Warning: Permanently added '169.63.101.78' (ED25519) to the list of known hosts. Running (timeout=18000): unbuffer mock --spec /var/lib/copr-rpmbuild/workspace/workdir-791wwy_l/cinnamon-session/cinnamon-session.spec --sources /var/lib/copr-rpmbuild/workspace/workdir-791wwy_l/cinnamon-session --resultdir /var/lib/copr-rpmbuild/results --uniqueext 1732355311.446954 -r /var/lib/copr-rpmbuild/results/configs/child.cfg --with toolchain_clang --with clang_lto INFO: mock.py version 5.9 starting (python version = 3.13.0, NVR = mock-5.9-1.fc41), args: /usr/libexec/mock/mock --spec /var/lib/copr-rpmbuild/workspace/workdir-791wwy_l/cinnamon-session/cinnamon-session.spec --sources /var/lib/copr-rpmbuild/workspace/workdir-791wwy_l/cinnamon-session --resultdir /var/lib/copr-rpmbuild/results --uniqueext 1732355311.446954 -r /var/lib/copr-rpmbuild/results/configs/child.cfg --with toolchain_clang --with clang_lto Start(bootstrap): init plugins INFO: tmpfs initialized INFO: selinux enabled INFO: chroot_scan: initialized INFO: compress_logs: initialized Finish(bootstrap): init plugins Start: init plugins INFO: tmpfs initialized INFO: selinux enabled INFO: chroot_scan: initialized INFO: compress_logs: initialized Finish: init plugins INFO: Signal handler active Start: run INFO: Start(/var/lib/copr-rpmbuild/workspace/workdir-791wwy_l/cinnamon-session/cinnamon-session.spec) Config(fedora-41-s390x) Start: clean chroot Finish: clean chroot Mock Version: 5.9 INFO: Mock Version: 5.9 Start(bootstrap): chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-41-s390x-bootstrap-1732355311.446954/root. INFO: calling preinit hooks INFO: enabled root cache INFO: enabled package manager cache Start(bootstrap): cleaning package manager metadata Finish(bootstrap): cleaning package manager metadata INFO: Guessed host environment type: unknown INFO: Using bootstrap image: registry.fedoraproject.org/fedora:41 INFO: Pulling image: registry.fedoraproject.org/fedora:41 INFO: Copy content of container registry.fedoraproject.org/fedora:41 to /var/lib/mock/fedora-41-s390x-bootstrap-1732355311.446954/root INFO: Checking that registry.fedoraproject.org/fedora:41 image matches host's architecture INFO: mounting registry.fedoraproject.org/fedora:41 with podman image mount INFO: image registry.fedoraproject.org/fedora:41 as /var/lib/containers/storage/overlay/ee56e34a791fd929e332418c77b29ea54e8e3a1e32aa97e17d7f18cbc6584357/merged INFO: umounting image registry.fedoraproject.org/fedora:41 (/var/lib/containers/storage/overlay/ee56e34a791fd929e332418c77b29ea54e8e3a1e32aa97e17d7f18cbc6584357/merged) with podman image umount INFO: Package manager dnf5 detected and used (fallback) INFO: Not updating bootstrap chroot, bootstrap_image_ready=True Start(bootstrap): creating root cache Finish(bootstrap): creating root cache Finish(bootstrap): chroot init Start: chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-41-s390x-1732355311.446954/root. INFO: calling preinit hooks INFO: enabled root cache INFO: enabled package manager cache Start: cleaning package manager metadata Finish: cleaning package manager metadata INFO: enabled HW Info plugin INFO: Package manager dnf5 detected and used (direct choice) INFO: Buildroot is handled by package management downloaded with a bootstrap image: rpm-4.20.0-1.fc41.s390x rpm-sequoia-1.7.0-2.fc41.s390x dnf5-5.2.7.0-1.fc41.s390x dnf5-plugins-5.2.7.0-1.fc41.s390x Start: installing minimal buildroot with dnf5 Updating and loading repositories: updates 100% | 80.8 KiB/s | 5.1 KiB | 00m00s fedora 100% | 181.0 KiB/s | 4.5 KiB | 00m00s Copr repository 100% | 90.1 KiB/s | 1.5 KiB | 00m00s Additional repo copr_tstellar_fedora_c 100% | 100.7 KiB/s | 1.5 KiB | 00m00s Additional repo copr_fedora_llvm_team_ 100% | 101.6 KiB/s | 1.5 KiB | 00m00s Copr repository 100% | 20.2 MiB/s | 972.2 KiB | 00m00s Repositories loaded. Package Arch Version Repository Size Installing group/module packages: bash s390x 5.2.32-1.fc41 fedora 8.3 MiB bzip2 s390x 1.0.8-19.fc41 fedora 99.2 KiB coreutils s390x 9.5-11.fc41 updates 5.5 MiB cpio s390x 2.15-2.fc41 copr_base 1.1 MiB diffutils s390x 3.10-8.fc41 copr_base 1.6 MiB fedora-release-common noarch 41-28 updates 19.7 KiB findutils s390x 1:4.10.0-4.fc41 fedora 1.9 MiB gawk s390x 5.3.0-4.fc41 fedora 1.8 MiB glibc-minimal-langpack s390x 2.40-11.fc41 updates 0.0 B grep s390x 3.11-9.fc41 copr_base 1.0 MiB gzip s390x 1.13-2.fc41 copr_base 420.7 KiB info s390x 7.1-3.fc41 fedora 405.1 KiB patch s390x 2.7.6-25.fc41 copr_base 347.0 KiB redhat-rpm-config noarch 293-1.fc41 fedora 183.5 KiB rpm-build s390x 4.20.0-1.fc41 fedora 164.5 KiB sed s390x 4.9-3.fc41 fedora 873.2 KiB shadow-utils s390x 2:4.15.1-12.fc41 fedora 4.0 MiB tar s390x 2:1.35-4.fc41 copr_base 3.1 MiB unzip s390x 6.0-64.fc41 fedora 410.0 KiB util-linux s390x 2.40.2-4.fc41 fedora 3.7 MiB which s390x 2.21-42.fc41 fedora 83.9 KiB xz s390x 1:5.6.2-2.fc41 fedora 1.2 MiB Installing dependencies: add-determinism s390x 0.3.6-3.fc41 updates 3.1 MiB alternatives s390x 1.30-1.fc41 fedora 70.1 KiB ansible-srpm-macros noarch 1-16.fc41 fedora 35.7 KiB audit-libs s390x 4.0.2-1.fc41 fedora 350.9 KiB authselect s390x 1.5.0-8.fc41 fedora 153.3 KiB authselect-libs s390x 1.5.0-8.fc41 fedora 819.5 KiB basesystem noarch 11-21.fc41 fedora 0.0 B binutils s390x 2.43.1-2.fc41 fedora 26.9 MiB build-reproducibility-srpm-macros noarch 0.3.6-3.fc41 updates 735.0 B bzip2-libs s390x 1.0.8-19.fc41 fedora 88.5 KiB ca-certificates noarch 2024.2.69_v8.0.401-1.0.fc41 fedora 2.4 MiB coreutils-common s390x 9.5-11.fc41 updates 11.2 MiB cracklib s390x 2.9.11-6.fc41 copr_base 225.3 KiB crypto-policies noarch 20241029-1.git8baf557.fc41 updates 136.9 KiB curl s390x 8.9.1-2.fc41 fedora 828.0 KiB cyrus-sasl-lib s390x 2.1.28-27.fc41 fedora 2.4 MiB debugedit s390x 5.1-1.fc41 copr_base 203.0 KiB dwz s390x 0.15-8.fc41 fedora 314.6 KiB ed s390x 1.20.2-2.fc41 fedora 150.6 KiB efi-srpm-macros noarch 5-12.fc41 fedora 40.1 KiB elfutils s390x 0.192-6.fc41 updates 3.0 MiB elfutils-debuginfod-client s390x 0.192-6.fc41 updates 75.7 KiB elfutils-default-yama-scope noarch 0.192-6.fc41 updates 1.8 KiB elfutils-libelf s390x 0.192-6.fc41 updates 1.2 MiB elfutils-libs s390x 0.192-6.fc41 updates 758.2 KiB fedora-gpg-keys noarch 41-1 fedora 126.4 KiB fedora-release noarch 41-28 updates 0.0 B fedora-release-identity-basic noarch 41-28 updates 682.0 B fedora-repos noarch 41-1 fedora 4.9 KiB file s390x 5.45-7.fc41 fedora 103.3 KiB file-libs s390x 5.45-7.fc41 fedora 9.9 MiB filesystem s390x 3.18-23.fc41 fedora 106.0 B fonts-srpm-macros noarch 1:2.0.5-17.fc41 fedora 55.8 KiB forge-srpm-macros noarch 0.3.2-1.fc41 fedora 39.0 KiB fpc-srpm-macros noarch 1.3-13.fc41 fedora 144.0 B gdb-minimal s390x 15.2-3.fc41 updates 15.0 MiB gdbm s390x 1:1.23-7.fc41 fedora 483.9 KiB gdbm-libs s390x 1:1.23-7.fc41 fedora 133.4 KiB ghc-srpm-macros noarch 1.9.1-2.fc41 fedora 747.0 B glibc s390x 2.40-11.fc41 updates 5.1 MiB glibc-common s390x 2.40-11.fc41 updates 1.1 MiB glibc-gconv-extra s390x 2.40-11.fc41 updates 6.8 MiB gmp s390x 1:6.3.0-2.fc41 fedora 770.0 KiB gnat-srpm-macros noarch 6-6.fc41 fedora 1.0 KiB go-srpm-macros noarch 3.6.0-3.fc41 fedora 60.8 KiB jansson s390x 2.13.1-10.fc41 copr_base 108.2 KiB json-c s390x 0.17-4.fc41 copr_base 86.0 KiB kernel-srpm-macros noarch 1.0-24.fc41 fedora 1.9 KiB keyutils-libs s390x 1.6.3-4.fc41 fedora 54.2 KiB krb5-libs s390x 1.21.3-3.fc41 updates 2.4 MiB libacl s390x 2.3.2-2.fc41 fedora 43.8 KiB libarchive s390x 3.7.4-4.fc41 updates 1.0 MiB libattr s390x 2.5.2-4.fc41 fedora 28.3 KiB libblkid s390x 2.40.2-4.fc41 fedora 286.5 KiB libbrotli s390x 1.1.0-5.fc41 copr_base 972.4 KiB libcap s390x 2.70-4.fc41 fedora 234.2 KiB libcap-ng s390x 0.8.5-3.fc41 fedora 76.7 KiB libcom_err s390x 1.47.1-6.fc41 fedora 59.0 KiB libcurl s390x 8.9.1-2.fc41 fedora 870.1 KiB libeconf s390x 0.6.2-3.fc41 fedora 61.8 KiB libevent s390x 2.1.12-14.fc41 copr_base 988.7 KiB libfdisk s390x 2.40.2-4.fc41 fedora 394.8 KiB libffi s390x 3.4.6-3.fc41 fedora 65.9 KiB libgcc s390x 14.2.1-3.fc41 fedora 173.2 KiB libgomp s390x 14.2.1-3.fc41 fedora 531.2 KiB libidn2 s390x 2.3.7-2.fc41 copr_base 328.7 KiB libmount s390x 2.40.2-4.fc41 fedora 375.8 KiB libnghttp2 s390x 1.62.1-2.fc41 fedora 178.0 KiB libnsl2 s390x 2.0.1-2.fc41 fedora 61.7 KiB libpkgconf s390x 2.3.0-1.fc41 fedora 85.9 KiB libpsl s390x 0.21.5-4.fc41 fedora 80.3 KiB libpwquality s390x 1.4.5-11.fc41 fedora 420.9 KiB libselinux s390x 3.7-5.fc41 fedora 188.9 KiB libsemanage s390x 3.7-2.fc41 copr_base 321.8 KiB libsepol s390x 3.7-2.fc41 copr_base 988.3 KiB libsmartcols s390x 2.40.2-4.fc41 fedora 192.2 KiB libssh s390x 0.10.6-8.fc41 fedora 529.0 KiB libssh-config noarch 0.10.6-8.fc41 fedora 277.0 B libstdc++ s390x 14.2.1-3.fc41 fedora 3.1 MiB libtasn1 s390x 4.19.0-9.fc41 fedora 187.5 KiB libtirpc s390x 1.3.6-1.fc41 copr_base 235.1 KiB libtool-ltdl s390x 2.4.7-12.fc41 fedora 74.0 KiB libunistring s390x 1.1-8.fc41 fedora 1.8 MiB libutempter s390x 1.2.1-15.fc41 copr_base 48.8 KiB libuuid s390x 2.40.2-4.fc41 fedora 37.3 KiB libverto s390x 0.3.2-9.fc41 fedora 29.3 KiB libxcrypt s390x 4.4.36-10.fc41 updates 271.3 KiB libxml2 s390x 2.12.8-2.fc41 copr_base 2.4 MiB libzstd s390x 1.5.6-2.fc41 fedora 875.7 KiB lua-libs s390x 5.4.6-6.fc41 fedora 320.9 KiB lua-srpm-macros noarch 1-14.fc41 fedora 1.3 KiB lz4-libs s390x 1.10.0-1.fc41 copr_base 229.0 KiB mpfr s390x 4.2.1-5.fc41 copr_base 782.4 KiB ncurses-base noarch 6.5-2.20240629.fc41 fedora 326.3 KiB ncurses-libs s390x 6.5-2.20240629.fc41 fedora 1.1 MiB ocaml-srpm-macros noarch 10-3.fc41 fedora 1.9 KiB openblas-srpm-macros noarch 2-18.fc41 fedora 112.0 B openldap s390x 2.6.8-5.fc41 fedora 683.6 KiB openssl-libs s390x 1:3.2.2-9.fc41 fedora 6.1 MiB p11-kit s390x 0.25.5-3.fc41 fedora 2.5 MiB p11-kit-trust s390x 0.25.5-3.fc41 fedora 475.2 KiB package-notes-srpm-macros noarch 0.5-12.fc41 fedora 1.6 KiB pam s390x 1.6.1-6.fc41 updates 1.5 MiB pam-libs s390x 1.6.1-6.fc41 updates 122.3 KiB pcre2 s390x 10.44-1.fc41.1 copr_base 843.8 KiB pcre2-syntax noarch 10.44-1.fc41.1 copr_base 251.6 KiB perl-srpm-macros noarch 1-56.fc41 fedora 861.0 B pkgconf s390x 2.3.0-1.fc41 fedora 92.4 KiB pkgconf-m4 noarch 2.3.0-1.fc41 fedora 14.4 KiB pkgconf-pkg-config s390x 2.3.0-1.fc41 fedora 988.0 B popt s390x 1.19-7.fc41 copr_base 136.4 KiB publicsuffix-list-dafsa noarch 20240107-4.fc41 fedora 67.5 KiB pyproject-srpm-macros noarch 1.16.0-1.fc41 updates 1.9 KiB python-srpm-macros noarch 3.13-3.fc41 fedora 51.0 KiB qt5-srpm-macros noarch 5.15.15-1.fc41 fedora 500.0 B qt6-srpm-macros noarch 6.8.0-1.fc41 updates 456.0 B readline s390x 8.2-10.fc41 copr_base 552.6 KiB rpm s390x 4.20.0-1.fc41 fedora 3.0 MiB rpm-build-libs s390x 4.20.0-1.fc41 fedora 214.4 KiB rpm-libs s390x 4.20.0-1.fc41 fedora 805.5 KiB rpm-sequoia s390x 1.7.0-2.fc41 fedora 3.2 MiB rust-srpm-macros noarch 26.3-3.fc41 fedora 4.8 KiB setup noarch 2.15.0-5.fc41 fedora 720.7 KiB sqlite-libs s390x 3.46.1-1.fc41 copr_base 2.0 MiB systemd-libs s390x 256.8-1.fc41 updates 2.1 MiB util-linux-core s390x 2.40.2-4.fc41 fedora 1.5 MiB xxhash-libs s390x 0.8.2-4.fc41 fedora 60.0 KiB xz-libs s390x 1:5.6.2-2.fc41 fedora 226.1 KiB zig-srpm-macros noarch 1-3.fc41 fedora 1.1 KiB zip s390x 3.0-41.fc41 fedora 750.2 KiB zlib-ng-compat s390x 2.1.7-3.fc41 copr_base 129.0 KiB zstd s390x 1.5.6-2.fc41 fedora 1.8 MiB Installing groups: Buildsystem building group Transaction Summary: Installing: 154 packages Total size of inbound packages is 54 MiB. Need to download 0 B. After this operation, 184 MiB extra will be used (install 184 MiB, remove 0 B). [1/1] bzip2-0:1.0.8-19.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [1/1] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/2] redhat-rpm-config-0:293-1.fc41.no 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [2/2] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/3] rpm-build-0:4.20.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [3/3] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/4] unzip-0:6.0-64.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [4/4] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/5] which-0:2.21-42.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [5/5] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/6] bash-0:5.2.32-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [6/6] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/7] sed-0:4.9-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [7/7] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/8] shadow-utils-2:4.15.1-12.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [8/8] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/9] util-linux-0:2.40.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [9/9] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/10] findutils-1:4.10.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [10/10] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/11] gawk-0:5.3.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [11/11] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/12] info-0:7.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [12/12] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/13] xz-1:5.6.2-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [13/13] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/14] tar-2:1.35-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [14/14] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/15] cpio-0:2.15-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [15/15] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/16] coreutils-0:9.5-11.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [16/16] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/17] grep-0:3.11-9.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [17/17] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/18] patch-0:2.7.6-25.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [18/18] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/19] diffutils-0:3.10-8.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [19/19] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/20] fedora-release-common-0:41-28.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [20/20] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/21] glibc-minimal-langpack-0:2.40-1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [21/21] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/22] gzip-0:1.13-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [22/22] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/23] bzip2-libs-0:1.0.8-19.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [23/23] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/24] ansible-srpm-macros-0:1-16.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [24/24] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/25] dwz-0:0.15-8.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [25/25] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/26] efi-srpm-macros-0:5-12.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [26/26] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/27] file-0:5.45-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [27/27] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/28] fonts-srpm-macros-1:2.0.5-17.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [28/28] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/29] forge-srpm-macros-0:0.3.2-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [29/29] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/30] fpc-srpm-macros-0:1.3-13.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [30/30] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/31] ghc-srpm-macros-0:1.9.1-2.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [31/31] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/32] gnat-srpm-macros-0:6-6.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [32/32] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/33] go-srpm-macros-0:3.6.0-3.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [33/33] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/34] kernel-srpm-macros-0:1.0-24.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [34/34] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/35] lua-srpm-macros-0:1-14.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [35/35] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/36] ocaml-srpm-macros-0:10-3.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [36/36] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/37] openblas-srpm-macros-0:2-18.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [37/37] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/38] package-notes-srpm-macros-0:0.5 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [38/38] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/39] perl-srpm-macros-0:1-56.fc41.no 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [39/39] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/40] python-srpm-macros-0:3.13-3.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [40/40] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/41] qt5-srpm-macros-0:5.15.15-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [41/41] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/42] rpm-0:4.20.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [42/42] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/43] rust-srpm-macros-0:26.3-3.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [43/43] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/44] zig-srpm-macros-0:1-3.fc41.noar 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [44/44] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/45] zip-0:3.0-41.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [45/45] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/46] binutils-0:2.43.1-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [46/46] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/47] pkgconf-pkg-config-0:2.3.0-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [47/47] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/48] rpm-build-libs-0:4.20.0-1.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [48/48] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/49] rpm-libs-0:4.20.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [49/49] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/50] zstd-0:1.5.6-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [50/50] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/51] filesystem-0:3.18-23.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [51/51] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/52] ncurses-libs-0:6.5-2.20240629.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [52/52] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/53] libacl-0:2.3.2-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [53/53] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/54] libselinux-0:3.7-5.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [54/54] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/55] audit-libs-0:4.0.2-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [55/55] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/56] libattr-0:2.5.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [56/56] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/57] libeconf-0:0.6.2-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [57/57] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/58] setup-0:2.15.0-5.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [58/58] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/59] authselect-libs-0:1.5.0-8.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [59/59] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/60] libblkid-0:2.40.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [60/60] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/61] libcap-ng-0:0.8.5-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [61/61] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/62] libfdisk-0:2.40.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [62/62] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/63] libmount-0:2.40.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [63/63] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/64] libsmartcols-0:2.40.2-4.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [64/64] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/65] libuuid-0:2.40.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [65/65] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/66] util-linux-core-0:2.40.2-4.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [66/66] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/67] gmp-1:6.3.0-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [67/67] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/68] xz-libs-1:5.6.2-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [68/68] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/69] coreutils-common-0:9.5-11.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [69/69] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/70] libcap-0:2.70-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [70/70] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/71] openssl-libs-1:3.2.2-9.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [71/71] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/72] ed-0:1.20.2-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [72/72] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/73] fedora-repos-0:41-1.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [73/73] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/74] glibc-0:2.40-11.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [74/74] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/75] glibc-common-0:2.40-11.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [75/75] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/76] file-libs-0:5.45-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [76/76] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/77] curl-0:8.9.1-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [77/77] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/78] alternatives-0:1.30-1.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [78/78] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/79] libgcc-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [79/79] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/80] libstdc++-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [80/80] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/81] pkgconf-0:2.3.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [81/81] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/82] pkgconf-m4-0:2.3.0-1.fc41.noarc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [82/82] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/83] libgomp-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [83/83] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/84] lua-libs-0:5.4.6-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [84/84] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/85] libzstd-0:1.5.6-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [85/85] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/86] rpm-sequoia-0:1.7.0-2.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [86/86] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/87] ncurses-base-0:6.5-2.20240629.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [87/87] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/88] ca-certificates-0:2024.2.69_v8. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [88/88] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/89] fedora-gpg-keys-0:41-1.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [89/89] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/90] glibc-gconv-extra-0:2.40-11.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [90/90] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/91] basesystem-0:11-21.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [91/91] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/92] libpkgconf-0:2.3.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [92/92] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/93] libffi-0:3.4.6-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [93/93] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/94] p11-kit-0:0.25.5-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [94/94] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/95] p11-kit-trust-0:0.25.5-3.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [95/95] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/96] libtasn1-0:4.19.0-9.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [96/96] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/97] pcre2-0:10.44-1.fc41.1.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [97/97] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/98] lz4-libs-0:1.10.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [98/98] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/99] zlib-ng-compat-0:2.1.7-3.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [99/99] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/100] libxcrypt-0:4.4.36-10.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [100/100] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/101] systemd-libs-0:256.8-1.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [101/101] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/102] pam-0:1.6.1-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [102/102] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/103] pam-libs-0:1.6.1-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [103/103] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/104] authselect-0:1.5.0-8.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [104/104] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/105] gdbm-1:1.23-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [105/105] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/106] gdbm-libs-1:1.23-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [106/106] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/107] libnsl2-0:2.0.1-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [107/107] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/108] libpwquality-0:1.4.5-11.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [108/108] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/109] libutempter-0:1.2.1-15.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [109/109] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/110] readline-0:8.2-10.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [110/110] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/111] libsemanage-0:3.7-2.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [111/111] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/112] popt-0:1.19-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [112/112] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/113] sqlite-libs-0:3.46.1-1.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [113/113] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/114] elfutils-libelf-0:0.192-6.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [114/114] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/115] elfutils-libs-0:0.192-6.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [115/115] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/116] elfutils-debuginfod-client-0: 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [116/116] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/117] elfutils-0:0.192-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [117/117] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/118] debugedit-0:5.1-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [118/118] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/119] libarchive-0:3.7.4-4.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [119/119] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/120] build-reproducibility-srpm-ma 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [120/120] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/121] add-determinism-0:0.3.6-3.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [121/121] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/122] pyproject-srpm-macros-0:1.16. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [122/122] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/123] qt6-srpm-macros-0:6.8.0-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [123/123] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/124] crypto-policies-0:20241029-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [124/124] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/125] libsepol-0:3.7-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [125/125] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/126] cracklib-0:2.9.11-6.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [126/126] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/127] libtirpc-0:1.3.6-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [127/127] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/128] libcom_err-0:1.47.1-6.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [128/128] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/129] mpfr-0:4.2.1-5.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [129/129] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/130] jansson-0:2.13.1-10.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [130/130] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/131] libxml2-0:2.12.8-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [131/131] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/132] elfutils-default-yama-scope-0 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [132/132] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/133] json-c-0:0.17-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [133/133] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/134] pcre2-syntax-0:10.44-1.fc41.1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [134/134] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/135] krb5-libs-0:1.21.3-3.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [135/135] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/136] keyutils-libs-0:1.6.3-4.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [136/136] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/137] libverto-0:0.3.2-9.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [137/137] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/138] fedora-release-0:41-28.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [138/138] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/139] gdb-minimal-0:15.2-3.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [139/139] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/140] xxhash-libs-0:0.8.2-4.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [140/140] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/141] libcurl-0:8.9.1-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [141/141] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/142] libnghttp2-0:1.62.1-2.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [142/142] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/143] libpsl-0:0.21.5-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [143/143] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/144] libssh-0:0.10.6-8.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [144/144] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/145] openldap-0:2.6.8-5.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [145/145] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/146] libunistring-0:1.1-8.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [146/146] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/147] publicsuffix-list-dafsa-0:202 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [147/147] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/148] libssh-config-0:0.10.6-8.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [148/148] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/149] cyrus-sasl-lib-0:2.1.28-27.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [149/149] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/150] libtool-ltdl-0:2.4.7-12.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [150/150] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/151] fedora-release-identity-basic 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [151/151] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/152] libevent-0:2.1.12-14.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [152/152] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/153] libidn2-0:2.3.7-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [153/153] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/154] libbrotli-0:1.1.0-5.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [154/154] Total 100% | 0.0 B/s | 0.0 B | 00m00s Running transaction Importing PGP key 0xE99D6AD1: UserID : "Fedora (41) " Fingerprint: 466CF2D8B60BC3057AA9453ED0622462E99D6AD1 From : file:///usr/share/distribution-gpg-keys/fedora/RPM-GPG-KEY-fedora-41-primary The key was successfully imported. [ 1/156] Verify package files 100% | 781.0 B/s | 154.0 B | 00m00s >>> Running pre-transaction scriptlet: filesystem-0:3.18-23.fc41.s390x >>> Finished pre-transaction scriptlet: filesystem-0:3.18-23.fc41.s390x >>> [RPM] /var/lib/mock/fedora-41-s390x-1732355311.446954/root/var/cache/dnf/cop [ 2/156] Prepare transaction 100% | 3.1 KiB/s | 154.0 B | 00m00s [ 3/156] Installing libgcc-0:14.2.1-3. 100% | 170.8 MiB/s | 174.9 KiB | 00m00s [ 4/156] Installing fedora-release-ide 100% | 0.0 B/s | 940.0 B | 00m00s [ 5/156] Installing fedora-gpg-keys-0: 100% | 33.6 MiB/s | 172.2 KiB | 00m00s [ 6/156] Installing fedora-repos-0:41- 100% | 0.0 B/s | 5.7 KiB | 00m00s [ 7/156] Installing fedora-release-com 100% | 23.4 MiB/s | 24.0 KiB | 00m00s [ 8/156] Installing fedora-release-0:4 100% | 0.0 B/s | 124.0 B | 00m00s [ 9/156] Installing setup-0:2.15.0-5.f 100% | 50.6 MiB/s | 726.1 KiB | 00m00s >>> [RPM] /etc/hosts created as /etc/hosts.rpmnew [ 10/156] Installing filesystem-0:3.18- 100% | 3.1 MiB/s | 212.5 KiB | 00m00s [ 11/156] Installing basesystem-0:11-21 100% | 0.0 B/s | 124.0 B | 00m00s [ 12/156] Installing libssh-config-0:0. 100% | 0.0 B/s | 816.0 B | 00m00s [ 13/156] Installing publicsuffix-list- 100% | 0.0 B/s | 68.3 KiB | 00m00s [ 14/156] Installing pcre2-syntax-0:10. 100% | 248.1 MiB/s | 254.1 KiB | 00m00s [ 15/156] Installing qt6-srpm-macros-0: 100% | 0.0 B/s | 732.0 B | 00m00s [ 16/156] Installing ncurses-base-0:6.5 100% | 85.9 MiB/s | 351.7 KiB | 00m00s [ 17/156] Installing glibc-minimal-lang 100% | 0.0 B/s | 124.0 B | 00m00s [ 18/156] Installing ncurses-libs-0:6.5 100% | 212.5 MiB/s | 1.1 MiB | 00m00s [ 19/156] Installing glibc-0:2.40-11.fc 100% | 232.4 MiB/s | 5.1 MiB | 00m00s [ 20/156] Installing bash-0:5.2.32-1.fc 100% | 348.5 MiB/s | 8.4 MiB | 00m00s [ 21/156] Installing glibc-common-0:2.4 100% | 179.3 MiB/s | 1.1 MiB | 00m00s [ 22/156] Installing glibc-gconv-extra- 100% | 228.6 MiB/s | 6.9 MiB | 00m00s [ 23/156] Installing zlib-ng-compat-0:2 100% | 126.8 MiB/s | 129.8 KiB | 00m00s [ 24/156] Installing bzip2-libs-0:1.0.8 100% | 0.0 B/s | 89.6 KiB | 00m00s [ 25/156] Installing xz-libs-1:5.6.2-2. 100% | 221.9 MiB/s | 227.2 KiB | 00m00s [ 26/156] Installing libuuid-0:2.40.2-4 100% | 0.0 B/s | 38.4 KiB | 00m00s [ 27/156] Installing readline-0:8.2-10. 100% | 270.9 MiB/s | 554.8 KiB | 00m00s [ 28/156] Installing popt-0:1.19-7.fc41 100% | 69.8 MiB/s | 143.0 KiB | 00m00s [ 29/156] Installing libblkid-0:2.40.2- 100% | 280.8 MiB/s | 287.6 KiB | 00m00s [ 30/156] Installing libattr-0:2.5.2-4. 100% | 0.0 B/s | 29.3 KiB | 00m00s [ 31/156] Installing libacl-0:2.3.2-2.f 100% | 0.0 B/s | 44.6 KiB | 00m00s [ 32/156] Installing gmp-1:6.3.0-2.fc41 100% | 251.4 MiB/s | 772.2 KiB | 00m00s [ 33/156] Installing libstdc++-0:14.2.1 100% | 312.3 MiB/s | 3.1 MiB | 00m00s [ 34/156] Installing libzstd-0:1.5.6-2. 100% | 285.5 MiB/s | 877.0 KiB | 00m00s [ 35/156] Installing elfutils-libelf-0: 100% | 392.6 MiB/s | 1.2 MiB | 00m00s [ 36/156] Installing libxcrypt-0:4.4.36 100% | 267.6 MiB/s | 274.0 KiB | 00m00s [ 37/156] Installing libeconf-0:0.6.2-3 100% | 0.0 B/s | 63.5 KiB | 00m00s [ 38/156] Installing gdbm-libs-1:1.23-7 100% | 132.0 MiB/s | 135.1 KiB | 00m00s [ 39/156] Installing dwz-0:0.15-8.fc41. 100% | 308.6 MiB/s | 316.0 KiB | 00m00s [ 40/156] Installing mpfr-0:4.2.1-5.fc4 100% | 255.2 MiB/s | 784.1 KiB | 00m00s [ 41/156] Installing gawk-0:5.3.0-4.fc4 100% | 259.2 MiB/s | 1.8 MiB | 00m00s [ 42/156] Installing unzip-0:6.0-64.fc4 100% | 201.9 MiB/s | 413.5 KiB | 00m00s [ 43/156] Installing file-libs-0:5.45-7 100% | 585.0 MiB/s | 9.9 MiB | 00m00s [ 44/156] Installing file-0:5.45-7.fc41 100% | 17.0 MiB/s | 104.8 KiB | 00m00s >>> Running pre-install scriptlet: crypto-policies-0:20241029-1.git8baf557.fc41. >>> Finished pre-install scriptlet: crypto-policies-0:20241029-1.git8baf557.fc41 >>> Scriptlet output: >>> /var/tmp/rpm-tmp.HNnXFU: line 2: rm: command not found >>> [ 45/156] Installing crypto-policies-0: 100% | 31.9 MiB/s | 163.3 KiB | 00m00s [ 46/156] Installing libcap-ng-0:0.8.5- 100% | 76.7 MiB/s | 78.6 KiB | 00m00s [ 47/156] Installing audit-libs-0:4.0.2 100% | 172.4 MiB/s | 353.0 KiB | 00m00s [ 48/156] Installing pam-libs-0:1.6.1-6 100% | 121.7 MiB/s | 124.6 KiB | 00m00s [ 49/156] Installing libcap-0:2.70-4.fc 100% | 116.8 MiB/s | 239.2 KiB | 00m00s [ 50/156] Installing systemd-libs-0:256 100% | 257.4 MiB/s | 2.1 MiB | 00m00s [ 51/156] Installing libsmartcols-0:2.4 100% | 188.9 MiB/s | 193.4 KiB | 00m00s [ 52/156] Installing alternatives-0:1.3 100% | 0.0 B/s | 71.7 KiB | 00m00s [ 53/156] Installing lua-libs-0:5.4.6-6 100% | 314.5 MiB/s | 322.1 KiB | 00m00s [ 54/156] Installing libffi-0:3.4.6-3.f 100% | 0.0 B/s | 67.3 KiB | 00m00s [ 55/156] Installing libtasn1-0:4.19.0- 100% | 184.9 MiB/s | 189.3 KiB | 00m00s [ 56/156] Installing p11-kit-0:0.25.5-3 100% | 250.4 MiB/s | 2.5 MiB | 00m00s [ 57/156] Installing pcre2-0:10.44-1.fc 100% | 275.1 MiB/s | 845.2 KiB | 00m00s [ 58/156] Installing grep-0:3.11-9.fc41 100% | 207.7 MiB/s | 1.0 MiB | 00m00s [ 59/156] Installing xz-1:5.6.2-2.fc41. 100% | 241.7 MiB/s | 1.2 MiB | 00m00s [ 60/156] Installing lz4-libs-0:1.10.0- 100% | 224.7 MiB/s | 230.1 KiB | 00m00s [ 61/156] Installing libsepol-0:3.7-2.f 100% | 322.0 MiB/s | 989.3 KiB | 00m00s [ 62/156] Installing libselinux-0:3.7-5 100% | 185.7 MiB/s | 190.1 KiB | 00m00s [ 63/156] Installing sed-0:4.9-3.fc41.s 100% | 215.2 MiB/s | 881.4 KiB | 00m00s [ 64/156] Installing findutils-1:4.10.0 100% | 270.4 MiB/s | 1.9 MiB | 00m00s [ 65/156] Installing libmount-0:2.40.2- 100% | 184.1 MiB/s | 376.9 KiB | 00m00s [ 66/156] Installing libcom_err-0:1.47. 100% | 0.0 B/s | 60.1 KiB | 00m00s [ 67/156] Installing libunistring-0:1.1 100% | 295.6 MiB/s | 1.8 MiB | 00m00s [ 68/156] Installing libidn2-0:2.3.7-2. 100% | 163.4 MiB/s | 334.6 KiB | 00m00s [ 69/156] Installing libpsl-0:0.21.5-4. 100% | 79.5 MiB/s | 81.4 KiB | 00m00s [ 70/156] Installing util-linux-core-0: 100% | 216.1 MiB/s | 1.5 MiB | 00m00s [ 71/156] Installing tar-2:1.35-4.fc41. 100% | 313.1 MiB/s | 3.1 MiB | 00m00s [ 72/156] Installing libsemanage-0:3.7- 100% | 158.0 MiB/s | 323.6 KiB | 00m00s [ 73/156] Installing shadow-utils-2:4.1 100% | 157.2 MiB/s | 4.1 MiB | 00m00s [ 74/156] Installing libutempter-0:1.2. 100% | 49.6 MiB/s | 50.7 KiB | 00m00s [ 75/156] Installing zstd-0:1.5.6-2.fc4 100% | 305.8 MiB/s | 1.8 MiB | 00m00s [ 76/156] Installing p11-kit-trust-0:0. 100% | 77.6 MiB/s | 476.8 KiB | 00m00s [ 77/156] Installing zip-0:3.0-41.fc41. 100% | 245.5 MiB/s | 754.1 KiB | 00m00s [ 78/156] Installing gdbm-1:1.23-7.fc41 100% | 159.1 MiB/s | 488.8 KiB | 00m00s [ 79/156] Installing cyrus-sasl-lib-0:2 100% | 265.4 MiB/s | 2.4 MiB | 00m00s [ 80/156] Installing libfdisk-0:2.40.2- 100% | 193.3 MiB/s | 395.9 KiB | 00m00s [ 81/156] Installing libxml2-0:2.12.8-2 100% | 304.2 MiB/s | 2.4 MiB | 00m00s [ 82/156] Installing bzip2-0:1.0.8-19.f 100% | 101.3 MiB/s | 103.7 KiB | 00m00s [ 83/156] Installing sqlite-libs-0:3.46 100% | 281.3 MiB/s | 2.0 MiB | 00m00s [ 84/156] Installing add-determinism-0: 100% | 282.2 MiB/s | 3.1 MiB | 00m00s [ 85/156] Installing build-reproducibil 100% | 0.0 B/s | 1.0 KiB | 00m00s [ 86/156] Installing ed-0:1.20.2-2.fc41 100% | 149.3 MiB/s | 152.9 KiB | 00m00s [ 87/156] Installing patch-0:2.7.6-25.f 100% | 170.2 MiB/s | 348.5 KiB | 00m00s [ 88/156] Installing elfutils-default-y 100% | 510.7 KiB/s | 2.0 KiB | 00m00s [ 89/156] Installing elfutils-libs-0:0. 100% | 247.4 MiB/s | 760.1 KiB | 00m00s [ 90/156] Installing cpio-0:2.15-2.fc41 100% | 230.1 MiB/s | 1.2 MiB | 00m00s [ 91/156] Installing diffutils-0:3.10-8 100% | 271.5 MiB/s | 1.6 MiB | 00m00s [ 92/156] Installing libgomp-0:14.2.1-3 100% | 260.1 MiB/s | 532.6 KiB | 00m00s [ 93/156] Installing libpkgconf-0:2.3.0 100% | 0.0 B/s | 87.0 KiB | 00m00s [ 94/156] Installing pkgconf-0:2.3.0-1. 100% | 92.7 MiB/s | 94.9 KiB | 00m00s [ 95/156] Installing jansson-0:2.13.1-1 100% | 107.0 MiB/s | 109.6 KiB | 00m00s [ 96/156] Installing json-c-0:0.17-4.fc 100% | 85.2 MiB/s | 87.2 KiB | 00m00s [ 97/156] Installing keyutils-libs-0:1. 100% | 0.0 B/s | 55.6 KiB | 00m00s [ 98/156] Installing libverto-0:0.3.2-9 100% | 30.3 MiB/s | 31.1 KiB | 00m00s [ 99/156] Installing xxhash-libs-0:0.8. 100% | 0.0 B/s | 61.4 KiB | 00m00s [100/156] Installing libnghttp2-0:1.62. 100% | 174.9 MiB/s | 179.1 KiB | 00m00s [101/156] Installing libtool-ltdl-0:2.4 100% | 0.0 B/s | 75.1 KiB | 00m00s [102/156] Installing libbrotli-0:1.1.0- 100% | 238.0 MiB/s | 974.7 KiB | 00m00s [103/156] Installing pkgconf-m4-0:2.3.0 100% | 0.0 B/s | 14.8 KiB | 00m00s [104/156] Installing pkgconf-pkg-config 100% | 1.7 MiB/s | 1.8 KiB | 00m00s [105/156] Installing coreutils-common-0 100% | 339.1 MiB/s | 11.2 MiB | 00m00s [106/156] Installing openssl-libs-1:3.2 100% | 292.4 MiB/s | 6.1 MiB | 00m00s [107/156] Installing coreutils-0:9.5-11 100% | 254.0 MiB/s | 5.6 MiB | 00m00s [108/156] Installing ca-certificates-0: 100% | 2.0 MiB/s | 2.4 MiB | 00m01s [109/156] Installing krb5-libs-0:1.21.3 100% | 201.2 MiB/s | 2.4 MiB | 00m00s [110/156] Installing libarchive-0:3.7.4 100% | 248.2 MiB/s | 1.0 MiB | 00m00s [111/156] Installing libtirpc-0:1.3.6-1 100% | 231.3 MiB/s | 236.8 KiB | 00m00s [112/156] Installing gzip-0:1.13-2.fc41 100% | 138.7 MiB/s | 426.2 KiB | 00m00s [113/156] Installing authselect-libs-0: 100% | 163.0 MiB/s | 834.5 KiB | 00m00s [114/156] Installing cracklib-0:2.9.11- 100% | 77.0 MiB/s | 236.6 KiB | 00m00s [115/156] Installing libpwquality-0:1.4 100% | 105.8 MiB/s | 433.3 KiB | 00m00s [116/156] Installing libnsl2-0:2.0.1-2. 100% | 61.4 MiB/s | 62.8 KiB | 00m00s [117/156] Installing pam-0:1.6.1-6.fc41 100% | 132.1 MiB/s | 1.6 MiB | 00m00s [118/156] Installing libssh-0:0.10.6-8. 100% | 259.3 MiB/s | 531.1 KiB | 00m00s [119/156] Installing rpm-sequoia-0:1.7. 100% | 289.1 MiB/s | 3.2 MiB | 00m00s [120/156] Installing rpm-libs-0:4.20.0- 100% | 262.7 MiB/s | 807.1 KiB | 00m00s [121/156] Installing rpm-build-libs-0:4 100% | 210.2 MiB/s | 215.3 KiB | 00m00s [122/156] Installing libevent-0:2.1.12- 100% | 242.3 MiB/s | 992.4 KiB | 00m00s [123/156] Installing openldap-0:2.6.8-5 100% | 223.8 MiB/s | 687.4 KiB | 00m00s [124/156] Installing libcurl-0:8.9.1-2. 100% | 212.7 MiB/s | 871.2 KiB | 00m00s [125/156] Installing elfutils-debuginfo 100% | 38.0 MiB/s | 77.9 KiB | 00m00s [126/156] Installing binutils-0:2.43.1- 100% | 324.0 MiB/s | 26.9 MiB | 00m00s [127/156] Installing elfutils-0:0.192-6 100% | 298.0 MiB/s | 3.0 MiB | 00m00s [128/156] Installing gdb-minimal-0:15.2 100% | 311.5 MiB/s | 15.0 MiB | 00m00s [129/156] Installing debugedit-0:5.1-1. 100% | 200.9 MiB/s | 205.7 KiB | 00m00s [130/156] Installing curl-0:8.9.1-2.fc4 100% | 90.1 MiB/s | 830.5 KiB | 00m00s [131/156] Installing rpm-0:4.20.0-1.fc4 100% | 165.4 MiB/s | 2.5 MiB | 00m00s [132/156] Installing efi-srpm-macros-0: 100% | 0.0 B/s | 41.2 KiB | 00m00s [133/156] Installing lua-srpm-macros-0: 100% | 0.0 B/s | 1.9 KiB | 00m00s [134/156] Installing zig-srpm-macros-0: 100% | 0.0 B/s | 1.7 KiB | 00m00s [135/156] Installing rust-srpm-macros-0 100% | 0.0 B/s | 5.6 KiB | 00m00s [136/156] Installing qt5-srpm-macros-0: 100% | 0.0 B/s | 776.0 B | 00m00s [137/156] Installing perl-srpm-macros-0 100% | 0.0 B/s | 1.1 KiB | 00m00s [138/156] Installing package-notes-srpm 100% | 0.0 B/s | 2.0 KiB | 00m00s [139/156] Installing openblas-srpm-macr 100% | 0.0 B/s | 392.0 B | 00m00s [140/156] Installing ocaml-srpm-macros- 100% | 0.0 B/s | 2.2 KiB | 00m00s [141/156] Installing kernel-srpm-macros 100% | 0.0 B/s | 2.3 KiB | 00m00s [142/156] Installing gnat-srpm-macros-0 100% | 0.0 B/s | 1.3 KiB | 00m00s [143/156] Installing ghc-srpm-macros-0: 100% | 0.0 B/s | 1.0 KiB | 00m00s [144/156] Installing fpc-srpm-macros-0: 100% | 0.0 B/s | 420.0 B | 00m00s [145/156] Installing ansible-srpm-macro 100% | 0.0 B/s | 36.2 KiB | 00m00s [146/156] Installing fonts-srpm-macros- 100% | 0.0 B/s | 57.0 KiB | 00m00s [147/156] Installing forge-srpm-macros- 100% | 39.4 MiB/s | 40.4 KiB | 00m00s [148/156] Installing go-srpm-macros-0:3 100% | 0.0 B/s | 62.0 KiB | 00m00s [149/156] Installing python-srpm-macros 100% | 50.9 MiB/s | 52.2 KiB | 00m00s [150/156] Installing redhat-rpm-config- 100% | 92.8 MiB/s | 190.1 KiB | 00m00s [151/156] Installing rpm-build-0:4.20.0 100% | 84.5 MiB/s | 173.0 KiB | 00m00s [152/156] Installing pyproject-srpm-mac 100% | 2.4 MiB/s | 2.5 KiB | 00m00s [153/156] Installing util-linux-0:2.40. 100% | 163.9 MiB/s | 3.8 MiB | 00m00s [154/156] Installing authselect-0:1.5.0 100% | 77.0 MiB/s | 157.7 KiB | 00m00s [155/156] Installing which-0:2.21-42.fc 100% | 84.1 MiB/s | 86.1 KiB | 00m00s [156/156] Installing info-0:7.1-3.fc41. 100% | 339.9 KiB/s | 405.5 KiB | 00m01s Warning: skipped PGP checks for 26 packages from repository: copr_base Complete! Updating and loading repositories: fedora 100% | 82.3 KiB/s | 4.5 KiB | 00m00s updates 100% | 77.1 KiB/s | 5.1 KiB | 00m00s Copr repository 100% | 95.7 KiB/s | 1.5 KiB | 00m00s Additional repo copr_tstellar_fedora_c 100% | 100.7 KiB/s | 1.5 KiB | 00m00s Additional repo copr_fedora_llvm_team_ 100% | 101.6 KiB/s | 1.5 KiB | 00m00s Repositories loaded. Package Arch Version Repository Size Installing: fedora-clang-default-cc noarch 1-1.fc41 copr_tstellar_fedora_clang_default_cc 17.0 B Installing dependencies: annobin-docs noarch 12.69-1.fc41 fedora 97.7 KiB annobin-plugin-gcc s390x 12.69-1.fc41 fedora 984.8 KiB clang s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 191.7 KiB clang-libs s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 199.5 MiB clang-resource-filesystem s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 15.3 KiB compiler-rt s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 19.6 MiB cpp s390x 14.2.1-3.fc41 fedora 25.5 MiB expat s390x 2.6.4-1.fc41 updates 308.6 KiB gcc s390x 14.2.1-3.fc41 fedora 76.7 MiB gcc-c++ s390x 14.2.1-3.fc41 fedora 28.7 MiB gcc-plugin-annobin s390x 14.2.1-3.fc41 fedora 60.8 KiB glibc-devel s390x 2.40-11.fc41 updates 2.6 MiB kernel-headers s390x 6.11.3-300.fc41 fedora 6.4 MiB libasan s390x 14.2.1-3.fc41 fedora 1.6 MiB libatomic s390x 14.2.1-3.fc41 fedora 32.3 KiB libb2 s390x 0.98.1-12.fc41 copr_base 45.6 KiB libedit s390x 3.1-53.20240808cvs.fc41 copr_base 284.5 KiB libmpc s390x 1.3.1-6.fc41 copr_base 156.3 KiB libomp s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 7.9 MiB libstdc++-devel s390x 14.2.1-3.fc41 fedora 15.1 MiB libubsan s390x 14.2.1-3.fc41 fedora 491.3 KiB libxcrypt-devel s390x 4.4.36-10.fc41 updates 30.5 KiB lld s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 44.0 KiB lld-libs s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 9.4 MiB llvm s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 118.8 MiB llvm-libs s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 200.0 MiB make s390x 1:4.4.1-8.fc41 copr_base 1.9 MiB mpdecimal s390x 2.5.1-16.fc41 copr_base 368.4 KiB python-pip-wheel noarch 24.2-1.fc41 fedora 1.2 MiB python3 s390x 3.13.0-1.fc41 fedora 23.6 KiB python3-libs s390x 3.13.0-1.fc41 fedora 40.5 MiB tzdata noarch 2024a-9.fc41 fedora 1.7 MiB Transaction Summary: Installing: 33 packages Total size of inbound packages is 184 MiB. Need to download 0 B. After this operation, 760 MiB extra will be used (install 760 MiB, remove 0 B). [1/1] fedora-clang-default-cc-0:1-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [1/1] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/2] clang-0:20.0.0~pre20241121.g668f2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [2/2] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/3] gcc-c++-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [3/3] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/4] libstdc++-devel-0:14.2.1-3.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [4/4] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/5] clang-libs-0:20.0.0~pre20241121.g 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [5/5] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/6] llvm-libs-0:20.0.0~pre20241121.g6 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [6/6] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/7] gcc-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [7/7] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/8] clang-resource-filesystem-0:20.0. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [8/8] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/9] cpp-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [9/9] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/10] libasan-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [10/10] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/11] libatomic-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [11/11] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/12] libubsan-0:14.2.1-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [12/12] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/13] llvm-0:20.0.0~pre20241121.g668f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [13/13] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/14] lld-0:20.0.0~pre20241121.g668f2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [14/14] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/15] compiler-rt-0:20.0.0~pre2024112 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [15/15] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/16] python3-0:3.13.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [16/16] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/17] lld-libs-0:20.0.0~pre20241121.g 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [17/17] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/18] python3-libs-0:3.13.0-1.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [18/18] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/19] python-pip-wheel-0:24.2-1.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [19/19] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/20] tzdata-0:2024a-9.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [20/20] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/21] libomp-0:20.0.0~pre20241121.g66 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [21/21] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/22] expat-0:2.6.4-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [22/22] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/23] libb2-0:0.98.1-12.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [23/23] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/24] mpdecimal-0:2.5.1-16.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [24/24] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/25] libmpc-0:1.3.1-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [25/25] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/26] glibc-devel-0:2.40-11.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [26/26] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/27] kernel-headers-0:6.11.3-300.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [27/27] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/28] make-1:4.4.1-8.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [28/28] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/29] libedit-0:3.1-53.20240808cvs.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [29/29] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/30] libxcrypt-devel-0:4.4.36-10.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [30/30] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/31] annobin-plugin-gcc-0:12.69-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [31/31] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/32] gcc-plugin-annobin-0:14.2.1-3.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [32/32] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/33] annobin-docs-0:12.69-1.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [33/33] Total 100% | 0.0 B/s | 0.0 B | 00m00s Running transaction [ 1/35] Verify package files 100% | 52.0 B/s | 33.0 B | 00m01s [ 2/35] Prepare transaction 100% | 634.0 B/s | 33.0 B | 00m00s [ 3/35] Installing libmpc-0:1.3.1-6.fc4 100% | 154.2 MiB/s | 157.9 KiB | 00m00s [ 4/35] Installing clang-resource-files 100% | 8.1 MiB/s | 16.7 KiB | 00m00s [ 5/35] Installing libstdc++-devel-0:14 100% | 332.4 MiB/s | 15.3 MiB | 00m00s [ 6/35] Installing compiler-rt-0:20.0.0 100% | 528.7 MiB/s | 19.6 MiB | 00m00s [ 7/35] Installing cpp-0:14.2.1-3.fc41. 100% | 289.4 MiB/s | 25.5 MiB | 00m00s [ 8/35] Installing annobin-docs-0:12.69 100% | 0.0 B/s | 98.8 KiB | 00m00s [ 9/35] Installing libedit-0:3.1-53.202 100% | 279.5 MiB/s | 286.2 KiB | 00m00s [10/35] Installing llvm-libs-0:20.0.0~p 100% | 368.9 MiB/s | 200.0 MiB | 00m01s [11/35] Installing libomp-0:20.0.0~pre2 100% | 316.6 MiB/s | 7.9 MiB | 00m00s [12/35] Installing libb2-0:0.98.1-12.fc 100% | 45.6 MiB/s | 46.7 KiB | 00m00s [13/35] Installing clang-libs-0:20.0.0~ 100% | 420.9 MiB/s | 199.5 MiB | 00m00s [14/35] Installing lld-libs-0:20.0.0~pr 100% | 349.0 MiB/s | 9.4 MiB | 00m00s [15/35] Installing lld-0:20.0.0~pre2024 100% | 7.4 MiB/s | 45.6 KiB | 00m00s [16/35] Installing make-1:4.4.1-8.fc41. 100% | 187.6 MiB/s | 1.9 MiB | 00m00s [17/35] Installing kernel-headers-0:6.1 100% | 186.4 MiB/s | 6.5 MiB | 00m00s [18/35] Installing libxcrypt-devel-0:4. 100% | 16.0 MiB/s | 32.9 KiB | 00m00s [19/35] Installing glibc-devel-0:2.40-1 100% | 192.5 MiB/s | 2.7 MiB | 00m00s [20/35] Installing mpdecimal-0:2.5.1-16 100% | 360.9 MiB/s | 369.6 KiB | 00m00s [21/35] Installing expat-0:2.6.4-1.fc41 100% | 50.6 MiB/s | 310.6 KiB | 00m00s [22/35] Installing tzdata-0:2024a-9.fc4 100% | 58.8 MiB/s | 1.9 MiB | 00m00s [23/35] Installing python-pip-wheel-0:2 100% | 177.4 MiB/s | 1.2 MiB | 00m00s [24/35] Installing python3-libs-0:3.13. 100% | 300.5 MiB/s | 40.9 MiB | 00m00s [25/35] Installing python3-0:3.13.0-1.f 100% | 24.7 MiB/s | 25.3 KiB | 00m00s [26/35] Installing llvm-0:20.0.0~pre202 100% | 347.6 MiB/s | 118.9 MiB | 00m00s [27/35] Installing libubsan-0:14.2.1-3. 100% | 240.3 MiB/s | 492.1 KiB | 00m00s [28/35] Installing libatomic-0:14.2.1-3 100% | 0.0 B/s | 33.2 KiB | 00m00s [29/35] Installing libasan-0:14.2.1-3.f 100% | 275.0 MiB/s | 1.7 MiB | 00m00s [30/35] Installing gcc-0:14.2.1-3.fc41. 100% | 323.9 MiB/s | 76.8 MiB | 00m00s [31/35] Installing gcc-c++-0:14.2.1-3.f 100% | 273.6 MiB/s | 28.7 MiB | 00m00s [32/35] Installing clang-0:20.0.0~pre20 100% | 94.8 MiB/s | 194.2 KiB | 00m00s [33/35] Installing fedora-clang-default 100% | 0.0 B/s | 288.0 B | 00m00s [34/35] Installing annobin-plugin-gcc-0 100% | 74.1 MiB/s | 986.4 KiB | 00m00s [35/35] Installing gcc-plugin-annobin-0 100% | 588.7 KiB/s | 62.4 KiB | 00m00s Warning: skipped PGP checks for 15 packages from repositories: copr_base, copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121, copr_tstellar_fedora_clang_default_cc Complete! Finish: installing minimal buildroot with dnf5 Start: creating root cache Finish: creating root cache Finish: chroot init INFO: Installed packages: INFO: add-determinism-0.3.6-3.fc41.s390x alternatives-1.30-1.fc41.s390x annobin-docs-12.69-1.fc41.noarch annobin-plugin-gcc-12.69-1.fc41.s390x ansible-srpm-macros-1-16.fc41.noarch audit-libs-4.0.2-1.fc41.s390x authselect-1.5.0-8.fc41.s390x authselect-libs-1.5.0-8.fc41.s390x basesystem-11-21.fc41.noarch bash-5.2.32-1.fc41.s390x binutils-2.43.1-2.fc41.s390x build-reproducibility-srpm-macros-0.3.6-3.fc41.noarch bzip2-1.0.8-19.fc41.s390x bzip2-libs-1.0.8-19.fc41.s390x ca-certificates-2024.2.69_v8.0.401-1.0.fc41.noarch clang-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x clang-libs-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x clang-resource-filesystem-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x compiler-rt-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x coreutils-9.5-11.fc41.s390x coreutils-common-9.5-11.fc41.s390x cpio-2.15-2.fc41.s390x cpp-14.2.1-3.fc41.s390x cracklib-2.9.11-6.fc41.s390x crypto-policies-20241029-1.git8baf557.fc41.noarch curl-8.9.1-2.fc41.s390x cyrus-sasl-lib-2.1.28-27.fc41.s390x debugedit-5.1-1.fc41.s390x diffutils-3.10-8.fc41.s390x dwz-0.15-8.fc41.s390x ed-1.20.2-2.fc41.s390x efi-srpm-macros-5-12.fc41.noarch elfutils-0.192-6.fc41.s390x elfutils-debuginfod-client-0.192-6.fc41.s390x elfutils-default-yama-scope-0.192-6.fc41.noarch elfutils-libelf-0.192-6.fc41.s390x elfutils-libs-0.192-6.fc41.s390x expat-2.6.4-1.fc41.s390x fedora-clang-default-cc-1-1.fc41.noarch fedora-gpg-keys-41-1.noarch fedora-release-41-28.noarch fedora-release-common-41-28.noarch fedora-release-identity-basic-41-28.noarch fedora-repos-41-1.noarch file-5.45-7.fc41.s390x file-libs-5.45-7.fc41.s390x filesystem-3.18-23.fc41.s390x findutils-4.10.0-4.fc41.s390x fonts-srpm-macros-2.0.5-17.fc41.noarch forge-srpm-macros-0.3.2-1.fc41.noarch fpc-srpm-macros-1.3-13.fc41.noarch gawk-5.3.0-4.fc41.s390x gcc-14.2.1-3.fc41.s390x gcc-c++-14.2.1-3.fc41.s390x gcc-plugin-annobin-14.2.1-3.fc41.s390x gdb-minimal-15.2-3.fc41.s390x gdbm-1.23-7.fc41.s390x gdbm-libs-1.23-7.fc41.s390x ghc-srpm-macros-1.9.1-2.fc41.noarch glibc-2.40-11.fc41.s390x glibc-common-2.40-11.fc41.s390x glibc-devel-2.40-11.fc41.s390x glibc-gconv-extra-2.40-11.fc41.s390x glibc-minimal-langpack-2.40-11.fc41.s390x gmp-6.3.0-2.fc41.s390x gnat-srpm-macros-6-6.fc41.noarch go-srpm-macros-3.6.0-3.fc41.noarch gpg-pubkey-e99d6ad1-64d2612c grep-3.11-9.fc41.s390x gzip-1.13-2.fc41.s390x info-7.1-3.fc41.s390x jansson-2.13.1-10.fc41.s390x json-c-0.17-4.fc41.s390x kernel-headers-6.11.3-300.fc41.s390x kernel-srpm-macros-1.0-24.fc41.noarch keyutils-libs-1.6.3-4.fc41.s390x krb5-libs-1.21.3-3.fc41.s390x libacl-2.3.2-2.fc41.s390x libarchive-3.7.4-4.fc41.s390x libasan-14.2.1-3.fc41.s390x libatomic-14.2.1-3.fc41.s390x libattr-2.5.2-4.fc41.s390x libb2-0.98.1-12.fc41.s390x libblkid-2.40.2-4.fc41.s390x libbrotli-1.1.0-5.fc41.s390x libcap-2.70-4.fc41.s390x libcap-ng-0.8.5-3.fc41.s390x libcom_err-1.47.1-6.fc41.s390x libcurl-8.9.1-2.fc41.s390x libeconf-0.6.2-3.fc41.s390x libedit-3.1-53.20240808cvs.fc41.s390x libevent-2.1.12-14.fc41.s390x libfdisk-2.40.2-4.fc41.s390x libffi-3.4.6-3.fc41.s390x libgcc-14.2.1-3.fc41.s390x libgomp-14.2.1-3.fc41.s390x libidn2-2.3.7-2.fc41.s390x libmount-2.40.2-4.fc41.s390x libmpc-1.3.1-6.fc41.s390x libnghttp2-1.62.1-2.fc41.s390x libnsl2-2.0.1-2.fc41.s390x libomp-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x libpkgconf-2.3.0-1.fc41.s390x libpsl-0.21.5-4.fc41.s390x libpwquality-1.4.5-11.fc41.s390x libselinux-3.7-5.fc41.s390x libsemanage-3.7-2.fc41.s390x libsepol-3.7-2.fc41.s390x libsmartcols-2.40.2-4.fc41.s390x libssh-0.10.6-8.fc41.s390x libssh-config-0.10.6-8.fc41.noarch libstdc++-14.2.1-3.fc41.s390x libstdc++-devel-14.2.1-3.fc41.s390x libtasn1-4.19.0-9.fc41.s390x libtirpc-1.3.6-1.fc41.s390x libtool-ltdl-2.4.7-12.fc41.s390x libubsan-14.2.1-3.fc41.s390x libunistring-1.1-8.fc41.s390x libutempter-1.2.1-15.fc41.s390x libuuid-2.40.2-4.fc41.s390x libverto-0.3.2-9.fc41.s390x libxcrypt-4.4.36-10.fc41.s390x libxcrypt-devel-4.4.36-10.fc41.s390x libxml2-2.12.8-2.fc41.s390x libzstd-1.5.6-2.fc41.s390x lld-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x lld-libs-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x llvm-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x llvm-libs-20.0.0~pre20241121.g668f2c7fab288d-4.fc41.s390x lua-libs-5.4.6-6.fc41.s390x lua-srpm-macros-1-14.fc41.noarch lz4-libs-1.10.0-1.fc41.s390x make-4.4.1-8.fc41.s390x mpdecimal-2.5.1-16.fc41.s390x mpfr-4.2.1-5.fc41.s390x ncurses-base-6.5-2.20240629.fc41.noarch ncurses-libs-6.5-2.20240629.fc41.s390x ocaml-srpm-macros-10-3.fc41.noarch openblas-srpm-macros-2-18.fc41.noarch openldap-2.6.8-5.fc41.s390x openssl-libs-3.2.2-9.fc41.s390x p11-kit-0.25.5-3.fc41.s390x p11-kit-trust-0.25.5-3.fc41.s390x package-notes-srpm-macros-0.5-12.fc41.noarch pam-1.6.1-6.fc41.s390x pam-libs-1.6.1-6.fc41.s390x patch-2.7.6-25.fc41.s390x pcre2-10.44-1.fc41.1.s390x pcre2-syntax-10.44-1.fc41.1.noarch perl-srpm-macros-1-56.fc41.noarch pkgconf-2.3.0-1.fc41.s390x pkgconf-m4-2.3.0-1.fc41.noarch pkgconf-pkg-config-2.3.0-1.fc41.s390x popt-1.19-7.fc41.s390x publicsuffix-list-dafsa-20240107-4.fc41.noarch pyproject-srpm-macros-1.16.0-1.fc41.noarch python-pip-wheel-24.2-1.fc41.noarch python-srpm-macros-3.13-3.fc41.noarch python3-3.13.0-1.fc41.s390x python3-libs-3.13.0-1.fc41.s390x qt5-srpm-macros-5.15.15-1.fc41.noarch qt6-srpm-macros-6.8.0-1.fc41.noarch readline-8.2-10.fc41.s390x redhat-rpm-config-293-1.fc41.noarch rpm-4.20.0-1.fc41.s390x rpm-build-4.20.0-1.fc41.s390x rpm-build-libs-4.20.0-1.fc41.s390x rpm-libs-4.20.0-1.fc41.s390x rpm-sequoia-1.7.0-2.fc41.s390x rust-srpm-macros-26.3-3.fc41.noarch sed-4.9-3.fc41.s390x setup-2.15.0-5.fc41.noarch shadow-utils-4.15.1-12.fc41.s390x sqlite-libs-3.46.1-1.fc41.s390x systemd-libs-256.8-1.fc41.s390x tar-1.35-4.fc41.s390x tzdata-2024a-9.fc41.noarch unzip-6.0-64.fc41.s390x util-linux-2.40.2-4.fc41.s390x util-linux-core-2.40.2-4.fc41.s390x which-2.21-42.fc41.s390x xxhash-libs-0.8.2-4.fc41.s390x xz-5.6.2-2.fc41.s390x xz-libs-5.6.2-2.fc41.s390x zig-srpm-macros-1-3.fc41.noarch zip-3.0-41.fc41.s390x zlib-ng-compat-2.1.7-3.fc41.s390x zstd-1.5.6-2.fc41.s390x Start: buildsrpm Start: rpmbuild -bs Building target platforms: s390x Building for target s390x setting SOURCE_DATE_EPOCH=1721347200 Wrote: /builddir/build/SRPMS/cinnamon-session-6.2.1-1.fc41.src.rpm Finish: rpmbuild -bs INFO: chroot_scan: 1 files copied to /var/lib/copr-rpmbuild/results/chroot_scan INFO: /var/lib/mock/fedora-41-s390x-1732355311.446954/root/var/log/dnf5.log INFO: chroot_scan: creating tarball /var/lib/copr-rpmbuild/results/chroot_scan.tar.gz /bin/tar: Removing leading `/' from member names Finish: buildsrpm INFO: Done(/var/lib/copr-rpmbuild/workspace/workdir-791wwy_l/cinnamon-session/cinnamon-session.spec) Config(child) 0 minutes 30 seconds INFO: Results and/or logs in: /var/lib/copr-rpmbuild/results INFO: Cleaning up build root ('cleanup_on_success=True') Start: clean chroot INFO: unmounting tmpfs. Finish: clean chroot INFO: Start(/var/lib/copr-rpmbuild/results/cinnamon-session-6.2.1-1.fc41.src.rpm) Config(fedora-41-s390x) Start(bootstrap): chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-41-s390x-bootstrap-1732355311.446954/root. INFO: reusing tmpfs at /var/lib/mock/fedora-41-s390x-bootstrap-1732355311.446954/root. INFO: calling preinit hooks INFO: enabled root cache INFO: enabled package manager cache Start(bootstrap): cleaning package manager metadata Finish(bootstrap): cleaning package manager metadata Finish(bootstrap): chroot init Start: chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-41-s390x-1732355311.446954/root. INFO: calling preinit hooks INFO: enabled root cache Start: unpacking root cache Finish: unpacking root cache INFO: enabled package manager cache Start: cleaning package manager metadata Finish: cleaning package manager metadata INFO: enabled HW Info plugin INFO: Buildroot is handled by package management downloaded with a bootstrap image: rpm-4.20.0-1.fc41.s390x rpm-sequoia-1.7.0-2.fc41.s390x dnf5-5.2.7.0-1.fc41.s390x dnf5-plugins-5.2.7.0-1.fc41.s390x Finish: chroot init Start: build phase for cinnamon-session-6.2.1-1.fc41.src.rpm Start: build setup for cinnamon-session-6.2.1-1.fc41.src.rpm Building target platforms: s390x Building for target s390x setting SOURCE_DATE_EPOCH=1721347200 Wrote: /builddir/build/SRPMS/cinnamon-session-6.2.1-1.fc41.src.rpm Updating and loading repositories: fedora 100% | 70.7 KiB/s | 4.5 KiB | 00m00s updates 100% | 115.7 KiB/s | 5.1 KiB | 00m00s Copr repository 100% | 39.3 KiB/s | 1.5 KiB | 00m00s Additional repo copr_tstellar_fedora_c 100% | 68.6 KiB/s | 1.5 KiB | 00m00s Additional repo copr_fedora_llvm_team_ 100% | 95.2 KiB/s | 1.5 KiB | 00m00s Copr repository 100% | 20.7 MiB/s | 973.2 KiB | 00m00s Repositories loaded. Package "gcc-14.2.1-3.fc41.s390x" is already installed. Package Arch Version Repository Size Downgrading: clang s390x 19.1.0-1.fc41 fedora 195.7 KiB replacing clang s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 191.7 KiB clang-libs s390x 19.1.0-1.fc41 fedora 214.6 MiB replacing clang-libs s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 199.5 MiB clang-resource-filesystem s390x 19.1.0-1.fc41 fedora 15.3 KiB replacing clang-resource-filesystem s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 15.3 KiB compiler-rt s390x 19.1.0-1.fc41 fedora 20.5 MiB replacing compiler-rt s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 19.6 MiB libomp s390x 19.1.0-1.fc41 fedora 83.6 MiB replacing libomp s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 7.9 MiB lld s390x 19.1.0-1.fc41 fedora 52.0 KiB replacing lld s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 44.0 KiB lld-libs s390x 19.1.0-1.fc41 fedora 9.3 MiB replacing lld-libs s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 9.4 MiB llvm s390x 19.1.0-1.fc41 fedora 114.2 MiB replacing llvm s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 118.8 MiB llvm-libs s390x 19.1.0-1.fc41 fedora 188.6 MiB replacing llvm-libs s390x 20.0.0~pre20241121.g668f2c7fab288d-4.fc41 copr_fedora_llvm_team_llvm_snapshots_big_merge_20241121 200.0 MiB Installing: cinnamon-desktop-devel s390x 6.2.0-2.fc41 fedora 512.2 KiB glib2-devel s390x 2.82.2-1.fc41 updates 15.6 MiB gtk3-devel s390x 3.24.43-2.fc41 fedora 33.9 MiB intltool noarch 0.51.0-27.fc41 fedora 169.1 KiB libICE-devel s390x 1.1.1-4.fc41 fedora 261.8 KiB libSM-devel s390x 1.2.4-4.fc41 fedora 18.8 KiB libX11-devel s390x 1.8.10-2.fc41 fedora 1.0 MiB libXau-devel s390x 1.0.11-7.fc41 fedora 6.4 KiB libXcomposite-devel s390x 0.4.6-4.fc41 fedora 8.0 KiB libXext-devel s390x 1.3.6-2.fc41 fedora 98.9 KiB libcanberra-devel s390x 0.30-36.fc41 copr_base 145.0 KiB libglvnd-devel s390x 1:1.7.0-5.fc41 copr_base 2.1 MiB meson noarch 1.5.1-1.fc41 fedora 11.4 MiB pango-devel s390x 1.54.0-2.fc41 fedora 1.5 MiB python3-packaging noarch 24.1-2.fc41 fedora 422.3 KiB systemd-devel s390x 256.8-1.fc41 updates 556.3 KiB xapps-devel s390x 2.8.5-1.fc41 fedora 508.1 KiB xmlto s390x 0.0.29-1.fc41 fedora 120.0 KiB xorg-x11-xtrans-devel noarch 1.5.2-1.fc41 copr_base 281.2 KiB Installing dependencies: abattis-cantarell-vf-fonts noarch 0.301-13.fc41 fedora 192.7 KiB adwaita-cursor-theme noarch 47.0-1.fc41 fedora 10.0 MiB adwaita-icon-theme noarch 47.0-1.fc41 fedora 1.2 MiB adwaita-icon-theme-legacy noarch 46.2-2.fc41 fedora 2.1 MiB alsa-lib s390x 1.2.13-3.fc41 updates 1.5 MiB at-spi2-atk s390x 2.54.0-1.fc41 fedora 302.9 KiB at-spi2-atk-devel s390x 2.54.0-1.fc41 fedora 1.6 KiB at-spi2-core s390x 2.54.0-1.fc41 fedora 1.5 MiB at-spi2-core-devel s390x 2.54.0-1.fc41 fedora 4.1 MiB atk s390x 2.54.0-1.fc41 fedora 272.6 KiB atk-devel s390x 2.54.0-1.fc41 fedora 5.9 MiB autoconf noarch 2.72-3.fc41 fedora 2.8 MiB automake noarch 1.16.5-17.fc41 fedora 1.7 MiB avahi-glib s390x 0.8-29.fc41 fedora 19.4 KiB avahi-libs s390x 0.8-29.fc41 fedora 181.7 KiB brotli s390x 1.1.0-5.fc41 copr_base 27.3 KiB brotli-devel s390x 1.1.0-5.fc41 copr_base 65.6 KiB bzip2-devel s390x 1.0.8-19.fc41 fedora 309.8 KiB cairo s390x 1.18.0-4.fc41 fedora 1.8 MiB cairo-devel s390x 1.18.0-4.fc41 fedora 2.3 MiB cairo-gobject s390x 1.18.0-4.fc41 fedora 43.0 KiB cairo-gobject-devel s390x 1.18.0-4.fc41 fedora 7.0 KiB cinnamon-desktop s390x 6.2.0-2.fc41 fedora 1.0 MiB cmake-filesystem s390x 3.30.5-1.fc41 updates 0.0 B colord-libs s390x 1.4.7-5.fc41 fedora 873.6 KiB cups-filesystem noarch 1:2.4.11-3.fc41 updates 0.0 B cups-libs s390x 1:2.4.11-3.fc41 updates 722.7 KiB dbus s390x 1:1.14.10-4.fc41 fedora 0.0 B dbus-broker s390x 36-4.fc41 fedora 393.8 KiB dbus-common noarch 1:1.14.10-4.fc41 fedora 11.2 KiB dbus-devel s390x 1:1.14.10-4.fc41 fedora 129.9 KiB dbus-libs s390x 1:1.14.10-4.fc41 fedora 396.8 KiB default-fonts-core-sans noarch 4.1-2.fc41 fedora 11.9 KiB desktop-backgrounds-gnome noarch 41.0.0-1.fc41 fedora 361.0 B desktop-file-utils s390x 0.27-2.fc41 fedora 253.7 KiB docbook-dtds noarch 1.0-87.fc41 fedora 8.3 MiB docbook-style-xsl noarch 1.79.2-23.fc41 fedora 15.6 MiB emacs-filesystem noarch 1:30.0-3.fc41 fedora 0.0 B f41-backgrounds-base noarch 41.0.1-1.fc41 updates 34.1 MiB f41-backgrounds-gnome noarch 41.0.1-1.fc41 updates 706.0 B flac-libs s390x 1.4.3-5.fc41 copr_base 573.7 KiB flex s390x 2.6.4-18.fc41 copr_base 965.2 KiB fontconfig s390x 2.15.0-8.fc41 fedora 825.6 KiB fontconfig-devel s390x 2.15.0-8.fc41 fedora 117.2 KiB fonts-filesystem noarch 1:2.0.5-17.fc41 fedora 0.0 B fpaste noarch 0.5.0.0-1.fc41 fedora 75.7 KiB freetype s390x 2.13.3-1.fc41 copr_base 1.1 MiB freetype-devel s390x 2.13.3-1.fc41 copr_base 8.5 MiB fribidi s390x 1.0.15-2.fc41 copr_base 371.4 KiB fribidi-devel s390x 1.0.15-2.fc41 copr_base 78.0 KiB gdk-pixbuf2 s390x 2.42.12-6.fc41 fedora 2.5 MiB gdk-pixbuf2-devel s390x 2.42.12-6.fc41 fedora 2.3 MiB gdk-pixbuf2-modules s390x 2.42.12-6.fc41 fedora 59.2 KiB gettext s390x 0.22.5-6.fc41 fedora 5.3 MiB gettext-common-devel noarch 0.22.5-6.fc41 fedora 586.5 KiB gettext-devel s390x 0.22.5-6.fc41 fedora 1.0 MiB gettext-envsubst s390x 0.22.5-6.fc41 fedora 74.7 KiB gettext-libs s390x 0.22.5-6.fc41 fedora 1.8 MiB gettext-runtime s390x 0.22.5-6.fc41 fedora 480.8 KiB glib2 s390x 2.82.2-1.fc41 updates 14.9 MiB gnome-themes-extra s390x 3.28-20.fc41 fedora 47.6 KiB gnutls s390x 3.8.7-1.fc41 copr_base 3.2 MiB gobject-introspection s390x 1.82.0-1.fc41 fedora 407.9 KiB google-noto-fonts-common noarch 20240701-2.fc41 fedora 17.5 KiB google-noto-sans-vf-fonts noarch 20240701-2.fc41 fedora 1.2 MiB graphite2 s390x 1.3.14-16.fc41 fedora 207.4 KiB graphite2-devel s390x 1.3.14-16.fc41 fedora 49.1 KiB groff-base s390x 1.23.0-7.fc41 copr_base 4.6 MiB gsettings-desktop-schemas s390x 47.1-1.fc41 fedora 5.4 MiB gsm s390x 1.0.22-7.fc41 fedora 68.6 KiB gstreamer1 s390x 1.24.9-1.fc41 copr_base 6.3 MiB gtk-update-icon-cache s390x 3.24.43-2.fc41 fedora 70.0 KiB gtk2 s390x 2.24.33-19.fc41 fedora 13.2 MiB gtk2-devel s390x 2.24.33-19.fc41 fedora 23.8 MiB gtk3 s390x 3.24.43-2.fc41 fedora 23.1 MiB harfbuzz s390x 9.0.0-3.fc41 fedora 2.7 MiB harfbuzz-cairo s390x 9.0.0-3.fc41 fedora 56.0 KiB harfbuzz-devel s390x 9.0.0-3.fc41 fedora 5.1 MiB harfbuzz-icu s390x 9.0.0-3.fc41 fedora 19.2 KiB hicolor-icon-theme noarch 0.17-19.fc41 fedora 72.2 KiB highcontrast-icon-theme noarch 3.28-20.fc41 fedora 4.2 MiB hwdata noarch 0.389-1.fc41 updates 9.3 MiB iso-codes noarch 4.16.0-5.fc41 fedora 18.8 MiB jbigkit-libs s390x 2.1-30.fc41 fedora 121.2 KiB json-glib s390x 1.10.0-1.fc41 fedora 570.1 KiB lame-libs s390x 3.100-18.fc41 copr_base 1.3 MiB lcms2 s390x 2.16-4.fc41 copr_base 613.0 KiB libICE s390x 1.1.1-4.fc41 fedora 192.9 KiB libSM s390x 1.2.4-4.fc41 fedora 105.1 KiB libX11 s390x 1.8.10-2.fc41 fedora 1.4 MiB libX11-common noarch 1.8.10-2.fc41 fedora 1.1 MiB libX11-xcb s390x 1.8.10-2.fc41 fedora 14.8 KiB libXau s390x 1.0.11-7.fc41 fedora 66.6 KiB libXcomposite s390x 0.4.6-4.fc41 fedora 44.3 KiB libXcursor s390x 1.2.3-1.fc41 updates 53.3 KiB libXcursor-devel s390x 1.2.3-1.fc41 updates 22.7 KiB libXdamage s390x 1.1.6-4.fc41 fedora 43.5 KiB libXdamage-devel s390x 1.1.6-4.fc41 fedora 2.5 KiB libXext s390x 1.3.6-2.fc41 fedora 97.7 KiB libXfixes s390x 6.0.1-4.fc41 fedora 30.1 KiB libXfixes-devel s390x 6.0.1-4.fc41 fedora 9.2 KiB libXft s390x 2.3.8-7.fc41 fedora 172.2 KiB libXft-devel s390x 2.3.8-7.fc41 fedora 31.7 KiB libXi s390x 1.8.2-1.fc41 fedora 84.4 KiB libXi-devel s390x 1.8.2-1.fc41 fedora 132.5 KiB libXinerama s390x 1.1.5-7.fc41 fedora 18.8 KiB libXinerama-devel s390x 1.1.5-7.fc41 fedora 7.0 KiB libXmu s390x 1.2.1-2.fc41 fedora 211.0 KiB libXrandr s390x 1.5.4-4.fc41 fedora 55.5 KiB libXrandr-devel s390x 1.5.4-4.fc41 fedora 21.8 KiB libXrender s390x 0.9.11-7.fc41 fedora 53.9 KiB libXrender-devel s390x 0.9.11-7.fc41 fedora 50.1 KiB libXt s390x 1.3.1-1.fc41 updates 469.4 KiB libXtst s390x 1.2.5-1.fc41 fedora 41.3 KiB libXtst-devel s390x 1.2.5-1.fc41 fedora 11.6 KiB libXxf86vm s390x 1.1.5-7.fc41 fedora 25.1 KiB libasyncns s390x 0.8-29.fc41 fedora 55.2 KiB libblkid-devel s390x 2.40.2-4.fc41 fedora 44.9 KiB libcanberra s390x 0.30-36.fc41 copr_base 273.3 KiB libcanberra-gtk2 s390x 0.30-36.fc41 copr_base 45.8 KiB libcanberra-gtk3 s390x 0.30-36.fc41 copr_base 66.0 KiB libcloudproviders s390x 0.3.5-5.fc41 fedora 132.0 KiB libcloudproviders-devel s390x 0.3.5-5.fc41 fedora 375.4 KiB libdatrie s390x 0.2.13-10.fc41 fedora 61.7 KiB libdatrie-devel s390x 0.2.13-10.fc41 fedora 587.1 KiB libdbusmenu s390x 16.04.0-28.fc41 fedora 544.1 KiB libdbusmenu-gtk3 s390x 16.04.0-28.fc41 fedora 92.5 KiB libdrm s390x 2.4.123-1.fc41 fedora 439.3 KiB libepoxy s390x 1.5.10-8.fc41 copr_base 1.4 MiB libepoxy-devel s390x 1.5.10-8.fc41 copr_base 1.6 MiB libffi-devel s390x 3.4.6-3.fc41 fedora 29.4 KiB libglvnd s390x 1:1.7.0-5.fc41 copr_base 893.7 KiB libglvnd-core-devel s390x 1:1.7.0-5.fc41 copr_base 40.3 KiB libglvnd-egl s390x 1:1.7.0-5.fc41 copr_base 108.8 KiB libglvnd-gles s390x 1:1.7.0-5.fc41 copr_base 85.2 KiB libglvnd-glx s390x 1:1.7.0-5.fc41 copr_base 577.2 KiB libglvnd-opengl s390x 1:1.7.0-5.fc41 copr_base 152.8 KiB libgnomekbd s390x 3.28.1-6.fc41 fedora 623.7 KiB libgnomekbd-devel s390x 3.28.1-6.fc41 fedora 119.1 KiB libgusb s390x 0.4.9-2.fc41 fedora 161.8 KiB libicu s390x 74.2-2.fc41 fedora 35.3 MiB libicu-devel s390x 74.2-2.fc41 fedora 5.6 MiB libjpeg-turbo s390x 3.0.2-3.fc41 copr_base 863.0 KiB libjpeg-turbo-devel s390x 3.0.2-3.fc41 copr_base 353.2 KiB liblerc s390x 4.0.0-7.fc41 copr_base 312.3 KiB libmount-devel s390x 2.40.2-4.fc41 fedora 63.5 KiB libogg s390x 2:1.3.5-9.fc41 fedora 53.2 KiB libpciaccess s390x 0.16-13.fc41 fedora 44.4 KiB libpng s390x 2:1.6.40-4.fc41 fedora 253.6 KiB libpng-devel s390x 2:1.6.40-4.fc41 fedora 885.1 KiB libselinux-devel s390x 3.7-5.fc41 fedora 126.4 KiB libsepol-devel s390x 3.7-2.fc41 copr_base 120.3 KiB libsndfile s390x 1.2.2-5.fc41 updates 606.0 KiB libsoup3 s390x 3.6.0-1.fc41 copr_base 1.2 MiB libtdb s390x 1.4.12-3.fc41 fedora 104.9 KiB libtextstyle s390x 0.22.5-6.fc41 fedora 211.2 KiB libthai s390x 0.1.29-9.fc41 copr_base 790.1 KiB libthai-devel s390x 0.1.29-9.fc41 copr_base 701.1 KiB libtiff s390x 4.6.0-6.fc41 copr_base 725.4 KiB libtiff-devel s390x 4.6.0-6.fc41 copr_base 709.2 KiB libtracker-sparql s390x 3.7.3-3.fc41 fedora 1.1 MiB libunwind s390x 1.8.0-5.fc41 updates 147.0 KiB libusb1 s390x 1.0.27-4.fc41 copr_base 169.9 KiB libuuid-devel s390x 2.40.2-4.fc41 fedora 40.9 KiB libvorbis s390x 1:1.3.7-11.fc41 fedora 905.2 KiB libwayland-client s390x 1.23.0-2.fc41 fedora 73.9 KiB libwayland-cursor s390x 1.23.0-2.fc41 fedora 41.2 KiB libwayland-egl s390x 1.23.0-2.fc41 fedora 16.4 KiB libwayland-server s390x 1.23.0-2.fc41 fedora 98.4 KiB libwebp s390x 1.4.0-4.fc41 fedora 666.2 KiB libwebp-devel s390x 1.4.0-4.fc41 fedora 120.3 KiB libxcb s390x 1.17.0-3.fc41 fedora 1.1 MiB libxcb-devel s390x 1.17.0-3.fc41 fedora 2.7 MiB libxkbcommon s390x 1.7.0-4.fc41 copr_base 416.3 KiB libxkbcommon-devel s390x 1.7.0-4.fc41 copr_base 359.6 KiB libxkbfile s390x 1.1.3-2.fc41 fedora 221.7 KiB libxkbfile-devel s390x 1.1.3-2.fc41 fedora 36.8 KiB libxklavier s390x 5.4-26.fc41 fedora 157.9 KiB libxklavier-devel s390x 5.4-26.fc41 fedora 243.7 KiB libxml2-devel s390x 2.12.8-2.fc41 copr_base 3.4 MiB libxshmfence s390x 1.3.2-5.fc41 updates 12.3 KiB libxslt s390x 1.1.42-3.fc41 copr_base 490.2 KiB libzstd-devel s390x 1.5.6-2.fc41 fedora 202.4 KiB lm_sensors-libs s390x 3.6.0-20.fc41 fedora 85.6 KiB m4 s390x 1.4.19-10.fc41 fedora 628.5 KiB mailcap noarch 2.1.54-7.fc41 fedora 86.0 KiB mesa-dri-drivers s390x 24.2.7-1.fc41 updates 15.8 MiB mesa-filesystem s390x 24.2.7-1.fc41 updates 3.6 KiB mesa-libEGL s390x 24.2.7-1.fc41 updates 395.9 KiB mesa-libGL s390x 24.2.7-1.fc41 updates 590.0 KiB mesa-libgbm s390x 24.2.7-1.fc41 updates 69.0 KiB mesa-libglapi s390x 24.2.7-1.fc41 updates 357.7 KiB mpg123-libs s390x 1.31.3-5.fc41 copr_base 690.2 KiB ncurses s390x 6.5-2.20240629.fc41 fedora 641.5 KiB nettle s390x 3.10-3.fc41 fedora 849.2 KiB ninja-build s390x 1.12.1-3.fc41 copr_base 488.2 KiB opus s390x 1.5.2-1.fc41 fedora 447.3 KiB pango s390x 1.54.0-2.fc41 fedora 1.0 MiB pcre2-devel s390x 10.44-1.fc41.1 copr_base 2.0 MiB pcre2-utf16 s390x 10.44-1.fc41.1 copr_base 784.9 KiB pcre2-utf32 s390x 10.44-1.fc41.1 copr_base 748.8 KiB perl-AutoLoader noarch 5.74-512.fc41 updates 20.5 KiB perl-B s390x 1.89-512.fc41 updates 513.7 KiB perl-Carp noarch 1.54-511.fc41 fedora 46.6 KiB perl-Class-Struct noarch 0.68-512.fc41 updates 25.4 KiB perl-Clone s390x 0.47-1.fc41 fedora 36.3 KiB perl-Compress-Raw-Bzip2 s390x 2.212-512.fc41 fedora 69.3 KiB perl-Compress-Raw-Zlib s390x 2.212-512.fc41 fedora 166.2 KiB perl-Data-Dump noarch 1.25-11.fc41 fedora 50.2 KiB perl-Data-Dumper s390x 2.189-512.fc41 fedora 115.5 KiB perl-Digest noarch 1.20-511.fc41 fedora 35.3 KiB perl-Digest-HMAC noarch 1.04-11.fc41 fedora 28.1 KiB perl-Digest-MD5 s390x 2.59-5.fc41 fedora 59.6 KiB perl-Digest-SHA s390x 1:6.04-512.fc41 fedora 116.4 KiB perl-DynaLoader s390x 1.56-512.fc41 updates 32.1 KiB perl-Encode s390x 4:3.21-511.fc41 fedora 9.6 MiB perl-Encode-Locale noarch 1.05-30.fc41 fedora 19.0 KiB perl-Errno s390x 1.38-512.fc41 updates 8.4 KiB perl-Exporter noarch 5.78-511.fc41 fedora 54.3 KiB perl-Fcntl s390x 1.18-512.fc41 updates 48.8 KiB perl-File-Basename noarch 2.86-512.fc41 updates 14.0 KiB perl-File-Compare noarch 1.100.800-512.fc41 updates 5.6 KiB perl-File-Copy noarch 2.41-512.fc41 updates 19.6 KiB perl-File-Find noarch 1.44-512.fc41 updates 41.9 KiB perl-File-Listing noarch 6.16-4.fc41 fedora 41.2 KiB perl-File-Path noarch 2.18-511.fc41 fedora 63.5 KiB perl-File-Temp noarch 1:0.231.100-511.fc41 fedora 162.3 KiB perl-File-stat noarch 1.14-512.fc41 updates 12.5 KiB perl-FileHandle noarch 2.05-512.fc41 updates 9.3 KiB perl-Getopt-Long noarch 1:2.58-2.fc41 fedora 144.5 KiB perl-Getopt-Std noarch 1.14-512.fc41 updates 11.2 KiB perl-HTML-Parser s390x 3.83-1.fc41 fedora 289.6 KiB perl-HTML-Tagset noarch 3.24-2.fc41 fedora 18.7 KiB perl-HTTP-Cookies noarch 6.11-4.fc41 fedora 73.4 KiB perl-HTTP-Date noarch 6.06-5.fc41 fedora 41.2 KiB perl-HTTP-Message noarch 6.46-2.fc41 fedora 215.3 KiB perl-HTTP-Negotiate noarch 6.01-39.fc41 fedora 27.6 KiB perl-HTTP-Tiny noarch 0.090-1.fc41 updates 154.4 KiB perl-I18N-Langinfo s390x 0.24-512.fc41 updates 34.5 KiB perl-IO s390x 1.55-512.fc41 updates 146.8 KiB perl-IO-Compress noarch 2.212-512.fc41 fedora 1.0 MiB perl-IO-HTML noarch 1.004-13.fc41 fedora 45.2 KiB perl-IO-Socket-IP noarch 0.42-512.fc41 fedora 98.7 KiB perl-IO-Socket-SSL noarch 2.089-1.fc41 fedora 703.3 KiB perl-IPC-Open3 noarch 1.22-512.fc41 updates 22.5 KiB perl-LWP-MediaTypes noarch 6.04-19.fc41 fedora 79.0 KiB perl-MIME-Base32 noarch 1.303-21.fc41 fedora 30.7 KiB perl-MIME-Base64 s390x 3.16-511.fc41 fedora 45.9 KiB perl-Module-Load noarch 1:0.36-511.fc41 fedora 14.9 KiB perl-NTLM noarch 1.09-39.fc41 fedora 31.2 KiB perl-Net-HTTP noarch 6.23-5.fc41 fedora 74.7 KiB perl-Net-SSLeay s390x 1.94-7.fc41 fedora 1.4 MiB perl-POSIX s390x 2.20-512.fc41 updates 242.9 KiB perl-PathTools s390x 3.91-511.fc41 fedora 179.8 KiB perl-Pod-Escapes noarch 1:1.07-511.fc41 fedora 24.9 KiB perl-Pod-Perldoc noarch 3.28.01-512.fc41 fedora 163.7 KiB perl-Pod-Simple noarch 1:3.45-511.fc41 fedora 560.9 KiB perl-Pod-Usage noarch 4:2.03-511.fc41 fedora 84.8 KiB perl-Scalar-List-Utils s390x 5:1.68-1.fc41 updates 144.6 KiB perl-SelectSaver noarch 1.02-512.fc41 updates 2.2 KiB perl-Socket s390x 4:2.038-511.fc41 fedora 127.8 KiB perl-Storable s390x 1:3.32-511.fc41 fedora 232.2 KiB perl-Symbol noarch 1.09-512.fc41 updates 6.8 KiB perl-Term-ANSIColor noarch 5.01-512.fc41 fedora 97.5 KiB perl-Term-Cap noarch 1.18-511.fc41 fedora 29.3 KiB perl-Text-ParseWords noarch 3.31-511.fc41 fedora 13.6 KiB perl-Text-Tabs+Wrap noarch 2024.001-511.fc41 fedora 22.6 KiB perl-Thread-Queue noarch 3.14-511.fc41 fedora 28.9 KiB perl-Time-Local noarch 2:1.350-511.fc41 fedora 69.0 KiB perl-TimeDate noarch 1:2.33-15.fc41 fedora 95.2 KiB perl-Try-Tiny noarch 0.32-1.fc41 fedora 67.3 KiB perl-URI noarch 5.30-1.fc41 fedora 256.9 KiB perl-WWW-RobotRules noarch 6.02-40.fc41 fedora 24.3 KiB perl-XML-Parser s390x 2.47-5.fc41 fedora 661.1 KiB perl-base noarch 2.27-512.fc41 updates 12.5 KiB perl-constant noarch 1.33-512.fc41 fedora 26.2 KiB perl-if noarch 0.61.000-512.fc41 updates 5.8 KiB perl-interpreter s390x 4:5.40.0-512.fc41 updates 118.1 KiB perl-libnet noarch 3.15-512.fc41 fedora 289.4 KiB perl-libs s390x 4:5.40.0-512.fc41 updates 10.2 MiB perl-libwww-perl noarch 6.77-2.fc41 fedora 521.0 KiB perl-locale noarch 1.12-512.fc41 updates 6.5 KiB perl-mro s390x 1.29-512.fc41 updates 41.4 KiB perl-overload noarch 1.37-512.fc41 updates 71.5 KiB perl-overloading noarch 0.02-512.fc41 updates 4.8 KiB perl-parent noarch 1:0.242-1.fc41 fedora 10.0 KiB perl-podlators noarch 1:6.0.2-2.fc41 fedora 317.5 KiB perl-subs noarch 1.04-512.fc41 updates 2.1 KiB perl-threads s390x 1:2.40-511.fc41 fedora 114.9 KiB perl-threads-shared s390x 1.69-511.fc41 fedora 83.5 KiB perl-vars noarch 1.05-512.fc41 updates 3.9 KiB pixman s390x 0.44.0-0.fc41 copr_base 604.6 KiB pixman-devel s390x 0.44.0-0.fc41 copr_base 49.4 KiB pulseaudio-libs s390x 17.0-2.fc41 copr_base 3.7 MiB pulseaudio-libs-devel s390x 17.0-2.fc41 copr_base 4.9 MiB pulseaudio-libs-glib2 s390x 17.0-2.fc41 copr_base 19.2 KiB python3-gobject-base s390x 3.48.2-3.fc41 fedora 1.5 MiB python3-setuptools noarch 69.2.0-8.fc41 fedora 7.2 MiB python3-xapps-overrides s390x 2.8.5-1.fc41 fedora 2.1 KiB redhat-menus noarch 12.0.2-28.fc41 fedora 672.4 KiB setxkbmap s390x 1.3.4-4.fc41 fedora 35.1 KiB sgml-common noarch 0.6.3-65.fc41 fedora 168.1 KiB shared-mime-info s390x 2.3-6.fc41 fedora 5.2 MiB sound-theme-freedesktop noarch 0.8-22.fc41 copr_base 460.4 KiB sysprof-capture-devel s390x 47.1-1.fc41 copr_base 275.9 KiB systemd-rpm-macros noarch 256.8-1.fc41 updates 10.7 KiB vim-filesystem noarch 2:9.1.866-1.fc41 updates 40.0 B wayland-devel s390x 1.23.0-2.fc41 fedora 678.8 KiB xapps s390x 2.8.5-1.fc41 fedora 6.1 MiB xdg-utils noarch 1.2.1-2.fc41 fedora 346.3 KiB xhost s390x 1.0.9-8.fc41 copr_base 21.1 KiB xkeyboard-config noarch 2.42-2.fc41 fedora 6.5 MiB xml-common noarch 0.6.3-65.fc41 fedora 78.4 KiB xmodmap s390x 1.0.11-7.fc41 fedora 55.1 KiB xorg-x11-proto-devel noarch 2024.1-3.fc41 copr_base 1.7 MiB xorg-x11-xauth s390x 1:1.1.3-2.fc41 fedora 63.9 KiB xorg-x11-xinit s390x 1.4.2-3.fc41 fedora 136.2 KiB xprop s390x 1.2.7-2.fc41 fedora 62.6 KiB xrdb s390x 1.2.2-4.fc41 fedora 46.5 KiB xz-devel s390x 1:5.6.2-2.fc41 fedora 255.6 KiB zlib-ng-compat-devel s390x 2.1.7-3.fc41 copr_base 107.0 KiB Transaction Summary: Installing: 340 packages Replacing: 9 package Downgrading: 9 packages Total size of inbound packages is 271 MiB. Need to download 245 MiB. After this operation, 580 MiB extra will be used (install 1 GiB, remove 555 MiB). [ 1/13] python3-packaging-0:24.1-2.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 2/20] automake-0:1.16.5-17.fc41.noarc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 3/22] perl-Encode-4:3.21-511.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 4/23] perl-Getopt-Long-1:2.58-2.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 5/24] perl-PathTools-0:3.91-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 6/25] perl-Text-Tabs+Wrap-0:2024.001- 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 7/27] python3-setuptools-0:69.2.0-8.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 8/33] cairo-0:1.18.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 9/40] harfbuzz-0:9.0.0-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [10/49] libICE-0:1.1.1-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [11/53] libSM-0:1.2.4-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [12/55] libX11-0:1.8.10-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [13/60] libXau-0:1.0.11-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [14/62] libXext-0:1.3.6-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [15/67] libselinux-devel-0:3.7-5.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [16/68] glib2-0:2.82.2-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [17/70] autoconf-0:2.72-3.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [18/71] perl-Carp-0:1.54-511.fc41.noarc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [19/72] perl-Exporter-0:5.78-511.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [20/73] perl-File-Path-0:2.18-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [21/74] perl-Thread-Queue-0:3.14-511.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [22/75] perl-constant-0:1.33-512.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [23/76] perl-threads-1:2.40-511.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [24/80] perl-MIME-Base64-0:3.16-511.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [25/81] perl-Storable-1:3.32-511.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [26/82] perl-parent-1:0.242-1.fc41.noar 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [27/83] perl-Pod-Usage-4:2.03-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [28/84] perl-Text-ParseWords-0:3.31-511 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [29/85] perl-URI-0:5.30-1.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [30/96] fontconfig-0:2.15.0-8.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [31/97] libXrender-0:0.9.11-7.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [32/98] libpng-2:1.6.40-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [33/99] libxcb-0:1.17.0-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 34/104] colord-libs-0:1.4.7-5.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 35/117] graphite2-0:1.3.14-16.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 36/124] libX11-common-0:1.8.10-2.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 37/133] xml-common-0:0.6.3-65.fc41.no 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 38/136] emacs-filesystem-1:30.0-3.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 39/137] m4-0:1.4.19-10.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 40/138] perl-Data-Dumper-0:2.189-512. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 41/139] perl-File-Temp-1:0.231.100-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 42/140] perl-threads-shared-0:1.69-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 43/143] perl-Pod-Perldoc-0:3.28.01-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 44/144] perl-podlators-1:6.0.2-2.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 45/145] perl-MIME-Base32-0:1.303-21.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 46/146] perl-libnet-0:3.15-512.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 47/148] perl-Digest-MD5-0:2.59-5.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 48/164] dbus-libs-1:1.14.10-4.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 49/166] dbus-1:1.14.10-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 50/169] default-fonts-core-sans-0:4.1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 51/170] fonts-filesystem-1:2.0.5-17.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 52/173] libgusb-0:0.4.9-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 53/175] avahi-libs-0:0.8-29.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 54/176] json-glib-0:1.10.0-1.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 55/187] perl-Pod-Simple-1:3.45-511.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 56/188] perl-Term-ANSIColor-0:5.01-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 57/189] perl-Term-Cap-0:1.18-511.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 58/190] perl-IO-Socket-IP-0:0.42-512. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 59/191] perl-Socket-4:2.038-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 60/192] perl-Time-Local-2:1.350-511.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 61/193] perl-Digest-0:1.20-511.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 62/202] perl-IO-Socket-SSL-0:2.089-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 63/203] dbus-broker-0:36-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 64/204] abattis-cantarell-vf-fonts-0: 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 65/205] google-noto-sans-vf-fonts-0:2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 66/209] perl-Pod-Escapes-1:1.07-511.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 67/210] ncurses-0:6.5-2.20240629.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 68/213] perl-Net-SSLeay-0:1.94-7.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 69/214] dbus-common-1:1.14.10-4.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 70/215] google-noto-fonts-common-0:20 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 71/234] pcre2-devel-0:10.44-1.fc41.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 72/236] zlib-ng-compat-devel-0:2.1.7- 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 73/237] gnutls-0:3.8.7-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 74/238] nettle-0:3.10-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 75/242] perl-Scalar-List-Utils-5:1.68 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 76/243] perl-libs-4:5.40.0-512.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 77/244] perl-interpreter-4:5.40.0-512 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 78/245] perl-Errno-0:1.38-512.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 79/246] perl-overload-0:1.37-512.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 80/247] perl-File-Basename-0:2.86-512 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 81/248] perl-POSIX-0:2.20-512.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 82/249] perl-Fcntl-0:1.18-512.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 83/250] perl-File-Copy-0:2.41-512.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 84/251] perl-IO-0:1.55-512.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 85/252] perl-FileHandle-0:2.05-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 86/253] perl-Symbol-0:1.09-512.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 87/254] perl-vars-0:1.05-512.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 88/255] perl-base-0:2.27-512.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 89/256] perl-if-0:0.61.000-512.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 90/257] groff-base-0:1.23.0-7.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 91/258] perl-HTTP-Tiny-0:0.090-1.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 92/259] perl-IPC-Open3-0:1.22-512.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 93/260] perl-AutoLoader-0:5.74-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 94/261] perl-locale-0:1.12-512.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 95/263] perl-Getopt-Std-0:1.14-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 96/264] perl-B-0:1.89-512.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 97/272] freetype-0:2.13.3-1.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 98/280] libsepol-devel-0:3.7-2.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 99/281] libusb1-0:1.0.27-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [100/282] libXt-0:1.3.1-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [101/283] perl-File-Find-0:1.44-512.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [102/289] cups-libs-1:2.4.11-3.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [103/290] cups-filesystem-1:2.4.11-3.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [104/293] libtiff-0:4.6.0-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [105/294] jbigkit-libs-0:2.1-30.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [106/295] libwebp-0:1.4.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [107/299] libzstd-devel-0:1.5.6-2.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [108/300] libjpeg-turbo-0:3.0.2-3.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [109/303] cmake-filesystem-0:3.30.5-1.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [110/304] lcms2-0:2.16-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [111/308] pixman-0:0.44.0-0.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [112/309] perl-Class-Struct-0:0.68-512. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [113/310] perl-File-stat-0:1.14-512.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [114/311] perl-File-Compare-0:1.100.800 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [115/315] pcre2-utf16-0:10.44-1.fc41.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [116/316] pcre2-utf32-0:10.44-1.fc41.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [117/318] liblerc-0:4.0.0-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [118/329] brotli-devel-0:1.1.0-5.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [119/330] brotli-0:1.1.0-5.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [120/331] perl-mro-0:1.29-512.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [121/332] perl-overloading-0:0.02-512.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [122/333] perl-DynaLoader-0:1.56-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [123/334] perl-SelectSaver-0:1.02-512.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [124/340] systemd-rpm-macros-0:256.8-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [125/349] intltool-0:0.51.0-27.fc41.noa 100% | 216.2 KiB/s | 55.3 KiB | 00m00s [126/349] cinnamon-desktop-devel-0:6.2. 100% | 194.0 KiB/s | 57.0 KiB | 00m00s [127/349] libICE-devel-0:1.1.1-4.fc41.s 100% | 473.4 KiB/s | 45.9 KiB | 00m00s [128/349] pango-devel-0:1.54.0-2.fc41.s 100% | 942.5 KiB/s | 160.2 KiB | 00m00s [129/349] meson-0:1.5.1-1.fc41.noarch 100% | 3.6 MiB/s | 2.2 MiB | 00m01s [130/349] libSM-devel-0:1.2.4-4.fc41.s3 100% | 186.3 KiB/s | 11.9 KiB | 00m00s [131/349] libX11-devel-0:1.8.10-2.fc41. 100% | 12.0 MiB/s | 1.0 MiB | 00m00s [132/349] gtk3-devel-0:3.24.43-2.fc41.s 100% | 9.3 MiB/s | 4.3 MiB | 00m00s [133/349] xapps-devel-0:2.8.5-1.fc41.s3 100% | 527.2 KiB/s | 49.0 KiB | 00m00s [134/349] libXau-devel-0:1.0.11-7.fc41. 100% | 225.0 KiB/s | 13.7 KiB | 00m00s [135/349] libXcomposite-devel-0:0.4.6-4 100% | 260.2 KiB/s | 15.9 KiB | 00m00s [136/349] libXext-devel-0:1.3.6-2.fc41. 100% | 1.0 MiB/s | 85.3 KiB | 00m00s [137/349] xmlto-0:0.0.29-1.fc41.s390x 100% | 732.6 KiB/s | 54.9 KiB | 00m00s [138/349] libglvnd-devel-1:1.7.0-5.fc41 100% | 9.6 MiB/s | 157.5 KiB | 00m00s [139/349] libcanberra-devel-0:0.30-36.f 100% | 597.8 KiB/s | 31.1 KiB | 00m00s [140/349] xorg-x11-xtrans-devel-0:1.5.2 100% | 1.0 MiB/s | 72.7 KiB | 00m00s [141/349] glib2-devel-0:2.82.2-1.fc41.s 100% | 8.4 MiB/s | 1.5 MiB | 00m00s [142/349] systemd-devel-0:256.8-1.fc41. 100% | 4.1 MiB/s | 659.1 KiB | 00m00s [143/349] gettext-devel-0:0.22.5-6.fc41 100% | 3.6 MiB/s | 240.5 KiB | 00m00s [144/349] perl-XML-Parser-0:2.47-5.fc41 100% | 3.7 MiB/s | 239.7 KiB | 00m00s [145/349] libxkbfile-devel-0:1.1.3-2.fc 100% | 244.4 KiB/s | 15.6 KiB | 00m00s [146/349] at-spi2-atk-devel-0:2.54.0-1. 100% | 167.7 KiB/s | 10.7 KiB | 00m00s [147/349] atk-0:2.54.0-1.fc41.s390x 100% | 1.2 MiB/s | 81.7 KiB | 00m00s [148/349] cinnamon-desktop-0:6.2.0-2.fc 100% | 1.8 MiB/s | 298.6 KiB | 00m00s [149/349] atk-devel-0:2.54.0-1.fc41.s39 100% | 6.3 MiB/s | 443.2 KiB | 00m00s [150/349] cairo-devel-0:1.18.0-4.fc41.s 100% | 3.0 MiB/s | 191.7 KiB | 00m00s [151/349] cairo-gobject-devel-0:1.18.0- 100% | 169.5 KiB/s | 11.0 KiB | 00m00s [152/349] fontconfig-devel-0:2.15.0-8.f 100% | 2.5 MiB/s | 164.7 KiB | 00m00s [153/349] gdk-pixbuf2-0:2.42.12-6.fc41. 100% | 6.9 MiB/s | 490.0 KiB | 00m00s [154/349] gdk-pixbuf2-devel-0:2.42.12-6 100% | 3.7 MiB/s | 367.3 KiB | 00m00s [155/349] libXdamage-devel-0:1.1.6-4.fc 100% | 158.7 KiB/s | 9.5 KiB | 00m00s [156/349] libXfixes-devel-0:6.0.1-4.fc4 100% | 179.8 KiB/s | 12.6 KiB | 00m00s [157/349] libXi-devel-0:1.8.2-1.fc41.s3 100% | 1.5 MiB/s | 115.8 KiB | 00m00s [158/349] gtk3-0:3.24.43-2.fc41.s390x 100% | 30.4 MiB/s | 5.6 MiB | 00m00s [159/349] libXinerama-devel-0:1.1.5-7.f 100% | 212.1 KiB/s | 13.2 KiB | 00m00s [160/349] libXrandr-devel-0:1.5.4-4.fc4 100% | 320.9 KiB/s | 19.3 KiB | 00m00s [161/349] libcloudproviders-devel-0:0.3 100% | 805.3 KiB/s | 49.1 KiB | 00m00s [162/349] wayland-devel-0:1.23.0-2.fc41 100% | 2.4 MiB/s | 152.2 KiB | 00m00s [163/349] pango-0:1.54.0-2.fc41.s390x 100% | 3.9 MiB/s | 363.6 KiB | 00m00s [164/349] harfbuzz-devel-0:9.0.0-3.fc41 100% | 6.7 MiB/s | 447.4 KiB | 00m00s [165/349] libXft-devel-0:2.3.8-7.fc41.s 100% | 814.7 KiB/s | 49.7 KiB | 00m00s [166/349] libXrender-devel-0:0.9.11-7.f 100% | 302.0 KiB/s | 19.0 KiB | 00m00s [167/349] libuuid-devel-0:2.40.2-4.fc41 100% | 559.1 KiB/s | 34.1 KiB | 00m00s [168/349] libX11-xcb-0:1.8.10-2.fc41.s3 100% | 196.0 KiB/s | 11.8 KiB | 00m00s [169/349] libgnomekbd-devel-0:3.28.1-6. 100% | 242.0 KiB/s | 20.3 KiB | 00m00s [170/349] libXcomposite-0:0.4.6-4.fc41. 100% | 390.9 KiB/s | 24.2 KiB | 00m00s [171/349] libxcb-devel-0:1.17.0-3.fc41. 100% | 7.7 MiB/s | 1.4 MiB | 00m00s [172/349] xapps-0:2.8.5-1.fc41.s390x 100% | 31.6 MiB/s | 5.3 MiB | 00m00s [173/349] docbook-dtds-0:1.0-87.fc41.no 100% | 4.6 MiB/s | 334.8 KiB | 00m00s [174/349] libffi-devel-0:3.4.6-3.fc41.s 100% | 450.7 KiB/s | 27.5 KiB | 00m00s [175/349] libmount-devel-0:2.40.2-4.fc4 100% | 447.2 KiB/s | 27.3 KiB | 00m00s [176/349] docbook-style-xsl-0:1.79.2-23 100% | 14.0 MiB/s | 1.5 MiB | 00m00s [177/349] gettext-0:0.22.5-6.fc41.s390x 100% | 15.1 MiB/s | 1.1 MiB | 00m00s [178/349] gettext-common-devel-0:0.22.5 100% | 7.4 MiB/s | 595.9 KiB | 00m00s [179/349] gtk2-devel-0:2.24.33-19.fc41. 100% | 19.4 MiB/s | 2.8 MiB | 00m00s [180/349] gettext-libs-0:0.22.5-6.fc41. 100% | 9.2 MiB/s | 686.5 KiB | 00m00s [181/349] perl-libwww-perl-0:6.77-2.fc4 100% | 3.1 MiB/s | 206.4 KiB | 00m00s [182/349] desktop-backgrounds-gnome-0:4 100% | 130.3 KiB/s | 9.0 KiB | 00m00s [183/349] libXrandr-0:1.5.4-4.fc41.s390 100% | 454.2 KiB/s | 28.6 KiB | 00m00s [184/349] gnome-themes-extra-0:3.28-20. 100% | 314.9 KiB/s | 25.8 KiB | 00m00s [185/349] libxkbfile-0:1.1.3-2.fc41.s39 100% | 1.6 MiB/s | 97.3 KiB | 00m00s [186/349] at-spi2-atk-0:2.54.0-1.fc41.s 100% | 1.4 MiB/s | 88.0 KiB | 00m00s [187/349] redhat-menus-0:12.0.2-28.fc41 100% | 1.6 MiB/s | 155.4 KiB | 00m00s [188/349] at-spi2-core-devel-0:2.54.0-1 100% | 5.0 MiB/s | 328.3 KiB | 00m00s [189/349] dbus-devel-1:1.14.10-4.fc41.s 100% | 637.3 KiB/s | 38.9 KiB | 00m00s [190/349] at-spi2-core-0:2.54.0-1.fc41. 100% | 5.1 MiB/s | 377.9 KiB | 00m00s [191/349] libpng-devel-2:1.6.40-4.fc41. 100% | 4.5 MiB/s | 292.3 KiB | 00m00s [192/349] cairo-gobject-0:1.18.0-4.fc41 100% | 298.2 KiB/s | 17.9 KiB | 00m00s [193/349] shared-mime-info-0:2.3-6.fc41 100% | 5.4 MiB/s | 389.4 KiB | 00m00s [194/349] adwaita-icon-theme-0:47.0-1.f 100% | 6.1 MiB/s | 406.6 KiB | 00m00s [195/349] gdk-pixbuf2-modules-0:2.42.12 100% | 454.2 KiB/s | 27.7 KiB | 00m00s [196/349] gtk-update-icon-cache-0:3.24. 100% | 554.4 KiB/s | 34.4 KiB | 00m00s [197/349] hicolor-icon-theme-0:0.17-19. 100% | 1.1 MiB/s | 65.9 KiB | 00m00s [198/349] libXdamage-0:1.1.6-4.fc41.s39 100% | 388.5 KiB/s | 23.3 KiB | 00m00s [199/349] libXfixes-0:6.0.1-4.fc41.s390 100% | 309.0 KiB/s | 19.2 KiB | 00m00s [200/349] libXi-0:1.8.2-1.fc41.s390x 100% | 696.0 KiB/s | 42.5 KiB | 00m00s [201/349] libXinerama-0:1.1.5-7.fc41.s3 100% | 234.4 KiB/s | 14.3 KiB | 00m00s [202/349] libcloudproviders-0:0.3.5-5.f 100% | 739.3 KiB/s | 45.8 KiB | 00m00s [203/349] libtracker-sparql-0:3.7.3-3.f 100% | 5.7 MiB/s | 377.8 KiB | 00m00s [204/349] libwayland-client-0:1.23.0-2. 100% | 571.7 KiB/s | 34.9 KiB | 00m00s [205/349] libwayland-cursor-0:1.23.0-2. 100% | 313.4 KiB/s | 19.7 KiB | 00m00s [206/349] libwayland-egl-0:1.23.0-2.fc4 100% | 207.4 KiB/s | 12.4 KiB | 00m00s [207/349] libXft-0:2.3.8-7.fc41.s390x 100% | 1.2 MiB/s | 76.0 KiB | 00m00s [208/349] libwayland-server-0:1.23.0-2. 100% | 710.7 KiB/s | 44.1 KiB | 00m00s [209/349] graphite2-devel-0:1.3.14-16.f 100% | 344.9 KiB/s | 20.7 KiB | 00m00s [210/349] harfbuzz-cairo-0:9.0.0-3.fc41 100% | 492.4 KiB/s | 30.0 KiB | 00m00s [211/349] harfbuzz-icu-0:9.0.0-3.fc41.s 100% | 250.2 KiB/s | 15.5 KiB | 00m00s [212/349] libicu-devel-0:74.2-2.fc41.s3 100% | 12.9 MiB/s | 928.0 KiB | 00m00s [213/349] libgnomekbd-0:3.28.1-6.fc41.s 100% | 2.0 MiB/s | 173.8 KiB | 00m00s [214/349] fpaste-0:0.5.0.0-1.fc41.noarc 100% | 555.3 KiB/s | 33.9 KiB | 00m00s [215/349] libxklavier-devel-0:5.4-26.fc 100% | 461.1 KiB/s | 40.1 KiB | 00m00s [216/349] libdbusmenu-gtk3-0:16.04.0-28 100% | 603.2 KiB/s | 36.8 KiB | 00m00s [217/349] python3-xapps-overrides-0:2.8 100% | 138.3 KiB/s | 10.5 KiB | 00m00s [218/349] xdg-utils-0:1.2.1-2.fc41.noar 100% | 1.2 MiB/s | 79.3 KiB | 00m00s [219/349] xorg-x11-xinit-0:1.4.2-3.fc41 100% | 746.2 KiB/s | 57.5 KiB | 00m00s [220/349] sgml-common-0:0.6.3-65.fc41.n 100% | 995.2 KiB/s | 60.7 KiB | 00m00s [221/349] libblkid-devel-0:2.40.2-4.fc4 100% | 425.1 KiB/s | 26.4 KiB | 00m00s [222/349] gettext-runtime-0:0.22.5-6.fc 100% | 1.9 MiB/s | 122.4 KiB | 00m00s [223/349] libtextstyle-0:0.22.5-6.fc41. 100% | 1.2 MiB/s | 90.7 KiB | 00m00s [224/349] gtk2-0:2.24.33-19.fc41.s390x 100% | 27.2 MiB/s | 3.3 MiB | 00m00s [225/349] perl-Data-Dump-0:1.25-11.fc41 100% | 534.0 KiB/s | 32.6 KiB | 00m00s [226/349] perl-Encode-Locale-0:1.05-30. 100% | 300.3 KiB/s | 18.6 KiB | 00m00s [227/349] perl-File-Listing-0:6.16-4.fc 100% | 404.3 KiB/s | 24.7 KiB | 00m00s [228/349] perl-HTML-Parser-0:3.83-1.fc4 100% | 2.0 MiB/s | 126.0 KiB | 00m00s [229/349] perl-HTTP-Date-0:6.06-5.fc41. 100% | 380.6 KiB/s | 24.4 KiB | 00m00s [230/349] perl-HTTP-Cookies-0:6.11-4.fc 100% | 518.5 KiB/s | 37.3 KiB | 00m00s [231/349] perl-HTTP-Message-0:6.46-2.fc 100% | 1.6 MiB/s | 100.8 KiB | 00m00s [232/349] perl-HTTP-Negotiate-0:6.01-39 100% | 321.1 KiB/s | 19.6 KiB | 00m00s [233/349] perl-LWP-MediaTypes-0:6.04-19 100% | 533.5 KiB/s | 33.1 KiB | 00m00s [234/349] perl-Module-Load-1:0.36-511.f 100% | 289.4 KiB/s | 17.4 KiB | 00m00s [235/349] perl-NTLM-0:1.09-39.fc41.noar 100% | 355.5 KiB/s | 21.7 KiB | 00m00s [236/349] perl-Net-HTTP-0:6.23-5.fc41.n 100% | 631.4 KiB/s | 39.1 KiB | 00m00s [237/349] perl-Try-Tiny-0:0.32-1.fc41.n 100% | 615.6 KiB/s | 37.6 KiB | 00m00s [238/349] perl-WWW-RobotRules-0:6.02-40 100% | 328.2 KiB/s | 19.7 KiB | 00m00s [239/349] gsettings-desktop-schemas-0:4 100% | 9.6 MiB/s | 782.9 KiB | 00m00s [240/349] libXtst-devel-0:1.2.5-1.fc41. 100% | 254.1 KiB/s | 15.8 KiB | 00m00s [241/349] libXtst-0:1.2.5-1.fc41.s390x 100% | 330.4 KiB/s | 20.8 KiB | 00m00s [242/349] highcontrast-icon-theme-0:3.2 100% | 22.5 MiB/s | 3.2 MiB | 00m00s [243/349] xprop-0:1.2.7-2.fc41.s390x 100% | 593.1 KiB/s | 36.2 KiB | 00m00s [244/349] adwaita-cursor-theme-0:47.0-1 100% | 4.5 MiB/s | 326.5 KiB | 00m00s [245/349] avahi-glib-0:0.8-29.fc41.s390 100% | 223.5 KiB/s | 15.0 KiB | 00m00s [246/349] adwaita-icon-theme-legacy-0:4 100% | 23.8 MiB/s | 2.5 MiB | 00m00s [247/349] libxklavier-0:5.4-26.fc41.s39 100% | 735.0 KiB/s | 63.2 KiB | 00m00s [248/349] libdbusmenu-0:16.04.0-28.fc41 100% | 2.0 MiB/s | 130.9 KiB | 00m00s [249/349] python3-gobject-base-0:3.48.2 100% | 5.3 MiB/s | 382.1 KiB | 00m00s [250/349] desktop-file-utils-0:0.27-2.f 100% | 1.1 MiB/s | 71.8 KiB | 00m00s [251/349] setxkbmap-0:1.3.4-4.fc41.s390 100% | 273.7 KiB/s | 22.4 KiB | 00m00s [252/349] xmodmap-0:1.0.11-7.fc41.s390x 100% | 374.9 KiB/s | 32.2 KiB | 00m00s [253/349] libicu-0:74.2-2.fc41.s390x 100% | 31.0 MiB/s | 10.4 MiB | 00m00s [254/349] xorg-x11-xauth-1:1.1.3-2.fc41 100% | 451.0 KiB/s | 35.2 KiB | 00m00s [255/349] xrdb-0:1.2.2-4.fc41.s390x 100% | 361.5 KiB/s | 29.6 KiB | 00m00s [256/349] gettext-envsubst-0:0.22.5-6.f 100% | 617.3 KiB/s | 38.3 KiB | 00m00s [257/349] perl-HTML-Tagset-0:3.24-2.fc4 100% | 307.4 KiB/s | 18.4 KiB | 00m00s [258/349] perl-TimeDate-1:2.33-15.fc41. 100% | 944.4 KiB/s | 57.6 KiB | 00m00s [259/349] perl-Clone-0:0.47-1.fc41.s390 100% | 355.5 KiB/s | 22.0 KiB | 00m00s [260/349] perl-Compress-Raw-Zlib-0:2.21 100% | 1.0 MiB/s | 65.2 KiB | 00m00s [261/349] perl-IO-Compress-0:2.212-512. 100% | 4.6 MiB/s | 303.5 KiB | 00m00s [262/349] perl-IO-HTML-0:1.004-13.fc41. 100% | 444.5 KiB/s | 27.6 KiB | 00m00s [263/349] mailcap-0:2.1.54-7.fc41.noarc 100% | 563.4 KiB/s | 34.4 KiB | 00m00s [264/349] perl-Digest-HMAC-0:1.04-11.fc 100% | 368.2 KiB/s | 22.1 KiB | 00m00s [265/349] gobject-introspection-0:1.82. 100% | 1.8 MiB/s | 120.2 KiB | 00m00s [266/349] libXmu-0:1.2.1-2.fc41.s390x 100% | 1.3 MiB/s | 82.9 KiB | 00m00s [267/349] perl-Compress-Raw-Bzip2-0:2.2 100% | 582.6 KiB/s | 35.5 KiB | 00m00s [268/349] libglvnd-1:1.7.0-5.fc41.s390x 100% | 69.7 MiB/s | 142.7 KiB | 00m00s [269/349] libglvnd-core-devel-1:1.7.0-5 100% | 17.5 MiB/s | 17.9 KiB | 00m00s [270/349] libglvnd-egl-1:1.7.0-5.fc41.s 100% | 43.2 MiB/s | 44.2 KiB | 00m00s [271/349] libglvnd-gles-1:1.7.0-5.fc41. 100% | 31.7 MiB/s | 32.5 KiB | 00m00s [272/349] libglvnd-glx-1:1.7.0-5.fc41.s 100% | 69.6 MiB/s | 142.5 KiB | 00m00s [273/349] libglvnd-opengl-1:1.7.0-5.fc4 100% | 44.2 MiB/s | 45.2 KiB | 00m00s [274/349] perl-Digest-SHA-1:6.04-512.fc 100% | 1.0 MiB/s | 61.8 KiB | 00m00s [275/349] libcanberra-0:0.30-36.fc41.s3 100% | 85.8 MiB/s | 87.9 KiB | 00m00s [276/349] iso-codes-0:4.16.0-5.fc41.noa 100% | 18.7 MiB/s | 3.5 MiB | 00m00s [277/349] libtdb-0:1.4.12-3.fc41.s390x 100% | 875.4 KiB/s | 53.4 KiB | 00m00s [278/349] libvorbis-1:1.3.7-11.fc41.s39 100% | 3.3 MiB/s | 211.9 KiB | 00m00s [279/349] libcanberra-gtk2-0:0.30-36.fc 100% | 5.8 MiB/s | 23.6 KiB | 00m00s [280/349] libcanberra-gtk3-0:0.30-36.fc 100% | 9.6 MiB/s | 29.6 KiB | 00m00s [281/349] gstreamer1-0:1.24.9-1.fc41.s3 100% | 202.1 MiB/s | 1.8 MiB | 00m00s [282/349] pulseaudio-libs-0:17.0-2.fc41 100% | 249.5 MiB/s | 766.5 KiB | 00m00s [283/349] libogg-2:1.3.5-9.fc41.s390x 100% | 548.7 KiB/s | 34.0 KiB | 00m00s [284/349] sound-theme-freedesktop-0:0.8 100% | 184.4 MiB/s | 377.7 KiB | 00m00s [285/349] alsa-lib-0:1.2.13-3.fc41.s390 100% | 10.8 MiB/s | 539.7 KiB | 00m00s [286/349] sysprof-capture-devel-0:47.1- 100% | 53.7 MiB/s | 54.9 KiB | 00m00s [287/349] xhost-0:1.0.9-8.fc41.s390x 100% | 6.7 MiB/s | 20.5 KiB | 00m00s [288/349] flex-0:2.6.4-18.fc41.s390x 100% | 153.9 MiB/s | 315.2 KiB | 00m00s [289/349] libxslt-0:1.1.42-3.fc41.s390x 100% | 90.4 MiB/s | 185.2 KiB | 00m00s [290/349] libasyncns-0:0.8-29.fc41.s390 100% | 485.1 KiB/s | 29.6 KiB | 00m00s [291/349] libunwind-0:1.8.0-5.fc41.s390 100% | 1.2 MiB/s | 61.7 KiB | 00m00s [292/349] perl-I18N-Langinfo-0:0.24-512 100% | 920.9 KiB/s | 25.8 KiB | 00m00s [293/349] freetype-devel-0:2.13.3-1.fc4 100% | 248.5 MiB/s | 1.0 MiB | 00m00s [294/349] fribidi-devel-0:1.0.15-2.fc41 100% | 25.0 MiB/s | 25.6 KiB | 00m00s [295/349] libthai-devel-0:0.1.29-9.fc41 100% | 127.4 MiB/s | 130.5 KiB | 00m00s [296/349] perl-subs-0:1.04-512.fc41.noa 100% | 220.1 KiB/s | 11.7 KiB | 00m00s [297/349] bzip2-devel-0:1.0.8-19.fc41.s 100% | 3.4 MiB/s | 213.6 KiB | 00m00s [298/349] fribidi-0:1.0.15-2.fc41.s390x 100% | 92.3 MiB/s | 94.5 KiB | 00m00s [299/349] libthai-0:0.1.29-9.fc41.s390x 100% | 104.9 MiB/s | 214.9 KiB | 00m00s [300/349] libdatrie-devel-0:0.2.13-10.f 100% | 2.4 MiB/s | 155.0 KiB | 00m00s [301/349] ninja-build-0:1.12.1-3.fc41.s 100% | 87.6 MiB/s | 179.5 KiB | 00m00s [302/349] libxml2-devel-0:2.12.8-2.fc41 100% | 242.0 MiB/s | 495.5 KiB | 00m00s [303/349] xorg-x11-proto-devel-0:2024.1 100% | 130.0 MiB/s | 266.2 KiB | 00m00s [304/349] libsoup3-0:3.6.0-1.fc41.s390x 100% | 187.2 MiB/s | 383.3 KiB | 00m00s [305/349] libdatrie-0:0.2.13-10.fc41.s3 100% | 535.7 KiB/s | 33.2 KiB | 00m00s [306/349] libXcursor-devel-0:1.2.3-1.fc 100% | 1.1 MiB/s | 39.5 KiB | 00m00s [307/349] libepoxy-0:1.5.10-8.fc41.s390 100% | 128.8 MiB/s | 263.8 KiB | 00m00s [308/349] libepoxy-devel-0:1.5.10-8.fc4 100% | 65.2 MiB/s | 133.6 KiB | 00m00s [309/349] libxkbcommon-devel-0:1.7.0-4. 100% | 66.3 MiB/s | 67.9 KiB | 00m00s [310/349] libxkbcommon-0:1.7.0-4.fc41.s 100% | 158.3 MiB/s | 162.1 KiB | 00m00s [311/349] libXcursor-0:1.2.3-1.fc41.s39 100% | 1.2 MiB/s | 32.5 KiB | 00m00s [312/349] xz-devel-1:5.6.2-2.fc41.s390x 100% | 1.1 MiB/s | 66.4 KiB | 00m00s [313/349] libjpeg-turbo-devel-0:3.0.2-3 100% | 95.6 MiB/s | 97.9 KiB | 00m00s [314/349] libtiff-devel-0:4.6.0-6.fc41. 100% | 120.8 MiB/s | 247.4 KiB | 00m00s [315/349] f41-backgrounds-gnome-0:41.0. 100% | 192.6 KiB/s | 7.5 KiB | 00m00s [316/349] xkeyboard-config-0:2.42-2.fc4 100% | 13.6 MiB/s | 972.3 KiB | 00m00s [317/349] libwebp-devel-0:1.4.0-4.fc41. 100% | 645.2 KiB/s | 39.4 KiB | 00m00s [318/349] pulseaudio-libs-devel-0:17.0- 100% | 133.6 MiB/s | 410.3 KiB | 00m00s [319/349] pulseaudio-libs-glib2-0:17.0- 100% | 7.7 MiB/s | 15.7 KiB | 00m00s [320/349] pixman-devel-0:0.44.0-0.fc41. 100% | 17.3 MiB/s | 17.7 KiB | 00m00s [321/349] libsndfile-0:1.2.2-5.fc41.s39 100% | 9.0 MiB/s | 240.8 KiB | 00m00s [322/349] gsm-0:1.0.22-7.fc41.s390x 100% | 649.9 KiB/s | 39.6 KiB | 00m00s [323/349] opus-0:1.5.2-1.fc41.s390x 100% | 4.0 MiB/s | 258.1 KiB | 00m00s [324/349] vim-filesystem-2:9.1.866-1.fc 100% | 608.9 KiB/s | 16.4 KiB | 00m00s [325/349] mesa-libGL-0:24.2.7-1.fc41.s3 100% | 5.4 MiB/s | 200.9 KiB | 00m00s [326/349] libXxf86vm-0:1.1.5-7.fc41.s39 100% | 299.2 KiB/s | 17.9 KiB | 00m00s [327/349] libdrm-0:2.4.123-1.fc41.s390x 100% | 2.6 MiB/s | 165.0 KiB | 00m00s [328/349] mesa-libglapi-0:24.2.7-1.fc41 100% | 1.1 MiB/s | 78.7 KiB | 00m00s [329/349] mesa-dri-drivers-0:24.2.7-1.f 100% | 32.8 MiB/s | 3.9 MiB | 00m00s [330/349] f41-backgrounds-base-0:41.0.1 100% | 96.8 MiB/s | 34.1 MiB | 00m00s [331/349] libpciaccess-0:0.16-13.fc41.s 100% | 389.3 KiB/s | 26.5 KiB | 00m00s [332/349] lm_sensors-libs-0:3.6.0-20.fc 100% | 673.4 KiB/s | 41.1 KiB | 00m00s [333/349] mesa-libgbm-0:24.2.7-1.fc41.s 100% | 1.6 MiB/s | 49.5 KiB | 00m00s [334/349] mesa-filesystem-0:24.2.7-1.fc 100% | 633.8 KiB/s | 20.9 KiB | 00m00s [335/349] flac-libs-0:1.4.3-5.fc41.s390 100% | 95.3 MiB/s | 195.2 KiB | 00m00s [336/349] lame-libs-0:3.100-18.fc41.s39 100% | 175.9 MiB/s | 360.3 KiB | 00m00s [337/349] mpg123-libs-0:1.31.3-5.fc41.s 100% | 133.0 MiB/s | 272.5 KiB | 00m00s [338/349] libxshmfence-0:1.3.2-5.fc41.s 100% | 376.1 KiB/s | 13.2 KiB | 00m00s [339/349] mesa-libEGL-0:24.2.7-1.fc41.s 100% | 2.3 MiB/s | 154.1 KiB | 00m00s [340/349] hwdata-0:0.389-1.fc41.noarch 100% | 26.6 MiB/s | 1.6 MiB | 00m00s [341/349] lld-libs-0:19.1.0-1.fc41.s390 100% | 18.2 MiB/s | 2.2 MiB | 00m00s [342/349] lld-0:19.1.0-1.fc41.s390x 100% | 403.5 KiB/s | 34.7 KiB | 00m00s [343/349] llvm-0:19.1.0-1.fc41.s390x 100% | 34.0 MiB/s | 27.5 MiB | 00m01s [344/349] libomp-0:19.1.0-1.fc41.s390x 100% | 27.1 MiB/s | 19.6 MiB | 00m01s [345/349] clang-0:19.1.0-1.fc41.s390x 100% | 1.2 MiB/s | 81.9 KiB | 00m00s [346/349] llvm-libs-0:19.1.0-1.fc41.s39 100% | 36.5 MiB/s | 41.6 MiB | 00m01s [347/349] clang-resource-filesystem-0:1 100% | 159.7 KiB/s | 16.6 KiB | 00m00s [348/349] compiler-rt-0:19.1.0-1.fc41.s 100% | 14.1 MiB/s | 1.7 MiB | 00m00s [349/349] clang-libs-0:19.1.0-1.fc41.s3 100% | 40.5 MiB/s | 35.3 MiB | 00m01s -------------------------------------------------------------------------------- [349/349] Total 100% | 35.5 MiB/s | 245.2 MiB | 00m07s Running transaction [ 1/360] Verify package files 100% | 401.0 B/s | 349.0 B | 00m01s [ 2/360] Prepare transaction 100% | 2.0 KiB/s | 358.0 B | 00m00s [ 3/360] Installing xorg-x11-proto-dev 100% | 198.1 MiB/s | 1.8 MiB | 00m00s [ 4/360] Downgrading llvm-libs-0:19.1. 100% | 340.4 MiB/s | 188.6 MiB | 00m01s [ 5/360] Installing cmake-filesystem-0 100% | 7.1 MiB/s | 7.3 KiB | 00m00s [ 6/360] Installing zlib-ng-compat-dev 100% | 106.0 MiB/s | 108.5 KiB | 00m00s [ 7/360] Installing libglvnd-1:1.7.0-5 100% | 291.4 MiB/s | 895.1 KiB | 00m00s [ 8/360] Installing dbus-libs-1:1.14.1 100% | 48.6 MiB/s | 398.0 KiB | 00m00s [ 9/360] Installing xml-common-0:0.6.3 100% | 79.2 MiB/s | 81.1 KiB | 00m00s [ 10/360] Installing libwayland-client- 100% | 73.3 MiB/s | 75.1 KiB | 00m00s [ 11/360] Installing libpng-2:1.6.40-4. 100% | 124.4 MiB/s | 254.9 KiB | 00m00s [ 12/360] Installing libpng-devel-2:1.6 100% | 217.0 MiB/s | 889.0 KiB | 00m00s [ 13/360] Installing avahi-libs-0:0.8-2 100% | 179.8 MiB/s | 184.1 KiB | 00m00s [ 14/360] Installing libjpeg-turbo-0:3. 100% | 281.5 MiB/s | 864.7 KiB | 00m00s [ 15/360] Installing libepoxy-0:1.5.10- 100% | 343.5 MiB/s | 1.4 MiB | 00m00s [ 16/360] Installing fribidi-0:1.0.15-2 100% | 182.6 MiB/s | 374.0 KiB | 00m00s [ 17/360] Installing libogg-2:1.3.5-9.f 100% | 0.0 B/s | 54.8 KiB | 00m00s [ 18/360] Installing libvorbis-1:1.3.7- 100% | 295.5 MiB/s | 907.7 KiB | 00m00s [ 19/360] Installing libtdb-0:1.4.12-3. 100% | 103.2 MiB/s | 105.7 KiB | 00m00s [ 20/360] Installing libicu-0:74.2-2.fc 100% | 269.8 MiB/s | 35.3 MiB | 00m00s [ 21/360] Installing fonts-filesystem-1 100% | 0.0 B/s | 788.0 B | 00m00s [ 22/360] Installing emacs-filesystem-1 100% | 0.0 B/s | 544.0 B | 00m00s [ 23/360] Installing libwayland-server- 100% | 97.3 MiB/s | 99.6 KiB | 00m00s [ 24/360] Installing libXau-0:1.0.11-7. 100% | 66.6 MiB/s | 68.2 KiB | 00m00s [ 25/360] Installing libxcb-0:1.17.0-3. 100% | 186.0 MiB/s | 1.1 MiB | 00m00s [ 26/360] Installing libX11-xcb-0:1.8.1 100% | 0.0 B/s | 15.7 KiB | 00m00s [ 27/360] Installing libICE-0:1.1.1-4.f 100% | 189.7 MiB/s | 194.3 KiB | 00m00s [ 28/360] Installing libSM-0:1.2.4-4.fc 100% | 104.0 MiB/s | 106.5 KiB | 00m00s [ 29/360] Installing fribidi-devel-0:1. 100% | 80.0 MiB/s | 81.9 KiB | 00m00s [ 30/360] Installing libjpeg-turbo-deve 100% | 347.3 MiB/s | 355.7 KiB | 00m00s [ 31/360] Installing libwayland-cursor- 100% | 0.0 B/s | 42.3 KiB | 00m00s [ 32/360] Installing dbus-devel-1:1.14. 100% | 131.6 MiB/s | 134.8 KiB | 00m00s [ 33/360] Downgrading clang-resource-fi 100% | 0.0 B/s | 16.7 KiB | 00m00s [ 34/360] Installing libxshmfence-0:1.3 100% | 0.0 B/s | 13.4 KiB | 00m00s [ 35/360] Installing pixman-0:0.44.0-0. 100% | 295.7 MiB/s | 605.7 KiB | 00m00s [ 36/360] Installing pixman-devel-0:0.4 100% | 0.0 B/s | 50.2 KiB | 00m00s [ 37/360] Installing libwebp-0:1.4.0-4. 100% | 218.2 MiB/s | 670.3 KiB | 00m00s [ 38/360] Installing libdatrie-0:0.2.13 100% | 0.0 B/s | 62.8 KiB | 00m00s [ 39/360] Installing libthai-0:0.1.29-9 100% | 257.8 MiB/s | 791.9 KiB | 00m00s [ 40/360] Installing libtextstyle-0:0.2 100% | 207.0 MiB/s | 212.0 KiB | 00m00s [ 41/360] Installing gettext-libs-0:0.2 100% | 223.3 MiB/s | 1.8 MiB | 00m00s [ 42/360] Installing m4-0:1.4.19-10.fc4 100% | 155.0 MiB/s | 634.8 KiB | 00m00s [ 43/360] Installing graphite2-0:1.3.14 100% | 204.6 MiB/s | 209.6 KiB | 00m00s [ 44/360] Installing libwayland-egl-0:1 100% | 17.1 MiB/s | 17.5 KiB | 00m00s [ 45/360] Installing hicolor-icon-theme 100% | 17.5 MiB/s | 179.5 KiB | 00m00s [ 46/360] Installing libffi-devel-0:3.4 100% | 0.0 B/s | 30.8 KiB | 00m00s [ 47/360] Installing wayland-devel-0:1. 100% | 223.7 MiB/s | 687.3 KiB | 00m00s [ 48/360] Installing graphite2-devel-0: 100% | 0.0 B/s | 50.6 KiB | 00m00s [ 49/360] Installing flex-0:2.6.4-18.fc 100% | 189.7 MiB/s | 971.3 KiB | 00m00s [ 50/360] Installing libdatrie-devel-0: 100% | 146.3 MiB/s | 599.2 KiB | 00m00s [ 51/360] Installing libthai-devel-0:0. 100% | 175.3 MiB/s | 718.1 KiB | 00m00s [ 52/360] Installing libwebp-devel-0:1. 100% | 60.5 MiB/s | 124.0 KiB | 00m00s [ 53/360] Downgrading clang-libs-0:19.1 100% | 382.6 MiB/s | 214.6 MiB | 00m01s [ 54/360] Installing libICE-devel-0:1.1 100% | 257.2 MiB/s | 263.4 KiB | 00m00s [ 55/360] Installing libXau-devel-0:1.0 100% | 1.1 MiB/s | 8.2 KiB | 00m00s [ 56/360] Installing libxcb-devel-0:1.1 100% | 59.0 MiB/s | 3.1 MiB | 00m00s [ 57/360] Installing abattis-cantarell- 100% | 94.9 MiB/s | 194.4 KiB | 00m00s [ 58/360] Installing libicu-devel-0:74. 100% | 235.0 MiB/s | 5.6 MiB | 00m00s [ 59/360] Installing flac-libs-0:1.4.3- 100% | 112.6 MiB/s | 576.5 KiB | 00m00s [ 60/360] Installing iso-codes-0:4.16.0 100% | 223.8 MiB/s | 19.0 MiB | 00m00s [ 61/360] Installing libglvnd-opengl-1: 100% | 150.0 MiB/s | 153.6 KiB | 00m00s [ 62/360] Downgrading lld-libs-0:19.1.0 100% | 311.6 MiB/s | 9.3 MiB | 00m00s [ 63/360] Installing hwdata-0:0.389-1.f 100% | 404.4 MiB/s | 9.3 MiB | 00m00s [ 64/360] Installing libpciaccess-0:0.1 100% | 44.7 MiB/s | 45.8 KiB | 00m00s [ 65/360] Installing libdrm-0:2.4.123-1 100% | 144.3 MiB/s | 443.2 KiB | 00m00s [ 66/360] Installing mpg123-libs-0:1.31 100% | 225.5 MiB/s | 692.8 KiB | 00m00s [ 67/360] Installing lame-libs-0:3.100- 100% | 320.1 MiB/s | 1.3 MiB | 00m00s [ 68/360] Installing brotli-0:1.1.0-5.f 100% | 0.0 B/s | 28.0 KiB | 00m00s [ 69/360] Installing brotli-devel-0:1.1 100% | 66.4 MiB/s | 68.0 KiB | 00m00s [ 70/360] Installing mesa-filesystem-0: 100% | 0.0 B/s | 4.3 KiB | 00m00s [ 71/360] Installing lm_sensors-libs-0: 100% | 84.7 MiB/s | 86.8 KiB | 00m00s [ 72/360] Installing mesa-libglapi-0:24 100% | 350.1 MiB/s | 358.5 KiB | 00m00s [ 73/360] Installing mesa-dri-drivers-0 100% | 329.2 MiB/s | 15.8 MiB | 00m00s [ 74/360] Installing mesa-libgbm-0:24.2 100% | 68.2 MiB/s | 69.8 KiB | 00m00s [ 75/360] Installing libglvnd-egl-1:1.7 100% | 107.8 MiB/s | 110.4 KiB | 00m00s [ 76/360] Installing mesa-libEGL-0:24.2 100% | 193.8 MiB/s | 396.9 KiB | 00m00s [ 77/360] Installing libglvnd-gles-1:1. 100% | 84.5 MiB/s | 86.6 KiB | 00m00s [ 78/360] Installing liblerc-0:4.0.0-7. 100% | 153.3 MiB/s | 313.9 KiB | 00m00s [ 79/360] Installing vim-filesystem-2:9 100% | 4.6 MiB/s | 4.7 KiB | 00m00s [ 80/360] Installing ninja-build-0:1.12 100% | 160.0 MiB/s | 491.5 KiB | 00m00s [ 81/360] Installing pcre2-utf32-0:10.4 100% | 244.0 MiB/s | 749.7 KiB | 00m00s [ 82/360] Installing pcre2-utf16-0:10.4 100% | 255.8 MiB/s | 785.7 KiB | 00m00s [ 83/360] Installing pcre2-devel-0:10.4 100% | 221.7 MiB/s | 2.0 MiB | 00m00s [ 84/360] Installing opus-0:1.5.2-1.fc4 100% | 219.0 MiB/s | 448.4 KiB | 00m00s [ 85/360] Installing gsm-0:1.0.22-7.fc4 100% | 68.6 MiB/s | 70.2 KiB | 00m00s [ 86/360] Installing libsndfile-0:1.2.2 100% | 197.8 MiB/s | 607.5 KiB | 00m00s [ 87/360] Installing lcms2-0:2.16-4.fc4 100% | 200.1 MiB/s | 614.7 KiB | 00m00s [ 88/360] Installing f41-backgrounds-ba 100% | 620.4 MiB/s | 34.1 MiB | 00m00s [ 89/360] Installing f41-backgrounds-gn 100% | 0.0 B/s | 1.1 KiB | 00m00s [ 90/360] Installing libzstd-devel-0:1. 100% | 198.5 MiB/s | 203.2 KiB | 00m00s [ 91/360] Installing jbigkit-libs-0:2.1 100% | 120.3 MiB/s | 123.2 KiB | 00m00s [ 92/360] Installing libtiff-0:4.6.0-6. 100% | 236.9 MiB/s | 727.7 KiB | 00m00s [ 93/360] Installing libtiff-devel-0:4. 100% | 175.8 MiB/s | 720.0 KiB | 00m00s [ 94/360] Installing xkeyboard-config-0 100% | 251.5 MiB/s | 6.5 MiB | 00m00s [ 95/360] Installing libxkbcommon-0:1.7 100% | 204.1 MiB/s | 418.0 KiB | 00m00s [ 96/360] Installing cups-filesystem-1: 100% | 0.0 B/s | 1.8 KiB | 00m00s [ 97/360] Installing libusb1-0:1.0.27-4 100% | 167.5 MiB/s | 171.6 KiB | 00m00s [ 98/360] Installing libsepol-devel-0:3 100% | 62.4 MiB/s | 127.8 KiB | 00m00s [ 99/360] Installing libselinux-devel-0 100% | 31.5 MiB/s | 161.2 KiB | 00m00s [100/360] Installing xz-devel-1:5.6.2-2 100% | 126.7 MiB/s | 259.4 KiB | 00m00s [101/360] Installing libxml2-devel-0:2. 100% | 310.6 MiB/s | 3.4 MiB | 00m00s [102/360] Installing libxkbcommon-devel 100% | 352.9 MiB/s | 361.3 KiB | 00m00s [103/360] Installing bzip2-devel-0:1.0. 100% | 37.9 MiB/s | 310.7 KiB | 00m00s [104/360] Installing groff-base-0:1.23. 100% | 170.7 MiB/s | 4.6 MiB | 00m00s [105/360] Installing libxslt-0:1.1.42-3 100% | 160.6 MiB/s | 493.3 KiB | 00m00s [106/360] Installing nettle-0:3.10-3.fc 100% | 208.1 MiB/s | 852.3 KiB | 00m00s [107/360] Installing gnutls-0:3.8.7-1.f 100% | 229.8 MiB/s | 3.2 MiB | 00m00s [108/360] Installing glib2-0:2.82.2-1.f 100% | 281.9 MiB/s | 14.9 MiB | 00m00s [109/360] Installing freetype-0:2.13.3- 100% | 214.1 MiB/s | 1.1 MiB | 00m00s [110/360] Installing harfbuzz-0:9.0.0-3 100% | 229.3 MiB/s | 2.8 MiB | 00m00s [111/360] Installing shared-mime-info-0 100% | 170.4 MiB/s | 2.6 MiB | 00m00s [112/360] Installing gdk-pixbuf2-0:2.42 100% | 195.2 MiB/s | 2.5 MiB | 00m00s [113/360] Installing gdk-pixbuf2-module 100% | 59.0 MiB/s | 60.4 KiB | 00m00s [114/360] Installing gtk-update-icon-ca 100% | 69.5 MiB/s | 71.2 KiB | 00m00s [115/360] Installing libcloudproviders- 100% | 130.7 MiB/s | 133.9 KiB | 00m00s [116/360] Installing json-glib-0:1.10.0 100% | 113.7 MiB/s | 582.0 KiB | 00m00s [117/360] Installing cups-libs-1:2.4.11 100% | 235.8 MiB/s | 724.3 KiB | 00m00s [118/360] Installing libgusb-0:0.4.9-2. 100% | 159.6 MiB/s | 163.5 KiB | 00m00s [119/360] Installing colord-libs-0:1.4. 100% | 214.0 MiB/s | 876.5 KiB | 00m00s [120/360] Installing libcloudproviders- 100% | 186.8 MiB/s | 382.5 KiB | 00m00s [121/360] Installing harfbuzz-icu-0:9.0 100% | 0.0 B/s | 20.1 KiB | 00m00s [122/360] Installing gsettings-desktop- 100% | 299.5 MiB/s | 5.4 MiB | 00m00s [123/360] Installing desktop-background 100% | 0.0 B/s | 880.0 B | 00m00s [124/360] Installing avahi-glib-0:0.8-2 100% | 0.0 B/s | 20.2 KiB | 00m00s [125/360] Installing libdbusmenu-0:16.0 100% | 266.7 MiB/s | 546.3 KiB | 00m00s [126/360] Installing desktop-file-utils 100% | 125.7 MiB/s | 257.4 KiB | 00m00s [127/360] Installing xdg-utils-0:1.2.1- 100% | 341.3 MiB/s | 349.5 KiB | 00m00s [128/360] Installing gobject-introspect 100% | 201.3 MiB/s | 412.2 KiB | 00m00s [129/360] Installing python3-gobject-ba 100% | 210.2 MiB/s | 1.5 MiB | 00m00s [130/360] Installing libsoup3-0:3.6.0-1 100% | 174.3 MiB/s | 1.2 MiB | 00m00s [131/360] Installing libtracker-sparql- 100% | 225.7 MiB/s | 1.1 MiB | 00m00s [132/360] Installing sysprof-capture-de 100% | 272.3 MiB/s | 278.8 KiB | 00m00s [133/360] Installing libunwind-0:1.8.0- 100% | 72.8 MiB/s | 149.2 KiB | 00m00s [134/360] Installing gstreamer1-0:1.24. 100% | 243.2 MiB/s | 6.3 MiB | 00m00s [135/360] Installing sound-theme-freede 100% | 65.2 MiB/s | 467.2 KiB | 00m00s [136/360] Installing libasyncns-0:0.8-2 100% | 55.1 MiB/s | 56.4 KiB | 00m00s [137/360] Installing pulseaudio-libs-0: 100% | 248.6 MiB/s | 3.7 MiB | 00m00s [138/360] Installing pulseaudio-libs-gl 100% | 0.0 B/s | 20.1 KiB | 00m00s [139/360] Installing alsa-lib-0:1.2.13- 100% | 188.5 MiB/s | 1.5 MiB | 00m00s [140/360] Installing libcanberra-0:0.30 100% | 45.3 MiB/s | 278.2 KiB | 00m00s [141/360] Installing libglvnd-core-deve 100% | 0.0 B/s | 41.1 KiB | 00m00s [142/360] Installing google-noto-fonts- 100% | 0.0 B/s | 18.3 KiB | 00m00s [143/360] Installing google-noto-sans-v 100% | 208.2 MiB/s | 1.2 MiB | 00m00s [144/360] Installing default-fonts-core 100% | 8.9 MiB/s | 18.2 KiB | 00m00s [145/360] Installing fontconfig-0:2.15. 100% | 825.0 KiB/s | 844.8 KiB | 00m01s [146/360] Installing dbus-common-1:1.14 100% | 713.2 KiB/s | 13.6 KiB | 00m00s [147/360] Installing dbus-broker-0:36-4 100% | 55.3 MiB/s | 396.3 KiB | 00m00s [148/360] Installing dbus-1:1.14.10-4.f 100% | 0.0 B/s | 124.0 B | 00m00s [149/360] Installing ncurses-0:6.5-2.20 100% | 158.2 MiB/s | 648.1 KiB | 00m00s [150/360] Installing perl-Digest-0:1.20 100% | 0.0 B/s | 37.1 KiB | 00m00s [151/360] Installing perl-Digest-MD5-0: 100% | 60.0 MiB/s | 61.5 KiB | 00m00s [152/360] Installing perl-B-0:1.89-512. 100% | 63.1 MiB/s | 517.0 KiB | 00m00s [153/360] Installing perl-FileHandle-0: 100% | 0.0 B/s | 9.8 KiB | 00m00s [154/360] Installing perl-MIME-Base32-0 100% | 0.0 B/s | 32.2 KiB | 00m00s [155/360] Installing perl-Data-Dumper-0 100% | 114.6 MiB/s | 117.4 KiB | 00m00s [156/360] Installing perl-libnet-0:3.15 100% | 143.9 MiB/s | 294.7 KiB | 00m00s [157/360] Installing perl-AutoLoader-0: 100% | 0.0 B/s | 20.9 KiB | 00m00s [158/360] Installing perl-IO-Socket-IP- 100% | 98.1 MiB/s | 100.5 KiB | 00m00s [159/360] Installing perl-URI-0:5.30-1. 100% | 87.7 MiB/s | 269.5 KiB | 00m00s [160/360] Installing perl-Text-Tabs+Wra 100% | 0.0 B/s | 23.9 KiB | 00m00s [161/360] Installing perl-Time-Local-2: 100% | 0.0 B/s | 70.6 KiB | 00m00s [162/360] Installing perl-File-Path-0:2 100% | 0.0 B/s | 64.5 KiB | 00m00s [163/360] Installing perl-Pod-Escapes-1 100% | 0.0 B/s | 25.9 KiB | 00m00s [164/360] Installing perl-if-0:0.61.000 100% | 0.0 B/s | 6.2 KiB | 00m00s [165/360] Installing perl-Net-SSLeay-0: 100% | 203.6 MiB/s | 1.4 MiB | 00m00s [166/360] Installing perl-locale-0:1.12 100% | 0.0 B/s | 6.9 KiB | 00m00s [167/360] Installing perl-IO-Socket-SSL 100% | 230.3 MiB/s | 707.4 KiB | 00m00s [168/360] Installing perl-Term-ANSIColo 100% | 0.0 B/s | 99.2 KiB | 00m00s [169/360] Installing perl-Term-Cap-0:1. 100% | 0.0 B/s | 30.6 KiB | 00m00s [170/360] Installing perl-POSIX-0:2.20- 100% | 238.4 MiB/s | 244.2 KiB | 00m00s [171/360] Installing perl-Class-Struct- 100% | 0.0 B/s | 25.9 KiB | 00m00s [172/360] Installing perl-File-Temp-1:0 100% | 160.2 MiB/s | 164.1 KiB | 00m00s [173/360] Installing perl-HTTP-Tiny-0:0 100% | 152.8 MiB/s | 156.4 KiB | 00m00s [174/360] Installing perl-Pod-Simple-1: 100% | 185.7 MiB/s | 570.5 KiB | 00m00s [175/360] Installing perl-IPC-Open3-0:1 100% | 0.0 B/s | 23.3 KiB | 00m00s [176/360] Installing perl-Socket-4:2.03 100% | 126.8 MiB/s | 129.9 KiB | 00m00s [177/360] Installing perl-Symbol-0:1.09 100% | 0.0 B/s | 7.2 KiB | 00m00s [178/360] Installing perl-File-stat-0:1 100% | 0.0 B/s | 13.1 KiB | 00m00s [179/360] Installing perl-podlators-1:6 100% | 157.0 MiB/s | 321.4 KiB | 00m00s [180/360] Installing perl-Pod-Perldoc-0 100% | 165.3 MiB/s | 169.3 KiB | 00m00s [181/360] Installing perl-SelectSaver-0 100% | 0.0 B/s | 2.6 KiB | 00m00s [182/360] Installing perl-Text-ParseWor 100% | 0.0 B/s | 14.6 KiB | 00m00s [183/360] Installing perl-Fcntl-0:1.18- 100% | 0.0 B/s | 49.9 KiB | 00m00s [184/360] Installing perl-base-0:2.27-5 100% | 0.0 B/s | 12.9 KiB | 00m00s [185/360] Installing perl-mro-0:1.29-51 100% | 0.0 B/s | 42.5 KiB | 00m00s [186/360] Installing perl-overloading-0 100% | 0.0 B/s | 5.5 KiB | 00m00s [187/360] Installing perl-Pod-Usage-4:2 100% | 84.3 MiB/s | 86.3 KiB | 00m00s [188/360] Installing perl-IO-0:1.55-512 100% | 147.6 MiB/s | 151.1 KiB | 00m00s [189/360] Installing perl-constant-0:1. 100% | 0.0 B/s | 27.4 KiB | 00m00s [190/360] Installing perl-MIME-Base64-0 100% | 0.0 B/s | 48.1 KiB | 00m00s [191/360] Installing perl-parent-1:0.24 100% | 0.0 B/s | 10.7 KiB | 00m00s [192/360] Installing perl-Scalar-List-U 100% | 144.9 MiB/s | 148.4 KiB | 00m00s [193/360] Installing perl-Errno-0:1.38- 100% | 0.0 B/s | 8.8 KiB | 00m00s [194/360] Installing perl-File-Basename 100% | 0.0 B/s | 14.6 KiB | 00m00s [195/360] Installing perl-vars-0:1.05-5 100% | 0.0 B/s | 4.3 KiB | 00m00s [196/360] Installing perl-Getopt-Std-0: 100% | 0.0 B/s | 11.7 KiB | 00m00s [197/360] Installing perl-overload-0:1. 100% | 0.0 B/s | 71.9 KiB | 00m00s [198/360] Installing perl-Storable-1:3. 100% | 228.3 MiB/s | 233.8 KiB | 00m00s [199/360] Installing perl-Getopt-Long-1 100% | 143.8 MiB/s | 147.2 KiB | 00m00s [200/360] Installing perl-Carp-0:1.54-5 100% | 0.0 B/s | 47.7 KiB | 00m00s [201/360] Installing perl-Exporter-0:5. 100% | 0.0 B/s | 55.6 KiB | 00m00s [202/360] Installing perl-PathTools-0:3 100% | 180.0 MiB/s | 184.3 KiB | 00m00s [203/360] Installing perl-DynaLoader-0: 100% | 0.0 B/s | 32.5 KiB | 00m00s [204/360] Installing perl-Encode-4:3.21 100% | 291.2 MiB/s | 9.6 MiB | 00m00s [205/360] Installing perl-libs-4:5.40.0 100% | 218.3 MiB/s | 10.3 MiB | 00m00s [206/360] Installing perl-interpreter-4 100% | 116.9 MiB/s | 119.8 KiB | 00m00s [207/360] Installing perl-Compress-Raw- 100% | 164.6 MiB/s | 168.5 KiB | 00m00s [208/360] Installing perl-File-Copy-0:2 100% | 0.0 B/s | 20.2 KiB | 00m00s [209/360] Installing perl-threads-1:2.4 100% | 114.2 MiB/s | 117.0 KiB | 00m00s [210/360] Installing perl-File-Find-0:1 100% | 0.0 B/s | 42.5 KiB | 00m00s [211/360] Installing perl-threads-share 100% | 83.7 MiB/s | 85.7 KiB | 00m00s [212/360] Installing perl-Thread-Queue- 100% | 0.0 B/s | 30.4 KiB | 00m00s [213/360] Installing perl-Digest-SHA-1: 100% | 116.1 MiB/s | 118.9 KiB | 00m00s [214/360] Installing perl-Digest-HMAC-0 100% | 0.0 B/s | 30.1 KiB | 00m00s [215/360] Installing perl-NTLM-0:1.09-3 100% | 0.0 B/s | 32.7 KiB | 00m00s [216/360] Installing perl-Module-Load-1 100% | 0.0 B/s | 15.9 KiB | 00m00s [217/360] Installing perl-Try-Tiny-0:0. 100% | 69.4 MiB/s | 71.1 KiB | 00m00s [218/360] Installing perl-WWW-RobotRule 100% | 0.0 B/s | 25.8 KiB | 00m00s [219/360] Installing perl-HTML-Tagset-0 100% | 0.0 B/s | 19.7 KiB | 00m00s [220/360] Installing perl-TimeDate-1:2. 100% | 50.6 MiB/s | 103.7 KiB | 00m00s [221/360] Installing perl-HTTP-Date-0:6 100% | 0.0 B/s | 42.6 KiB | 00m00s [222/360] Installing perl-File-Listing- 100% | 0.0 B/s | 42.5 KiB | 00m00s [223/360] Installing perl-Clone-0:0.47- 100% | 0.0 B/s | 38.0 KiB | 00m00s [224/360] Installing perl-IO-HTML-0:1.0 100% | 0.0 B/s | 46.8 KiB | 00m00s [225/360] Installing perl-Compress-Raw- 100% | 69.9 MiB/s | 71.6 KiB | 00m00s [226/360] Installing perl-IO-Compress-0 100% | 257.3 MiB/s | 1.0 MiB | 00m00s [227/360] Installing perl-Net-HTTP-0:6. 100% | 75.4 MiB/s | 77.2 KiB | 00m00s [228/360] Installing perl-I18N-Langinfo 100% | 0.0 B/s | 36.0 KiB | 00m00s [229/360] Installing perl-Encode-Locale 100% | 0.0 B/s | 20.1 KiB | 00m00s [230/360] Installing perl-subs-0:1.04-5 100% | 0.0 B/s | 2.5 KiB | 00m00s [231/360] Installing perl-Data-Dump-0:1 100% | 0.0 B/s | 52.2 KiB | 00m00s [232/360] Installing perl-File-Compare- 100% | 0.0 B/s | 6.1 KiB | 00m00s [233/360] Installing autoconf-0:2.72-3. 100% | 310.9 MiB/s | 2.8 MiB | 00m00s [234/360] Installing automake-0:1.16.5- 100% | 252.0 MiB/s | 1.8 MiB | 00m00s [235/360] Installing mailcap-0:2.1.54-7 100% | 0.0 B/s | 87.1 KiB | 00m00s [236/360] Installing perl-LWP-MediaType 100% | 78.6 MiB/s | 80.5 KiB | 00m00s [237/360] Installing perl-HTTP-Message- 100% | 107.4 MiB/s | 219.9 KiB | 00m00s [238/360] Installing perl-HTML-Parser-0 100% | 144.3 MiB/s | 295.6 KiB | 00m00s [239/360] Installing perl-HTTP-Cookies- 100% | 73.9 MiB/s | 75.7 KiB | 00m00s [240/360] Installing perl-HTTP-Negotiat 100% | 0.0 B/s | 28.7 KiB | 00m00s [241/360] Installing perl-libwww-perl-0 100% | 172.6 MiB/s | 530.3 KiB | 00m00s [242/360] Installing perl-XML-Parser-0: 100% | 218.6 MiB/s | 671.5 KiB | 00m00s [243/360] Installing gettext-envsubst-0 100% | 74.3 MiB/s | 76.1 KiB | 00m00s [244/360] Installing gettext-runtime-0: 100% | 119.7 MiB/s | 490.2 KiB | 00m00s [245/360] Installing gettext-0:0.22.5-6 100% | 243.0 MiB/s | 5.3 MiB | 00m00s [246/360] Installing adwaita-icon-theme 100% | 64.0 MiB/s | 2.4 MiB | 00m00s [247/360] Installing adwaita-cursor-the 100% | 528.2 MiB/s | 10.0 MiB | 00m00s [248/360] Installing adwaita-icon-theme 100% | 50.9 MiB/s | 1.3 MiB | 00m00s [249/360] Installing highcontrast-icon- 100% | 65.5 MiB/s | 4.8 MiB | 00m00s [250/360] Installing gnome-themes-extra 100% | 0.0 B/s | 49.4 KiB | 00m00s [251/360] Installing libblkid-devel-0:2 100% | 0.0 B/s | 46.0 KiB | 00m00s [252/360] Installing libmount-devel-0:2 100% | 0.0 B/s | 64.5 KiB | 00m00s [253/360] Installing sgml-common-0:0.6. 100% | 85.4 MiB/s | 174.9 KiB | 00m00s [254/360] Installing docbook-dtds-0:1.0 100% | 42.0 MiB/s | 8.3 MiB | 00m00s [255/360] Installing docbook-style-xsl- 100% | 226.6 MiB/s | 15.9 MiB | 00m00s [256/360] Installing fpaste-0:0.5.0.0-1 100% | 75.1 MiB/s | 76.9 KiB | 00m00s [257/360] Installing libX11-common-0:1. 100% | 131.9 MiB/s | 1.2 MiB | 00m00s [258/360] Installing libX11-0:1.8.10-2. 100% | 172.2 MiB/s | 1.4 MiB | 00m00s [259/360] Installing libX11-devel-0:1.8 100% | 62.2 MiB/s | 1.1 MiB | 00m00s [260/360] Installing libXext-0:1.3.6-2. 100% | 96.6 MiB/s | 99.0 KiB | 00m00s [261/360] Installing libXext-devel-0:1. 100% | 54.2 MiB/s | 110.9 KiB | 00m00s [262/360] Installing libXrender-0:0.9.1 100% | 0.0 B/s | 55.1 KiB | 00m00s [263/360] Installing cairo-0:1.18.0-4.f 100% | 254.6 MiB/s | 1.8 MiB | 00m00s [264/360] Installing libXrender-devel-0 100% | 0.0 B/s | 51.0 KiB | 00m00s [265/360] Installing libXi-0:1.8.2-1.fc 100% | 0.0 B/s | 85.5 KiB | 00m00s [266/360] Installing libXfixes-0:6.0.1- 100% | 0.0 B/s | 31.5 KiB | 00m00s [267/360] Installing libXfixes-devel-0: 100% | 0.0 B/s | 9.9 KiB | 00m00s [268/360] Installing cairo-gobject-0:1. 100% | 0.0 B/s | 43.8 KiB | 00m00s [269/360] Installing libXrandr-0:1.5.4- 100% | 55.4 MiB/s | 56.8 KiB | 00m00s [270/360] Installing libXi-devel-0:1.8. 100% | 70.6 MiB/s | 144.6 KiB | 00m00s [271/360] Installing libxkbfile-0:1.1.3 100% | 217.8 MiB/s | 223.0 KiB | 00m00s [272/360] Installing libXdamage-0:1.1.6 100% | 0.0 B/s | 45.1 KiB | 00m00s [273/360] Installing libXcursor-0:1.2.3 100% | 53.7 MiB/s | 55.0 KiB | 00m00s [274/360] Installing libXinerama-0:1.1. 100% | 0.0 B/s | 19.9 KiB | 00m00s [275/360] Installing libXcomposite-0:0. 100% | 0.0 B/s | 45.9 KiB | 00m00s [276/360] Installing libXcomposite-deve 100% | 0.0 B/s | 10.5 KiB | 00m00s [277/360] Installing libXinerama-devel- 100% | 0.0 B/s | 8.5 KiB | 00m00s [278/360] Installing libXcursor-devel-0 100% | 32.0 MiB/s | 32.8 KiB | 00m00s [279/360] Installing libxkbfile-devel-0 100% | 0.0 B/s | 38.1 KiB | 00m00s [280/360] Installing libxklavier-0:5.4- 100% | 156.0 MiB/s | 159.7 KiB | 00m00s [281/360] Installing libXrandr-devel-0: 100% | 0.0 B/s | 24.7 KiB | 00m00s [282/360] Installing libXtst-0:1.2.5-1. 100% | 0.0 B/s | 42.4 KiB | 00m00s [283/360] Installing libXft-0:2.3.8-7.f 100% | 169.7 MiB/s | 173.8 KiB | 00m00s [284/360] Installing pango-0:1.54.0-2.f 100% | 207.1 MiB/s | 1.0 MiB | 00m00s [285/360] Installing libXtst-devel-0:1. 100% | 0.0 B/s | 14.0 KiB | 00m00s [286/360] Installing libXdamage-devel-0 100% | 0.0 B/s | 3.1 KiB | 00m00s [287/360] Installing setxkbmap-0:1.3.4- 100% | 0.0 B/s | 36.2 KiB | 00m00s [288/360] Installing harfbuzz-cairo-0:9 100% | 0.0 B/s | 56.8 KiB | 00m00s [289/360] Installing libXxf86vm-0:1.1.5 100% | 0.0 B/s | 26.3 KiB | 00m00s [290/360] Installing libglvnd-glx-1:1.7 100% | 282.5 MiB/s | 578.6 KiB | 00m00s [291/360] Installing mesa-libGL-0:24.2. 100% | 288.6 MiB/s | 591.0 KiB | 00m00s [292/360] Installing libglvnd-devel-1:1 100% | 424.1 MiB/s | 2.1 MiB | 00m00s [293/360] Installing libepoxy-devel-0:1 100% | 529.8 MiB/s | 1.6 MiB | 00m00s [294/360] Installing xprop-0:1.2.7-2.fc 100% | 62.5 MiB/s | 64.0 KiB | 00m00s [295/360] Installing at-spi2-core-0:2.5 100% | 172.1 MiB/s | 1.5 MiB | 00m00s [296/360] Installing atk-0:2.54.0-1.fc4 100% | 267.6 MiB/s | 274.0 KiB | 00m00s [297/360] Installing at-spi2-atk-0:2.54 100% | 148.9 MiB/s | 305.0 KiB | 00m00s [298/360] Installing gtk3-0:3.24.43-2.f 100% | 278.4 MiB/s | 23.1 MiB | 00m00s [299/360] Installing libgnomekbd-0:3.28 100% | 125.1 MiB/s | 640.3 KiB | 00m00s [300/360] Installing libcanberra-gtk3-0 100% | 67.7 MiB/s | 69.3 KiB | 00m00s [301/360] Installing gtk2-0:2.24.33-19. 100% | 240.9 MiB/s | 13.2 MiB | 00m00s [302/360] Installing libcanberra-gtk2-0 100% | 0.0 B/s | 47.1 KiB | 00m00s [303/360] Installing libdbusmenu-gtk3-0 100% | 91.3 MiB/s | 93.5 KiB | 00m00s [304/360] Installing xmodmap-0:1.0.11-7 100% | 0.0 B/s | 56.2 KiB | 00m00s [305/360] Installing libXt-0:1.3.1-1.fc 100% | 229.8 MiB/s | 470.6 KiB | 00m00s [306/360] Installing libXmu-0:1.2.1-2.f 100% | 208.0 MiB/s | 213.0 KiB | 00m00s [307/360] Installing xorg-x11-xauth-1:1 100% | 0.0 B/s | 65.1 KiB | 00m00s [308/360] Installing xrdb-0:1.2.2-4.fc4 100% | 0.0 B/s | 47.6 KiB | 00m00s [309/360] Installing xhost-0:1.0.9-8.fc 100% | 0.0 B/s | 22.2 KiB | 00m00s [310/360] Installing xorg-x11-xinit-0:1 100% | 135.9 MiB/s | 139.2 KiB | 00m00s [311/360] Installing python3-xapps-over 100% | 1.3 MiB/s | 2.8 KiB | 00m00s [312/360] Installing xapps-0:2.8.5-1.fc 100% | 278.3 MiB/s | 6.1 MiB | 00m00s [313/360] Installing redhat-menus-0:12. 100% | 134.7 MiB/s | 689.6 KiB | 00m00s [314/360] Installing cinnamon-desktop-0 100% | 127.0 MiB/s | 1.0 MiB | 00m00s [315/360] Installing gettext-common-dev 100% | 573.0 MiB/s | 586.8 KiB | 00m00s [316/360] Installing gettext-devel-0:0. 100% | 198.6 MiB/s | 1.0 MiB | 00m00s [317/360] Installing libuuid-devel-0:2. 100% | 14.3 MiB/s | 43.8 KiB | 00m00s [318/360] Installing python3-setuptools 100% | 229.1 MiB/s | 7.3 MiB | 00m00s [319/360] Installing python3-packaging- 100% | 141.0 MiB/s | 433.2 KiB | 00m00s [320/360] Installing glib2-devel-0:2.82 100% | 383.3 MiB/s | 15.7 MiB | 00m00s [321/360] Installing atk-devel-0:2.54.0 100% | 274.2 MiB/s | 6.0 MiB | 00m00s [322/360] Installing gdk-pixbuf2-devel- 100% | 255.6 MiB/s | 2.3 MiB | 00m00s [323/360] Installing fontconfig-devel-0 100% | 29.7 MiB/s | 151.9 KiB | 00m00s [324/360] Installing freetype-devel-0:2 100% | 355.9 MiB/s | 8.5 MiB | 00m00s [325/360] Installing cairo-devel-0:1.18 100% | 327.3 MiB/s | 2.3 MiB | 00m00s [326/360] Installing harfbuzz-devel-0:9 100% | 364.7 MiB/s | 5.1 MiB | 00m00s [327/360] Installing cairo-gobject-deve 100% | 0.0 B/s | 7.6 KiB | 00m00s [328/360] Installing libXft-devel-0:2.3 100% | 21.6 MiB/s | 44.3 KiB | 00m00s [329/360] Installing pango-devel-0:1.54 100% | 300.7 MiB/s | 1.5 MiB | 00m00s [330/360] Installing gtk2-devel-0:2.24. 100% | 361.6 MiB/s | 23.9 MiB | 00m00s [331/360] Installing at-spi2-core-devel 100% | 277.0 MiB/s | 4.2 MiB | 00m00s [332/360] Installing at-spi2-atk-devel- 100% | 1.1 MiB/s | 2.2 KiB | 00m00s [333/360] Installing gtk3-devel-0:3.24. 100% | 373.7 MiB/s | 34.0 MiB | 00m00s [334/360] Installing libxklavier-devel- 100% | 242.6 MiB/s | 248.4 KiB | 00m00s [335/360] Installing libgnomekbd-devel- 100% | 118.6 MiB/s | 121.4 KiB | 00m00s [336/360] Installing pulseaudio-libs-de 100% | 309.5 MiB/s | 5.0 MiB | 00m00s [337/360] Installing cinnamon-desktop-d 100% | 252.9 MiB/s | 517.9 KiB | 00m00s [338/360] Installing xapps-devel-0:2.8. 100% | 499.9 MiB/s | 511.9 KiB | 00m00s [339/360] Installing libcanberra-devel- 100% | 48.5 MiB/s | 149.0 KiB | 00m00s [340/360] Installing meson-0:1.5.1-1.fc 100% | 274.2 MiB/s | 11.5 MiB | 00m00s [341/360] Installing libSM-devel-0:1.2. 100% | 0.0 B/s | 19.7 KiB | 00m00s [342/360] Installing intltool-0:0.51.0- 100% | 167.8 MiB/s | 171.8 KiB | 00m00s [343/360] Installing xmlto-0:0.0.29-1.f 100% | 61.5 MiB/s | 126.0 KiB | 00m00s [344/360] Downgrading lld-0:19.1.0-1.fc 100% | 7.5 MiB/s | 53.6 KiB | 00m00s [345/360] Downgrading clang-0:19.1.0-1. 100% | 96.8 MiB/s | 198.2 KiB | 00m00s [346/360] Downgrading compiler-rt-0:19. 100% | 445.0 MiB/s | 20.5 MiB | 00m00s [347/360] Downgrading llvm-0:19.1.0-1.f 100% | 307.1 MiB/s | 114.2 MiB | 00m00s [348/360] Downgrading libomp-0:19.1.0-1 100% | 360.4 MiB/s | 83.6 MiB | 00m00s [349/360] Installing systemd-rpm-macros 100% | 0.0 B/s | 11.2 KiB | 00m00s [350/360] Installing xorg-x11-xtrans-de 100% | 92.3 MiB/s | 283.6 KiB | 00m00s [351/360] Installing systemd-devel-0:25 100% | 44.7 MiB/s | 686.2 KiB | 00m00s [352/360] Removing lld-0:20.0.0~pre2024 100% | 2.0 KiB/s | 12.0 B | 00m00s [353/360] Removing clang-0:20.0.0~pre20 100% | 16.6 KiB/s | 17.0 B | 00m00s [354/360] Removing clang-libs-0:20.0.0~ 100% | 14.7 KiB/s | 317.0 B | 00m00s [355/360] Removing lld-libs-0:20.0.0~pr 100% | 9.3 KiB/s | 19.0 B | 00m00s [356/360] Removing llvm-0:20.0.0~pre202 100% | 148.9 KiB/s | 305.0 B | 00m00s [357/360] Removing libomp-0:20.0.0~pre2 100% | 13.7 KiB/s | 14.0 B | 00m00s [358/360] Removing compiler-rt-0:20.0.0 100% | 23.4 KiB/s | 72.0 B | 00m00s [359/360] Removing clang-resource-files 100% | 2.9 KiB/s | 9.0 B | 00m00s [360/360] Removing llvm-libs-0:20.0.0~p 100% | 33.0 B/s | 19.0 B | 00m01s Warning: skipped PGP checks for 56 packages from repository: copr_base Complete! Finish: build setup for cinnamon-session-6.2.1-1.fc41.src.rpm Start: rpmbuild cinnamon-session-6.2.1-1.fc41.src.rpm Building target platforms: s390x Building for target s390x setting SOURCE_DATE_EPOCH=1721347200 Executing(%mkbuilddir): /bin/sh -e /var/tmp/rpm-tmp.HYEOWj + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + test -d /builddir/build/BUILD/cinnamon-session-6.2.1-build + /usr/bin/chmod -Rf a+rX,u+w,g-w,o-w /builddir/build/BUILD/cinnamon-session-6.2.1-build + /usr/bin/rm -rf /builddir/build/BUILD/cinnamon-session-6.2.1-build + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.2.1-build + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.2.1-build/SPECPARTS + RPM_EC=0 ++ jobs -p + exit 0 Executing(%prep): /bin/sh -e /var/tmp/rpm-tmp.YydH7O + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + rm -rf cinnamon-session-6.2.1 + /usr/lib/rpm/rpmuncompress -x /builddir/build/SOURCES/cinnamon-session-6.2.1.tar.gz + STATUS=0 + '[' 0 -ne 0 ']' + cd cinnamon-session-6.2.1 + /usr/bin/chmod -Rf a+rX,u+w,g-w,o-w . + RPM_EC=0 ++ jobs -p + exit 0 Executing(%build): /bin/sh -e /var/tmp/rpm-tmp.DIRyKx + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + CFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CFLAGS + CXXFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CXXFLAGS + FFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FFLAGS + FCFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FCFLAGS + VALAFLAGS=-g + export VALAFLAGS + RUSTFLAGS='-Copt-level=3 -Cdebuginfo=2 -Ccodegen-units=1 -Cstrip=none --cap-lints=warn' + export RUSTFLAGS + LDFLAGS='-Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 ' + export LDFLAGS + LT_SYS_LIBRARY_PATH=/usr/lib64: + export LT_SYS_LIBRARY_PATH + CC=clang + export CC + CXX=clang++ + export CXX + cd cinnamon-session-6.2.1 + CFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CFLAGS + CXXFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CXXFLAGS + FFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FFLAGS + FCFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FCFLAGS + VALAFLAGS=-g + export VALAFLAGS + RUSTFLAGS='-Copt-level=3 -Cdebuginfo=2 -Ccodegen-units=1 -Cstrip=none --cap-lints=warn' + export RUSTFLAGS + LDFLAGS='-Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 ' + export LDFLAGS + LT_SYS_LIBRARY_PATH=/usr/lib64: + export LT_SYS_LIBRARY_PATH + CC=clang + export CC + CXX=clang++ + export CXX + /usr/bin/meson setup --buildtype=plain --prefix=/usr --libdir=/usr/lib64 --libexecdir=/usr/libexec --bindir=/usr/bin --sbindir=/usr/sbin --includedir=/usr/include --datadir=/usr/share --mandir=/usr/share/man --infodir=/usr/share/info --localedir=/usr/share/locale --sysconfdir=/etc --localstatedir=/var --sharedstatedir=/var/lib --wrap-mode=nodownload --auto-features=enabled . redhat-linux-build The Meson build system Version: 1.5.1 Source dir: /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1 Build dir: /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/redhat-linux-build Build type: native build Project name: cinnamon-session Project version: 6.2.1 C compiler for the host machine: clang (clang 19.1.0 "clang version 19.1.0 (Fedora 19.1.0-1.fc41)") C linker for the host machine: clang ld.bfd 2.43.1-2 Host machine cpu family: s390x Host machine cpu: s390x Compiler for C supports arguments -Wno-deprecated-declarations: YES Compiler for C supports arguments -Wno-unused: YES Found pkg-config: YES (/usr/bin/pkg-config) 2.3.0 Run-time dependency gio-2.0 found: YES 2.82.2 Run-time dependency gtk+-3.0 found: YES 3.24.43 Run-time dependency glib-2.0 found: YES 2.82.2 Run-time dependency libcanberra found: YES 0.30 Run-time dependency pango found: YES 1.54.0 Run-time dependency pangoxft found: YES 1.54.0 Run-time dependency sm found: YES 1.2.4 Run-time dependency ice found: YES 1.1.1 Run-time dependency x11 found: YES 1.8.10 Run-time dependency xext found: YES 1.3.6 Run-time dependency xapp found: YES 2.8.5 Run-time dependency xau found: YES 1.0.11 Run-time dependency xcomposite found: YES 0.4.6 Run-time dependency gl found: YES 1.2 Run-time dependency cinnamon-desktop found: YES 6.2.0 Run-time dependency gio-unix-2.0 found: YES 2.82.2 Did not find CMake 'cmake' Found CMake: NO Run-time dependency libelogind found: NO (tried pkgconfig and cmake) Run-time dependency libsystemd-login found: NO (tried pkgconfig and cmake) Run-time dependency libsystemd found: YES 256 Run-time dependency xtst found: YES 1.2.5 Run-time dependency xrender found: YES 0.9.11 Has header "execinfo.h" : YES Library backtrace found: NO Library execinfo found: NO Run-time dependency xtrans found: YES 1.5.2 Checking for function "getaddrinfo" : YES Configuring config.h using configuration Dependency glib-2.0 found: YES 2.82.2 (cached) Program /usr/bin/glib-genmarshal found: YES (/usr/bin/glib-genmarshal) Dependency gio-2.0 found: YES 2.82.2 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.82.2 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.82.2 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.82.2 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.82.2 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.82.2 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Configuring cinnamon-session using configuration Configuring config.py using configuration Configuring cinnamon-session-quit using configuration Message: cinnamon-session 6.2.1 prefix: /usr exec_prefix: /usr libdir: lib64 libexecdir: libexec bindir: bin sbindir: sbin sysconfdir: /etc localstatedir: /var datadir: share source code location: /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1 compiler: clang cflags: ['-Wno-deprecated-declarations', '-Wno-unused', '-DHAVE_CONFIG_H'] Logind support: true IPv6 support: true Backtrace support: false XRender support: true XTest support: true Build targets in project: 21 cinnamon-session 6.2.1 User defined options auto_features : enabled bindir : /usr/bin buildtype : plain datadir : /usr/share includedir : /usr/include infodir : /usr/share/info libdir : /usr/lib64 libexecdir : /usr/libexec localedir : /usr/share/locale localstatedir : /var mandir : /usr/share/man prefix : /usr sbindir : /usr/sbin sharedstatedir: /var/lib sysconfdir : /etc wrap_mode : nodownload Found ninja-1.12.1 at /usr/bin/ninja + /usr/bin/meson compile -C redhat-linux-build -j 2 --verbose ninja: Entering directory `/builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/redhat-linux-build' [1/57] /usr/bin/glib-genmarshal --quiet --prefix csm_marshal --output cinnamon-session/csm-marshal.h --header ../cinnamon-session/csm-marshal.list --pragma-once [2/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager. --c-namespace Csm --annotate org.gnome.SessionManager org.gtk.GDBus.C.Name ExportedManager --body --output cinnamon-session/csm-exported-manager.c ../cinnamon-session/org.gnome.SessionManager.xml [3/57] /usr/bin/glib-genmarshal --quiet --prefix csm_marshal --output cinnamon-session/csm-marshal.c --body ../cinnamon-session/csm-marshal.list --include-header csm-marshal.h [4/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager. --c-namespace Csm --annotate org.gnome.SessionManager org.gtk.GDBus.C.Name ExportedManager --header --output cinnamon-session/csm-exported-manager.h ../cinnamon-session/org.gnome.SessionManager.xml [5/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Client. --c-namespace Csm --annotate org.gnome.SessionManager.Client org.gtk.GDBus.C.Name ExportedClient --body --output cinnamon-session/csm-exported-client.c ../cinnamon-session/org.gnome.SessionManager.Client.xml [6/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Client. --c-namespace Csm --annotate org.gnome.SessionManager.Client org.gtk.GDBus.C.Name ExportedClient --header --output cinnamon-session/csm-exported-client.h ../cinnamon-session/org.gnome.SessionManager.Client.xml [7/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.ClientPrivate. --c-namespace Csm --annotate org.gnome.SessionManager.ClientPrivate org.gtk.GDBus.C.Name ExportedClientPrivate --body --output cinnamon-session/csm-exported-client-private.c ../cinnamon-session/org.gnome.SessionManager.ClientPrivate.xml [8/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.ClientPrivate. --c-namespace Csm --annotate org.gnome.SessionManager.ClientPrivate org.gtk.GDBus.C.Name ExportedClientPrivate --header --output cinnamon-session/csm-exported-client-private.h ../cinnamon-session/org.gnome.SessionManager.ClientPrivate.xml [9/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.App. --c-namespace Csm --annotate org.gnome.SessionManager.App org.gtk.GDBus.C.Name ExportedApp --body --output cinnamon-session/csm-exported-app.c ../cinnamon-session/org.gnome.SessionManager.App.xml [10/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.App. --c-namespace Csm --annotate org.gnome.SessionManager.App org.gtk.GDBus.C.Name ExportedApp --header --output cinnamon-session/csm-exported-app.h ../cinnamon-session/org.gnome.SessionManager.App.xml [11/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Inhibitor. --c-namespace Csm --annotate org.gnome.SessionManager.Inhibitor org.gtk.GDBus.C.Name ExportedInhibitor --body --output cinnamon-session/csm-exported-inhibitor.c ../cinnamon-session/org.gnome.SessionManager.Inhibitor.xml [12/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Inhibitor. --c-namespace Csm --annotate org.gnome.SessionManager.Inhibitor org.gtk.GDBus.C.Name ExportedInhibitor --header --output cinnamon-session/csm-exported-inhibitor.h ../cinnamon-session/org.gnome.SessionManager.Inhibitor.xml [13/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Presence. --c-namespace Csm --annotate org.gnome.SessionManager.Presence org.gtk.GDBus.C.Name ExportedPresence --body --output cinnamon-session/csm-exported-presence.c ../cinnamon-session/org.gnome.SessionManager.Presence.xml [14/57] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Presence. --c-namespace Csm --annotate org.gnome.SessionManager.Presence org.gtk.GDBus.C.Name ExportedPresence --header --output cinnamon-session/csm-exported-presence.h ../cinnamon-session/org.gnome.SessionManager.Presence.xml [15/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o -c cinnamon-session/csm-marshal.c [16/57] clang -Icinnamon-session/test-inhibit.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -DWITH_GZFILEOP -MD -MQ cinnamon-session/test-inhibit.p/test-inhibit.c.o -MF cinnamon-session/test-inhibit.p/test-inhibit.c.o.d -o cinnamon-session/test-inhibit.p/test-inhibit.c.o -c ../cinnamon-session/test-inhibit.c [17/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o -c cinnamon-session/csm-exported-manager.c [18/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o -c cinnamon-session/csm-exported-client.c [19/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o -c cinnamon-session/csm-exported-client-private.c [20/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o -c cinnamon-session/csm-exported-app.c [21/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o -c cinnamon-session/csm-exported-inhibitor.c [22/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o -c cinnamon-session/csm-exported-presence.c [23/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-app.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-app.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-app.c.o -c ../cinnamon-session/csm-app.c ../cinnamon-session/csm-app.c:208:21: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 208 | app->priv = CSM_APP_GET_PRIVATE (app); | ^ ../cinnamon-session/csm-app.c:32:33: note: expanded from macro 'CSM_APP_GET_PRIVATE' 32 | #define CSM_APP_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_APP, CsmAppPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :90:6: note: expanded from here 90 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [24/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o -c ../cinnamon-session/csm-autostart-app.c ../cinnamon-session/csm-autostart-app.c:100:21: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 100 | app->priv = CSM_AUTOSTART_APP_GET_PRIVATE (app); | ^ ../cinnamon-session/csm-autostart-app.c:90:48: note: expanded from macro 'CSM_AUTOSTART_APP_GET_PRIVATE' 90 | #define CSM_AUTOSTART_APP_GET_PRIVATE(object) (G_TYPE_INSTANCE_GET_PRIVATE ((object), CSM_TYPE_AUTOSTART_APP, CsmAutostartAppPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :60:6: note: expanded from here 60 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [25/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-client.c.o -c ../cinnamon-session/csm-client.c ../cinnamon-session/csm-client.c:244:24: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 244 | client->priv = CSM_CLIENT_GET_PRIVATE (client); | ^ ../cinnamon-session/csm-client.c:30:36: note: expanded from macro 'CSM_CLIENT_GET_PRIVATE' 30 | #define CSM_CLIENT_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_CLIENT, CsmClientPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :90:6: note: expanded from here 90 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [26/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o -c ../cinnamon-session/csm-dbus-client.c ../cinnamon-session/csm-dbus-client.c:135:24: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 135 | client->priv = CSM_DBUS_CLIENT_GET_PRIVATE (client); | ^ ../cinnamon-session/csm-dbus-client.c:36:41: note: expanded from macro 'CSM_DBUS_CLIENT_GET_PRIVATE' 36 | #define CSM_DBUS_CLIENT_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_DBUS_CLIENT, CsmDBusClientPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :6:6: note: expanded from here 6 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [27/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o -c ../cinnamon-session/csm-consolekit.c ../cinnamon-session/csm-consolekit.c:225:25: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 225 | manager->priv = G_TYPE_INSTANCE_GET_PRIVATE (manager, | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :37:6: note: expanded from here 37 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ ../cinnamon-session/csm-consolekit.c:223:19: warning: unused variable 'res' [-Wunused-variable] 223 | GVariant *res; | ^~~ 2 warnings generated. [28/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o -c ../cinnamon-session/csm-inhibitor.c ../cinnamon-session/csm-inhibitor.c:244:27: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 244 | inhibitor->priv = CSM_INHIBITOR_GET_PRIVATE (inhibitor); | ^ ../cinnamon-session/csm-inhibitor.c:36:39: note: expanded from macro 'CSM_INHIBITOR_GET_PRIVATE' 36 | #define CSM_INHIBITOR_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_INHIBITOR, CsmInhibitorPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :93:6: note: expanded from here 93 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [29/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o -c ../cinnamon-session/csm-presence.c ../cinnamon-session/csm-presence.c:426:26: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 426 | presence->priv = CSM_PRESENCE_GET_PRIVATE (presence); | ^ ../cinnamon-session/csm-presence.c:48:38: note: expanded from macro 'CSM_PRESENCE_GET_PRIVATE' 48 | #define CSM_PRESENCE_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_PRESENCE, CsmPresencePrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :2:6: note: expanded from here 2 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [30/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o -c ../cinnamon-session/csm-process-helper.c [31/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o -c ../cinnamon-session/csm-manager.c ../cinnamon-session/csm-manager.c:270:18: warning: variable 'allow_logout' set but not used [-Wunused-but-set-variable] 270 | gboolean allow_logout; | ^ ../cinnamon-session/csm-manager.c:1108:9: warning: ignoring return value of function declared with 'warn_unused_result' attribute [-Wunused-result] 1108 | fscanf(fp, "%d", &num_processes); | ^~~~~~ ~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-manager.c:2655:42: warning: implicit truncation from 'int' to a one-bit wide bit-field changes value from 1 to -1 [-Wsingle-bit-bitfield-constant-conversion] 2655 | manager->priv->dbus_disconnected = TRUE; | ^ ~~~~ ../cinnamon-session/csm-manager.c:3731:25: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 3731 | manager->priv = CSM_MANAGER_GET_PRIVATE (manager); | ^ ../cinnamon-session/csm-manager.c:60:37: note: expanded from macro 'CSM_MANAGER_GET_PRIVATE' 60 | #define CSM_MANAGER_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_MANAGER, CsmManagerPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :78:6: note: expanded from here 78 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 4 warnings generated. [32/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o -c ../cinnamon-session/csm-session-save.c [33/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o -c ../cinnamon-session/csm-session-fill.c ../cinnamon-session/csm-session-fill.c:186:18: warning: variable 'is_login' set but not used [-Wunused-but-set-variable] 186 | gboolean is_login; | ^ 1 warning generated. [34/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-store.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-store.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-store.c.o -c ../cinnamon-session/csm-store.c ../cinnamon-session/csm-store.c:379:23: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 379 | store->priv = CSM_STORE_GET_PRIVATE (store); | ^ ../cinnamon-session/csm-store.c:35:35: note: expanded from macro 'CSM_STORE_GET_PRIVATE' 35 | #define CSM_STORE_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_STORE, CsmStorePrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :81:6: note: expanded from here 81 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [35/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-system.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-system.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-system.c.o -c ../cinnamon-session/csm-system.c [36/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o -c ../cinnamon-session/csm-systemd.c ../cinnamon-session/csm-systemd.c:118:25: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 118 | manager->priv = G_TYPE_INSTANCE_GET_PRIVATE (manager, | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :35:6: note: expanded from here 35 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [37/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-util.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-util.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-util.c.o -c ../cinnamon-session/csm-util.c [38/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o -c ../cinnamon-session/csm-xsmp-server.c ../cinnamon-session/csm-xsmp-server.c:713:29: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 713 | xsmp_server->priv = CSM_XSMP_SERVER_GET_PRIVATE (xsmp_server); | ^ ../cinnamon-session/csm-xsmp-server.c:65:41: note: expanded from macro 'CSM_XSMP_SERVER_GET_PRIVATE' 65 | #define CSM_XSMP_SERVER_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_XSMP_SERVER, CsmXsmpServerPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :48:6: note: expanded from here 48 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [39/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o -c ../cinnamon-session/csm-xsmp-client.c ../cinnamon-session/csm-xsmp-client.c:200:24: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 200 | client->priv = CSM_XSMP_CLIENT_GET_PRIVATE (client); | ^ ../cinnamon-session/csm-xsmp-client.c:43:41: note: expanded from macro 'CSM_XSMP_CLIENT_GET_PRIVATE' 43 | #define CSM_XSMP_CLIENT_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_XSMP_CLIENT, CsmXSMPClientPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :49:6: note: expanded from here 49 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 1 warning generated. [40/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o -MF cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o.d -o cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o -c ../cinnamon-session/inhibit-dialog-info.c [41/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/main.c.o -MF cinnamon-session/cinnamon-session-binary.p/main.c.o.d -o cinnamon-session/cinnamon-session-binary.p/main.c.o -c ../cinnamon-session/main.c [42/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o -MF cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o.d -o cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o -c ../cinnamon-session/mdm-log.c [43/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o -MF cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o.d -o cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o -c ../cinnamon-session/mdm-signal-handler.c ../cinnamon-session/mdm-signal-handler.c:235:20: warning: variable 'ignore' set but not used [-Wunused-but-set-variable] 235 | int ignore; | ^ ../cinnamon-session/mdm-signal-handler.c:480:25: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" [-W#pragma-messages] 480 | handler->priv = MDM_SIGNAL_HANDLER_GET_PRIVATE (handler); | ^ ../cinnamon-session/mdm-signal-handler.c:44:44: note: expanded from macro 'MDM_SIGNAL_HANDLER_GET_PRIVATE' 44 | #define MDM_SIGNAL_HANDLER_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), MDM_TYPE_SIGNAL_HANDLER, MdmSignalHandlerPrivate)) | ^ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: expanded from macro 'G_TYPE_INSTANCE_GET_PRIVATE' 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: expanded from macro 'GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR' 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^ /usr/include/glib-2.0/glib/gmacros.h:1304:3: note: expanded from macro 'GLIB_DEPRECATED_MACRO_FOR' 1304 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^ /usr/include/glib-2.0/glib/gmacros.h:1301:33: note: expanded from macro '_GLIB_GNUC_DO_PRAGMA' 1301 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^ :35:6: note: expanded from here 35 | GCC warning "Deprecated pre-processor symbol: replace with \"G_ADD_PRIVATE\"" | ^ 2 warnings generated. [44/57] clang -Icinnamon-session/test-client-dbus.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-client-dbus.p/test-client-dbus.c.o -MF cinnamon-session/test-client-dbus.p/test-client-dbus.c.o.d -o cinnamon-session/test-client-dbus.p/test-client-dbus.c.o -c ../cinnamon-session/test-client-dbus.c [45/57] clang -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/mdm.c.o -MF cinnamon-session/cinnamon-session-binary.p/mdm.c.o.d -o cinnamon-session/cinnamon-session-binary.p/mdm.c.o -c ../cinnamon-session/mdm.c [46/57] clang -Icinnamon-session/test-process-helper.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-process-helper.p/test-process-helper.c.o -MF cinnamon-session/test-process-helper.p/test-process-helper.c.o.d -o cinnamon-session/test-process-helper.p/test-process-helper.c.o -c ../cinnamon-session/test-process-helper.c [47/57] clang -Icinnamon-session/test-process-helper.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-process-helper.p/csm-process-helper.c.o -MF cinnamon-session/test-process-helper.p/csm-process-helper.c.o.d -o cinnamon-session/test-process-helper.p/csm-process-helper.c.o -c ../cinnamon-session/csm-process-helper.c [48/57] clang -Icinnamon-session/test-session-proxy-monitor.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o -MF cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o.d -o cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o -c ../cinnamon-session/test-session-proxy-monitor.c ../cinnamon-session/test-session-proxy-monitor.c:38:25: warning: unused variable 'client_id' [-Wunused-variable] 38 | static char *client_id = NULL; | ^~~~~~~~~ ../cinnamon-session/test-session-proxy-monitor.c:39:25: warning: unused variable 'client_proxy' [-Wunused-variable] 39 | static GDBusProxy *client_proxy = NULL; | ^~~~~~~~~~~~ 2 warnings generated. [49/57] clang -Itools/cinnamon-session-check-accelerated-helper.p -Itools -I../tools -I. -I.. -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -MD -MQ tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o -MF tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o.d -o tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o -c ../tools/cinnamon-session-check-accelerated-helper.c [50/57] clang -Itools/cinnamon-session-check-accelerated.p -Itools -I../tools -I. -I.. -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/include/dbus-1.0 -I/usr/lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o -MF tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o.d -o tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o -c ../tools/cinnamon-session-check-accelerated.c ../tools/cinnamon-session-check-accelerated.c:49:1: warning: unused function 'exit_1_message' [-Wunused-function] 49 | exit_1_message (const char *msg) | ^~~~~~~~~~~~~~ 1 warning generated. [51/57] clang -o cinnamon-session/test-inhibit cinnamon-session/test-inhibit.p/test-inhibit.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so /usr/lib64/libgtk-3.so /usr/lib64/libgdk-3.so /usr/lib64/libz.so /usr/lib64/libpangocairo-1.0.so /usr/lib64/libpango-1.0.so /usr/lib64/libharfbuzz.so /usr/lib64/libatk-1.0.so /usr/lib64/libcairo-gobject.so /usr/lib64/libcairo.so /usr/lib64/libgdk_pixbuf-2.0.so -Wl,--end-group [52/57] clang -o cinnamon-session/test-client-dbus cinnamon-session/test-client-dbus.p/test-client-dbus.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so -Wl,--end-group [53/57] clang -o cinnamon-session/test-process-helper cinnamon-session/test-process-helper.p/test-process-helper.c.o cinnamon-session/test-process-helper.p/csm-process-helper.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so -Wl,--end-group [54/57] clang -o cinnamon-session/test-session-proxy-monitor cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so -Wl,--end-group [55/57] clang -o tools/cinnamon-session-check-accelerated tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgtk-3.so /usr/lib64/libgdk-3.so /usr/lib64/libz.so /usr/lib64/libpangocairo-1.0.so /usr/lib64/libpango-1.0.so /usr/lib64/libharfbuzz.so /usr/lib64/libatk-1.0.so /usr/lib64/libcairo-gobject.so /usr/lib64/libcairo.so /usr/lib64/libgdk_pixbuf-2.0.so /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so /usr/lib64/libX11.so -Wl,--end-group [56/57] clang -o tools/cinnamon-session-check-accelerated-helper tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libGL.so /usr/lib64/libX11.so /usr/lib64/libXcomposite.so -Wl,--end-group [57/57] clang -o cinnamon-session/cinnamon-session-binary cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o cinnamon-session/cinnamon-session-binary.p/csm-app.c.o cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o cinnamon-session/cinnamon-session-binary.p/csm-client.c.o cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o cinnamon-session/cinnamon-session-binary.p/csm-store.c.o cinnamon-session/cinnamon-session-binary.p/csm-system.c.o cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o cinnamon-session/cinnamon-session-binary.p/csm-util.c.o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o cinnamon-session/cinnamon-session-binary.p/main.c.o cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o cinnamon-session/cinnamon-session-binary.p/mdm.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 -O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libcinnamon-desktop.so /usr/lib64/libgtk-3.so /usr/lib64/libgdk-3.so /usr/lib64/libz.so /usr/lib64/libpangocairo-1.0.so /usr/lib64/libpango-1.0.so /usr/lib64/libharfbuzz.so /usr/lib64/libatk-1.0.so /usr/lib64/libcairo-gobject.so /usr/lib64/libcairo.so /usr/lib64/libgdk_pixbuf-2.0.so /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so /usr/lib64/libICE.so /usr/lib64/libcanberra.so /usr/lib64/libsystemd.so /usr/lib64/libSM.so /usr/lib64/libX11.so /usr/lib64/libxapp.so /usr/lib64/libXau.so /usr/lib64/libXext.so /usr/lib64/libXrender.so /usr/lib64/libXtst.so -Wl,--end-group INFO: autodetecting backend as ninja INFO: calculating backend command to run: /usr/bin/ninja -C /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/redhat-linux-build -j 2 -v + RPM_EC=0 ++ jobs -p + exit 0 Executing(%install): /bin/sh -e /var/tmp/rpm-tmp.eCEsgE + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + '[' /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT '!=' / ']' + rm -rf /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT ++ dirname /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT + mkdir -p /builddir/build/BUILD/cinnamon-session-6.2.1-build + mkdir /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT + CFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CFLAGS + CXXFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CXXFLAGS + FFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FFLAGS + FCFLAGS='-O2 -flto=thin -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS --config=/usr/lib/rpm/redhat/redhat-hardened-clang.cfg -fstack-protector-strong -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FCFLAGS + VALAFLAGS=-g + export VALAFLAGS + RUSTFLAGS='-Copt-level=3 -Cdebuginfo=2 -Ccodegen-units=1 -Cstrip=none --cap-lints=warn' + export RUSTFLAGS + LDFLAGS='-Wl,-z,relro -Wl,--as-needed -Wl,-z,now --config=/usr/lib/rpm/redhat/redhat-hardened-clang-ld.cfg -flto=thin -ffat-lto-objects -Wl,--build-id=sha1 ' + export LDFLAGS + LT_SYS_LIBRARY_PATH=/usr/lib64: + export LT_SYS_LIBRARY_PATH + CC=clang + export CC + CXX=clang++ + export CXX + cd cinnamon-session-6.2.1 + DESTDIR=/builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT + /usr/bin/meson install -C redhat-linux-build --no-rebuild Installing cinnamon-session/cinnamon-session-binary to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/libexec Installing tools/cinnamon-session-check-accelerated to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/libexec Installing tools/cinnamon-session-check-accelerated-helper to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/libexec Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/doc/man/cinnamon-session.1 to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/man/man1 Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/doc/man/cinnamon-session-quit.1 to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/man/man1 Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/redhat-linux-build/cinnamon-session/cinnamon-session to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/bin Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/icons/16x16/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/icons/hicolor/16x16/apps Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/icons/22x22/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/icons/hicolor/22x22/apps Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/icons/24x24/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/icons/hicolor/24x24/apps Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/icons/32x32/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/icons/hicolor/32x32/apps Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/icons/48x48/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/icons/hicolor/48x48/apps Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/icons/scalable/cinnamon-session-properties.svg to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/icons/hicolor/scalable/apps Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/hardware-compatibility to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/org.cinnamon.SessionManager.gschema.xml to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/glib-2.0/schemas Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/redhat-linux-build/cinnamon-session-quit/config.py to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/cinnamon-session-quit/cinnamon-session-quit.py to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/cinnamon-session-quit/cinnamon-session-quit.glade to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/redhat-linux-build/cinnamon-session-quit/cinnamon-session-quit to /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/bin Running custom install script '/usr/bin/python3 /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/data/meson_install_schemas.py' + /usr/bin/find-debuginfo -j2 --strict-build-id -m -i --build-id-seed 6.2.1-1.fc41 --unique-debug-suffix -6.2.1-1.fc41.s390x --unique-debug-src-base cinnamon-session-6.2.1-1.fc41.s390x --run-dwz --dwz-low-mem-die-limit 10000000 --dwz-max-die-limit 50000000 -S debugsourcefiles.list /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1 find-debuginfo: starting Extracting debug info from 3 files DWARF-compressing 3 files dwz: ./usr/libexec/cinnamon-session-binary-6.2.1-1.fc41.s390x.debug: Unknown debugging section .debug_addr dwz: ./usr/libexec/cinnamon-session-check-accelerated-6.2.1-1.fc41.s390x.debug: Unknown debugging section .debug_addr dwz: ./usr/libexec/cinnamon-session-check-accelerated-helper-6.2.1-1.fc41.s390x.debug: Unknown debugging section .debug_addr dwz: Too few files for multifile optimization sepdebugcrcfix: Updated 0 CRC32s, 3 CRC32s did match. Creating .debug symlinks for symlinks to ELF files Copying sources found by 'debugedit -l' to /usr/src/debug/cinnamon-session-6.2.1-1.fc41.s390x find-debuginfo: done + /usr/lib/rpm/check-buildroot + /usr/lib/rpm/redhat/brp-ldconfig + /usr/lib/rpm/brp-compress + /usr/lib/rpm/redhat/brp-strip-lto /usr/bin/strip + /usr/lib/rpm/brp-strip-static-archive /usr/bin/strip + /usr/lib/rpm/check-rpaths + /usr/lib/rpm/redhat/brp-mangle-shebangs mangling shebang in /usr/bin/cinnamon-session from /bin/sh to #!/usr/bin/sh mangling shebang in /usr/bin/cinnamon-session-quit from /bin/sh to #!/usr/bin/sh + /usr/lib/rpm/brp-remove-la-files + env /usr/lib/rpm/redhat/brp-python-bytecompile '' 1 0 -j2 + /usr/lib/rpm/redhat/brp-python-hardlink + /usr/bin/add-determinism --brp -j2 /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT Scanned 35 directories and 77 files, processed 0 inodes, 0 modified (0 replaced + 0 rewritten), 0 unsupported format, 0 errors Reading /builddir/build/BUILD/cinnamon-session-6.2.1-build/SPECPARTS/rpm-debuginfo.specpart Processing files: cinnamon-session-6.2.1-1.fc41.s390x Executing(%doc): /bin/sh -e /var/tmp/rpm-tmp.QglvQp + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + cd cinnamon-session-6.2.1 + DOCDIR=/builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/doc/cinnamon-session + export LC_ALL=C.UTF-8 + LC_ALL=C.UTF-8 + export DOCDIR + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/doc/cinnamon-session + cp -pr /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/AUTHORS /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/doc/cinnamon-session + cp -pr /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/README /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/doc/cinnamon-session + RPM_EC=0 ++ jobs -p + exit 0 Executing(%license): /bin/sh -e /var/tmp/rpm-tmp.p8jrQ3 + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + cd cinnamon-session-6.2.1 + LICENSEDIR=/builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/licenses/cinnamon-session + export LC_ALL=C.UTF-8 + LC_ALL=C.UTF-8 + export LICENSEDIR + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/licenses/cinnamon-session + cp -pr /builddir/build/BUILD/cinnamon-session-6.2.1-build/cinnamon-session-6.2.1/COPYING /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT/usr/share/licenses/cinnamon-session + RPM_EC=0 ++ jobs -p + exit 0 Provides: cinnamon-session = 6.2.1-1.fc41 cinnamon-session(s390-64) = 6.2.1-1.fc41 Requires(rpmlib): rpmlib(CompressedFileNames) <= 3.0.4-1 rpmlib(FileDigests) <= 4.6.0-1 rpmlib(PayloadFilesHavePrefix) <= 4.0-1 Requires: /usr/bin/python3 /usr/bin/sh libGL.so.1()(64bit) libICE.so.6()(64bit) libSM.so.6()(64bit) libX11.so.6()(64bit) libXau.so.6()(64bit) libXcomposite.so.1()(64bit) libc.so.6()(64bit) libc.so.6(GLIBC_2.17)(64bit) libc.so.6(GLIBC_2.2)(64bit) libc.so.6(GLIBC_2.28)(64bit) libc.so.6(GLIBC_2.3)(64bit) libc.so.6(GLIBC_2.3.4)(64bit) libc.so.6(GLIBC_2.34)(64bit) libc.so.6(GLIBC_2.4)(64bit) libc.so.6(GLIBC_2.7)(64bit) libcanberra.so.0()(64bit) libcinnamon-desktop.so.4()(64bit) libgcc_s.so.1()(64bit) libgcc_s.so.1(GCC_3.0)(64bit) libgcc_s.so.1(GCC_3.3.1)(64bit) libgdk-3.so.0()(64bit) libgio-2.0.so.0()(64bit) libglib-2.0.so.0()(64bit) libgobject-2.0.so.0()(64bit) libgtk-3.so.0()(64bit) libsystemd.so.0()(64bit) libsystemd.so.0(LIBSYSTEMD_209)(64bit) rtld(GNU_HASH) Processing files: cinnamon-session-debugsource-6.2.1-1.fc41.s390x Provides: cinnamon-session-debugsource = 6.2.1-1.fc41 cinnamon-session-debugsource(s390-64) = 6.2.1-1.fc41 Requires(rpmlib): rpmlib(CompressedFileNames) <= 3.0.4-1 rpmlib(FileDigests) <= 4.6.0-1 rpmlib(PayloadFilesHavePrefix) <= 4.0-1 Processing files: cinnamon-session-debuginfo-6.2.1-1.fc41.s390x Provides: cinnamon-session-debuginfo = 6.2.1-1.fc41 cinnamon-session-debuginfo(s390-64) = 6.2.1-1.fc41 debuginfo(build-id) = 17e6e1cec0d6cd87c7a4980b2433c189cdf8f4d9 debuginfo(build-id) = 31dea8c7b639d43d58ae1df233253b701b2daa17 debuginfo(build-id) = 4501985c821894bd50479071e1f3ae438a5e21f1 Requires(rpmlib): rpmlib(CompressedFileNames) <= 3.0.4-1 rpmlib(FileDigests) <= 4.6.0-1 rpmlib(PayloadFilesHavePrefix) <= 4.0-1 Recommends: cinnamon-session-debugsource(s390-64) = 6.2.1-1.fc41 Checking for unpackaged file(s): /usr/lib/rpm/check-files /builddir/build/BUILD/cinnamon-session-6.2.1-build/BUILDROOT Wrote: /builddir/build/RPMS/cinnamon-session-debuginfo-6.2.1-1.fc41.s390x.rpm Wrote: /builddir/build/RPMS/cinnamon-session-6.2.1-1.fc41.s390x.rpm Wrote: /builddir/build/RPMS/cinnamon-session-debugsource-6.2.1-1.fc41.s390x.rpm Executing(rmbuild): /bin/sh -e /var/tmp/rpm-tmp.ak2mb6 + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.2.1-build + test -d /builddir/build/BUILD/cinnamon-session-6.2.1-build + /usr/bin/chmod -Rf a+rX,u+w,g-w,o-w /builddir/build/BUILD/cinnamon-session-6.2.1-build + rm -rf /builddir/build/BUILD/cinnamon-session-6.2.1-build + RPM_EC=0 ++ jobs -p + exit 0 Finish: rpmbuild cinnamon-session-6.2.1-1.fc41.src.rpm Finish: build phase for cinnamon-session-6.2.1-1.fc41.src.rpm INFO: chroot_scan: 1 files copied to /var/lib/copr-rpmbuild/results/chroot_scan INFO: /var/lib/mock/fedora-41-s390x-1732355311.446954/root/var/log/dnf5.log INFO: chroot_scan: creating tarball /var/lib/copr-rpmbuild/results/chroot_scan.tar.gz /bin/tar: Removing leading `/' from member names INFO: Done(/var/lib/copr-rpmbuild/results/cinnamon-session-6.2.1-1.fc41.src.rpm) Config(child) 0 minutes 32 seconds INFO: Results and/or logs in: /var/lib/copr-rpmbuild/results INFO: Cleaning up build root ('cleanup_on_success=True') Start: clean chroot INFO: unmounting tmpfs. Finish: clean chroot Finish: run Running RPMResults tool Package info: { "packages": [ { "name": "cinnamon-session-debuginfo", "epoch": null, "version": "6.2.1", "release": "1.fc41", "arch": "s390x" }, { "name": "cinnamon-session-debugsource", "epoch": null, "version": "6.2.1", "release": "1.fc41", "arch": "s390x" }, { "name": "cinnamon-session", "epoch": null, "version": "6.2.1", "release": "1.fc41", "arch": "s390x" }, { "name": "cinnamon-session", "epoch": null, "version": "6.2.1", "release": "1.fc41", "arch": "src" } ] } RPMResults finished