onDragEnd);

      Toast._container.parentNode.removeChild(Toast._container);
      Toast._container = null;
    }

    /**
     * Begin drag handler
     * @param {Event} e
     */

  }, {
    key: '_onDragStart',
    value: function _onDragStart(e) {
      if (e.target && $(e.target).closest('.toast').length) {
        var $toast = $(e.target).closest('.toast');
        var toast = $toast[0].M_Toast;
        toast.panning = true;
        Toast._draggedToast = toast;
        toast.el.classList.add('panning');
        toast.el.style.transition = '';
        toast.startingXPos = Toast._xPos(e);
        toast.time = Date.now();
        toast.xPos = Toast._xPos(e);
      }
    }

    /**
     * Drag move handler
     * @param {Event} e
     */

  }, {
    key: '_onDragMove',
    value: function _onDragMove(e) {
      if (!!Toast._draggedToast) {
        e.preventDefault();
        var toast = Toast._draggedToast;
        toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
        toast.xPos = Toast._xPos(e);
        toast.velocityX = toast.deltaX / (Date.now() - toast.time);
        toast.time = Date.now();

        var totalDeltaX = toast.xPos - toast.startingXPos;
        var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
        toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
        toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
      }
    }

    /**
     * End drag handler
     * @param {Event} e
     */

  }, {
    key: '_onDragEnd',
    value: function _onDragEnd(e) {
      if (!!Toast._draggedToast) {
        var toast = Toast._draggedToast;
        toast.panning = false;
        toast.el.classList.remove('panning');

        var totalDeltaX = toast.xPos - toast.startingXPos;
        var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
        var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;

        // Remove toast
        if (shouldBeDismissed) {
          toast.wasSwiped = true;
          toast.remove();

          // Animate toast back to original position
        } else {
          toast.el.style.transition = 'transform .2s, opacity .2s';
          toast.el.style.transform = '';
          toast.el.style.opacity = '';
        }
        Toast._draggedToast = null;
      }
    }

    /**
     * Get x position of mouse or touch event
     * @param {Event} e
     */

  }, {
    key: '_xPos',
    value: function _xPos(e) {
      if (e.targetTouches && e.targetTouches.length >= 1) {
        return e.targetTouches[0].clientX;
      }
      // mouse event
      return e.clientX;
    }

    /**
     * Remove all toasts
     */

  }, {
    key: 'removeAll',
    value: function removeAll() {
      for (var toastIndex in Toast._toasts) {
        Toast._toasts[toastIndex].remove();
      }
    }
  }, {
    key: 'defaults',
    get: function () {
      return _defaults;
    }
  }]);

  return Toast;
}();

/**
 * @static
 * @memberof Toast
 * @type {Array.<Toast>}
 */

Toast._toasts = [];

/**
 * @static
 * @memberof Toast
 */
Toast._container = null;

/**
 * @static
 * @memberof Toast
 * @type {Toast}
 */
Toast._draggedToast = null;

Materialize.Toast = Toast;
Materialize.toast = function (message, displayLength, className, completeCallback) {
  return new Toast(message, displayLength, className, completeCallback);
};

})(jQuery, Materialize.Vel); ;(function ($) {

var methods = {
  init: function (options) {
    var defaults = {
      menuWidth: 300,
      edge: 'left',
      closeOnClick: false,
      draggable: true,
      onOpen: null,
      onClose: null
    };
    options = $.extend(defaults, options);

    $(this).each(function () {
      var $this = $(this);
      var menuId = $this.attr('data-activates');
      var menu = $("#" + menuId);

      // Set to width
      if (options.menuWidth != 300) {
        menu.css('width', options.menuWidth);
      }

      // Add Touch Area
      var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
      if (options.draggable) {
        // Regenerate dragTarget
        if ($dragTarget.length) {
          $dragTarget.remove();
        }

        $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
        $('body').append($dragTarget);
      } else {
        $dragTarget = $();
      }

      if (options.edge == 'left') {
        menu.css('transform', 'translateX(-100%)');
        $dragTarget.css({ 'left': 0 }); // Add Touch Area
      } else {
        menu.addClass('right-aligned') // Change text-alignment to right
        .css('transform', 'translateX(100%)');
        $dragTarget.css({ 'right': 0 }); // Add Touch Area
      }

      // If fixed sidenav, bring menu out
      if (menu.hasClass('fixed')) {
        if (window.innerWidth > 992) {
          menu.css('transform', 'translateX(0)');
        }
      }

      // Window resize to reset on large screens fixed
      if (menu.hasClass('fixed')) {
        $(window).resize(function () {
          if (window.innerWidth > 992) {
            // Close menu if window is resized bigger than 992 and user has fixed sidenav
            if ($('#sidenav-overlay').length !== 0 && menuOut) {
              removeMenu(true);
            } else {
              // menu.removeAttr('style');
              menu.css('transform', 'translateX(0%)');
              // menu.css('width', options.menuWidth);
            }
          } else if (menuOut === false) {
            if (options.edge === 'left') {
              menu.css('transform', 'translateX(-100%)');
            } else {
              menu.css('transform', 'translateX(100%)');
            }
          }
        });
      }

      // if closeOnClick, then add close event for all a tags in side sideNav
      if (options.closeOnClick === true) {
        menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
          if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
            removeMenu();
          }
        });
      }

      var removeMenu = function (restoreNav) {
        panning = false;
        menuOut = false;
        // Reenable scrolling
        $('body').css({
          overflow: '',
          width: ''
        });

        $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
          queue: false, easing: 'easeOutQuad',
          complete: function () {
            $(this).remove();
          } });
        if (options.edge === 'left') {
          // Reset phantom div
          $dragTarget.css({ width: '', right: '', left: '0' });
          menu.velocity({ 'translateX': '-100%' }, { duration: 200,
            queue: false,
            easing: 'easeOutCubic',
            complete: function () {
              if (restoreNav === true) {
                // Restore Fixed sidenav
                menu.removeAttr('style');
                menu.css('width', options.menuWidth);
              }
            }

          });
        } else {
          // Reset phantom div
          $dragTarget.css({ width: '', right: '0', left: '' });
          menu.velocity({ 'translateX': '100%' }, { duration: 200,
            queue: false,
            easing: 'easeOutCubic',
            complete: function () {
              if (restoreNav === true) {
                // Restore Fixed sidenav
                menu.removeAttr('style');
                menu.css('width', options.menuWidth);
              }
            }
          });
        }

        // Callback
        if (typeof options.onClose === 'function') {
          options.onClose.call(this, menu);
        }
      };

      // Touch Event
      var panning = false;
      var menuOut = false;

      if (options.draggable) {
        $dragTarget.on('click', function () {
          if (menuOut) {
            removeMenu();
          }
        });

        $dragTarget.hammer({
          prevent_default: false
        }).on('pan', function (e) {

          if (e.gesture.pointerType == "touch") {

            var direction = e.gesture.direction;
            var x = e.gesture.center.x;
            var y = e.gesture.center.y;
            var velocityX = e.gesture.velocityX;

            // Vertical scroll bugfix
            if (x === 0 && y === 0) {
              return;
            }

            // Disable Scrolling
            var $body = $('body');
            var $overlay = $('#sidenav-overlay');
            var oldWidth = $body.innerWidth();
            $body.css('overflow', 'hidden');
            $body.width(oldWidth);

            // If overlay does not exist, create one and if it is clicked, close menu
            if ($overlay.length === 0) {
              $overlay = $('<div id="sidenav-overlay"></div>');
              $overlay.css('opacity', 0).click(function () {
                removeMenu();
              });

              // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
              if (typeof options.onOpen === 'function') {
                options.onOpen.call(this, menu);
              }

              $('body').append($overlay);
            }

            // Keep within boundaries
            if (options.edge === 'left') {
              if (x > options.menuWidth) {
                x = options.menuWidth;
              } else if (x < 0) {
                x = 0;
              }
            }

            if (options.edge === 'left') {
              // Left Direction
              if (x < options.menuWidth / 2) {
                menuOut = false;
              }
              // Right Direction
              else if (x >= options.menuWidth / 2) {
                  menuOut = true;
                }
              menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
            } else {
              // Left Direction
              if (x < window.innerWidth - options.menuWidth / 2) {
                menuOut = true;
              }
              // Right Direction
              else if (x >= window.innerWidth - options.menuWidth / 2) {
                  menuOut = false;
                }
              var rightPos = x - options.menuWidth / 2;
              if (rightPos < 0) {
                rightPos = 0;
              }

              menu.css('transform', 'translateX(' + rightPos + 'px)');
            }

            // Percentage overlay
            var overlayPerc;
            if (options.edge === 'left') {
              overlayPerc = x / options.menuWidth;
              $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
            } else {
              overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
              $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
            }
          }
        }).on('panend', function (e) {

          if (e.gesture.pointerType == "touch") {
            var $overlay = $('#sidenav-overlay');
            var velocityX = e.gesture.velocityX;
            var x = e.gesture.center.x;
            var leftPos = x - options.menuWidth;
            var rightPos = x - options.menuWidth / 2;
            if (leftPos > 0) {
              leftPos = 0;
            }
            if (rightPos < 0) {
              rightPos = 0;
            }
            panning = false;

            if (options.edge === 'left') {
              // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
              if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
                // Return menu to open
                if (leftPos !== 0) {
                  menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                }

                $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
                $dragTarget.css({ width: '50%', right: 0, left: '' });
                menuOut = true;
              } else if (!menuOut || velocityX > 0.3) {
                // Enable Scrolling
                $('body').css({
                  overflow: '',
                  width: ''
                });
                // Slide menu closed
                menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
                $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
                  complete: function () {
                    // Run 'onClose' when sidenav is closed via touch/swipe if applicable
                    if (typeof options.onClose === 'function') {
                      options.onClose.call(this, menu);
                    }

                    $(this).remove();
                  } });
                $dragTarget.css({ width: '10px', right: '', left: 0 });
              }
            } else {
              if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
                // Return menu to open
                if (rightPos !== 0) {
                  menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                }

                $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
                $dragTarget.css({ width: '50%', right: '', left: 0 });
                menuOut = true;
              } else if (!menuOut || velocityX < -0.3) {
                // Enable Scrolling
                $('body').css({
                  overflow: '',
                  width: ''
                });

                // Slide menu closed
                menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
                $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
                  complete: function () {
                    // Run 'onClose' when sidenav is closed via touch/swipe if applicable
                    if (typeof options.onClose === 'function') {
                      options.onClose.call(this, menu);
                    }

                    $(this).remove();
                  } });
                $dragTarget.css({ width: '10px', right: 0, left: '' });
              }
            }
          }
        });
      }

      $this.off('click.sidenav').on('click.sidenav', function () {
        if (menuOut === true) {
          menuOut = false;
          panning = false;
          removeMenu();
        } else {

          // Disable Scrolling
          var $body = $('body');
          var $overlay = $('<div id="sidenav-overlay"></div>');
          var oldWidth = $body.innerWidth();
          $body.css('overflow', 'hidden');
          $body.width(oldWidth);

          // Push current drag target on top of DOM tree
          $('body').append($dragTarget);

          if (options.edge === 'left') {
            $dragTarget.css({ width: '50%', right: 0, left: '' });
            menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
          } else {
            $dragTarget.css({ width: '50%', right: '', left: 0 });
            menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
          }

          // Overlay close on click
          $overlay.css('opacity', 0).click(function () {
            menuOut = false;
            panning = false;
            removeMenu();
            $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
              complete: function () {
                $(this).remove();
              }
            });
          });

          // Append body
          $('body').append($overlay);
          $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
            complete: function () {
              menuOut = true;
              panning = false;
            }
          });

          // Callback
          if (typeof options.onOpen === 'function') {
            options.onOpen.call(this, menu);
          }
        }

        return false;
      });
    });
  },
  destroy: function () {
    var $overlay = $('#sidenav-overlay');
    var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
    $overlay.trigger('click');
    $dragTarget.remove();
    $(this).off('click');
    $overlay.remove();
  },
  show: function () {
    this.trigger('click');
  },
  hide: function () {
    $('#sidenav-overlay').trigger('click');
  }
};

$.fn.sideNav = function (methodOrOptions) {
  if (methods[methodOrOptions]) {
    return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
  } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
    // Default to "init"
    return methods.init.apply(this, arguments);
  } else {
    $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
  }
}; // Plugin end

})(jQuery); ; /**

* Extend jquery with a scrollspy plugin.
* This watches the window scroll and fires events when elements are scrolled into viewport.
*
* throttle() and getTime() taken from Underscore.js
* https://github.com/jashkenas/underscore
*
* @author Copyright 2013 John Smart
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
* @see https://github.com/thesmart
* @version 0.1.2
*/

(function ($) {

var jWindow = $(window);
var elements = [];
var elementsInView = [];
var isSpying = false;
var ticks = 0;
var unique_id = 1;
var offset = {
  top: 0,
  right: 0,
  bottom: 0,
  left: 0

  /**
   * Find elements that are within the boundary
   * @param {number} top
   * @param {number} right
   * @param {number} bottom
   * @param {number} left
   * @return {jQuery}         A collection of elements
   */
};function findElements(top, right, bottom, left) {
  var hits = $();
  $.each(elements, function (i, element) {
    if (element.height() > 0) {
      var elTop = element.offset().top,
          elLeft = element.offset().left,
          elRight = elLeft + element.width(),
          elBottom = elTop + element.height();

      var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);

      if (isIntersect) {
        hits.push(element);
      }
    }
  });

  return hits;
}

/**
 * Called when the user scrolls the window
 */
function onScroll(scrollOffset) {
  // unique tick id
  ++ticks;

  // viewport rectangle
  var top = jWindow.scrollTop(),
      left = jWindow.scrollLeft(),
      right = left + jWindow.width(),
      bottom = top + jWindow.height();

  // determine which elements are in view
  var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
  $.each(intersections, function (i, element) {

    var lastTick = element.data('scrollSpy:ticks');
    if (typeof lastTick != 'number') {
      // entered into view
      element.triggerHandler('scrollSpy:enter');
    }

    // update tick id
    element.data('scrollSpy:ticks', ticks);
  });

  // determine which elements are no longer in view
  $.each(elementsInView, function (i, element) {
    var lastTick = element.data('scrollSpy:ticks');
    if (typeof lastTick == 'number' && lastTick !== ticks) {
      // exited from view
      element.triggerHandler('scrollSpy:exit');
      element.data('scrollSpy:ticks', null);
    }
  });

  // remember elements in view for next tick
  elementsInView = intersections;
}

/**
 * Called when window is resized
*/
function onWinSize() {
  jWindow.trigger('scrollSpy:winSize');
}

/**
 * Enables ScrollSpy using a selector
 * @param {jQuery|string} selector  The elements collection, or a selector
 * @param {Object=} options   Optional.
       throttle : number -> scrollspy throttling. Default: 100 ms
       offsetTop : number -> offset from top. Default: 0
       offsetRight : number -> offset from right. Default: 0
       offsetBottom : number -> offset from bottom. Default: 0
       offsetLeft : number -> offset from left. Default: 0
                      activeClass : string -> Class name to be added to the active link. Default: active
 * @returns {jQuery}
 */
$.scrollSpy = function (selector, options) {
  var defaults = {
    throttle: 100,
    scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
    activeClass: 'active',
    getActiveElement: function (id) {
      return 'a[href="#' + id + '"]';
    }
  };
  options = $.extend(defaults, options);

  var visible = [];
  selector = $(selector);
  selector.each(function (i, element) {
    elements.push($(element));
    $(element).data("scrollSpy:id", i);
    // Smooth scroll to section
    $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
      e.preventDefault();
      var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
      $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
    });
  });

  offset.top = options.offsetTop || 0;
  offset.right = options.offsetRight || 0;
  offset.bottom = options.offsetBottom || 0;
  offset.left = options.offsetLeft || 0;

  var throttledScroll = Materialize.throttle(function () {
    onScroll(options.scrollOffset);
  }, options.throttle || 100);
  var readyScroll = function () {
    $(document).ready(throttledScroll);
  };

  if (!isSpying) {
    jWindow.on('scroll', readyScroll);
    jWindow.on('resize', readyScroll);
    isSpying = true;
  }

  // perform a scan once, after current execution context, and after dom is ready
  setTimeout(readyScroll, 0);

  selector.on('scrollSpy:enter', function () {
    visible = $.grep(visible, function (value) {
      return value.height() != 0;
    });

    var $this = $(this);

    if (visible[0]) {
      $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
      if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
        visible.unshift($(this));
      } else {
        visible.push($(this));
      }
    } else {
      visible.push($(this));
    }

    $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
  });
  selector.on('scrollSpy:exit', function () {
    visible = $.grep(visible, function (value) {
      return value.height() != 0;
    });

    if (visible[0]) {
      $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
      var $this = $(this);
      visible = $.grep(visible, function (value) {
        return value.attr('id') != $this.attr('id');
      });
      if (visible[0]) {
        // Check if empty
        $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
      }
    }
  });

  return selector;
};

/**
 * Listen for window resize events
 * @param {Object=} options                                           Optional. Set { throttle: number } to change throttling. Default: 100 ms
 * @returns {jQuery}          $(window)
 */
$.winSizeSpy = function (options) {
  $.winSizeSpy = function () {
    return jWindow;
  }; // lock from multiple calls
  options = options || {
    throttle: 100
  };
  return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
};

/**
 * Enables ScrollSpy on a collection of elements
 * e.g. $('.scrollSpy').scrollSpy()
 * @param {Object=} options   Optional.
                                                                              throttle : number -> scrollspy throttling. Default: 100 ms
                                                                              offsetTop : number -> offset from top. Default: 0
                                                                              offsetRight : number -> offset from right. Default: 0
                                                                              offsetBottom : number -> offset from bottom. Default: 0
                                                                              offsetLeft : number -> offset from left. Default: 0
 * @returns {jQuery}
 */
$.fn.scrollSpy = function (options) {
  return $.scrollSpy($(this), options);
};

})(jQuery); ;(function ($) {

$(document).ready(function () {

  // Function to update labels of text fields
  Materialize.updateTextFields = function () {
    var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
    $(input_selector).each(function (index, element) {
      var $this = $(this);
      if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
        $this.siblings('label').addClass('active');
      } else if ($(element)[0].validity) {
        $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
      } else {
        $this.siblings('label').removeClass('active');
      }
    });
  };

  // Text based inputs
  var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';

  // Add active if form auto complete
  $(document).on('change', input_selector, function () {
    if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
      $(this).siblings('label').addClass('active');
    }
    validate_field($(this));
  });

  // Add active if input element has been pre-populated on document ready
  $(document).ready(function () {
    Materialize.updateTextFields();
  });

  // HTML DOM FORM RESET handling
  $(document).on('reset', function (e) {
    var formReset = $(e.target);
    if (formReset.is('form')) {
      formReset.find(input_selector).removeClass('valid').removeClass('invalid');
      formReset.find(input_selector).each(function () {
        if ($(this).attr('value') === '') {
          $(this).siblings('label').removeClass('active');
        }
      });

      // Reset select
      formReset.find('select.initialized').each(function () {
        var reset_text = formReset.find('option[selected]').text();
        formReset.siblings('input.select-dropdown').val(reset_text);
      });
    }
  });

  // Add active when element has focus
  $(document).on('focus', input_selector, function () {
    $(this).siblings('label, .prefix').addClass('active');
  });

  $(document).on('blur', input_selector, function () {
    var $inputElement = $(this);
    var selector = ".prefix";

    if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
      selector += ", label";
    }

    $inputElement.siblings(selector).removeClass('active');

    validate_field($inputElement);
  });

  window.validate_field = function (object) {
    var hasLength = object.attr('data-length') !== undefined;
    var lenAttr = parseInt(object.attr('data-length'));
    var len = object.val().length;

    if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
      if (object.hasClass('validate')) {
        object.removeClass('valid');
        object.removeClass('invalid');
      }
    } else {
      if (object.hasClass('validate')) {
        // Check for character counter attributes
        if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
          object.removeClass('invalid');
          object.addClass('valid');
        } else {
          object.removeClass('valid');
          object.addClass('invalid');
        }
      }
    }
  };

  // Radio and Checkbox focus class
  var radio_checkbox = 'input[type=radio], input[type=checkbox]';
  $(document).on('keyup.radio', radio_checkbox, function (e) {
    // TAB, check if tabbing to radio or checkbox.
    if (e.which === 9) {
      $(this).addClass('tabbed');
      var $this = $(this);
      $this.one('blur', function (e) {

        $(this).removeClass('tabbed');
      });
      return;
    }
  });

  // Textarea Auto Resize
  var hiddenDiv = $('.hiddendiv').first();
  if (!hiddenDiv.length) {
    hiddenDiv = $('<div class="hiddendiv common"></div>');
    $('body').append(hiddenDiv);
  }
  var text_area_selector = '.materialize-textarea';

  function textareaAutoResize($textarea) {
    // Set font properties of hiddenDiv

    var fontFamily = $textarea.css('font-family');
    var fontSize = $textarea.css('font-size');
    var lineHeight = $textarea.css('line-height');
    var padding = $textarea.css('padding');

    if (fontSize) {
      hiddenDiv.css('font-size', fontSize);
    }
    if (fontFamily) {
      hiddenDiv.css('font-family', fontFamily);
    }
    if (lineHeight) {
      hiddenDiv.css('line-height', lineHeight);
    }
    if (padding) {
      hiddenDiv.css('padding', padding);
    }

    // Set original-height, if none
    if (!$textarea.data('original-height')) {
      $textarea.data('original-height', $textarea.height());
    }

    if ($textarea.attr('wrap') === 'off') {
      hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
    }

    hiddenDiv.text($textarea.val() + '\n');
    var content = hiddenDiv.html().replace(/\n/g, '<br>');
    hiddenDiv.html(content);

    // When textarea is hidden, width goes crazy.
    // Approximate with half of window size

    if ($textarea.is(':visible')) {
      hiddenDiv.css('width', $textarea.width());
    } else {
      hiddenDiv.css('width', $(window).width() / 2);
    }

    /**
     * Resize if the new height is greater than the
     * original height of the textarea
     */
    if ($textarea.data('original-height') <= hiddenDiv.height()) {
      $textarea.css('height', hiddenDiv.height());
    } else if ($textarea.val().length < $textarea.data('previous-length')) {
      /**
       * In case the new height is less than original height, it
       * means the textarea has less text than before
       * So we set the height to the original one
       */
      $textarea.css('height', $textarea.data('original-height'));
    }
    $textarea.data('previous-length', $textarea.val().length);
  }

  $(text_area_selector).each(function () {
    var $textarea = $(this);
    /**
     * Instead of resizing textarea on document load,
     * store the original height and the original length
     */
    $textarea.data('original-height', $textarea.height());
    $textarea.data('previous-length', $textarea.val().length);
  });

  $('body').on('keyup keydown autoresize', text_area_selector, function () {
    textareaAutoResize($(this));
  });

  // File Input Path
  $(document).on('change', '.file-field input[type="file"]', function () {
    var file_field = $(this).closest('.file-field');
    var path_input = file_field.find('input.file-path');
    var files = $(this)[0].files;
    var file_names = [];
    for (var i = 0; i < files.length; i++) {
      file_names.push(files[i].name);
    }
    path_input.val(file_names.join(", "));
    path_input.trigger('change');
  });

  /****************
  *  Range Input  *
  ****************/

  var range_type = 'input[type=range]';
  var range_mousedown = false;
  var left;

  $(range_type).each(function () {
    var thumb = $('<span class="thumb"><span class="value"></span></span>');
    $(this).after(thumb);
  });

  var showRangeBubble = function (thumb) {
    var paddingLeft = parseInt(thumb.parent().css('padding-left'));
    var marginLeft = -7 + paddingLeft + 'px';
    thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
  };

  var calcRangeOffset = function (range) {
    var width = range.width() - 15;
    var max = parseFloat(range.attr('max'));
    var min = parseFloat(range.attr('min'));
    var percent = (parseFloat(range.val()) - min) / (max - min);
    return percent * width;
  };

  var range_wrapper = '.range-field';
  $(document).on('change', range_type, function (e) {
    var thumb = $(this).siblings('.thumb');
    thumb.find('.value').html($(this).val());

    if (!thumb.hasClass('active')) {
      showRangeBubble(thumb);
    }

    var offsetLeft = calcRangeOffset($(this));
    thumb.addClass('active').css('left', offsetLeft);
  });

  $(document).on('mousedown touchstart', range_type, function (e) {
    var thumb = $(this).siblings('.thumb');

    // If thumb indicator does not exist yet, create it
    if (thumb.length <= 0) {
      thumb = $('<span class="thumb"><span class="value"></span></span>');
      $(this).after(thumb);
    }

    // Set indicator value
    thumb.find('.value').html($(this).val());

    range_mousedown = true;
    $(this).addClass('active');

    if (!thumb.hasClass('active')) {
      showRangeBubble(thumb);
    }

    if (e.type !== 'input') {
      var offsetLeft = calcRangeOffset($(this));
      thumb.addClass('active').css('left', offsetLeft);
    }
  });

  $(document).on('mouseup touchend', range_wrapper, function () {
    range_mousedown = false;
    $(this).removeClass('active');
  });

  $(document).on('input mousemove touchmove', range_wrapper, function (e) {
    var thumb = $(this).children('.thumb');
    var left;
    var input = $(this).find(range_type);

    if (range_mousedown) {
      if (!thumb.hasClass('active')) {
        showRangeBubble(thumb);
      }

      var offsetLeft = calcRangeOffset(input);
      thumb.addClass('active').css('left', offsetLeft);
      thumb.find('.value').html(thumb.siblings(range_type).val());
    }
  });

  $(document).on('mouseout touchleave', range_wrapper, function () {
    if (!range_mousedown) {

      var thumb = $(this).children('.thumb');
      var paddingLeft = parseInt($(this).css('padding-left'));
      var marginLeft = 7 + paddingLeft + 'px';

      if (thumb.hasClass('active')) {
        thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
      }
      thumb.removeClass('active');
    }
  });

  /**************************
   * Auto complete plugin  *
   *************************/
  $.fn.autocomplete = function (options) {
    // Defaults
    var defaults = {
      data: {},
      limit: Infinity,
      onAutocomplete: null,
      minLength: 1
    };

    options = $.extend(defaults, options);

    return this.each(function () {
      var $input = $(this);
      var data = options.data,
          count = 0,
          activeIndex = -1,
          oldVal,
          $inputDiv = $input.closest('.input-field'); // Div to append on

      // Check if data isn't empty
      if (!$.isEmptyObject(data)) {
        var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
        var $oldAutocomplete;

        // Append autocomplete element.
        // Prevent double structure init.
        if ($inputDiv.length) {
          $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
          if (!$oldAutocomplete.length) {
            $inputDiv.append($autocomplete); // Set ul in body
          }
        } else {
          $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
          if (!$oldAutocomplete.length) {
            $input.after($autocomplete);
          }
        }
        if ($oldAutocomplete.length) {
          $autocomplete = $oldAutocomplete;
        }

        // Highlight partial match.
        var highlight = function (string, $el) {
          var img = $el.find('img');
          var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
              matchEnd = matchStart + string.length - 1,
              beforeMatch = $el.text().slice(0, matchStart),
              matchText = $el.text().slice(matchStart, matchEnd + 1),
              afterMatch = $el.text().slice(matchEnd + 1);
          $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
          if (img.length) {
            $el.prepend(img);
          }
        };

        // Reset current element position
        var resetCurrentElement = function () {
          activeIndex = -1;
          $autocomplete.find('.active').removeClass('active');
        };

        // Remove autocomplete elements
        var removeAutocomplete = function () {
          $autocomplete.empty();
          resetCurrentElement();
          oldVal = undefined;
        };

        $input.off('blur.autocomplete').on('blur.autocomplete', function () {
          removeAutocomplete();
        });

        // Perform search
        $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
          // Reset count.
          count = 0;
          var val = $input.val().toLowerCase();

          // Don't capture enter or arrow key usage.
          if (e.which === 13 || e.which === 38 || e.which === 40) {
            return;
          }

          // Check if the input isn't empty
          if (oldVal !== val) {
            removeAutocomplete();

            if (val.length >= options.minLength) {
              for (var key in data) {
                if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
                  // Break if past limit
                  if (count >= options.limit) {
                    break;
                  }

                  var autocompleteOption = $('<li></li>');
                  if (!!data[key]) {
                    autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
                  } else {
                    autocompleteOption.append('<span>' + key + '</span>');
                  }

                  $autocomplete.append(autocompleteOption);
                  highlight(val, autocompleteOption);
                  count++;
                }
              }
            }
          }

          // Update oldVal
          oldVal = val;
        });

        $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
          // Arrow keys and enter key usage
          var keyCode = e.which,
              liElement,
              numItems = $autocomplete.children('li').length,
              $active = $autocomplete.children('.active').first();

          // select element on Enter
          if (keyCode === 13 && activeIndex >= 0) {
            liElement = $autocomplete.children('li').eq(activeIndex);
            if (liElement.length) {
              liElement.trigger('mousedown.autocomplete');
              e.preventDefault();
            }
            return;
          }

          // Capture up and down key
          if (keyCode === 38 || keyCode === 40) {
            e.preventDefault();

            if (keyCode === 38 && activeIndex > 0) {
              activeIndex--;
            }

            if (keyCode === 40 && activeIndex < numItems - 1) {
              activeIndex++;
            }

            $active.removeClass('active');
            if (activeIndex >= 0) {
              $autocomplete.children('li').eq(activeIndex).addClass('active');
            }
          }
        });

        // Set input value
        $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
          var text = $(this).text().trim();
          $input.val(text);
          $input.trigger('change');
          removeAutocomplete();

          // Handle onAutocomplete callback.
          if (typeof options.onAutocomplete === "function") {
            options.onAutocomplete.call(this, text);
          }
        });

        // Empty data
      } else {
        $input.off('keyup.autocomplete focus.autocomplete');
      }
    });
  };
}); // End of $(document).ready

/*******************
 *  Select Plugin  *
 ******************/
$.fn.material_select = function (callback) {
  $(this).each(function () {
    var $select = $(this);

    if ($select.hasClass('browser-default')) {
      return; // Continue to next (return false breaks out of entire loop)
    }

    var multiple = $select.attr('multiple') ? true : false,
        lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt

    if (lastID) {
      $select.parent().find('span.caret').remove();
      $select.parent().find('input').remove();

      $select.unwrap();
      $('ul#select-options-' + lastID).remove();
    }

    // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
    if (callback === 'destroy') {
      $select.removeAttr('data-select-id').removeClass('initialized');
      $(window).off('click.select');
      return;
    }

    var uniqueID = Materialize.guid();
    $select.attr('data-select-id', uniqueID);
    var wrapper = $('<div class="select-wrapper"></div>');
    wrapper.addClass($select.attr('class'));
    if ($select.is(':disabled')) wrapper.addClass('disabled');
    var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
        selectChildren = $select.children('option, optgroup'),
        valuesSelected = [],
        optionsHover = false;

    var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";

    // Function that renders and appends the option taking into
    // account type and possible image icon.
    var appendOptionWithIcon = function (select, option, type) {
      // Add disabled attr if disabled
      var disabledClass = option.is(':disabled') ? 'disabled ' : '';
      var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
      var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';

      // add icons
      var icon_url = option.data('icon');
      var classes = option.attr('class');
      if (!!icon_url) {
        var classString = '';
        if (!!classes) classString = ' class="' + classes + '"';

        // Check for multiple type.
        options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
        return true;
      }

      // Check for multiple type.
      options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
    };

    /* Create dropdown structure. */
    if (selectChildren.length) {
      selectChildren.each(function () {
        if ($(this).is('option')) {
          // Direct descendant option.
          if (multiple) {
            appendOptionWithIcon($select, $(this), 'multiple');
          } else {
            appendOptionWithIcon($select, $(this));
          }
        } else if ($(this).is('optgroup')) {
          // Optgroup.
          var selectOptions = $(this).children('option');
          options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));

          selectOptions.each(function () {
            appendOptionWithIcon($select, $(this), 'optgroup-option');
          });
        }
      });
    }

    options.find('li:not(.optgroup)').each(function (i) {
      $(this).click(function (e) {
        // Check if option element is disabled
        if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
          var selected = true;

          if (multiple) {
            $('input[type="checkbox"]', this).prop('checked', function (i, v) {
              return !v;
            });
            selected = toggleEntryFromArray(valuesSelected, i, $select);
            $newSelect.trigger('focus');
          } else {
            options.find('li').removeClass('active');
            $(this).toggleClass('active');
            $newSelect.val($(this).text());
          }

          activateOption(options, $(this));
          $select.find('option').eq(i).prop('selected', selected);
          // Trigger onchange() event
          $select.trigger('change');
          if (typeof callback !== 'undefined') callback();
        }

        e.stopPropagation();
      });
    });

    // Wrap Elements
    $select.wrap(wrapper);
    // Add Select Display Element
    var dropdownIcon = $('<span class="caret">&#9660;</span>');

    // escape double quotes
    var sanitizedLabelHtml = label.replace(/"/g, '&quot;');

    var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
    $select.before($newSelect);
    $newSelect.before(dropdownIcon);

    $newSelect.after(options);
    // Check if section element is disabled
    if (!$select.is(':disabled')) {
      $newSelect.dropdown({ 'hover': false });
    }

    // Copy tabindex
    if ($select.attr('tabindex')) {
      $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
    }

    $select.addClass('initialized');

    $newSelect.on({
      'focus': function () {
        if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
          $('input.select-dropdown').trigger('close');
          $(window).off('click.select');
        }
        if (!options.is(':visible')) {
          $(this).trigger('open', ['focus']);
          var label = $(this).val();
          if (multiple && label.indexOf(',') >= 0) {
            label = label.split(',')[0];
          }

          var selectedOption = options.find('li').filter(function () {
            return $(this).text().toLowerCase() === label.toLowerCase();
          })[0];
          activateOption(options, selectedOption, true);

          $(window).off('click.select').on('click.select', function () {
            multiple && (optionsHover || $newSelect.trigger('close'));
            $(window).off('click.select');
          });
        }
      },
      'click': function (e) {
        e.stopPropagation();
      }
    });

    $newSelect.on('blur', function () {
      if (!multiple) {
        $(this).trigger('close');
        $(window).off('click.select');
      }
      options.find('li.selected').removeClass('selected');
    });

    options.hover(function () {
      optionsHover = true;
    }, function () {
      optionsHover = false;
    });

    // Add initial multiple selections.
    if (multiple) {
      $select.find("option:selected:not(:disabled)").each(function () {
        var index = this.index;

        toggleEntryFromArray(valuesSelected, index, $select);
        options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
      });
    }

    /**
     * Make option as selected and scroll to selected position
     * @param {jQuery} collection  Select options jQuery element
     * @param {Element} newOption  element of the new option
     * @param {Boolean} firstActivation  If on first activation of select
     */
    var activateOption = function (collection, newOption, firstActivation) {
      if (newOption) {
        collection.find('li.selected').removeClass('selected');
        var option = $(newOption);
        option.addClass('selected');
        if (!multiple || !!firstActivation) {
          options.scrollTo(option);
        }
      }
    };

    // Allow user to search by typing
    // this array is cleared after 1 second
    var filterQuery = [],
        onKeyDown = function (e) {
      // TAB - switch to another input
      if (e.which == 9) {
        $newSelect.trigger('close');
        return;
      }

      // ARROW DOWN WHEN SELECT IS CLOSED - open select options
      if (e.which == 40 && !options.is(':visible')) {
        $newSelect.trigger('open');
        return;
      }

      // ENTER WHEN SELECT IS CLOSED - submit form
      if (e.which == 13 && !options.is(':visible')) {
        return;
      }

      e.preventDefault();

      // CASE WHEN USER TYPE LETTERS
      var letter = String.fromCharCode(e.which).toLowerCase(),
          nonLetters = [9, 13, 27, 38, 40];
      if (letter && nonLetters.indexOf(e.which) === -1) {
        filterQuery.push(letter);

        var string = filterQuery.join(''),
            newOption = options.find('li').filter(function () {
          return $(this).text().toLowerCase().indexOf(string) === 0;
        })[0];

        if (newOption) {
          activateOption(options, newOption);
        }
      }

      // ENTER - select option and close when select options are opened
      if (e.which == 13) {
        var activeOption = options.find('li.selected:not(.disabled)')[0];
        if (activeOption) {
          $(activeOption).trigger('click');
          if (!multiple) {
            $newSelect.trigger('close');
          }
        }
      }

      // ARROW DOWN - move to next not disabled option
      if (e.which == 40) {
        if (options.find('li.selected').length) {
          newOption = options.find('li.selected').next('li:not(.disabled)')[0];
        } else {
          newOption = options.find('li:not(.disabled)')[0];
        }
        activateOption(options, newOption);
      }

      // ESC - close options
      if (e.which == 27) {
        $newSelect.trigger('close');
      }

      // ARROW UP - move to previous not disabled option
      if (e.which == 38) {
        newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
        if (newOption) activateOption(options, newOption);
      }

      // Automaticaly clean filter query so user can search again by starting letters
      setTimeout(function () {
        filterQuery = [];
      }, 1000);
    };

    $newSelect.on('keydown', onKeyDown);
  });

  function toggleEntryFromArray(entriesArray, entryIndex, select) {
    var index = entriesArray.indexOf(entryIndex),
        notAdded = index === -1;

    if (notAdded) {
      entriesArray.push(entryIndex);
    } else {
      entriesArray.splice(index, 1);
    }

    select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');

    // use notAdded instead of true (to detect if the option is selected or not)
    select.find('option').eq(entryIndex).prop('selected', notAdded);
    setValueToInput(entriesArray, select);

    return notAdded;
  }

  function setValueToInput(entriesArray, select) {
    var value = '';

    for (var i = 0, count = entriesArray.length; i < count; i++) {
      var text = select.find('option').eq(entriesArray[i]).text();

      i === 0 ? value += text : value += ', ' + text;
    }

    if (value === '') {
      value = select.find('option:disabled').eq(0).text();
    }

    select.siblings('input.select-dropdown').val(value);
  }
};

})(jQuery); ;(function ($) {

var methods = {

  init: function (options) {
    var defaults = {
      indicators: true,
      height: 400,
      transition: 500,
      interval: 6000
    };
    options = $.extend(defaults, options);

    return this.each(function () {

      // For each slider, we want to keep track of
      // which slide is active and its associated content
      var $this = $(this);
      var $slider = $this.find('ul.slides').first();
      var $slides = $slider.find('> li');
      var $active_index = $slider.find('.active').index();
      var $active, $indicators, $interval;
      if ($active_index != -1) {
        $active = $slides.eq($active_index);
      }

      // Transitions the caption depending on alignment
      function captionTransition(caption, duration) {
        if (caption.hasClass("center-align")) {
          caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
        } else if (caption.hasClass("right-align")) {
          caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
        } else if (caption.hasClass("left-align")) {
          caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
        }
      }

      // This function will transition the slide to any index of the next slide
      function moveToSlide(index) {
        // Wrap around indices.
        if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;

        $active_index = $slider.find('.active').index();

        // Only do if index changes
        if ($active_index != index) {
          $active = $slides.eq($active_index);
          $caption = $active.find('.caption');

          $active.removeClass('active');
          $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
            complete: function () {
              $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
            } });
          captionTransition($caption, options.transition);

          // Update indicators
          if (options.indicators) {
            $indicators.eq($active_index).removeClass('active');
          }

          $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
          $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
          $slides.eq(index).addClass('active');

          // Update indicators
          if (options.indicators) {
            $indicators.eq(index).addClass('active');
          }
        }
      }

      // Set height of slider
      // If fullscreen, do nothing
      if (!$this.hasClass('fullscreen')) {
        if (options.indicators) {
          // Add height if indicators are present
          $this.height(options.height + 40);
        } else {
          $this.height(options.height);
        }
        $slider.height(options.height);
      }

      // Set initial positions of captions
      $slides.find('.caption').each(function () {
        captionTransition($(this), 0);
      });

      // Move img src into background-image
      $slides.find('img').each(function () {
        var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
        if ($(this).attr('src') !== placeholderBase64) {
          $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
          $(this).attr('src', placeholderBase64);
        }
      });

      // dynamically add indicators
      if (options.indicators) {
        $indicators = $('<ul class="indicators"></ul>');
        $slides.each(function (index) {
          var $indicator = $('<li class="indicator-item"></li>');

          // Handle clicks on indicators
          $indicator.click(function () {
            var $parent = $slider.parent();
            var curr_index = $parent.find($(this)).index();
            moveToSlide(curr_index);

            // reset interval
            clearInterval($interval);
            $interval = setInterval(function () {
              $active_index = $slider.find('.active').index();
              if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
              else $active_index += 1;

              moveToSlide($active_index);
            }, options.transition + options.interval);
          });
          $indicators.append($indicator);
        });
        $this.append($indicators);
        $indicators = $this.find('ul.indicators').find('li.indicator-item');
      }

      if ($active) {
        $active.show();
      } else {
        $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });

        $active_index = 0;
        $active = $slides.eq($active_index);

        // Update indicators
        if (options.indicators) {
          $indicators.eq($active_index).addClass('active');
        }
      }

      // Adjust height to current slide
      $active.find('img').each(function () {
        $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
      });

      // auto scroll
      $interval = setInterval(function () {
        $active_index = $slider.find('.active').index();
        moveToSlide($active_index + 1);
      }, options.transition + options.interval);

      // HammerJS, Swipe navigation

      // Touch Event
      var panning = false;
      var swipeLeft = false;
      var swipeRight = false;

      $this.hammer({
        prevent_default: false
      }).on('pan', function (e) {
        if (e.gesture.pointerType === "touch") {

          // reset interval
          clearInterval($interval);

          var direction = e.gesture.direction;
          var x = e.gesture.deltaX;
          var velocityX = e.gesture.velocityX;
          var velocityY = e.gesture.velocityY;

          $curr_slide = $slider.find('.active');
          if (Math.abs(velocityX) > Math.abs(velocityY)) {
            $curr_slide.velocity({ translateX: x
            }, { duration: 50, queue: false, easing: 'easeOutQuad' });
          }

          // Swipe Left
          if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
            swipeRight = true;
          }
          // Swipe Right
          else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
              swipeLeft = true;
            }

          // Make Slide Behind active slide visible
          var next_slide;
          if (swipeLeft) {
            next_slide = $curr_slide.next();
            if (next_slide.length === 0) {
              next_slide = $slides.first();
            }
            next_slide.velocity({ opacity: 1
            }, { duration: 300, queue: false, easing: 'easeOutQuad' });
          }
          if (swipeRight) {
            next_slide = $curr_slide.prev();
            if (next_slide.length === 0) {
              next_slide = $slides.last();
            }
            next_slide.velocity({ opacity: 1
            }, { duration: 300, queue: false, easing: 'easeOutQuad' });
          }
        }
      }).on('panend', function (e) {
        if (e.gesture.pointerType === "touch") {

          $curr_slide = $slider.find('.active');
          panning = false;
          curr_index = $slider.find('.active').index();

          if (!swipeRight && !swipeLeft || $slides.length <= 1) {
            // Return to original spot
            $curr_slide.velocity({ translateX: 0
            }, { duration: 300, queue: false, easing: 'easeOutQuad' });
          } else if (swipeLeft) {
            moveToSlide(curr_index + 1);
            $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
              complete: function () {
                $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
              } });
          } else if (swipeRight) {
            moveToSlide(curr_index - 1);
            $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
              complete: function () {
                $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
              } });
          }
          swipeLeft = false;
          swipeRight = false;

          // Restart interval
          clearInterval($interval);
          $interval = setInterval(function () {
            $active_index = $slider.find('.active').index();
            if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
            else $active_index += 1;

            moveToSlide($active_index);
          }, options.transition + options.interval);
        }
      });

      $this.on('sliderPause', function () {
        clearInterval($interval);
      });

      $this.on('sliderStart', function () {
        clearInterval($interval);
        $interval = setInterval(function () {
          $active_index = $slider.find('.active').index();
          if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
          else $active_index += 1;

          moveToSlide($active_index);
        }, options.transition + options.interval);
      });

      $this.on('sliderNext', function () {
        $active_index = $slider.find('.active').index();
        moveToSlide($active_index + 1);
      });

      $this.on('sliderPrev', function () {
        $active_index = $slider.find('.active').index();
        moveToSlide($active_index - 1);
      });
    });
  },
  pause: function () {
    $(this).trigger('sliderPause');
  },
  start: function () {
    $(this).trigger('sliderStart');
  },
  next: function () {
    $(this).trigger('sliderNext');
  },
  prev: function () {
    $(this).trigger('sliderPrev');
  }
};

$.fn.slider = function (methodOrOptions) {
  if (methods[methodOrOptions]) {
    return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
  } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
    // Default to "init"
    return methods.init.apply(this, arguments);
  } else {
    $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
  }
}; // Plugin end

})(jQuery); ;(function ($) {

$(document).ready(function () {

  $(document).on('click.card', '.card', function (e) {
    if ($(this).find('> .card-reveal').length) {
      var $card = $(e.target).closest('.card');
      if ($card.data('initialOverflow') === undefined) {
        $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
      }
      if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
        // Make Reveal animate down and display none
        $(this).find('.card-reveal').velocity({ translateY: 0 }, {
          duration: 225,
          queue: false,
          easing: 'easeInOutQuad',
          complete: function () {
            $(this).css({ display: 'none' });
            $card.css('overflow', $card.data('initialOverflow'));
          }
        });
      } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
        $card.css('overflow', 'hidden');
        $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
      }
    }
  });
});

})(jQuery); ;(function ($) {

var materialChipsDefaults = {
  data: [],
  placeholder: '',
  secondaryPlaceholder: '',
  autocompleteOptions: {}
};

$(document).ready(function () {
  // Handle removal of static chips.
  $(document).on('click', '.chip .close', function (e) {
    var $chips = $(this).closest('.chips');
    if ($chips.attr('data-initialized')) {
      return;
    }
    $(this).closest('.chip').remove();
  });
});

$.fn.material_chip = function (options) {
  var self = this;
  this.$el = $(this);
  this.$document = $(document);
  this.SELS = {
    CHIPS: '.chips',
    CHIP: '.chip',
    INPUT: 'input',
    DELETE: '.material-icons',
    SELECTED_CHIP: '.selected'
  };

  if ('data' === options) {
    return this.$el.data('chips');
  }

  var curr_options = $.extend({}, materialChipsDefaults, options);
  self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);

  // Initialize
  this.init = function () {
    var i = 0;
    var chips;
    self.$el.each(function () {
      var $chips = $(this);
      var chipId = Materialize.guid();
      self.chipId = chipId;

      if (!curr_options.data || !(curr_options.data instanceof Array)) {
        curr_options.data = [];
      }
      $chips.data('chips', curr_options.data);
      $chips.attr('data-index', i);
      $chips.attr('data-initialized', true);

      if (!$chips.hasClass(self.SELS.CHIPS)) {
        $chips.addClass('chips');
      }

      self.chips($chips, chipId);
      i++;
    });
  };

  this.handleEvents = function () {
    var SELS = self.SELS;

    self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
      $(e.target).find(SELS.INPUT).focus();
    });

    self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
      var $chip = $(e.target);
      if ($chip.length) {
        var wasSelected = $chip.hasClass('selected');
        var $chips = $chip.closest(SELS.CHIPS);
        $(SELS.CHIP).removeClass('selected');

        if (!wasSelected) {
          self.selectChip($chip.index(), $chips);
        }
      }
    });

    self.$document.off('keydown.chips').on('keydown.chips', function (e) {
      if ($(e.target).is('input, textarea')) {
        return;
      }

      // delete
      var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
      var $chips = $chip.closest(SELS.CHIPS);
      var length = $chip.siblings(SELS.CHIP).length;
      var index;

      if (!$chip.length) {
        return;
      }

      if (e.which === 8 || e.which === 46) {
        e.preventDefault();

        index = $chip.index();
        self.deleteChip(index, $chips);

        var selectIndex = null;
        if (index + 1 < length) {
          selectIndex = index;
        } else if (index === length || index + 1 === length) {
          selectIndex = length - 1;
        }

        if (selectIndex < 0) selectIndex = null;

        if (null !== selectIndex) {
          self.selectChip(selectIndex, $chips);
        }
        if (!length) $chips.find('input').focus();

        // left
      } else if (e.which === 37) {
        index = $chip.index() - 1;
        if (index < 0) {
          return;
        }
        $(SELS.CHIP).removeClass('selected');
        self.selectChip(index, $chips);

        // right
      } else if (e.which === 39) {
        index = $chip.index() + 1;
        $(SELS.CHIP).removeClass('selected');
        if (index > length) {
          $chips.find('input').focus();
          return;
        }
        self.selectChip(index, $chips);
      }
    });

    self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
      var $currChips = $(e.target).closest(SELS.CHIPS);
      $currChips.addClass('focus');
      $currChips.siblings('label, .prefix').addClass('active');
      $(SELS.CHIP).removeClass('selected');
    });

    self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
      var $currChips = $(e.target).closest(SELS.CHIPS);
      $currChips.removeClass('focus');

      // Remove active if empty
      if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
        $currChips.siblings('label').removeClass('active');
      }
      $currChips.siblings('.prefix').removeClass('active');
    });

    self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
      var $target = $(e.target);
      var $chips = $target.closest(SELS.CHIPS);
      var chipsLength = $chips.children(SELS.CHIP).length;

      // enter
      if (13 === e.which) {
        // Override enter if autocompleting.
        if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
          return;
        }

        e.preventDefault();
        self.addChip({ tag: $target.val() }, $chips);
        $target.val('');
        return;
      }

      // delete or left
      if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
        e.preventDefault();
        self.selectChip(chipsLength - 1, $chips);
        $target.blur();
        return;
      }
    });

    // Click on delete icon in chip.
    self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
      var $target = $(e.target);
      var $chips = $target.closest(SELS.CHIPS);
      var $chip = $target.closest(SELS.CHIP);
      e.stopPropagation();
      self.deleteChip($chip.index(), $chips);
      $chips.find('input').focus();
    });
  };

  this.chips = function ($chips, chipId) {
    $chips.empty();
    $chips.data('chips').forEach(function (elem) {
      $chips.append(self.renderChip(elem));
    });
    $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
    self.setPlaceholder($chips);

    // Set for attribute for label
    var label = $chips.next('label');
    if (label.length) {
      label.attr('for', chipId);

      if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
        label.addClass('active');
      }
    }

    // Setup autocomplete if needed.
    var input = $('#' + chipId);
    if (self.hasAutocomplete) {
      curr_options.autocompleteOptions.onAutocomplete = function (val) {
        self.addChip({ tag: val }, $chips);
        input.val('');
        input.focus();
      };
      input.autocomplete(curr_options.autocompleteOptions);
    }
  };

  /**
   * Render chip jQuery element.
   * @param {Object} elem
   * @return {jQuery}
   */
  this.renderChip = function (elem) {
    if (!elem.tag) return;

    var $renderedChip = $('<div class="chip"></div>');
    $renderedChip.text(elem.tag);
    if (elem.image) {
      $renderedChip.prepend($('<img />').attr('src', elem.image));
    }
    $renderedChip.append($('<i class="material-icons close">close</i>'));
    return $renderedChip;
  };

  this.setPlaceholder = function ($chips) {
    if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
      $chips.find('input').prop('placeholder', curr_options.placeholder);
    } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
      $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
    }
  };

  this.isValid = function ($chips, elem) {
    var chips = $chips.data('chips');
    var exists = false;
    for (var i = 0; i < chips.length; i++) {
      if (chips[i].tag === elem.tag) {
        exists = true;
        return;
      }
    }
    return '' !== elem.tag && !exists;
  };

  this.addChip = function (elem, $chips) {
    if (!self.isValid($chips, elem)) {
      return;
    }
    var $renderedChip = self.renderChip(elem);
    var newData = [];
    var oldData = $chips.data('chips');
    for (var i = 0; i < oldData.length; i++) {
      newData.push(oldData[i]);
    }
    newData.push(elem);

    $chips.data('chips', newData);
    $renderedChip.insertBefore($chips.find('input'));
    $chips.trigger('chip.add', elem);
    self.setPlaceholder($chips);
  };

  this.deleteChip = function (chipIndex, $chips) {
    var chip = $chips.data('chips')[chipIndex];
    $chips.find('.chip').eq(chipIndex).remove();

    var newData = [];
    var oldData = $chips.data('chips');
    for (var i = 0; i < oldData.length; i++) {
      if (i !== chipIndex) {
        newData.push(oldData[i]);
      }
    }

    $chips.data('chips', newData);
    $chips.trigger('chip.delete', chip);
    self.setPlaceholder($chips);
  };

  this.selectChip = function (chipIndex, $chips) {
    var $chip = $chips.find('.chip').eq(chipIndex);
    if ($chip && false === $chip.hasClass('selected')) {
      $chip.addClass('selected');
      $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
    }
  };

  this.getChipsElement = function (index, $chips) {
    return $chips.eq(index);
  };

  // init
  this.init();

  this.handleEvents();
};

})(jQuery); ;(function ($) {

$.fn.pushpin = function (options) {
  // Defaults
  var defaults = {
    top: 0,
    bottom: Infinity,
    offset: 0
  };

  // Remove pushpin event and classes
  if (options === "remove") {
    this.each(function () {
      if (id = $(this).data('pushpin-id')) {
        $(window).off('scroll.' + id);
        $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
      }
    });
    return false;
  }

  options = $.extend(defaults, options);

  $index = 0;
  return this.each(function () {
    var $uniqueId = Materialize.guid(),
        $this = $(this),
        $original_offset = $(this).offset().top;

    function removePinClasses(object) {
      object.removeClass('pin-top');
      object.removeClass('pinned');
      object.removeClass('pin-bottom');
    }

    function updateElements(objects, scrolled) {
      objects.each(function () {
        // Add position fixed (because its between top and bottom)
        if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
          removePinClasses($(this));
          $(this).css('top', options.offset);
          $(this).addClass('pinned');
        }

        // Add pin-top (when scrolled position is above top)
        if (scrolled < options.top && !$(this).hasClass('pin-top')) {
          removePinClasses($(this));
          $(this).css('top', 0);
          $(this).addClass('pin-top');
        }

        // Add pin-bottom (when scrolled position is below bottom)
        if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
          removePinClasses($(this));
          $(this).addClass('pin-bottom');
          $(this).css('top', options.bottom - $original_offset);
        }
      });
    }

    $(this).data('pushpin-id', $uniqueId);
    updateElements($this, $(window).scrollTop());
    $(window).on('scroll.' + $uniqueId, function () {
      var $scrolled = $(window).scrollTop() + options.offset;
      updateElements($this, $scrolled);
    });
  });
};

})(jQuery);;(function ($) {

$(document).ready(function () {

  // jQuery reverse
  $.fn.reverse = [].reverse;

  // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
  $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
    var $this = $(this);
    openFABMenu($this);
  });
  $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
    var $this = $(this);
    closeFABMenu($this);
  });

  // Toggle-on-click behaviour.
  $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
    var $this = $(this);
    var $menu = $this.parent();
    if ($menu.hasClass('active')) {
      closeFABMenu($menu);
    } else {
      openFABMenu($menu);
    }
  });

  // Toolbar transition behaviour.
  $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
    var $this = $(this);
    var $menu = $this.parent();
    FABtoToolbar($menu);
  });
});

$.fn.extend({
  openFAB: function () {
    openFABMenu($(this));
  },
  closeFAB: function () {
    closeFABMenu($(this));
  },
  openToolbar: function () {
    FABtoToolbar($(this));
  },
  closeToolbar: function () {
    toolbarToFAB($(this));
  }
});

var openFABMenu = function (btn) {
  var $this = btn;
  if ($this.hasClass('active') === false) {

    // Get direction option
    var horizontal = $this.hasClass('horizontal');
    var offsetY, offsetX;

    if (horizontal === true) {
      offsetX = 40;
    } else {
      offsetY = 40;
    }

    $this.addClass('active');
    $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });

    var time = 0;
    $this.find('ul .btn-floating').reverse().each(function () {
      $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
      time += 40;
    });
  }
};

var closeFABMenu = function (btn) {
  var $this = btn;
  // Get direction option
  var horizontal = $this.hasClass('horizontal');
  var offsetY, offsetX;

  if (horizontal === true) {
    offsetX = 40;
  } else {
    offsetY = 40;
  }

  $this.removeClass('active');
  var time = 0;
  $this.find('ul .btn-floating').velocity("stop", true);
  $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
};

/**
 * Transform FAB into toolbar
 * @param  {Object}  object jQuery object
 */
var FABtoToolbar = function (btn) {
  if (btn.attr('data-open') === "true") {
    return;
  }

  var offsetX, offsetY, scaleFactor;
  var windowWidth = window.innerWidth;
  var windowHeight = window.innerHeight;
  var btnRect = btn[0].getBoundingClientRect();
  var anchor = btn.find('> a').first();
  var menu = btn.find('> ul').first();
  var backdrop = $('<div class="fab-backdrop"></div>');
  var fabColor = anchor.css('background-color');
  anchor.append(backdrop);

  offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
  offsetY = windowHeight - btnRect.bottom;
  scaleFactor = windowWidth / backdrop.width();
  btn.attr('data-origin-bottom', btnRect.bottom);
  btn.attr('data-origin-left', btnRect.left);
  btn.attr('data-origin-width', btnRect.width);

  // Set initial state
  btn.addClass('active');
  btn.attr('data-open', true);
  btn.css({
    'text-align': 'center',
    width: '100%',
    bottom: 0,
    left: 0,
    transform: 'translateX(' + offsetX + 'px)',
    transition: 'none'
  });
  anchor.css({
    transform: 'translateY(' + -offsetY + 'px)',
    transition: 'none'
  });
  backdrop.css({
    'background-color': fabColor
  });

  setTimeout(function () {
    btn.css({
      transform: '',
      transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
    });
    anchor.css({
      overflow: 'visible',
      transform: '',
      transition: 'transform .2s'
    });

    setTimeout(function () {
      btn.css({
        overflow: 'hidden',
        'background-color': fabColor
      });
      backdrop.css({
        transform: 'scale(' + scaleFactor + ')',
        transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
      });
      menu.find('> li > a').css({
        opacity: 1
      });

      // Scroll to close.
      $(window).on('scroll.fabToolbarClose', function () {
        toolbarToFAB(btn);
        $(window).off('scroll.fabToolbarClose');
        $(document).off('click.fabToolbarClose');
      });

      $(document).on('click.fabToolbarClose', function (e) {
        if (!$(e.target).closest(menu).length) {
          toolbarToFAB(btn);
          $(window).off('scroll.fabToolbarClose');
          $(document).off('click.fabToolbarClose');
        }
      });
    }, 100);
  }, 0);
};

/**
 * Transform toolbar back into FAB
 * @param  {Object}  object jQuery object
 */
var toolbarToFAB = function (btn) {
  if (btn.attr('data-open') !== "true") {
    return;
  }

  var offsetX, offsetY, scaleFactor;
  var windowWidth = window.innerWidth;
  var windowHeight = window.innerHeight;
  var btnWidth = btn.attr('data-origin-width');
  var btnBottom = btn.attr('data-origin-bottom');
  var btnLeft = btn.attr('data-origin-left');
  var anchor = btn.find('> .btn-floating').first();
  var menu = btn.find('> ul').first();
  var backdrop = btn.find('.fab-backdrop');
  var fabColor = anchor.css('background-color');

  offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
  offsetY = windowHeight - btnBottom;
  scaleFactor = windowWidth / backdrop.width();

  // Hide backdrop
  btn.removeClass('active');
  btn.attr('data-open', false);
  btn.css({
    'background-color': 'transparent',
    transition: 'none'
  });
  anchor.css({
    transition: 'none'
  });
  backdrop.css({
    transform: 'scale(0)',
    'background-color': fabColor
  });
  menu.find('> li > a').css({
    opacity: ''
  });

  setTimeout(function () {
    backdrop.remove();

    // Set initial state.
    btn.css({
      'text-align': '',
      width: '',
      bottom: '',
      left: '',
      overflow: '',
      'background-color': '',
      transform: 'translate3d(' + -offsetX + 'px,0,0)'
    });
    anchor.css({
      overflow: '',
      transform: 'translate3d(0,' + offsetY + 'px,0)'
    });

    setTimeout(function () {
      btn.css({
        transform: 'translate3d(0,0,0)',
        transition: 'transform .2s'
      });
      anchor.css({
        transform: 'translate3d(0,0,0)',
        transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
      });
    }, 20);
  }, 200);
};

})(jQuery); ;(function ($) {

// Image transition function
Materialize.fadeInImage = function (selectorOrEl) {
  var element;
  if (typeof selectorOrEl === 'string') {
    element = $(selectorOrEl);
  } else if (typeof selectorOrEl === 'object') {
    element = selectorOrEl;
  } else {
    return;
  }
  element.css({ opacity: 0 });
  $(element).velocity({ opacity: 1 }, {
    duration: 650,
    queue: false,
    easing: 'easeOutSine'
  });
  $(element).velocity({ opacity: 1 }, {
    duration: 1300,
    queue: false,
    easing: 'swing',
    step: function (now, fx) {
      fx.start = 100;
      var grayscale_setting = now / 100;
      var brightness_setting = 150 - (100 - now) / 1.75;

      if (brightness_setting < 100) {
        brightness_setting = 100;
      }
      if (now >= 0) {
        $(this).css({
          "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
          "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
        });
      }
    }
  });
};

// Horizontal staggered list
Materialize.showStaggeredList = function (selectorOrEl) {
  var element;
  if (typeof selectorOrEl === 'string') {
    element = $(selectorOrEl);
  } else if (typeof selectorOrEl === 'object') {
    element = selectorOrEl;
  } else {
    return;
  }
  var time = 0;
  element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });

  element.find('li').each(function () {
    $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
    time += 120;
  });
};

$(document).ready(function () {
  // Hardcoded .staggered-list scrollFire
  // var staggeredListOptions = [];
  // $('ul.staggered-list').each(function (i) {

  //   var label = 'scrollFire-' + i;
  //   $(this).addClass(label);
  //   staggeredListOptions.push(
  //     {selector: 'ul.staggered-list.' + label,
  //      offset: 200,
  //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
  // });
  // scrollFire(staggeredListOptions);

  // HammerJS, Swipe navigation

  // Touch Event
  var swipeLeft = false;
  var swipeRight = false;

  // Dismissible Collections
  $('.dismissable').each(function () {
    $(this).hammer({
      prevent_default: false
    }).on('pan', function (e) {
      if (e.gesture.pointerType === "touch") {
        var $this = $(this);
        var direction = e.gesture.direction;
        var x = e.gesture.deltaX;
        var velocityX = e.gesture.velocityX;

        $this.velocity({ translateX: x
        }, { duration: 50, queue: false, easing: 'easeOutQuad' });

        // Swipe Left
        if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
          swipeLeft = true;
        }

        // Swipe Right
        if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
          swipeRight = true;
        }
      }
    }).on('panend', function (e) {
      // Reset if collection is moved back into original position
      if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
        swipeRight = false;
        swipeLeft = false;
      }

      if (e.gesture.pointerType === "touch") {
        var $this = $(this);
        if (swipeLeft || swipeRight) {
          var fullWidth;
          if (swipeLeft) {
            fullWidth = $this.innerWidth();
          } else {
            fullWidth = -1 * $this.innerWidth();
          }

          $this.velocity({ translateX: fullWidth
          }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
              $this.css('border', 'none');
              $this.velocity({ height: 0, padding: 0
              }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
                  $this.remove();
                }
              });
            }
          });
        } else {
          $this.velocity({ translateX: 0
          }, { duration: 100, queue: false, easing: 'easeOutQuad' });
        }
        swipeLeft = false;
        swipeRight = false;
      }
    });
  });

  // time = 0
  // // Vertical Staggered list
  // $('ul.staggered-list.vertical li').velocity(
  //     { translateY: "100px"},
  //     { duration: 0 });

  // $('ul.staggered-list.vertical li').each(function() {
  //   $(this).velocity(
  //     { opacity: "1", translateY: "0"},
  //     { duration: 800, delay: time, easing: [60, 25] });
  //   time += 120;
  // });

  // // Fade in and Scale
  // $('.fade-in.scale').velocity(
  //     { scaleX: .4, scaleY: .4, translateX: -600},
  //     { duration: 0});
  // $('.fade-in').each(function() {
  //   $(this).velocity(
  //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
  //     { duration: 800, easing: [60, 10] });
  // });
});

})(jQuery); ;(function ($) {

var scrollFireEventsHandled = false;

// Input: Array of JSON objects {selector, offset, callback}
Materialize.scrollFire = function (options) {
  var onScroll = function () {
    var windowScroll = window.pageYOffset + window.innerHeight;

    for (var i = 0; i < options.length; i++) {
      // Get options from each line
      var value = options[i];
      var selector = value.selector,
          offset = value.offset,
          callback = value.callback;

      var currentElement = document.querySelector(selector);
      if (currentElement !== null) {
        var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;

        if (windowScroll > elementOffset + offset) {
          if (value.done !== true) {
            if (typeof callback === 'function') {
              callback.call(this, currentElement);
            } else if (typeof callback === 'string') {
              var callbackFunc = new Function(callback);
              callbackFunc(currentElement);
            }
            value.done = true;
          }
        }
      }
    }
  };

  var throttledScroll = Materialize.throttle(function () {
    onScroll();
  }, options.throttle || 100);

  if (!scrollFireEventsHandled) {
    window.addEventListener("scroll", throttledScroll);
    window.addEventListener("resize", throttledScroll);
    scrollFireEventsHandled = true;
  }

  // perform a scan once, after current execution context, and after dom is ready
  setTimeout(throttledScroll, 0);
};

})(jQuery); ; /*!

* pickadate.js v3.5.0, 2014/04/13
* By Amsul, http://amsul.ca
* Hosted on http://amsul.github.io/pickadate.js
* Licensed under MIT
*/

(function (factory) {

Materialize.Picker = factory(jQuery);

})(function ($) {

var $window = $(window);
var $document = $(document);
var $html = $(document.documentElement);

/**
 * The picker constructor that creates a blank picker.
 */
function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {

  // If there’s no element, return the picker constructor.
  if (!ELEMENT) return PickerConstructor;

  var IS_DEFAULT_THEME = false,

  // The state of the picker.
  STATE = {
    id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
  },

  // Merge the defaults and options passed.
  SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},

  // Merge the default classes with the settings classes.
  CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),

  // The element node wrapper into a jQuery object.
  $ELEMENT = $(ELEMENT),

  // Pseudo picker constructor.
  PickerInstance = function () {
    return this.start();
  },

  // The picker prototype.
  P = PickerInstance.prototype = {

    constructor: PickerInstance,

    $node: $ELEMENT,

    /**
     * Initialize everything
     */
    start: function () {

      // If it’s already started, do nothing.
      if (STATE && STATE.start) return P;

      // Update the picker states.
      STATE.methods = {};
      STATE.start = true;
      STATE.open = false;
      STATE.type = ELEMENT.type;

      // Confirm focus state, convert into text input to remove UA stylings,
      // and set as readonly to prevent keyboard popup.
      ELEMENT.autofocus = ELEMENT == getActiveElement();
      ELEMENT.readOnly = !SETTINGS.editable;
      ELEMENT.id = ELEMENT.id || STATE.id;
      if (ELEMENT.type != 'text') {
        ELEMENT.type = 'text';
      }

      // Create a new picker component with the settings.
      P.component = new COMPONENT(P, SETTINGS);

      // Create the picker root with a holder and then prepare it.
      P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
      prepareElementRoot();

      // If there’s a format for the hidden input element, create the element.
      if (SETTINGS.formatSubmit) {
        prepareElementHidden();
      }

      // Prepare the input element.
      prepareElement();

      // Insert the root as specified in the settings.
      if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);

      // Bind the default component and settings events.
      P.on({
        start: P.component.onStart,
        render: P.component.onRender,
        stop: P.component.onStop,
        open: P.component.onOpen,
        close: P.component.onClose,
        set: P.component.onSet
      }).on({
        start: SETTINGS.onStart,
        render: SETTINGS.onRender,
        stop: SETTINGS.onStop,
        open: SETTINGS.onOpen,
        close: SETTINGS.onClose,
        set: SETTINGS.onSet
      });

      // Once we’re all set, check the theme in use.
      IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);

      // If the element has autofocus, open the picker.
      if (ELEMENT.autofocus) {
        P.open();
      }

      // Trigger queued the “start” and “render” events.
      return P.trigger('start').trigger('render');
    }, //start

    /**
     * Render a new picker
     */
    render: function (entireComponent) {

      // Insert a new component holder in the root or box.
      if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));

      // Trigger the queued “render” events.
      return P.trigger('render');
    }, //render

    /**
     * Destroy everything
     */
    stop: function () {

      // If it’s already stopped, do nothing.
      if (!STATE.start) return P;

      // Then close the picker.
      P.close();

      // Remove the hidden field.
      if (P._hidden) {
        P._hidden.parentNode.removeChild(P._hidden);
      }

      // Remove the root.
      P.$root.remove();

      // Remove the input class, remove the stored data, and unbind
      // the events (after a tick for IE - see `P.close`).
      $ELEMENT.removeClass(CLASSES.input).removeData(NAME);
      setTimeout(function () {
        $ELEMENT.off('.' + STATE.id);
      }, 0);

      // Restore the element state
      ELEMENT.type = STATE.type;
      ELEMENT.readOnly = false;

      // Trigger the queued “stop” events.
      P.trigger('stop');

      // Reset the picker states.
      STATE.methods = {};
      STATE.start = false;

      return P;
    }, //stop

    /**
     * Open up the picker
     */
    open: function (dontGiveFocus) {

      // If it’s already open, do nothing.
      if (STATE.open) return P;

      // Add the “active” class.
      $ELEMENT.addClass(CLASSES.active);
      aria(ELEMENT, 'expanded', true);

      // * A Firefox bug, when `html` has `overflow:hidden`, results in
      //   killing transitions :(. So add the “opened” state on the next tick.
      //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
      setTimeout(function () {

        // Add the “opened” class to the picker root.
        P.$root.addClass(CLASSES.opened);
        aria(P.$root[0], 'hidden', false);
      }, 0);

      // If we have to give focus, bind the element and doc events.
      if (dontGiveFocus !== false) {

        // Set it as open.
        STATE.open = true;

        // Prevent the page from scrolling.
        if (IS_DEFAULT_THEME) {
          $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
        }

        // Pass focus to the root element’s jQuery object.
        // * Workaround for iOS8 to bring the picker’s root into view.
        P.$root.eq(0).focus();

        // Bind the document events.
        $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {

          var target = event.target;

          // If the target of the event is not the element, close the picker picker.
          // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
          //   Also, for Firefox, a click on an `option` element bubbles up directly
          //   to the doc. So make sure the target wasn't the doc.
          // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
          //   which causes the picker to unexpectedly close when right-clicking it. So make
          //   sure the event wasn’t a right-click.
          if (target != ELEMENT && target != document && event.which != 3) {

            // If the target was the holder that covers the screen,
            // keep the element focused to maintain tabindex.
            P.close(target === P.$root.children()[0]);
          }
        }).on('keydown.' + STATE.id, function (event) {

          var
          // Get the keycode.
          keycode = event.keyCode,

          // Translate that to a selection change.
          keycodeToMove = P.component.key[keycode],

          // Grab the target.
          target = event.target;

          // On escape, close the picker and give focus.
          if (keycode == 27) {
            P.close(true);
          }

          // Check if there is a key movement or “enter” keypress on the element.
          else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {

              // Prevent the default action to stop page movement.
              event.preventDefault();

              // Trigger the key movement action.
              if (keycodeToMove) {
                PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
              }

              // On “enter”, if the highlighted item isn’t disabled, set the value and close.
              else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
                  P.set('select', P.component.item.highlight);
                  if (SETTINGS.closeOnSelect) {
                    P.close(true);
                  }
                }
            }

            // If the target is within the root and “enter” is pressed,
            // prevent the default action and trigger a click on the target instead.
            else if ($.contains(P.$root[0], target) && keycode == 13) {
                event.preventDefault();
                target.click();
              }
        });
      }

      // Trigger the queued “open” events.
      return P.trigger('open');
    }, //open

    /**
     * Close the picker
     */
    close: function (giveFocus) {

      // If we need to give focus, do it before changing states.
      if (giveFocus) {
        // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
        // The focus is triggered *after* the close has completed - causing it
        // to open again. So unbind and rebind the event at the next tick.
        P.$root.off('focus.toOpen').eq(0).focus();
        setTimeout(function () {
          P.$root.on('focus.toOpen', handleFocusToOpenEvent);
        }, 0);
      }

      // Remove the “active” class.
      $ELEMENT.removeClass(CLASSES.active);
      aria(ELEMENT, 'expanded', false);

      // * A Firefox bug, when `html` has `overflow:hidden`, results in
      //   killing transitions :(. So remove the “opened” state on the next tick.
      //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
      setTimeout(function () {

        // Remove the “opened” and “focused” class from the picker root.
        P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
        aria(P.$root[0], 'hidden', true);
      }, 0);

      // If it’s already closed, do nothing more.
      if (!STATE.open) return P;

      // Set it as closed.
      STATE.open = false;

      // Allow the page to scroll.
      if (IS_DEFAULT_THEME) {
        $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
      }

      // Unbind the document events.
      $document.off('.' + STATE.id);

      // Trigger the queued “close” events.
      return P.trigger('close');
    }, //close

    /**
     * Clear the values
     */
    clear: function (options) {
      return P.set('clear', null, options);
    }, //clear

    /**
     * Set something
     */
    set: function (thing, value, options) {

      var thingItem,
          thingValue,
          thingIsObject = $.isPlainObject(thing),
          thingObject = thingIsObject ? thing : {};

      // Make sure we have usable options.
      options = thingIsObject && $.isPlainObject(value) ? value : options || {};

      if (thing) {

        // If the thing isn’t an object, make it one.
        if (!thingIsObject) {
          thingObject[thing] = value;
        }

        // Go through the things of items to set.
        for (thingItem in thingObject) {

          // Grab the value of the thing.
          thingValue = thingObject[thingItem];

          // First, if the item exists and there’s a value, set it.
          if (thingItem in P.component.item) {
            if (thingValue === undefined) thingValue = null;
            P.component.set(thingItem, thingValue, options);
          }

          // Then, check to update the element value and broadcast a change.
          if (thingItem == 'select' || thingItem == 'clear') {
            $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
          }
        }

        // Render a new picker.
        P.render();
      }

      // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
      return options.muted ? P : P.trigger('set', thingObject);
    }, //set

    /**
     * Get something
     */
    get: function (thing, format) {

      // Make sure there’s something to get.
      thing = thing || 'value';

      // If a picker state exists, return that.
      if (STATE[thing] != null) {
        return STATE[thing];
      }

      // Return the submission value, if that.
      if (thing == 'valueSubmit') {
        if (P._hidden) {
          return P._hidden.value;
        }
        thing = 'value';
      }

      // Return the value, if that.
      if (thing == 'value') {
        return ELEMENT.value;
      }

      // Check if a component item exists, return that.
      if (thing in P.component.item) {
        if (typeof format == 'string') {
          var thingValue = P.component.get(thing);
          return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
        }
        return P.component.get(thing);
      }
    }, //get

    /**
     * Bind events on the things.
     */
    on: function (thing, method, internal) {

      var thingName,
          thingMethod,
          thingIsObject = $.isPlainObject(thing),
          thingObject = thingIsObject ? thing : {};

      if (thing) {

        // If the thing isn’t an object, make it one.
        if (!thingIsObject) {
          thingObject[thing] = method;
        }

        // Go through the things to bind to.
        for (thingName in thingObject) {

          // Grab the method of the thing.
          thingMethod = thingObject[thingName];

          // If it was an internal binding, prefix it.
          if (internal) {
            thingName = '_' + thingName;
          }

          // Make sure the thing methods collection exists.
          STATE.methods[thingName] = STATE.methods[thingName] || [];

          // Add the method to the relative method collection.
          STATE.methods[thingName].push(thingMethod);
        }
      }

      return P;
    }, //on

    /**
     * Unbind events on the things.
     */
    off: function () {
      var i,
          thingName,
          names = arguments;
      for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
        thingName = names[i];
        if (thingName in STATE.methods) {
          delete STATE.methods[thingName];
        }
      }
      return P;
    },

    /**
     * Fire off method events.
     */
    trigger: function (name, data) {
      var _trigger = function (name) {
        var methodList = STATE.methods[name];
        if (methodList) {
          methodList.map(function (method) {
            PickerConstructor._.trigger(method, P, [data]);
          });
        }
      };
      _trigger('_' + name);
      _trigger(name);
      return P;
    } //trigger
    //PickerInstance.prototype

    /**
     * Wrap the picker holder components together.
     */
  };function createWrappedComponent() {

    // Create a picker wrapper holder
    return PickerConstructor._.node('div',

    // Create a picker wrapper node
    PickerConstructor._.node('div',

    // Create a picker frame
    PickerConstructor._.node('div',

    // Create a picker box node
    PickerConstructor._.node('div',

    // Create the components nodes.
    P.component.nodes(STATE.open),

    // The picker box class
    CLASSES.box),

    // Picker wrap class
    CLASSES.wrap),

    // Picker frame class
    CLASSES.frame),

    // Picker holder class
    CLASSES.holder); //endreturn
  } //createWrappedComponent

  /**
   * Prepare the input element with all bindings.
   */
  function prepareElement() {

    $ELEMENT.

    // Store the picker data by component name.
    data(NAME, P).

    // Add the “input” class name.
    addClass(CLASSES.input).

    // Remove the tabindex.
    attr('tabindex', -1).

    // If there’s a `data-value`, update the value of the element.
    val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);

    // Only bind keydown events if the element isn’t editable.
    if (!SETTINGS.editable) {

      $ELEMENT.

      // On focus/click, focus onto the root to open it up.
      on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
        event.preventDefault();
        P.$root.eq(0).focus();
      }).

      // Handle keyboard event based on the picker being opened or not.
      on('keydown.' + STATE.id, handleKeydownEvent);
    }

    // Update the aria attributes.
    aria(ELEMENT, {
      haspopup: true,
      expanded: false,
      readonly: false,
      owns: ELEMENT.id + '_root'
    });
  }

  /**
   * Prepare the root picker element with all bindings.
   */
  function prepareElementRoot() {

    P.$root.on({

      // For iOS8.
      keydown: handleKeydownEvent,

      // When something within the root is focused, stop from bubbling
      // to the doc and remove the “focused” state from the root.
      focusin: function (event) {
        P.$root.removeClass(CLASSES.focused);
        event.stopPropagation();
      },

      // When something within the root holder is clicked, stop it
      // from bubbling to the doc.
      'mousedown click': function (event) {

        var target = event.target;

        // Make sure the target isn’t the root holder so it can bubble up.
        if (target != P.$root.children()[0]) {

          event.stopPropagation();

          // * For mousedown events, cancel the default action in order to
          //   prevent cases where focus is shifted onto external elements
          //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
          //   Also, for Firefox, don’t prevent action on the `option` element.
          if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {

            event.preventDefault();

            // Re-focus onto the root so that users can click away
            // from elements focused within the picker.
            P.$root.eq(0).focus();
          }
        }
      }
    }).

    // Add/remove the “target” class on focus and blur.
    on({
      focus: function () {
        $ELEMENT.addClass(CLASSES.target);
      },
      blur: function () {
        $ELEMENT.removeClass(CLASSES.target);
      }
    }).

    // Open the picker and adjust the root “focused” state
    on('focus.toOpen', handleFocusToOpenEvent).

    // If there’s a click on an actionable element, carry out the actions.
    on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {

      var $target = $(this),
          targetData = $target.data(),
          targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),

      // * For IE, non-focusable elements can be active elements as well
      //   (http://stackoverflow.com/a/2684561).
      activeElement = getActiveElement();
      activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;

      // If it’s disabled or nothing inside is actively focused, re-focus the element.
      if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
        P.$root.eq(0).focus();
      }

      // If something is superficially changed, update the `highlight` based on the `nav`.
      if (!targetDisabled && targetData.nav) {
        P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
      }

      // If something is picked, set `select` then close with focus.
      else if (!targetDisabled && 'pick' in targetData) {
          P.set('select', targetData.pick);
          if (SETTINGS.closeOnSelect) {
            P.close(true);
          }
        }

        // If a “clear” button is pressed, empty the values and close with focus.
        else if (targetData.clear) {
            P.clear();
            if (SETTINGS.closeOnSelect) {
              P.close(true);
            }
          } else if (targetData.close) {
            P.close(true);
          }
    }); //P.$root

    aria(P.$root[0], 'hidden', true);
  }

  /**
   * Prepare the hidden input element along with all bindings.
   */
  function prepareElementHidden() {

    var name;

    if (SETTINGS.hiddenName === true) {
      name = ELEMENT.name;
      ELEMENT.name = '';
    } else {
      name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
      name = name[0] + ELEMENT.name + name[1];
    }

    P._hidden = $('<input ' + 'type=hidden ' +

    // Create the name using the original input’s with a prefix and suffix.
    'name="' + name + '"' + (

    // If the element has a value, set the hidden value as well.
    $ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];

    $ELEMENT.

    // If the value changes, update the hidden input with the correct format.
    on('change.' + STATE.id, function () {
      P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
    });

    // Insert the hidden input as specified in the settings.
    if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
  }

  // For iOS8.
  function handleKeydownEvent(event) {

    var keycode = event.keyCode,

    // Check if one of the delete keys was pressed.
    isKeycodeDelete = /^(8|46)$/.test(keycode);

    // For some reason IE clears the input value on “escape”.
    if (keycode == 27) {
      P.close();
      return false;
    }

    // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
    if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {

      // Prevent it from moving the page and bubbling to doc.
      event.preventDefault();
      event.stopPropagation();

      // If `delete` was pressed, clear the values and close the picker.
      // Otherwise open the picker.
      if (isKeycodeDelete) {
        P.clear().close();
      } else {
        P.open();
      }
    }
  }

  // Separated for IE
  function handleFocusToOpenEvent(event) {

    // Stop the event from propagating to the doc.
    event.stopPropagation();

    // If it’s a focus event, add the “focused” class to the root.
    if (event.type == 'focus') {
      P.$root.addClass(CLASSES.focused);
    }

    // And then finally open the picker.
    P.open();
  }

  // Return a new picker instance.
  return new PickerInstance();
} //PickerConstructor

/**
 * The default classes and prefix to use for the HTML classes.
 */
PickerConstructor.klasses = function (prefix) {
  prefix = prefix || 'picker';
  return {

    picker: prefix,
    opened: prefix + '--opened',
    focused: prefix + '--focused',

    input: prefix + '__input',
    active: prefix + '__input--active',
    target: prefix + '__input--target',

    holder: prefix + '__holder',

    frame: prefix + '__frame',
    wrap: prefix + '__wrap',

    box: prefix + '__box'
  };
}; //PickerConstructor.klasses

/**
 * Check if the default theme is being used.
 */
function isUsingDefaultTheme(element) {

  var theme,
      prop = 'position';

  // For IE.
  if (element.currentStyle) {
    theme = element.currentStyle[prop];
  }

  // For normal browsers.
  else if (window.getComputedStyle) {
      theme = getComputedStyle(element)[prop];
    }

  return theme == 'fixed';
}

/**
 * Get the width of the browser’s scrollbar.
 * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
 */
function getScrollbarWidth() {

  if ($html.height() <= $window.height()) {
    return 0;
  }

  var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');

  // Get the width without scrollbars.
  var widthWithoutScroll = $outer[0].offsetWidth;

  // Force adding scrollbars.
  $outer.css('overflow', 'scroll');

  // Add the inner div.
  var $inner = $('<div style="width:100%" />').appendTo($outer);

  // Get the width with scrollbars.
  var widthWithScroll = $inner[0].offsetWidth;

  // Remove the divs.
  $outer.remove();

  // Return the difference between the widths.
  return widthWithoutScroll - widthWithScroll;
}

/**
 * PickerConstructor helper methods.
 */
PickerConstructor._ = {

  /**
   * Create a group of nodes. Expects:
   * `
      {
          min:    {Integer},
          max:    {Integer},
          i:      {Integer},
          node:   {String},
          item:   {Function}
      }
   * `
   */
  group: function (groupObject) {

    var
    // Scope for the looped object
    loopObjectScope,

    // Create the nodes list
    nodesList = '',

    // The counter starts from the `min`
    counter = PickerConstructor._.trigger(groupObject.min, groupObject);

    // Loop from the `min` to `max`, incrementing by `i`
    for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {

      // Trigger the `item` function within scope of the object
      loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);

      // Splice the subgroup and create nodes out of the sub nodes
      nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
      loopObjectScope[1], // the classes
      loopObjectScope[2] // the attributes
      );
    }

    // Return the list of nodes
    return nodesList;
  }, //group

  /**
   * Create a dom node string
   */
  node: function (wrapper, item, klass, attribute) {

    // If the item is false-y, just return an empty string
    if (!item) return '';

    // If the item is an array, do a join
    item = $.isArray(item) ? item.join('') : item;

    // Check for the class
    klass = klass ? ' class="' + klass + '"' : '';

    // Check for any attributes
    attribute = attribute ? ' ' + attribute : '';

    // Return the wrapped item
    return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
  }, //node

  /**
   * Lead numbers below 10 with a zero.
   */
  lead: function (number) {
    return (number < 10 ? '0' : '') + number;
  },

  /**
   * Trigger a function otherwise return the value.
   */
  trigger: function (callback, scope, args) {
    return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
  },

  /**
   * If the second character is a digit, length is 2 otherwise 1.
   */
  digits: function (string) {
    return (/\d/.test(string[1]) ? 2 : 1
    );
  },

  /**
   * Tell if something is a date object.
   */
  isDate: function (value) {
    return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
  },

  /**
   * Tell if something is an integer.
   */
  isInteger: function (value) {
    return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
  },

  /**
   * Create ARIA attribute strings.
   */
  ariaAttr: ariaAttr //PickerConstructor._

  /**
   * Extend the picker with a component and defaults.
   */
};PickerConstructor.extend = function (name, Component) {

  // Extend jQuery.
  $.fn[name] = function (options, action) {

    // Grab the component data.
    var componentData = this.data(name);

    // If the picker is requested, return the data object.
    if (options == 'picker') {
      return componentData;
    }

    // If the component data exists and `options` is a string, carry out the action.
    if (componentData && typeof options == 'string') {
      return PickerConstructor._.trigger(componentData[options], componentData, [action]);
    }

    // Otherwise go through each matched element and if the component
    // doesn’t exist, create a new picker using `this` element
    // and merging the defaults and options with a deep copy.
    return this.each(function () {
      var $this = $(this);
      if (!$this.data(name)) {
        new PickerConstructor(this, name, Component, options);
      }
    });
  };

  // Set the defaults.
  $.fn[name].defaults = Component.defaults;
}; //PickerConstructor.extend

function aria(element, attribute, value) {
  if ($.isPlainObject(attribute)) {
    for (var key in attribute) {
      ariaSet(element, key, attribute[key]);
    }
  } else {
    ariaSet(element, attribute, value);
  }
}
function ariaSet(element, attribute, value) {
  element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
}
function ariaAttr(attribute, data) {
  if (!$.isPlainObject(attribute)) {
    attribute = { attribute: data };
  }
  data = '';
  for (var key in attribute) {
    var attr = (key == 'role' ? '' : 'aria-') + key,
        attrVal = attribute[key];
    data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
  }
  return data;
}

// IE8 bug throws an error for activeElements within iframes.
function getActiveElement() {
  try {
    return document.activeElement;
  } catch (err) {}
}

// Expose the picker constructor.
return PickerConstructor;

}); ; /*!

* Date picker for pickadate.js v3.5.0
* http://amsul.github.io/pickadate.js/date.htm
*/

(function (factory) {

factory(Materialize.Picker, jQuery);

})(function (Picker, $) {

/**
 * Globals and constants
 */
var DAYS_IN_WEEK = 7,
    WEEKS_IN_CALENDAR = 6,
    _ = Picker._;

/**
 * The date picker constructor
 */
function DatePicker(picker, settings) {

  var calendar = this,
      element = picker.$node[0],
      elementValue = element.value,
      elementDataValue = picker.$node.data('value'),
      valueString = elementDataValue || elementValue,
      formatString = elementDataValue ? settings.formatSubmit : settings.format,
      isRTL = function () {

    return element.currentStyle ?

    // For IE.
    element.currentStyle.direction == 'rtl' :

    // For normal browsers.
    getComputedStyle(picker.$root[0]).direction == 'rtl';
  };

  calendar.settings = settings;
  calendar.$node = picker.$node;

  // The queue of methods that will be used to build item objects.
  calendar.queue = {
    min: 'measure create',
    max: 'measure create',
    now: 'now create',
    select: 'parse create validate',
    highlight: 'parse navigate create validate',
    view: 'parse create validate viewset',
    disable: 'deactivate',
    enable: 'activate'

    // The component's item object.
  };calendar.item = {};

  calendar.item.clear = null;
  calendar.item.disable = (settings.disable || []).slice(0);
  calendar.item.enable = -function (collectionDisabled) {
    return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
  }(calendar.item.disable);

  calendar.set('min', settings.min).set('max', settings.max).set('now');

  // When there’s a value, set the `select`, which in turn
  // also sets the `highlight` and `view`.
  if (valueString) {
    calendar.set('select', valueString, { format: formatString });
  }

  // If there’s no value, default to highlighting “today”.
  else {
      calendar.set('select', null).set('highlight', calendar.item.now);
    }

  // The keycode to movement mapping.
  calendar.key = {
    40: 7, // Down
    38: -7, // Up
    39: function () {
      return isRTL() ? -1 : 1;
    }, // Right
    37: function () {
      return isRTL() ? 1 : -1;
    }, // Left
    go: function (timeChange) {
      var highlightedObject = calendar.item.highlight,
          targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
      calendar.set('highlight', targetDate, { interval: timeChange });
      this.render();
    }

    // Bind some picker events.
  };picker.on('render', function () {
    picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
      var value = this.value;
      if (value) {
        picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
        picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
      }
    });
    picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
      var value = this.value;
      if (value) {
        picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
        picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
      }
    });
  }, 1).on('open', function () {
    var includeToday = '';
    if (calendar.disabled(calendar.get('now'))) {
      includeToday = ':not(.' + settings.klass.buttonToday + ')';
    }
    picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
  }, 1).on('close', function () {
    picker.$root.find('button, select').attr('disabled', true);
  }, 1);
} //DatePicker

/**
 * Set a datepicker item object.
 */
DatePicker.prototype.set = function (type, value, options) {

  var calendar = this,
      calendarItem = calendar.item;

  // If the value is `null` just set it immediately.
  if (value === null) {
    if (type == 'clear') type = 'select';
    calendarItem[type] = value;
    return calendar;
  }

  // Otherwise go through the queue of methods, and invoke the functions.
  // Update this as the time unit, and set the final value as this item.
  // * In the case of `enable`, keep the queue but set `disable` instead.
  //   And in the case of `flip`, keep the queue but set `enable` instead.
  calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
    value = calendar[method](type, value, options);
    return value;
  }).pop();

  // Check if we need to cascade through more updates.
  if (type == 'select') {
    calendar.set('highlight', calendarItem.select, options);
  } else if (type == 'highlight') {
    calendar.set('view', calendarItem.highlight, options);
  } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
    if (calendarItem.select && calendar.disabled(calendarItem.select)) {
      calendar.set('select', calendarItem.select, options);
    }
    if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
      calendar.set('highlight', calendarItem.highlight, options);
    }
  }

  return calendar;
}; //DatePicker.prototype.set

/**
 * Get a datepicker item object.
 */
DatePicker.prototype.get = function (type) {
  return this.item[type];
}; //DatePicker.prototype.get

/**
 * Create a picker date object.
 */
DatePicker.prototype.create = function (type, value, options) {

  var isInfiniteValue,
      calendar = this;

  // If there’s no value, use the type as the value.
  value = value === undefined ? type : value;

  // If it’s infinity, update the value.
  if (value == -Infinity || value == Infinity) {
    isInfiniteValue = value;
  }

  // If it’s an object, use the native date object.
  else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
      value = value.obj;
    }

    // If it’s an array, convert it into a date and make sure
    // that it’s a valid date – otherwise default to today.
    else if ($.isArray(value)) {
        value = new Date(value[0], value[1], value[2]);
        value = _.isDate(value) ? value : calendar.create().obj;
      }

      // If it’s a number or date object, make a normalized date.
      else if (_.isInteger(value) || _.isDate(value)) {
          value = calendar.normalize(new Date(value), options);
        }

        // If it’s a literal true or any other case, set it to now.
        else /*if ( value === true )*/{
            value = calendar.now(type, value, options);
          }

  // Return the compiled object.
  return {
    year: isInfiniteValue || value.getFullYear(),
    month: isInfiniteValue || value.getMonth(),
    date: isInfiniteValue || value.getDate(),
    day: isInfiniteValue || value.getDay(),
    obj: isInfiniteValue || value,
    pick: isInfiniteValue || value.getTime()
  };
}; //DatePicker.prototype.create

/**
 * Create a range limit object using an array, date object,
 * literal “true”, or integer relative to another time.
 */
DatePicker.prototype.createRange = function (from, to) {

  var calendar = this,
      createDate = function (date) {
    if (date === true || $.isArray(date) || _.isDate(date)) {
      return calendar.create(date);
    }
    return date;
  };

  // Create objects if possible.
  if (!_.isInteger(from)) {
    from = createDate(from);
  }
  if (!_.isInteger(to)) {
    to = createDate(to);
  }

  // Create relative dates.
  if (_.isInteger(from) && $.isPlainObject(to)) {
    from = [to.year, to.month, to.date + from];
  } else if (_.isInteger(to) && $.isPlainObject(from)) {
    to = [from.year, from.month, from.date + to];
  }

  return {
    from: createDate(from),
    to: createDate(to)
  };
}; //DatePicker.prototype.createRange

/**
 * Check if a date unit falls within a date range object.
 */
DatePicker.prototype.withinRange = function (range, dateUnit) {
  range = this.createRange(range.from, range.to);
  return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
};

/**
 * Check if two date range objects overlap.
 */
DatePicker.prototype.overlapRanges = function (one, two) {

  var calendar = this;

  // Convert the ranges into comparable dates.
  one = calendar.createRange(one.from, one.to);
  two = calendar.createRange(two.from, two.to);

  return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
};

/**
 * Get the date today.
 */
DatePicker.prototype.now = function (type, value, options) {
  value = new Date();
  if (options && options.rel) {
    value.setDate(value.getDate() + options.rel);
  }
  return this.normalize(value, options);
};

/**
 * Navigate to next/prev month.
 */
DatePicker.prototype.navigate = function (type, value, options) {

  var targetDateObject,
      targetYear,
      targetMonth,
      targetDate,
      isTargetArray = $.isArray(value),
      isTargetObject = $.isPlainObject(value),
      viewsetObject = this.item.view; /*,
                                      safety = 100*/

  if (isTargetArray || isTargetObject) {

    if (isTargetObject) {
      targetYear = value.year;
      targetMonth = value.month;
      targetDate = value.date;
    } else {
      targetYear = +value[0];
      targetMonth = +value[1];
      targetDate = +value[2];
    }

    // If we’re navigating months but the view is in a different
    // month, navigate to the view’s year and month.
    if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
      targetYear = viewsetObject.year;
      targetMonth = viewsetObject.month;
    }

    // Figure out the expected target year and month.
    targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
    targetYear = targetDateObject.getFullYear();
    targetMonth = targetDateObject.getMonth();

    // If the month we’re going to doesn’t have enough days,
    // keep decreasing the date until we reach the month’s last date.
    while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
      targetDate -= 1;
      /*safety -= 1
      if ( !safety ) {
          throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
      }*/
    }

    value = [targetYear, targetMonth, targetDate];
  }

  return value;
}; //DatePicker.prototype.navigate

/**
 * Normalize a date by setting the hours to midnight.
 */
DatePicker.prototype.normalize = function (value /*, options*/) {
  value.setHours(0, 0, 0, 0);
  return value;
};

/**
 * Measure the range of dates.
 */
DatePicker.prototype.measure = function (type, value /*, options*/) {

  var calendar = this;

  // If it’s anything false-y, remove the limits.
  if (!value) {
    value = type == 'min' ? -Infinity : Infinity;
  }

  // If it’s a string, parse it.
  else if (typeof value == 'string') {
      value = calendar.parse(type, value);
    }

    // If it's an integer, get a date relative to today.
    else if (_.isInteger(value)) {
        value = calendar.now(type, value, { rel: value });
      }

  return value;
}; ///DatePicker.prototype.measure

/**
 * Create a viewset object based on navigation.
 */
DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
  return this.create([dateObject.year, dateObject.month, 1]);
};

/**
 * Validate a date as enabled and shift if needed.
 */
DatePicker.prototype.validate = function (type, dateObject, options) {

  var calendar = this,

  // Keep a reference to the original date.
  originalDateObject = dateObject,

  // Make sure we have an interval.
  interval = options && options.interval ? options.interval : 1,

  // Check if the calendar enabled dates are inverted.
  isFlippedBase = calendar.item.enable === -1,

  // Check if we have any enabled dates after/before now.
  hasEnabledBeforeTarget,
      hasEnabledAfterTarget,

  // The min & max limits.
  minLimitObject = calendar.item.min,
      maxLimitObject = calendar.item.max,

  // Check if we’ve reached the limit during shifting.
  reachedMin,
      reachedMax,

  // Check if the calendar is inverted and at least one weekday is enabled.
  hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {

    // If there’s a date, check where it is relative to the target.
    if ($.isArray(value)) {
      var dateTime = calendar.create(value).pick;
      if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
    }

    // Return only integers for enabled weekdays.
    return _.isInteger(value);
  }).length; /*,
             safety = 100*/

  // Cases to validate for:
  // [1] Not inverted and date disabled.
  // [2] Inverted and some dates enabled.
  // [3] Not inverted and out of range.
  //
  // Cases to **not** validate for:
  // • Navigating months.
  // • Not inverted and date enabled.
  // • Inverted and all dates disabled.
  // • ..and anything else.
  if (!options || !options.nav) if (
  /* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
  /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
  /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {

    // When inverted, flip the direction if there aren’t any enabled weekdays
    // and there are no enabled dates in the direction of the interval.
    if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
      interval *= -1;
    }

    // Keep looping until we reach an enabled date.
    while ( /*safety &&*/calendar.disabled(dateObject)) {

      /*safety -= 1
      if ( !safety ) {
          throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
      }*/

      // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
      if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
        dateObject = originalDateObject;
        interval = interval > 0 ? 1 : -1;
      }

      // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
      if (dateObject.pick <= minLimitObject.pick) {
        reachedMin = true;
        interval = 1;
        dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
      } else if (dateObject.pick >= maxLimitObject.pick) {
        reachedMax = true;
        interval = -1;
        dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
      }

      // If we’ve reached both limits, just break out of the loop.
      if (reachedMin && reachedMax) {
        break;
      }

      // Finally, create the shifted date using the interval and keep looping.
      dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
    }
  } //endif

  // Return the date object settled on.
  return dateObject;
}; //DatePicker.prototype.validate

/**
 * Check if a date is disabled.
 */
DatePicker.prototype.disabled = function (dateToVerify) {

  var calendar = this,

  // Filter through the disabled dates to check if this is one.
  isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {

    // If the date is a number, match the weekday with 0index and `firstDay` check.
    if (_.isInteger(dateToDisable)) {
      return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
    }

    // If it’s an array or a native JS date, create and match the exact date.
    if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
      return dateToVerify.pick === calendar.create(dateToDisable).pick;
    }

    // If it’s an object, match a date within the “from” and “to” range.
    if ($.isPlainObject(dateToDisable)) {
      return calendar.withinRange(dateToDisable, dateToVerify);
    }
  });

  // If this date matches a disabled date, confirm it’s not inverted.
  isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
    return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
  }).length;

  // Check the calendar “enabled” flag and respectively flip the
  // disabled state. Then also check if it’s beyond the min/max limits.
  return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
}; //DatePicker.prototype.disabled

/**
 * Parse a string into a usable type.
 */
DatePicker.prototype.parse = function (type, value, options) {

  var calendar = this,
      parsingObject = {};

  // If it’s already parsed, we’re good.
  if (!value || typeof value != 'string') {
    return value;
  }

  // We need a `.format` to parse the value with.
  if (!(options && options.format)) {
    options = options || {};
    options.format = calendar.settings.format;
  }

  // Convert the format into an array and then map through it.
  calendar.formats.toArray(options.format).map(function (label) {

    var
    // Grab the formatting label.
    formattingLabel = calendar.formats[label],

    // The format length is from the formatting label function or the
    // label length without the escaping exclamation (!) mark.
    formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;

    // If there's a format label, split the value up to the format length.
    // Then add it to the parsing object with appropriate label.
    if (formattingLabel) {
      parsingObject[label] = value.substr(0, formatLength);
    }

    // Update the value as the substring from format length to end.
    value = value.substr(formatLength);
  });

  // Compensate for month 0index.
  return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
}; //DatePicker.prototype.parse

/**
 * Various formats to display the object in.
 */
DatePicker.prototype.formats = function () {

  // Return the length of the first word in a collection.
  function getWordLengthFromCollection(string, collection, dateObject) {

    // Grab the first word from the string.
    var word = string.match(/\w+/)[0];

    // If there's no month index, add it to the date object
    if (!dateObject.mm && !dateObject.m) {
      dateObject.m = collection.indexOf(word) + 1;
    }

    // Return the length of the word.
    return word.length;
  }

  // Get the length of the first word in a string.
  function getFirstWordLength(string) {
    return string.match(/\w+/)[0].length;
  }

  return {

    d: function (string, dateObject) {

      // If there's string, then get the digits length.
      // Otherwise return the selected date.
      return string ? _.digits(string) : dateObject.date;
    },
    dd: function (string, dateObject) {

      // If there's a string, then the length is always 2.
      // Otherwise return the selected date with a leading zero.
      return string ? 2 : _.lead(dateObject.date);
    },
    ddd: function (string, dateObject) {

      // If there's a string, then get the length of the first word.
      // Otherwise return the short selected weekday.
      return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
    },
    dddd: function (string, dateObject) {

      // If there's a string, then get the length of the first word.
      // Otherwise return the full selected weekday.
      return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
    },
    m: function (string, dateObject) {

      // If there's a string, then get the length of the digits
      // Otherwise return the selected month with 0index compensation.
      return string ? _.digits(string) : dateObject.month + 1;
    },
    mm: function (string, dateObject) {

      // If there's a string, then the length is always 2.
      // Otherwise return the selected month with 0index and leading zero.
      return string ? 2 : _.lead(dateObject.month + 1);
    },
    mmm: function (string, dateObject) {

      var collection = this.settings.monthsShort;

      // If there's a string, get length of the relevant month from the short
      // months collection. Otherwise return the selected month from that collection.
      return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
    },
    mmmm: function (string, dateObject) {

      var collection = this.settings.monthsFull;

      // If there's a string, get length of the relevant month from the full
      // months collection. Otherwise return the selected month from that collection.
      return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
    },
    yy: function (string, dateObject) {

      // If there's a string, then the length is always 2.
      // Otherwise return the selected year by slicing out the first 2 digits.
      return string ? 2 : ('' + dateObject.year).slice(2);
    },
    yyyy: function (string, dateObject) {

      // If there's a string, then the length is always 4.
      // Otherwise return the selected year.
      return string ? 4 : dateObject.year;
    },

    // Create an array by splitting the formatting string passed.
    toArray: function (formatString) {
      return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
    },

    // Format an object into a string using the formatting options.
    toString: function (formatString, itemObject) {
      var calendar = this;
      return calendar.formats.toArray(formatString).map(function (label) {
        return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
      }).join('');
    }
  };
}(); //DatePicker.prototype.formats

/**
 * Check if two date units are the exact.
 */
DatePicker.prototype.isDateExact = function (one, two) {

  var calendar = this;

  // When we’re working with weekdays, do a direct comparison.
  if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
    return one === two;
  }

  // When we’re working with date representations, compare the “pick” value.
  if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
    return calendar.create(one).pick === calendar.create(two).pick;
  }

  // When we’re working with range objects, compare the “from” and “to”.
  if ($.isPlainObject(one) && $.isPlainObject(two)) {
    return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
  }

  return false;
};

/**
 * Check if two date units overlap.
 */
DatePicker.prototype.isDateOverlap = function (one, two) {

  var calendar = this,
      firstDay = calendar.settings.firstDay ? 1 : 0;

  // When we’re working with a weekday index, compare the days.
  if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
    one = one % 7 + firstDay;
    return one === calendar.create(two).day + 1;
  }
  if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
    two = two % 7 + firstDay;
    return two === calendar.create(one).day + 1;
  }

  // When we’re working with range objects, check if the ranges overlap.
  if ($.isPlainObject(one) && $.isPlainObject(two)) {
    return calendar.overlapRanges(one, two);
  }

  return false;
};

/**
 * Flip the “enabled” state.
 */
DatePicker.prototype.flipEnable = function (val) {
  var itemObject = this.item;
  itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
};

/**
 * Mark a collection of dates as “disabled”.
 */
DatePicker.prototype.deactivate = function (type, datesToDisable) {

  var calendar = this,
      disabledItems = calendar.item.disable.slice(0);

  // If we’re flipping, that’s all we need to do.
  if (datesToDisable == 'flip') {
    calendar.flipEnable();
  } else if (datesToDisable === false) {
    calendar.flipEnable(1);
    disabledItems = [];
  } else if (datesToDisable === true) {
    calendar.flipEnable(-1);
    disabledItems = [];
  }

  // Otherwise go through the dates to disable.
  else {

      datesToDisable.map(function (unitToDisable) {

        var matchFound;

        // When we have disabled items, check for matches.
        // If something is matched, immediately break out.
        for (var index = 0; index < disabledItems.length; index += 1) {
          if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
            matchFound = true;
            break;
          }
        }

        // If nothing was found, add the validated unit to the collection.
        if (!matchFound) {
          if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
            disabledItems.push(unitToDisable);
          }
        }
      });
    }

  // Return the updated collection.
  return disabledItems;
}; //DatePicker.prototype.deactivate

/**
 * Mark a collection of dates as “enabled”.
 */
DatePicker.prototype.activate = function (type, datesToEnable) {

  var calendar = this,
      disabledItems = calendar.item.disable,
      disabledItemsCount = disabledItems.length;

  // If we’re flipping, that’s all we need to do.
  if (datesToEnable == 'flip') {
    calendar.flipEnable();
  } else if (datesToEnable === true) {
    calendar.flipEnable(1);
    disabledItems = [];
  } else if (datesToEnable === false) {
    calendar.flipEnable(-1);
    disabledItems = [];
  }

  // Otherwise go through the disabled dates.
  else {

      datesToEnable.map(function (unitToEnable) {

        var matchFound, disabledUnit, index, isExactRange;

        // Go through the disabled items and try to find a match.
        for (index = 0; index < disabledItemsCount; index += 1) {

          disabledUnit = disabledItems[index];

          // When an exact match is found, remove it from the collection.
          if (calendar.isDateExact(disabledUnit, unitToEnable)) {
            matchFound = disabledItems[index] = null;
            isExactRange = true;
            break;
          }

          // When an overlapped match is found, add the “inverted” state to it.
          else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
              if ($.isPlainObject(unitToEnable)) {
                unitToEnable.inverted = true;
                matchFound = unitToEnable;
              } else if ($.isArray(unitToEnable)) {
                matchFound = unitToEnable;
                if (!matchFound[3]) matchFound.push('inverted');
              } else if (_.isDate(unitToEnable)) {
                matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
              }
              break;
            }
        }

        // If a match was found, remove a previous duplicate entry.
        if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
          if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
            disabledItems[index] = null;
            break;
          }
        }

        // In the event that we’re dealing with an exact range of dates,
        // make sure there are no “inverted” dates because of it.
        if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
          if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
            disabledItems[index] = null;
            break;
          }
        }

        // If something is still matched, add it into the collection.
        if (matchFound) {
          disabledItems.push(matchFound);
        }
      });
    }

  // Return the updated collection.
  return disabledItems.filter(function (val) {
    return val != null;
  });
}; //DatePicker.prototype.activate

/**
 * Create a string for the nodes in the picker.
 */
DatePicker.prototype.nodes = function (isOpen) {

  var calendar = this,
      settings = calendar.settings,
      calendarItem = calendar.item,
      nowObject = calendarItem.now,
      selectedObject = calendarItem.select,
      highlightedObject = calendarItem.highlight,
      viewsetObject = calendarItem.view,
      disabledCollection = calendarItem.disable,
      minLimitObject = calendarItem.min,
      maxLimitObject = calendarItem.max,

  // Create the calendar table head using a copy of weekday labels collection.
  // * We do a copy so we don't mutate the original array.
  tableHead = function (collection, fullCollection) {

    // If the first day should be Monday, move Sunday to the end.
    if (settings.firstDay) {
      collection.push(collection.shift());
      fullCollection.push(fullCollection.shift());
    }

    // Create and return the table head group.
    return _.node('thead', _.node('tr', _.group({
      min: 0,
      max: DAYS_IN_WEEK - 1,
      i: 1,
      node: 'th',
      item: function (counter) {
        return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
      }
    }))); //endreturn

    // Materialize modified
  }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
      //tableHead

  // Create the nav for next/prev month.
  createMonthNav = function (next) {

    // Otherwise, return the created month tag.
    return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (

    // If the focused month is outside the range, disabled the button.
    next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
      role: 'button',
      controls: calendar.$node[0].id + '_table'
    }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
  },
      //createMonthNav

  // Create the month label.
  //Materialize modified
  createMonthLabel = function (override) {

    var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;

    // Materialize modified
    if (override == "short_months") {
      monthsCollection = settings.monthsShort;
    }

    // If there are months to select, add a dropdown menu.
    if (settings.selectMonths && override == undefined) {

      return _.node('select', _.group({
        min: 0,
        max: 11,
        i: 1,
        node: 'option',
        item: function (loopedMonth) {

          return [

          // The looped month and no classes.
          monthsCollection[loopedMonth], 0,

          // Set the value and selected index.
          'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
        }
      }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
    }

    // Materialize modified
    if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];

    // If there's a need for a month selector
    return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
  },
      //createMonthLabel

  // Create the year label.
  // Materialize modified
  createYearLabel = function (override) {

    var focusedYear = viewsetObject.year,

    // If years selector is set to a literal "true", set it to 5. Otherwise
    // divide in half to get half before and half after focused year.
    numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);

    // If there are years to select, add a dropdown menu.
    if (numberYears) {

      var minYear = minLimitObject.year,
          maxYear = maxLimitObject.year,
          lowestYear = focusedYear - numberYears,
          highestYear = focusedYear + numberYears;

      // If the min year is greater than the lowest year, increase the highest year
      // by the difference and set the lowest year to the min year.
      if (minYear > lowestYear) {
        highestYear += minYear - lowestYear;
        lowestYear = minYear;
      }

      // If the max year is less than the highest year, decrease the lowest year
      // by the lower of the two: available and needed years. Then set the
      // highest year to the max year.
      if (maxYear < highestYear) {

        var availableYears = lowestYear - minYear,
            neededYears = highestYear - maxYear;

        lowestYear -= availableYears > neededYears ? neededYears : availableYears;
        highestYear = maxYear;
      }

      if (settings.selectYears && override == undefined) {
        return _.node('select', _.group({
          min: lowestYear,
          max: highestYear,
          i: 1,
          node: 'option',
          item: function (loopedYear) {
            return [

            // The looped year and no classes.
            loopedYear, 0,

            // Set the value and selected index.
            'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
          }
        }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
      }
    }

    // Materialize modified
    if (override === 'raw' && selectedObject != null) {
      return _.node('div', selectedObject.year);
    }

    // Otherwise just return the year focused
    return _.node('div', focusedYear, settings.klass.year);
  }; //createYearLabel

  // Materialize modified
  createDayLabel = function () {
    if (selectedObject != null) return selectedObject.date;else return nowObject.date;
  };
  createWeekdayLabel = function () {
    var display_day;

    if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
    var weekday = settings.weekdaysShort[display_day];
    return weekday;
  };

  // Create and return the entire calendar.

  return _.node(
  // Date presentation View
  'div', _.node(
  // Div for Year
  'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
  // Div for short Month
  'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
  // Div for Day
  'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
  // Calendar container
  _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
    min: 0,
    max: WEEKS_IN_CALENDAR - 1,
    i: 1,
    node: 'tr',
    item: function (rowCounter) {

      // If Monday is the first day and the month starts on Sunday, shift the date back a week.
      var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;

      return [_.group({
        min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
        max: function () {
          return this.min + DAYS_IN_WEEK - 1;
        },
        i: 1,
        node: 'td',
        item: function (targetDate) {

          // Convert the time date from a relative date to a target date.
          targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);

          var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
              isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
              isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
              formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);

          return [_.node('div', targetDate.date, function (klasses) {

            // Add the `infocus` or `outfocus` classes based on month in view.
            klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);

            // Add the `today` class if needed.
            if (nowObject.pick == targetDate.pick) {
              klasses.push(settings.klass.now);
            }

            // Add the `selected` class if something's selected and the time matches.
            if (isSelected) {
              klasses.push(settings.klass.selected);
            }

            // Add the `highlighted` class if something's highlighted and the time matches.
            if (isHighlighted) {
              klasses.push(settings.klass.highlighted);
            }

            // Add the `disabled` class if something's disabled and the object matches.
            if (isDisabled) {
              klasses.push(settings.klass.disabled);
            }

            return klasses.join(' ');
          }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
            role: 'gridcell',
            label: formattedDate,
            selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
            activedescendant: isHighlighted ? true : null,
            disabled: isDisabled ? true : null
          }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
        }
      })]; //endreturn
    }
  })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
    role: 'grid',
    controls: calendar.$node[0].id,
    readonly: true
  })), settings.klass.calendar_container) // end calendar

  +

  // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
  _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
}; //DatePicker.prototype.nodes

/**
 * The date picker defaults.
 */
DatePicker.defaults = function (prefix) {

  return {

    // The title label to use for the month nav buttons
    labelMonthNext: 'Next month',
    labelMonthPrev: 'Previous month',

    // The title label to use for the dropdown selectors
    labelMonthSelect: 'Select a month',
    labelYearSelect: 'Select a year',

    // Months and weekdays
    monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
    monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
    weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
    weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],

    // Materialize modified
    weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],

    // Today and clear
    today: 'Today',
    clear: 'Clear',
    close: 'Ok',

    // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
    closeOnSelect: false,

    // The format to show on the `input` element
    format: 'd mmmm, yyyy',

    // Classes
    klass: {

      table: prefix + 'table',

      header: prefix + 'header',

      // Materialize Added klasses
      date_display: prefix + 'date-display',
      day_display: prefix + 'day-display',
      month_display: prefix + 'month-display',
      year_display: prefix + 'year-display',
      calendar_container: prefix + 'calendar-container',
      // end

      navPrev: prefix + 'nav--prev',
      navNext: prefix + 'nav--next',
      navDisabled: prefix + 'nav--disabled',

      month: prefix + 'month',
      year: prefix + 'year',

      selectMonth: prefix + 'select--month',
      selectYear: prefix + 'select--year',

      weekdays: prefix + 'weekday',

      day: prefix + 'day',
      disabled: prefix + 'day--disabled',
      selected: prefix + 'day--selected',
      highlighted: prefix + 'day--highlighted',
      now: prefix + 'day--today',
      infocus: prefix + 'day--infocus',
      outfocus: prefix + 'day--outfocus',

      footer: prefix + 'footer',

      buttonClear: prefix + 'button--clear',
      buttonToday: prefix + 'button--today',
      buttonClose: prefix + 'button--close'
    }
  };
}(Picker.klasses().picker + '__');

/**
 * Extend the picker to add the date picker.
 */
Picker.extend('pickadate', DatePicker);

}); ; /*!

* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
* Copyright 2014 Wang Shenwei.
* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
*
* Further modified
* Copyright 2015 Ching Yaw Hao.
*/

(function ($) {

var $win = $(window),
    $doc = $(document);

// Can I use inline svg ?
var svgNS = 'http://www.w3.org/2000/svg',
    svgSupported = 'SVGAngle' in window && function () {
  var supported,
      el = document.createElement('div');
  el.innerHTML = '<svg/>';
  supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
  el.innerHTML = '';
  return supported;
}();

// Can I use transition ?
var transitionSupported = function () {
  var style = document.createElement('div').style;
  return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
}();

// Listen touch events in touch screen device, instead of mouse events in desktop.
var touchSupported = 'ontouchstart' in window,
    mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
    mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
    mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');

// Vibrate the device if supported
var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;

function createSvgElement(name) {
  return document.createElementNS(svgNS, name);
}

function leadingZero(num) {
  return (num < 10 ? '0' : '') + num;
}

// Get a unique id
var idCounter = 0;
function uniqueId(prefix) {
  var id = ++idCounter + '';
  return prefix ? prefix + id : id;
}

// Clock size
var dialRadius = 135,
    outerRadius = 105,

// innerRadius = 80 on 12 hour clock
innerRadius = 70,
    tickRadius = 20,
    diameter = dialRadius * 2,
    duration = transitionSupported ? 350 : 1;

// Popover template
var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');

// ClockPicker
function ClockPicker(element, options) {
  var popover = $(tpl),
      plate = popover.find('.clockpicker-plate'),
      holder = popover.find('.picker__holder'),
      hoursView = popover.find('.clockpicker-hours'),
      minutesView = popover.find('.clockpicker-minutes'),
      amPmBlock = popover.find('.clockpicker-am-pm-block'),
      isInput = element.prop('tagName') === 'INPUT',
      input = isInput ? element : element.find('input'),
      label = $("label[for=" + input.attr("id") + "]"),
      self = this;

  this.id = uniqueId('cp');
  this.element = element;
  this.holder = holder;
  this.options = options;
  this.isAppended = false;
  this.isShown = false;
  this.currentView = 'hours';
  this.isInput = isInput;
  this.input = input;
  this.label = label;
  this.popover = popover;
  this.plate = plate;
  this.hoursView = hoursView;
  this.minutesView = minutesView;
  this.amPmBlock = amPmBlock;
  this.spanHours = popover.find('.clockpicker-span-hours');
  this.spanMinutes = popover.find('.clockpicker-span-minutes');
  this.spanAmPm = popover.find('.clockpicker-span-am-pm');
  this.footer = popover.find('.picker__footer');
  this.amOrPm = "PM";

  // Setup for for 12 hour clock if option is selected
  if (options.twelvehour) {
    if (!options.ampmclickable) {
      this.spanAmPm.empty();
      $('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
      $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
    } else {
      this.spanAmPm.empty();
      $('<div id="click-am">AM</div>').on("click", function () {
        self.spanAmPm.children('#click-am').addClass("text-primary");
        self.spanAmPm.children('#click-pm').removeClass("text-primary");
        self.amOrPm = "AM";
      }).appendTo(this.spanAmPm);
      $('<div id="click-pm">PM</div>').on("click", function () {
        self.spanAmPm.children('#click-pm').addClass("text-primary");
        self.spanAmPm.children('#click-am').removeClass("text-primary");
        self.amOrPm = 'PM';
      }).appendTo(this.spanAmPm);
    }
  }

  // Add buttons to footer
  $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
  $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
  $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);

  this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
  this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));

  // Show or toggle
  input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));

  // Build ticks
  var tickTpl = $('<div class="clockpicker-tick"></div>'),
      i,
      tick,
      radian,
      radius;

  // Hours view
  if (options.twelvehour) {
    for (i = 1; i < 13; i += 1) {
      tick = tickTpl.clone();
      radian = i / 6 * Math.PI;
      radius = outerRadius;
      tick.css({
        left: dialRadius + Math.sin(radian) * radius - tickRadius,
        top: dialRadius - Math.cos(radian) * radius - tickRadius
      });
      tick.html(i === 0 ? '00' : i);
      hoursView.append(tick);
      tick.on(mousedownEvent, mousedown);
    }
  } else {
    for (i = 0; i < 24; i += 1) {
      tick = tickTpl.clone();
      radian = i / 6 * Math.PI;
      var inner = i > 0 && i < 13;
      radius = inner ? innerRadius : outerRadius;
      tick.css({
        left: dialRadius + Math.sin(radian) * radius - tickRadius,
        top: dialRadius - Math.cos(radian) * radius - tickRadius
      });
      tick.html(i === 0 ? '00' : i);
      hoursView.append(tick);
      tick.on(mousedownEvent, mousedown);
    }
  }

  // Minutes view
  for (i = 0; i < 60; i += 5) {
    tick = tickTpl.clone();
    radian = i / 30 * Math.PI;
    tick.css({
      left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
      top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
    });
    tick.html(leadingZero(i));
    minutesView.append(tick);
    tick.on(mousedownEvent, mousedown);
  }

  // Clicking on minutes view space
  plate.on(mousedownEvent, function (e) {
    if ($(e.target).closest('.clockpicker-tick').length === 0) {
      mousedown(e, true);
    }
  });

  // Mousedown or touchstart
  function mousedown(e, space) {
    var offset = plate.offset(),
        isTouch = /^touch/.test(e.type),
        x0 = offset.left + dialRadius,
        y0 = offset.top + dialRadius,
        dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
        dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
        z = Math.sqrt(dx * dx + dy * dy),
        moved = false;

    // When clicking on minutes view space, check the mouse position
    if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
      return;
    }
    e.preventDefault();

    // Set cursor style of body after 200ms
    var movingTimer = setTimeout(function () {
      self.popover.addClass('clockpicker-moving');
    }, 200);

    // Clock
    self.setHand(dx, dy, !space, true);

    // Mousemove on document
    $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
      e.preventDefault();
      var isTouch = /^touch/.test(e.type),
          x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
          y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
      if (!moved && x === dx && y === dy) {
        // Clicking in chrome on windows will trigger a mousemove event
        return;
      }
      moved = true;
      self.setHand(x, y, false, true);
    });

    // Mouseup on document
    $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
      $doc.off(mouseupEvent);
      e.preventDefault();
      var isTouch = /^touch/.test(e.type),
          x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
          y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
      if ((space || moved) && x === dx && y === dy) {
        self.setHand(x, y);
      }

      if (self.currentView === 'hours') {
        self.toggleView('minutes', duration / 2);
      } else if (options.autoclose) {
        self.minutesView.addClass('clockpicker-dial-out');
        setTimeout(function () {
          self.done();
        }, duration / 2);
      }
      plate.prepend(canvas);

      // Reset cursor style of body
      clearTimeout(movingTimer);
      self.popover.removeClass('clockpicker-moving');

      // Unbind mousemove event
      $doc.off(mousemoveEvent);
    });
  }

  if (svgSupported) {
    // Draw clock hands and others
    var canvas = popover.find('.clockpicker-canvas'),
        svg = createSvgElement('svg');
    svg.setAttribute('class', 'clockpicker-svg');
    svg.setAttribute('width', diameter);
    svg.setAttribute('height', diameter);
    var g = createSvgElement('g');
    g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
    var bearing = createSvgElement('circle');
    bearing.setAttribute('class', 'clockpicker-canvas-bearing');
    bearing.setAttribute('cx', 0);
    bearing.setAttribute('cy', 0);
    bearing.setAttribute('r', 4);
    var hand = createSvgElement('line');
    hand.setAttribute('x1', 0);
    hand.setAttribute('y1', 0);
    var bg = createSvgElement('circle');
    bg.setAttribute('class', 'clockpicker-canvas-bg');
    bg.setAttribute('r', tickRadius);
    g.appendChild(hand);
    g.appendChild(bg);
    g.appendChild(bearing);
    svg.appendChild(g);
    canvas.append(svg);

    this.hand = hand;
    this.bg = bg;
    this.bearing = bearing;
    this.g = g;
    this.canvas = canvas;
  }

  raiseCallback(this.options.init);
}

function raiseCallback(callbackFunction) {
  if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
}

// Default options
ClockPicker.DEFAULTS = {
  'default': '', // default time, 'now' or '13:14' e.g.
  fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
  donetext: 'Ok', // done button text
  cleartext: 'Clear',
  canceltext: 'Cancel',
  autoclose: false, // auto close when minute is selected
  ampmclickable: true, // set am/pm button on itself
  darktheme: false, // set to dark theme
  twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
  vibrate: true // vibrate the device when dragging clock hand
};

// Show or hide popover
ClockPicker.prototype.toggle = function () {
  this[this.isShown ? 'hide' : 'show']();
};

// Set popover position
ClockPicker.prototype.locate = function () {
  var element = this.element,
      popover = this.popover,
      offset = element.offset(),
      width = element.outerWidth(),
      height = element.outerHeight(),
      align = this.options.align,
      self = this;

  popover.show();
};

// Show popover
ClockPicker.prototype.show = function (e) {
  // Not show again
  if (this.isShown) {
    return;
  }
  raiseCallback(this.options.beforeShow);
  $(':input').each(function () {
    $(this).attr('tabindex', -1);
  });
  var self = this;
  // Initialize
  this.input.blur();
  this.popover.addClass('picker--opened');
  this.input.addClass('picker__input picker__input--active');
  $(document.body).css('overflow', 'hidden');
  // Get the time
  var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
  if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
    if (value[1].indexOf("AM") > 0) {
      this.amOrPm = 'AM';
    } else {
      this.amOrPm = 'PM';
    }
    value[1] = value[1].replace("AM", "").replace("PM", "");
  }
  if (value[0] === 'now') {
    var now = new Date(+new Date() + this.options.fromnow);
    value = [now.getHours(), now.getMinutes()];
    if (this.options.twelvehour) {
      this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
    }
  }
  this.hours = +value[0] || 0;
  this.minutes = +value[1] || 0;
  this.spanHours.html(this.hours);
  this.spanMinutes.html(leadingZero(this.minutes));
  if (!this.isAppended) {

    // Append popover to input by default
    var containerEl = document.querySelector(this.options.container);
    if (this.options.container && containerEl) {
      containerEl.appendChild(this.popover[0]);
    } else {
      this.popover.insertAfter(this.input);
    }

    if (this.options.twelvehour) {
      if (this.amOrPm === 'PM') {
        this.spanAmPm.children('#click-pm').addClass("text-primary");
        this.spanAmPm.children('#click-am').removeClass("text-primary");
      } else {
        this.spanAmPm.children('#click-am').addClass("text-primary");
        this.spanAmPm.children('#click-pm').removeClass("text-primary");
      }
    }
    // Reset position when resize
    $win.on('resize.clockpicker' + this.id, function () {
      if (self.isShown) {
        self.locate();
      }
    });
    this.isAppended = true;
  }
  // Toggle to hours view
  this.toggleView('hours');
  // Set position
  this.locate();
  this.isShown = true;
  // Hide when clicking or tabbing on any element except the clock and input
  $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
    var target = $(e.target);
    if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
      self.hide();
    }
  });
  // Hide when ESC is pressed
  $doc.on('keyup.clockpicker.' + this.id, function (e) {
    if (e.keyCode === 27) {
      self.hide();
    }
  });
  raiseCallback(this.options.afterShow);
};
// Hide popover
ClockPicker.prototype.hide = function () {
  raiseCallback(this.options.beforeHide);
  this.input.removeClass('picker__input picker__input--active');
  this.popover.removeClass('picker--opened');
  $(document.body).css('overflow', 'visible');
  this.isShown = false;
  $(':input').each(function (index) {
    $(this).attr('tabindex', index + 1);
  });
  // Unbinding events on document
  $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
  $doc.off('keyup.clockpicker.' + this.id);
  this.popover.hide();
  raiseCallback(this.options.afterHide);
};
// Toggle to hours or minutes view
ClockPicker.prototype.toggleView = function (view, delay) {
  var raiseAfterHourSelect = false;
  if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
    raiseCallback(this.options.beforeHourSelect);
    raiseAfterHourSelect = true;
  }
  var isHours = view === 'hours',
      nextView = isHours ? this.hoursView : this.minutesView,
      hideView = isHours ? this.minutesView : this.hoursView;
  this.currentView = view;

  this.spanHours.toggleClass('text-primary', isHours);
  this.spanMinutes.toggleClass('text-primary', !isHours);

  // Let's make transitions
  hideView.addClass('clockpicker-dial-out');
  nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');

  // Reset clock hand
  this.resetClock(delay);

  // After transitions ended
  clearTimeout(this.toggleViewTimer);
  this.toggleViewTimer = setTimeout(function () {
    hideView.css('visibility', 'hidden');
  }, duration);

  if (raiseAfterHourSelect) {
    raiseCallback(this.options.afterHourSelect);
  }
};

// Reset clock hand
ClockPicker.prototype.resetClock = function (delay) {
  var view = this.currentView,
      value = this[view],
      isHours = view === 'hours',
      unit = Math.PI / (isHours ? 6 : 30),
      radian = value * unit,
      radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
      x = Math.sin(radian) * radius,
      y = -Math.cos(radian) * radius,
      self = this;

  if (svgSupported && delay) {
    self.canvas.addClass('clockpicker-canvas-out');
    setTimeout(function () {
      self.canvas.removeClass('clockpicker-canvas-out');
      self.setHand(x, y);
    }, delay);
  } else this.setHand(x, y);
};

// Set clock hand to (x, y)
ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
  var radian = Math.atan2(x, -y),
      isHours = this.currentView === 'hours',
      unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
      z = Math.sqrt(x * x + y * y),
      options = this.options,
      inner = isHours && z < (outerRadius + innerRadius) / 2,
      radius = inner ? innerRadius : outerRadius,
      value;

  if (options.twelvehour) {
    radius = outerRadius;
  }

  // Radian should in range [0, 2PI]
  if (radian < 0) {
    radian = Math.PI * 2 + radian;
  }

  // Get the round value
  value = Math.round(radian / unit);

  // Get the round radian
  radian = value * unit;

  // Correct the hours or minutes
  if (options.twelvehour) {
    if (isHours) {
      if (value === 0) value = 12;
    } else {
      if (roundBy5) value *= 5;
      if (value === 60) value = 0;
    }
  } else {
    if (isHours) {
      if (value === 12) value = 0;
      value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
    } else {
      if (roundBy5) value *= 5;
      if (value === 60) value = 0;
    }
  }

  // Once hours or minutes changed, vibrate the device
  if (this[this.currentView] !== value) {
    if (vibrate && this.options.vibrate) {
      // Do not vibrate too frequently
      if (!this.vibrateTimer) {
        navigator[vibrate](10);
        this.vibrateTimer = setTimeout($.proxy(function () {
          this.vibrateTimer = null;
        }, this), 100);
      }
    }
  }

  this[this.currentView] = value;
  if (isHours) {
    this['spanHours'].html(value);
  } else {
    this['spanMinutes'].html(leadingZero(value));
  }

  // If svg is not supported, just add an active class to the tick
  if (!svgSupported) {
    this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
      var tick = $(this);
      tick.toggleClass('active', value === +tick.html());
    });
    return;
  }

  // Set clock hand and others' position
  var cx1 = Math.sin(radian) * (radius - tickRadius),
      cy1 = -Math.cos(radian) * (radius - tickRadius),
      cx2 = Math.sin(radian) * radius,
      cy2 = -Math.cos(radian) * radius;
  this.hand.setAttribute('x2', cx1);
  this.hand.setAttribute('y2', cy1);
  this.bg.setAttribute('cx', cx2);
  this.bg.setAttribute('cy', cy2);
};

// Hours and minutes are selected
ClockPicker.prototype.done = function () {
  raiseCallback(this.options.beforeDone);
  this.hide();
  this.label.addClass('active');

  var last = this.input.prop('value'),
      value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
  if (this.options.twelvehour) {
    value = value + this.amOrPm;
  }

  this.input.prop('value', value);
  if (value !== last) {
    this.input.triggerHandler('change');
    if (!this.isInput) {
      this.element.trigger('change');
    }
  }

  if (this.options.autoclose) this.input.trigger('blur');

  raiseCallback(this.options.afterDone);
};

// Clear input field
ClockPicker.prototype.clear = function () {
  this.hide();
  this.label.removeClass('active');

  var last = this.input.prop('value'),
      value = '';

  this.input.prop('value', value);
  if (value !== last) {
    this.input.triggerHandler('change');
    if (!this.isInput) {
      this.element.trigger('change');
    }
  }

  if (this.options.autoclose) {
    this.input.trigger('blur');
  }
};

// Remove clockpicker from input
ClockPicker.prototype.remove = function () {
  this.element.removeData('clockpicker');
  this.input.off('focus.clockpicker click.clockpicker');
  if (this.isShown) {
    this.hide();
  }
  if (this.isAppended) {
    $win.off('resize.clockpicker' + this.id);
    this.popover.remove();
  }
};

// Extends $.fn.clockpicker
$.fn.pickatime = function (option) {
  var args = Array.prototype.slice.call(arguments, 1);
  return this.each(function () {
    var $this = $(this),
        data = $this.data('clockpicker');
    if (!data) {
      var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
      $this.data('clockpicker', new ClockPicker($this, options));
    } else {
      // Manual operatsions. show, hide, remove, e.g.
      if (typeof data[option] === 'function') {
        data[option].apply(data, args);
      }
    }
  });
};

})(jQuery); ;(function ($) {

$.fn.characterCounter = function () {
  return this.each(function () {
    var $input = $(this);
    var $counterElement = $input.parent().find('span[class="character-counter"]');

    // character counter has already been added appended to the parent container
    if ($counterElement.length) {
      return;
    }

    var itHasLengthAttribute = $input.attr('data-length') !== undefined;

    if (itHasLengthAttribute) {
      $input.on('input', updateCounter);
      $input.on('focus', updateCounter);
      $input.on('blur', removeCounterElement);

      addCounterElement($input);
    }
  });
};

function updateCounter() {
  var maxLength = +$(this).attr('data-length'),
      actualLength = +$(this).val().length,
      isValidLength = actualLength <= maxLength;

  $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);

  addInputStyle(isValidLength, $(this));
}

function addCounterElement($input) {
  var $counterElement = $input.parent().find('span[class="character-counter"]');

  if ($counterElement.length) {
    return;
  }

  $counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);

  $input.parent().append($counterElement);
}

function removeCounterElement() {
  $(this).parent().find('span[class="character-counter"]').html('');
}

function addInputStyle(isValidLength, $input) {
  var inputHasInvalidClass = $input.hasClass('invalid');
  if (isValidLength && inputHasInvalidClass) {
    $input.removeClass('invalid');
  } else if (!isValidLength && !inputHasInvalidClass) {
    $input.removeClass('valid');
    $input.addClass('invalid');
  }
}

$(document).ready(function () {
  $('input, textarea').characterCounter();
});

})(jQuery); ;(function ($) {

var methods = {

  init: function (options) {
    var defaults = {
      duration: 200, // ms
      dist: -100, // zoom scale TODO: make this more intuitive as an option
      shift: 0, // spacing for center image
      padding: 0, // Padding between non center items
      fullWidth: false, // Change to full width styles
      indicators: false, // Toggle indicators
      noWrap: false, // Don't wrap around and cycle through items.
      onCycleTo: null // Callback for when a new slide is cycled to.
    };
    options = $.extend(defaults, options);
    var namespace = Materialize.objectSelectorString($(this));

    return this.each(function (i) {

      var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
      var $indicators = $('<ul class="indicators"></ul>');
      var scrollingTimeout = null;
      var oneTimeCallback = null;

      // Initialize
      var view = $(this);
      var hasMultipleSlides = view.find('.carousel-item').length > 1;
      var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
      var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
      var uniqueNamespace = view.attr('data-namespace') || namespace + i;
      view.attr('data-namespace', uniqueNamespace);

      // Options
      var setCarouselHeight = function (imageOnly) {
        var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
        var firstImage = firstSlide.find('img').first();
        if (firstImage.length) {
          if (firstImage[0].complete) {
            // If image won't trigger the load event
            var imageHeight = firstImage.height();
            if (imageHeight > 0) {
              view.css('height', firstImage.height());
            } else {
              // If image still has no height, use the natural dimensions to calculate
              var naturalWidth = firstImage[0].naturalWidth;
              var naturalHeight = firstImage[0].naturalHeight;
              var adjustedHeight = view.width() / naturalWidth * naturalHeight;
              view.css('height', adjustedHeight);
            }
          } else {
            // Get height when image is loaded normally
            firstImage.on('load', function () {
              view.css('height', $(this).height());
            });
          }
        } else if (!imageOnly) {
          var slideHeight = firstSlide.height();
          view.css('height', slideHeight);
        }
      };

      if (options.fullWidth) {
        options.dist = 0;
        setCarouselHeight();

        // Offset fixed items when indicators.
        if (showIndicators) {
          view.find('.carousel-fixed-item').addClass('with-indicators');
        }
      }

      // Don't double initialize.
      if (view.hasClass('initialized')) {
        // Recalculate variables
        $(window).trigger('resize');

        // Redraw carousel.
        view.trigger('carouselNext', [0.000001]);
        return true;
      }

      view.addClass('initialized');
      pressed = false;
      offset = target = 0;
      images = [];
      item_width = view.find('.carousel-item').first().innerWidth();
      item_height = view.find('.carousel-item').first().innerHeight();
      dim = item_width * 2 + options.padding;

      view.find('.carousel-item').each(function (i) {
        images.push($(this)[0]);
        if (showIndicators) {
          var $indicator = $('<li class="indicator-item"></li>');

          // Add active to first by default.
          if (i === 0) {
            $indicator.addClass('active');
          }

          // Handle clicks on indicators.
          $indicator.click(function (e) {
            e.stopPropagation();

            var index = $(this).index();
            cycleTo(index);
          });
          $indicators.append($indicator);
        }
      });

      if (showIndicators) {
        view.append($indicators);
      }
      count = images.length;

      function setupEvents() {
        if (typeof window.ontouchstart !== 'undefined') {
          view.on('touchstart.carousel', tap);
          view.on('touchmove.carousel', drag);
          view.on('touchend.carousel', release);
        }
        view.on('mousedown.carousel', tap);
        view.on('mousemove.carousel', drag);
        view.on('mouseup.carousel', release);
        view.on('mouseleave.carousel', release);
        view.on('click.carousel', click);
      }

      function xpos(e) {
        // touch event
        if (e.targetTouches && e.targetTouches.length >= 1) {
          return e.targetTouches[0].clientX;
        }

        // mouse event
        return e.clientX;
      }

      function ypos(e) {
        // touch event
        if (e.targetTouches && e.targetTouches.length >= 1) {
          return e.targetTouches[0].clientY;
        }

        // mouse event
        return e.clientY;
      }

      function wrap(x) {
        return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
      }

      function scroll(x) {
        // Track scrolling state
        scrolling = true;
        if (!view.hasClass('scrolling')) {
          view.addClass('scrolling');
        }
        if (scrollingTimeout != null) {
          window.clearTimeout(scrollingTimeout);
        }
        scrollingTimeout = window.setTimeout(function () {
          scrolling = false;
          view.removeClass('scrolling');
        }, options.duration);

        // Start actual scroll
        var i, half, delta, dir, tween, el, alignment, xTranslation;
        var lastCenter = center;

        offset = typeof x === 'number' ? x : offset;
        center = Math.floor((offset + dim / 2) / dim);
        delta = offset - center * dim;
        dir = delta < 0 ? 1 : -1;
        tween = -dir * delta * 2 / dim;
        half = count >> 1;

        if (!options.fullWidth) {
          alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
          alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
        } else {
          alignment = 'translateX(0)';
        }

        // Set indicator active
        if (showIndicators) {
          var diff = center % count;
          var activeIndicator = $indicators.find('.indicator-item.active');
          if (activeIndicator.index() !== diff) {
            activeIndicator.removeClass('active');
            $indicators.find('.indicator-item').eq(diff).addClass('active');
          }
        }

        // center
        // Don't show wrapped items.
        if (!noWrap || center >= 0 && center < count) {
          el = images[wrap(center)];

          // Add active class to center item.
          if (!$(el).hasClass('active')) {
            view.find('.carousel-item').removeClass('active');
            $(el).addClass('active');
          }
          el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
          el.style.zIndex = 0;
          if (options.fullWidth) {
            tweenedOpacity = 1;
          } else {
            tweenedOpacity = 1 - 0.2 * tween;
          }
          el.style.opacity = tweenedOpacity;
          el.style.display = 'block';
        }

        for (i = 1; i <= half; ++i) {
          // right side
          if (options.fullWidth) {
            zTranslation = options.dist;
            tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
          } else {
            zTranslation = options.dist * (i * 2 + tween * dir);
            tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
          }
          // Don't show wrapped items.
          if (!noWrap || center + i < count) {
            el = images[wrap(center + i)];
            el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
            el.style.zIndex = -i;
            el.style.opacity = tweenedOpacity;
            el.style.display = 'block';
          }

          // left side
          if (options.fullWidth) {
            zTranslation = options.dist;
            tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
          } else {
            zTranslation = options.dist * (i * 2 - tween * dir);
            tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
          }
          // Don't show wrapped items.
          if (!noWrap || center - i >= 0) {
            el = images[wrap(center - i)];
            el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
            el.style.zIndex = -i;
            el.style.opacity = tweenedOpacity;
            el.style.display = 'block';
          }
        }

        // center
        // Don't show wrapped items.
        if (!noWrap || center >= 0 && center < count) {
          el = images[wrap(center)];
          el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
          el.style.zIndex = 0;
          if (options.fullWidth) {
            tweenedOpacity = 1;
          } else {
            tweenedOpacity = 1 - 0.2 * tween;
          }
          el.style.opacity = tweenedOpacity;
          el.style.display = 'block';
        }

        // onCycleTo callback
        if (lastCenter !== center && typeof options.onCycleTo === "function") {
          var $curr_item = view.find('.carousel-item').eq(wrap(center));
          options.onCycleTo.call(this, $curr_item, dragged);
        }

        // One time callback
        if (typeof oneTimeCallback === "function") {
          oneTimeCallback.call(this, $curr_item, dragged);
          oneTimeCallback = null;
        }
      }

      function track() {
        var now, elapsed, delta, v;

        now = Date.now();
        elapsed = now - timestamp;
        timestamp = now;
        delta = offset - frame;
        frame = offset;

        v = 1000 * delta / (1 + elapsed);
        velocity = 0.8 * v + 0.2 * velocity;
      }

      function autoScroll() {
        var elapsed, delta;

        if (amplitude) {
          elapsed = Date.now() - timestamp;
          delta = amplitude * Math.exp(-elapsed / options.duration);
          if (delta > 2 || delta < -2) {
            scroll(target - delta);
            requestAnimationFrame(autoScroll);
          } else {
            scroll(target);
          }
        }
      }

      function click(e) {
        // Disable clicks if carousel was dragged.
        if (dragged) {
          e.preventDefault();
          e.stopPropagation();
          return false;
        } else if (!options.fullWidth) {
          var clickedIndex = $(e.target).closest('.carousel-item').index();
          var diff = wrap(center) - clickedIndex;

          // Disable clicks if carousel was shifted by click
          if (diff !== 0) {
            e.preventDefault();
            e.stopPropagation();
          }
          cycleTo(clickedIndex);
        }
      }

      function cycleTo(n) {
        var diff = center % count - n;

        // Account for wraparound.
        if (!noWrap) {
          if (diff < 0) {
            if (Math.abs(diff + count) < Math.abs(diff)) {
              diff += count;
            }
          } else if (diff > 0) {
            if (Math.abs(diff - count) < diff) {
              diff -= count;
            }
          }
        }

        // Call prev or next accordingly.
        if (diff < 0) {
          view.trigger('carouselNext', [Math.abs(diff)]);
        } else if (diff > 0) {
          view.trigger('carouselPrev', [diff]);
        }
      }

      function tap(e) {
        // Fixes firefox draggable image bug
        if (e.type === 'mousedown' && $(e.target).is('img')) {
          e.preventDefault();
        }
        pressed = true;
        dragged = false;
        vertical_dragged = false;
        reference = xpos(e);
        referenceY = ypos(e);

        velocity = amplitude = 0;
        frame = offset;
        timestamp = Date.now();
        clearInterval(ticker);
        ticker = setInterval(track, 100);
      }

      function drag(e) {
        var x, delta, deltaY;
        if (pressed) {
          x = xpos(e);
          y = ypos(e);
          delta = reference - x;
          deltaY = Math.abs(referenceY - y);
          if (deltaY < 30 && !vertical_dragged) {
            // If vertical scrolling don't allow dragging.
            if (delta > 2 || delta < -2) {
              dragged = true;
              reference = x;
              scroll(offset + delta);
            }
          } else if (dragged) {
            // If dragging don't allow vertical scroll.
            e.preventDefault();
            e.stopPropagation();
            return false;
          } else {
            // Vertical scrolling.
            vertical_dragged = true;
          }
        }

        if (dragged) {
          // If dragging don't allow vertical scroll.
          e.preventDefault();
          e.stopPropagation();
          return false;
        }
      }

      function release(e) {
        if (pressed) {
          pressed = false;
        } else {
          return;
        }

        clearInterval(ticker);
        target = offset;
        if (velocity > 10 || velocity < -10) {
          amplitude = 0.9 * velocity;
          target = offset + amplitude;
        }
        target = Math.round(target / dim) * dim;

        // No wrap of items.
        if (noWrap) {
          if (target >= dim * (count - 1)) {
            target = dim * (count - 1);
          } else if (target < 0) {
            target = 0;
          }
        }
        amplitude = target - offset;
        timestamp = Date.now();
        requestAnimationFrame(autoScroll);

        if (dragged) {
          e.preventDefault();
          e.stopPropagation();
        }
        return false;
      }

      xform = 'transform';
      ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
        var e = prefix + 'Transform';
        if (typeof document.body.style[e] !== 'undefined') {
          xform = e;
          return false;
        }
        return true;
      });

      var throttledResize = Materialize.throttle(function () {
        if (options.fullWidth) {
          item_width = view.find('.carousel-item').first().innerWidth();
          var imageHeight = view.find('.carousel-item.active').height();
          dim = item_width * 2 + options.padding;
          offset = center * 2 * item_width;
          target = offset;
          setCarouselHeight(true);
        } else {
          scroll();
        }
      }, 200);
      $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);

      setupEvents();
      scroll(offset);

      $(this).on('carouselNext', function (e, n, callback) {
        if (n === undefined) {
          n = 1;
        }
        if (typeof callback === "function") {
          oneTimeCallback = callback;
        }

        target = dim * Math.round(offset / dim) + dim * n;
        if (offset !== target) {
          amplitude = target - offset;
          timestamp = Date.now();
          requestAnimationFrame(autoScroll);
        }
      });

      $(this).on('carouselPrev', function (e, n, callback) {
        if (n === undefined) {
          n = 1;
        }
        if (typeof callback === "function") {
          oneTimeCallback = callback;
        }

        target = dim * Math.round(offset / dim) - dim * n;
        if (offset !== target) {
          amplitude = target - offset;
          timestamp = Date.now();
          requestAnimationFrame(autoScroll);
        }
      });

      $(this).on('carouselSet', function (e, n, callback) {
        if (n === undefined) {
          n = 0;
        }
        if (typeof callback === "function") {
          oneTimeCallback = callback;
        }

        cycleTo(n);
      });
    });
  },
  next: function (n, callback) {
    $(this).trigger('carouselNext', [n, callback]);
  },
  prev: function (n, callback) {
    $(this).trigger('carouselPrev', [n, callback]);
  },
  set: function (n, callback) {
    $(this).trigger('carouselSet', [n, callback]);
  },
  destroy: function () {
    var uniqueNamespace = $(this).attr('data-namespace');
    $(this).removeAttr('data-namespace');
    $(this).removeClass('initialized');
    $(this).find('.indicators').remove();

    // Remove event handlers
    $(this).off('carouselNext carouselPrev carouselSet');
    $(window).off('resize.carousel-' + uniqueNamespace);
    if (typeof window.ontouchstart !== 'undefined') {
      $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
    }
    $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
  }
};

$.fn.carousel = function (methodOrOptions) {
  if (methods[methodOrOptions]) {
    return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
  } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
    // Default to "init"
    return methods.init.apply(this, arguments);
  } else {
    $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
  }
}; // Plugin end

})(jQuery); ;(function ($) {

var methods = {
  init: function (options) {
    return this.each(function () {
      var origin = $('#' + $(this).attr('data-activates'));
      var screen = $('body');

      // Creating tap target
      var tapTargetEl = $(this);
      var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
      var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
      var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
      var tapTargetContentEl = tapTargetEl.find('.tap-target-content');

      // Creating wrapper
      if (!tapTargetWrapper.length) {
        tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
      }

      // Creating content
      if (!tapTargetContentEl.length) {
        tapTargetContentEl = $('<div class="tap-target-content"></div>');
        tapTargetEl.append(tapTargetContentEl);
      }

      // Creating foreground wave
      if (!tapTargetWave.length) {
        tapTargetWave = $('<div class="tap-target-wave"></div>');

        // Creating origin
        if (!tapTargetOriginEl.length) {
          tapTargetOriginEl = origin.clone(true, true);
          tapTargetOriginEl.addClass('tap-target-origin');
          tapTargetOriginEl.removeAttr('id');
          tapTargetOriginEl.removeAttr('style');
          tapTargetWave.append(tapTargetOriginEl);
        }

        tapTargetWrapper.append(tapTargetWave);
      }

      // Open
      var openTapTarget = function () {
        if (tapTargetWrapper.is('.open')) {
          return;
        }

        // Adding open class
        tapTargetWrapper.addClass('open');

        setTimeout(function () {
          tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
            closeTapTarget();
            tapTargetOriginEl.off('click.tapTarget');
          });

          $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
            closeTapTarget();
            $(document).off('click.tapTarget');
          });

          var throttledCalc = Materialize.throttle(function () {
            calculateTapTarget();
          }, 200);
          $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
        }, 0);
      };

      // Close
      var closeTapTarget = function () {
        if (!tapTargetWrapper.is('.open')) {
          return;
        }

        tapTargetWrapper.removeClass('open');
        tapTargetOriginEl.off('click.tapTarget');
        $(document).off('click.tapTarget');
        $(window).off('resize.tapTarget');
      };

      // Pre calculate
      var calculateTapTarget = function () {
        // Element or parent is fixed position?
        var isFixed = origin.css('position') === 'fixed';
        if (!isFixed) {
          var parents = origin.parents();
          for (var i = 0; i < parents.length; i++) {
            isFixed = $(parents[i]).css('position') == 'fixed';
            if (isFixed) {
              break;
            }
          }
        }

        // Calculating origin
        var originWidth = origin.outerWidth();
        var originHeight = origin.outerHeight();
        var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
        var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;

        // Calculating screen
        var windowWidth = $(window).width();
        var windowHeight = $(window).height();
        var centerX = windowWidth / 2;
        var centerY = windowHeight / 2;
        var isLeft = originLeft <= centerX;
        var isRight = originLeft > centerX;
        var isTop = originTop <= centerY;
        var isBottom = originTop > centerY;
        var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
        var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;

        // Calculating tap target
        var tapTargetWidth = tapTargetEl.outerWidth();
        var tapTargetHeight = tapTargetEl.outerHeight();
        var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
        var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
        var tapTargetPosition = isFixed ? 'fixed' : 'absolute';

        // Calculating content
        var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
        var tapTargetTextHeight = tapTargetHeight / 2;
        var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
        var tapTargetTextBottom = 0;
        var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
        var tapTargetTextRight = 0;
        var tapTargetTextPadding = originWidth;
        var tapTargetTextAlign = isBottom ? 'bottom' : 'top';

        // Calculating wave
        var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
        var tapTargetWaveHeight = tapTargetWaveWidth;
        var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
        var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;

        // Setting tap target
        var tapTargetWrapperCssObj = {};
        tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
        tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
        tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
        tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
        tapTargetWrapperCssObj.position = tapTargetPosition;
        tapTargetWrapper.css(tapTargetWrapperCssObj);

        // Setting content
        tapTargetContentEl.css({
          width: tapTargetTextWidth,
          height: tapTargetTextHeight,
          top: tapTargetTextTop,
          right: tapTargetTextRight,
          bottom: tapTargetTextBottom,
          left: tapTargetTextLeft,
          padding: tapTargetTextPadding,
          verticalAlign: tapTargetTextAlign
        });

        // Setting wave
        tapTargetWave.css({
          top: tapTargetWaveTop,
          left: tapTargetWaveLeft,
          width: tapTargetWaveWidth,
          height: tapTargetWaveHeight
        });
      };

      if (options == 'open') {
        calculateTapTarget();
        openTapTarget();
      }

      if (options == 'close') closeTapTarget();
    });
  },
  open: function () {},
  close: function () {}
};

$.fn.tapTarget = function (methodOrOptions) {
  if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);

  $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
};

})(jQuery);